diff --git a/dist/136.index.js b/dist/136.index.js new file mode 100644 index 00000000..80578879 --- /dev/null +++ b/dist/136.index.js @@ -0,0 +1,1235 @@ +"use strict"; +exports.id = 136; +exports.ids = [136]; +exports.modules = { + +/***/ 3723: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.STSClient = exports.__Client = void 0; +const middleware_host_header_1 = __webpack_require__(2590); +const middleware_logger_1 = __webpack_require__(5242); +const middleware_recursion_detection_1 = __webpack_require__(1568); +const middleware_user_agent_1 = __webpack_require__(2959); +const config_resolver_1 = __webpack_require__(9316); +const core_1 = __webpack_require__(402); +const middleware_content_length_1 = __webpack_require__(7212); +const middleware_endpoint_1 = __webpack_require__(99); +const middleware_retry_1 = __webpack_require__(9618); +const smithy_client_1 = __webpack_require__(1411); +Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } })); +const httpAuthSchemeProvider_1 = __webpack_require__(7851); +const EndpointParameters_1 = __webpack_require__(6811); +const runtimeConfig_1 = __webpack_require__(6578); +const runtimeExtensions_1 = __webpack_require__(7742); +class STSClient extends smithy_client_1.Client { + config; + constructor(...[configuration]) { + const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration || {}); + super(_config_0); + this.initConfig = _config_0; + const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); + const _config_2 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_1); + const _config_3 = (0, middleware_retry_1.resolveRetryConfig)(_config_2); + const _config_4 = (0, config_resolver_1.resolveRegionConfig)(_config_3); + const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_5); + const _config_7 = (0, httpAuthSchemeProvider_1.resolveHttpAuthSchemeConfig)(_config_6); + const _config_8 = (0, runtimeExtensions_1.resolveRuntimeExtensions)(_config_7, configuration?.extensions || []); + this.config = _config_8; + this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); + this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use((0, core_1.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { + httpAuthSchemeParametersProvider: httpAuthSchemeProvider_1.defaultSTSHttpAuthSchemeParametersProvider, + identityProviderConfigProvider: async (config) => new core_1.DefaultIdentityProviderConfig({ + "aws.auth#sigv4": config.credentials, + }), + })); + this.middlewareStack.use((0, core_1.getHttpSigningPlugin)(this.config)); + } + destroy() { + super.destroy(); + } +} +exports.STSClient = STSClient; + + +/***/ }), + +/***/ 4532: +/***/ ((__unused_webpack_module, exports) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpAuthRuntimeConfig = exports.getHttpAuthExtensionConfiguration = void 0; +const getHttpAuthExtensionConfiguration = (runtimeConfig) => { + const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; + let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; + let _credentials = runtimeConfig.credentials; + return { + setHttpAuthScheme(httpAuthScheme) { + const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); + if (index === -1) { + _httpAuthSchemes.push(httpAuthScheme); + } + else { + _httpAuthSchemes.splice(index, 1, httpAuthScheme); + } + }, + httpAuthSchemes() { + return _httpAuthSchemes; + }, + setHttpAuthSchemeProvider(httpAuthSchemeProvider) { + _httpAuthSchemeProvider = httpAuthSchemeProvider; + }, + httpAuthSchemeProvider() { + return _httpAuthSchemeProvider; + }, + setCredentials(credentials) { + _credentials = credentials; + }, + credentials() { + return _credentials; + }, + }; +}; +exports.getHttpAuthExtensionConfiguration = getHttpAuthExtensionConfiguration; +const resolveHttpAuthRuntimeConfig = (config) => { + return { + httpAuthSchemes: config.httpAuthSchemes(), + httpAuthSchemeProvider: config.httpAuthSchemeProvider(), + credentials: config.credentials(), + }; +}; +exports.resolveHttpAuthRuntimeConfig = resolveHttpAuthRuntimeConfig; + + +/***/ }), + +/***/ 7851: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpAuthSchemeConfig = exports.resolveStsAuthConfig = exports.defaultSTSHttpAuthSchemeProvider = exports.defaultSTSHttpAuthSchemeParametersProvider = void 0; +const core_1 = __webpack_require__(8704); +const util_middleware_1 = __webpack_require__(6324); +const STSClient_1 = __webpack_require__(3723); +const defaultSTSHttpAuthSchemeParametersProvider = async (config, context, input) => { + return { + operation: (0, util_middleware_1.getSmithyContext)(context).operation, + region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) || + (() => { + throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); + })(), + }; +}; +exports.defaultSTSHttpAuthSchemeParametersProvider = defaultSTSHttpAuthSchemeParametersProvider; +function createAwsAuthSigv4HttpAuthOption(authParameters) { + return { + schemeId: "aws.auth#sigv4", + signingProperties: { + name: "sts", + region: authParameters.region, + }, + propertiesExtractor: (config, context) => ({ + signingProperties: { + config, + context, + }, + }), + }; +} +function createSmithyApiNoAuthHttpAuthOption(authParameters) { + return { + schemeId: "smithy.api#noAuth", + }; +} +const defaultSTSHttpAuthSchemeProvider = (authParameters) => { + const options = []; + switch (authParameters.operation) { + case "AssumeRoleWithWebIdentity": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + default: { + options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + } + } + return options; +}; +exports.defaultSTSHttpAuthSchemeProvider = defaultSTSHttpAuthSchemeProvider; +const resolveStsAuthConfig = (input) => Object.assign(input, { + stsClientCtor: STSClient_1.STSClient, +}); +exports.resolveStsAuthConfig = resolveStsAuthConfig; +const resolveHttpAuthSchemeConfig = (config) => { + const config_0 = (0, exports.resolveStsAuthConfig)(config); + const config_1 = (0, core_1.resolveAwsSdkSigV4Config)(config_0); + return Object.assign(config_1, { + authSchemePreference: (0, util_middleware_1.normalizeProvider)(config.authSchemePreference ?? []), + }); +}; +exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; + + +/***/ }), + +/***/ 6811: +/***/ ((__unused_webpack_module, exports) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.commonParams = exports.resolveClientEndpointParameters = void 0; +const resolveClientEndpointParameters = (options) => { + return Object.assign(options, { + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + useGlobalEndpoint: options.useGlobalEndpoint ?? false, + defaultSigningName: "sts", + }); +}; +exports.resolveClientEndpointParameters = resolveClientEndpointParameters; +exports.commonParams = { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, +}; + + +/***/ }), + +/***/ 9765: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultEndpointResolver = void 0; +const util_endpoints_1 = __webpack_require__(3068); +const util_endpoints_2 = __webpack_require__(9674); +const ruleset_1 = __webpack_require__(1670); +const cache = new util_endpoints_2.EndpointCache({ + size: 50, + params: ["Endpoint", "Region", "UseDualStack", "UseFIPS", "UseGlobalEndpoint"], +}); +const defaultEndpointResolver = (endpointParams, context = {}) => { + return cache.get(endpointParams, () => (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams: endpointParams, + logger: context.logger, + })); +}; +exports.defaultEndpointResolver = defaultEndpointResolver; +util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; + + +/***/ }), + +/***/ 1670: +/***/ ((__unused_webpack_module, exports) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ruleSet = void 0; +const F = "required", G = "type", H = "fn", I = "argv", J = "ref"; +const a = false, b = true, c = "booleanEquals", d = "stringEquals", e = "sigv4", f = "sts", g = "us-east-1", h = "endpoint", i = "https://sts.{Region}.{PartitionResult#dnsSuffix}", j = "tree", k = "error", l = "getAttr", m = { [F]: false, [G]: "string" }, n = { [F]: true, "default": false, [G]: "boolean" }, o = { [J]: "Endpoint" }, p = { [H]: "isSet", [I]: [{ [J]: "Region" }] }, q = { [J]: "Region" }, r = { [H]: "aws.partition", [I]: [q], "assign": "PartitionResult" }, s = { [J]: "UseFIPS" }, t = { [J]: "UseDualStack" }, u = { "url": "https://sts.amazonaws.com", "properties": { "authSchemes": [{ "name": e, "signingName": f, "signingRegion": g }] }, "headers": {} }, v = {}, w = { "conditions": [{ [H]: d, [I]: [q, "aws-global"] }], [h]: u, [G]: h }, x = { [H]: c, [I]: [s, true] }, y = { [H]: c, [I]: [t, true] }, z = { [H]: l, [I]: [{ [J]: "PartitionResult" }, "supportsFIPS"] }, A = { [J]: "PartitionResult" }, B = { [H]: c, [I]: [true, { [H]: l, [I]: [A, "supportsDualStack"] }] }, C = [{ [H]: "isSet", [I]: [o] }], D = [x], E = [y]; +const _data = { version: "1.0", parameters: { Region: m, UseDualStack: n, UseFIPS: n, Endpoint: m, UseGlobalEndpoint: n }, rules: [{ conditions: [{ [H]: c, [I]: [{ [J]: "UseGlobalEndpoint" }, b] }, { [H]: "not", [I]: C }, p, r, { [H]: c, [I]: [s, a] }, { [H]: c, [I]: [t, a] }], rules: [{ conditions: [{ [H]: d, [I]: [q, "ap-northeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-south-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-2"] }], endpoint: u, [G]: h }, w, { conditions: [{ [H]: d, [I]: [q, "ca-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-north-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-3"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "sa-east-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, g] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-east-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-2"] }], endpoint: u, [G]: h }, { endpoint: { url: i, properties: { authSchemes: [{ name: e, signingName: f, signingRegion: "{Region}" }] }, headers: v }, [G]: h }], [G]: j }, { conditions: C, rules: [{ conditions: D, error: "Invalid Configuration: FIPS and custom endpoint are not supported", [G]: k }, { conditions: E, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", [G]: k }, { endpoint: { url: o, properties: v, headers: v }, [G]: h }], [G]: j }, { conditions: [p], rules: [{ conditions: [r], rules: [{ conditions: [x, y], rules: [{ conditions: [{ [H]: c, [I]: [b, z] }, B], rules: [{ endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", [G]: k }], [G]: j }, { conditions: D, rules: [{ conditions: [{ [H]: c, [I]: [z, b] }], rules: [{ conditions: [{ [H]: d, [I]: [{ [H]: l, [I]: [A, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://sts.{Region}.amazonaws.com", properties: v, headers: v }, [G]: h }, { endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS is enabled but this partition does not support FIPS", [G]: k }], [G]: j }, { conditions: E, rules: [{ conditions: [B], rules: [{ endpoint: { url: "https://sts.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "DualStack is enabled but this partition does not support DualStack", [G]: k }], [G]: j }, w, { endpoint: { url: i, properties: v, headers: v }, [G]: h }], [G]: j }], [G]: j }, { error: "Invalid Configuration: Missing Region", [G]: k }] }; +exports.ruleSet = _data; + + +/***/ }), + +/***/ 1136: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + + +var STSClient = __webpack_require__(3723); +var smithyClient = __webpack_require__(1411); +var middlewareEndpoint = __webpack_require__(99); +var middlewareSerde = __webpack_require__(3255); +var EndpointParameters = __webpack_require__(6811); +var core = __webpack_require__(8704); +var protocolHttp = __webpack_require__(2356); +var client = __webpack_require__(5152); +var regionConfigResolver = __webpack_require__(6463); + +class STSServiceException extends smithyClient.ServiceException { + constructor(options) { + super(options); + Object.setPrototypeOf(this, STSServiceException.prototype); + } +} + +const CredentialsFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.SecretAccessKey && { SecretAccessKey: smithyClient.SENSITIVE_STRING }), +}); +const AssumeRoleResponseFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) }), +}); +class ExpiredTokenException extends STSServiceException { + name = "ExpiredTokenException"; + $fault = "client"; + constructor(opts) { + super({ + name: "ExpiredTokenException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ExpiredTokenException.prototype); + } +} +class MalformedPolicyDocumentException extends STSServiceException { + name = "MalformedPolicyDocumentException"; + $fault = "client"; + constructor(opts) { + super({ + name: "MalformedPolicyDocumentException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, MalformedPolicyDocumentException.prototype); + } +} +class PackedPolicyTooLargeException extends STSServiceException { + name = "PackedPolicyTooLargeException"; + $fault = "client"; + constructor(opts) { + super({ + name: "PackedPolicyTooLargeException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, PackedPolicyTooLargeException.prototype); + } +} +class RegionDisabledException extends STSServiceException { + name = "RegionDisabledException"; + $fault = "client"; + constructor(opts) { + super({ + name: "RegionDisabledException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, RegionDisabledException.prototype); + } +} +class IDPRejectedClaimException extends STSServiceException { + name = "IDPRejectedClaimException"; + $fault = "client"; + constructor(opts) { + super({ + name: "IDPRejectedClaimException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, IDPRejectedClaimException.prototype); + } +} +class InvalidIdentityTokenException extends STSServiceException { + name = "InvalidIdentityTokenException"; + $fault = "client"; + constructor(opts) { + super({ + name: "InvalidIdentityTokenException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, InvalidIdentityTokenException.prototype); + } +} +const AssumeRoleWithWebIdentityRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.WebIdentityToken && { WebIdentityToken: smithyClient.SENSITIVE_STRING }), +}); +const AssumeRoleWithWebIdentityResponseFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) }), +}); +class IDPCommunicationErrorException extends STSServiceException { + name = "IDPCommunicationErrorException"; + $fault = "client"; + constructor(opts) { + super({ + name: "IDPCommunicationErrorException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, IDPCommunicationErrorException.prototype); + } +} + +const se_AssumeRoleCommand = async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_AssumeRoleRequest(input), + [_A]: _AR, + [_V]: _, + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_AssumeRoleWithWebIdentityCommand = async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_AssumeRoleWithWebIdentityRequest(input), + [_A]: _ARWWI, + [_V]: _, + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const de_AssumeRoleCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core.parseXmlBody(output.body, context); + let contents = {}; + contents = de_AssumeRoleResponse(data.AssumeRoleResult); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +const de_AssumeRoleWithWebIdentityCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core.parseXmlBody(output.body, context); + let contents = {}; + contents = de_AssumeRoleWithWebIdentityResponse(data.AssumeRoleWithWebIdentityResult); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +const de_CommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await core.parseXmlErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ExpiredTokenException": + case "com.amazonaws.sts#ExpiredTokenException": + throw await de_ExpiredTokenExceptionRes(parsedOutput); + case "MalformedPolicyDocument": + case "com.amazonaws.sts#MalformedPolicyDocumentException": + throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput); + case "PackedPolicyTooLarge": + case "com.amazonaws.sts#PackedPolicyTooLargeException": + throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput); + case "RegionDisabledException": + case "com.amazonaws.sts#RegionDisabledException": + throw await de_RegionDisabledExceptionRes(parsedOutput); + case "IDPCommunicationError": + case "com.amazonaws.sts#IDPCommunicationErrorException": + throw await de_IDPCommunicationErrorExceptionRes(parsedOutput); + case "IDPRejectedClaim": + case "com.amazonaws.sts#IDPRejectedClaimException": + throw await de_IDPRejectedClaimExceptionRes(parsedOutput); + case "InvalidIdentityToken": + case "com.amazonaws.sts#InvalidIdentityTokenException": + throw await de_InvalidIdentityTokenExceptionRes(parsedOutput); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody: parsedBody.Error, + errorCode, + }); + } +}; +const de_ExpiredTokenExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_ExpiredTokenException(body.Error); + const exception = new ExpiredTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_IDPCommunicationErrorExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_IDPCommunicationErrorException(body.Error); + const exception = new IDPCommunicationErrorException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_IDPRejectedClaimExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_IDPRejectedClaimException(body.Error); + const exception = new IDPRejectedClaimException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_InvalidIdentityTokenExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_InvalidIdentityTokenException(body.Error); + const exception = new InvalidIdentityTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_MalformedPolicyDocumentExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_MalformedPolicyDocumentException(body.Error); + const exception = new MalformedPolicyDocumentException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_PackedPolicyTooLargeExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_PackedPolicyTooLargeException(body.Error); + const exception = new PackedPolicyTooLargeException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_RegionDisabledExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_RegionDisabledException(body.Error); + const exception = new RegionDisabledException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const se_AssumeRoleRequest = (input, context) => { + const entries = {}; + if (input[_RA] != null) { + entries[_RA] = input[_RA]; + } + if (input[_RSN] != null) { + entries[_RSN] = input[_RSN]; + } + if (input[_PA] != null) { + const memberEntries = se_policyDescriptorListType(input[_PA]); + if (input[_PA]?.length === 0) { + entries.PolicyArns = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input[_P] != null) { + entries[_P] = input[_P]; + } + if (input[_DS] != null) { + entries[_DS] = input[_DS]; + } + if (input[_T] != null) { + const memberEntries = se_tagListType(input[_T]); + if (input[_T]?.length === 0) { + entries.Tags = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `Tags.${key}`; + entries[loc] = value; + }); + } + if (input[_TTK] != null) { + const memberEntries = se_tagKeyListType(input[_TTK]); + if (input[_TTK]?.length === 0) { + entries.TransitiveTagKeys = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `TransitiveTagKeys.${key}`; + entries[loc] = value; + }); + } + if (input[_EI] != null) { + entries[_EI] = input[_EI]; + } + if (input[_SN] != null) { + entries[_SN] = input[_SN]; + } + if (input[_TC] != null) { + entries[_TC] = input[_TC]; + } + if (input[_SI] != null) { + entries[_SI] = input[_SI]; + } + if (input[_PC] != null) { + const memberEntries = se_ProvidedContextsListType(input[_PC]); + if (input[_PC]?.length === 0) { + entries.ProvidedContexts = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `ProvidedContexts.${key}`; + entries[loc] = value; + }); + } + return entries; +}; +const se_AssumeRoleWithWebIdentityRequest = (input, context) => { + const entries = {}; + if (input[_RA] != null) { + entries[_RA] = input[_RA]; + } + if (input[_RSN] != null) { + entries[_RSN] = input[_RSN]; + } + if (input[_WIT] != null) { + entries[_WIT] = input[_WIT]; + } + if (input[_PI] != null) { + entries[_PI] = input[_PI]; + } + if (input[_PA] != null) { + const memberEntries = se_policyDescriptorListType(input[_PA]); + if (input[_PA]?.length === 0) { + entries.PolicyArns = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input[_P] != null) { + entries[_P] = input[_P]; + } + if (input[_DS] != null) { + entries[_DS] = input[_DS]; + } + return entries; +}; +const se_policyDescriptorListType = (input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + const memberEntries = se_PolicyDescriptorType(entry); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; + } + return entries; +}; +const se_PolicyDescriptorType = (input, context) => { + const entries = {}; + if (input[_a] != null) { + entries[_a] = input[_a]; + } + return entries; +}; +const se_ProvidedContext = (input, context) => { + const entries = {}; + if (input[_PAr] != null) { + entries[_PAr] = input[_PAr]; + } + if (input[_CA] != null) { + entries[_CA] = input[_CA]; + } + return entries; +}; +const se_ProvidedContextsListType = (input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + const memberEntries = se_ProvidedContext(entry); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; + } + return entries; +}; +const se_Tag = (input, context) => { + const entries = {}; + if (input[_K] != null) { + entries[_K] = input[_K]; + } + if (input[_Va] != null) { + entries[_Va] = input[_Va]; + } + return entries; +}; +const se_tagKeyListType = (input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + entries[`member.${counter}`] = entry; + counter++; + } + return entries; +}; +const se_tagListType = (input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + const memberEntries = se_Tag(entry); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; + } + return entries; +}; +const de_AssumedRoleUser = (output, context) => { + const contents = {}; + if (output[_ARI] != null) { + contents[_ARI] = smithyClient.expectString(output[_ARI]); + } + if (output[_Ar] != null) { + contents[_Ar] = smithyClient.expectString(output[_Ar]); + } + return contents; +}; +const de_AssumeRoleResponse = (output, context) => { + const contents = {}; + if (output[_C] != null) { + contents[_C] = de_Credentials(output[_C]); + } + if (output[_ARU] != null) { + contents[_ARU] = de_AssumedRoleUser(output[_ARU]); + } + if (output[_PPS] != null) { + contents[_PPS] = smithyClient.strictParseInt32(output[_PPS]); + } + if (output[_SI] != null) { + contents[_SI] = smithyClient.expectString(output[_SI]); + } + return contents; +}; +const de_AssumeRoleWithWebIdentityResponse = (output, context) => { + const contents = {}; + if (output[_C] != null) { + contents[_C] = de_Credentials(output[_C]); + } + if (output[_SFWIT] != null) { + contents[_SFWIT] = smithyClient.expectString(output[_SFWIT]); + } + if (output[_ARU] != null) { + contents[_ARU] = de_AssumedRoleUser(output[_ARU]); + } + if (output[_PPS] != null) { + contents[_PPS] = smithyClient.strictParseInt32(output[_PPS]); + } + if (output[_Pr] != null) { + contents[_Pr] = smithyClient.expectString(output[_Pr]); + } + if (output[_Au] != null) { + contents[_Au] = smithyClient.expectString(output[_Au]); + } + if (output[_SI] != null) { + contents[_SI] = smithyClient.expectString(output[_SI]); + } + return contents; +}; +const de_Credentials = (output, context) => { + const contents = {}; + if (output[_AKI] != null) { + contents[_AKI] = smithyClient.expectString(output[_AKI]); + } + if (output[_SAK] != null) { + contents[_SAK] = smithyClient.expectString(output[_SAK]); + } + if (output[_ST] != null) { + contents[_ST] = smithyClient.expectString(output[_ST]); + } + if (output[_E] != null) { + contents[_E] = smithyClient.expectNonNull(smithyClient.parseRfc3339DateTimeWithOffset(output[_E])); + } + return contents; +}; +const de_ExpiredTokenException = (output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = smithyClient.expectString(output[_m]); + } + return contents; +}; +const de_IDPCommunicationErrorException = (output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = smithyClient.expectString(output[_m]); + } + return contents; +}; +const de_IDPRejectedClaimException = (output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = smithyClient.expectString(output[_m]); + } + return contents; +}; +const de_InvalidIdentityTokenException = (output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = smithyClient.expectString(output[_m]); + } + return contents; +}; +const de_MalformedPolicyDocumentException = (output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = smithyClient.expectString(output[_m]); + } + return contents; +}; +const de_PackedPolicyTooLargeException = (output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = smithyClient.expectString(output[_m]); + } + return contents; +}; +const de_RegionDisabledException = (output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = smithyClient.expectString(output[_m]); + } + return contents; +}; +const deserializeMetadata = (output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"], +}); +const throwDefaultError = smithyClient.withBaseException(STSServiceException); +const buildHttpRpcRequest = async (context, headers, path, resolvedHostname, body) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const contents = { + protocol, + hostname, + port, + method: "POST", + path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, + headers, + }; + if (body !== undefined) { + contents.body = body; + } + return new protocolHttp.HttpRequest(contents); +}; +const SHARED_HEADERS = { + "content-type": "application/x-www-form-urlencoded", +}; +const _ = "2011-06-15"; +const _A = "Action"; +const _AKI = "AccessKeyId"; +const _AR = "AssumeRole"; +const _ARI = "AssumedRoleId"; +const _ARU = "AssumedRoleUser"; +const _ARWWI = "AssumeRoleWithWebIdentity"; +const _Ar = "Arn"; +const _Au = "Audience"; +const _C = "Credentials"; +const _CA = "ContextAssertion"; +const _DS = "DurationSeconds"; +const _E = "Expiration"; +const _EI = "ExternalId"; +const _K = "Key"; +const _P = "Policy"; +const _PA = "PolicyArns"; +const _PAr = "ProviderArn"; +const _PC = "ProvidedContexts"; +const _PI = "ProviderId"; +const _PPS = "PackedPolicySize"; +const _Pr = "Provider"; +const _RA = "RoleArn"; +const _RSN = "RoleSessionName"; +const _SAK = "SecretAccessKey"; +const _SFWIT = "SubjectFromWebIdentityToken"; +const _SI = "SourceIdentity"; +const _SN = "SerialNumber"; +const _ST = "SessionToken"; +const _T = "Tags"; +const _TC = "TokenCode"; +const _TTK = "TransitiveTagKeys"; +const _V = "Version"; +const _Va = "Value"; +const _WIT = "WebIdentityToken"; +const _a = "arn"; +const _m = "message"; +const buildFormUrlencodedString = (formEntries) => Object.entries(formEntries) + .map(([key, value]) => smithyClient.extendedEncodeURIComponent(key) + "=" + smithyClient.extendedEncodeURIComponent(value)) + .join("&"); +const loadQueryErrorCode = (output, data) => { + if (data.Error?.Code !== undefined) { + return data.Error.Code; + } + if (output.statusCode == 404) { + return "NotFound"; + } +}; + +class AssumeRoleCommand extends smithyClient.Command + .classBuilder() + .ep(EndpointParameters.commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AWSSecurityTokenServiceV20110615", "AssumeRole", {}) + .n("STSClient", "AssumeRoleCommand") + .f(void 0, AssumeRoleResponseFilterSensitiveLog) + .ser(se_AssumeRoleCommand) + .de(de_AssumeRoleCommand) + .build() { +} + +class AssumeRoleWithWebIdentityCommand extends smithyClient.Command + .classBuilder() + .ep(EndpointParameters.commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AWSSecurityTokenServiceV20110615", "AssumeRoleWithWebIdentity", {}) + .n("STSClient", "AssumeRoleWithWebIdentityCommand") + .f(AssumeRoleWithWebIdentityRequestFilterSensitiveLog, AssumeRoleWithWebIdentityResponseFilterSensitiveLog) + .ser(se_AssumeRoleWithWebIdentityCommand) + .de(de_AssumeRoleWithWebIdentityCommand) + .build() { +} + +const commands = { + AssumeRoleCommand, + AssumeRoleWithWebIdentityCommand, +}; +class STS extends STSClient.STSClient { +} +smithyClient.createAggregatedClient(commands, STS); + +const getAccountIdFromAssumedRoleUser = (assumedRoleUser) => { + if (typeof assumedRoleUser?.Arn === "string") { + const arnComponents = assumedRoleUser.Arn.split(":"); + if (arnComponents.length > 4 && arnComponents[4] !== "") { + return arnComponents[4]; + } + } + return undefined; +}; +const resolveRegion = async (_region, _parentRegion, credentialProviderLogger, loaderConfig = {}) => { + const region = typeof _region === "function" ? await _region() : _region; + const parentRegion = typeof _parentRegion === "function" ? await _parentRegion() : _parentRegion; + const stsDefaultRegion = await regionConfigResolver.stsRegionDefaultResolver(loaderConfig)(); + credentialProviderLogger?.debug?.("@aws-sdk/client-sts::resolveRegion", "accepting first of:", `${region} (credential provider clientConfig)`, `${parentRegion} (contextual client)`, `${stsDefaultRegion} (STS default: AWS_REGION, profile region, or us-east-1)`); + return region ?? parentRegion ?? stsDefaultRegion; +}; +const getDefaultRoleAssumer$1 = (stsOptions, STSClient) => { + let stsClient; + let closureSourceCreds; + return async (sourceCreds, params) => { + closureSourceCreds = sourceCreds; + if (!stsClient) { + const { logger = stsOptions?.parentClientConfig?.logger, profile = stsOptions?.parentClientConfig?.profile, region, requestHandler = stsOptions?.parentClientConfig?.requestHandler, credentialProviderLogger, userAgentAppId = stsOptions?.parentClientConfig?.userAgentAppId, } = stsOptions; + const resolvedRegion = await resolveRegion(region, stsOptions?.parentClientConfig?.region, credentialProviderLogger, { + logger, + profile, + }); + const isCompatibleRequestHandler = !isH2(requestHandler); + stsClient = new STSClient({ + ...stsOptions, + userAgentAppId, + profile, + credentialDefaultProvider: () => async () => closureSourceCreds, + region: resolvedRegion, + requestHandler: isCompatibleRequestHandler ? requestHandler : undefined, + logger: logger, + }); + } + const { Credentials, AssumedRoleUser } = await stsClient.send(new AssumeRoleCommand(params)); + if (!Credentials || !Credentials.AccessKeyId || !Credentials.SecretAccessKey) { + throw new Error(`Invalid response from STS.assumeRole call with role ${params.RoleArn}`); + } + const accountId = getAccountIdFromAssumedRoleUser(AssumedRoleUser); + const credentials = { + accessKeyId: Credentials.AccessKeyId, + secretAccessKey: Credentials.SecretAccessKey, + sessionToken: Credentials.SessionToken, + expiration: Credentials.Expiration, + ...(Credentials.CredentialScope && { credentialScope: Credentials.CredentialScope }), + ...(accountId && { accountId }), + }; + client.setCredentialFeature(credentials, "CREDENTIALS_STS_ASSUME_ROLE", "i"); + return credentials; + }; +}; +const getDefaultRoleAssumerWithWebIdentity$1 = (stsOptions, STSClient) => { + let stsClient; + return async (params) => { + if (!stsClient) { + const { logger = stsOptions?.parentClientConfig?.logger, profile = stsOptions?.parentClientConfig?.profile, region, requestHandler = stsOptions?.parentClientConfig?.requestHandler, credentialProviderLogger, userAgentAppId = stsOptions?.parentClientConfig?.userAgentAppId, } = stsOptions; + const resolvedRegion = await resolveRegion(region, stsOptions?.parentClientConfig?.region, credentialProviderLogger, { + logger, + profile, + }); + const isCompatibleRequestHandler = !isH2(requestHandler); + stsClient = new STSClient({ + ...stsOptions, + userAgentAppId, + profile, + region: resolvedRegion, + requestHandler: isCompatibleRequestHandler ? requestHandler : undefined, + logger: logger, + }); + } + const { Credentials, AssumedRoleUser } = await stsClient.send(new AssumeRoleWithWebIdentityCommand(params)); + if (!Credentials || !Credentials.AccessKeyId || !Credentials.SecretAccessKey) { + throw new Error(`Invalid response from STS.assumeRoleWithWebIdentity call with role ${params.RoleArn}`); + } + const accountId = getAccountIdFromAssumedRoleUser(AssumedRoleUser); + const credentials = { + accessKeyId: Credentials.AccessKeyId, + secretAccessKey: Credentials.SecretAccessKey, + sessionToken: Credentials.SessionToken, + expiration: Credentials.Expiration, + ...(Credentials.CredentialScope && { credentialScope: Credentials.CredentialScope }), + ...(accountId && { accountId }), + }; + if (accountId) { + client.setCredentialFeature(credentials, "RESOLVED_ACCOUNT_ID", "T"); + } + client.setCredentialFeature(credentials, "CREDENTIALS_STS_ASSUME_ROLE_WEB_ID", "k"); + return credentials; + }; +}; +const isH2 = (requestHandler) => { + return requestHandler?.metadata?.handlerProtocol === "h2"; +}; + +const getCustomizableStsClientCtor = (baseCtor, customizations) => { + if (!customizations) + return baseCtor; + else + return class CustomizableSTSClient extends baseCtor { + constructor(config) { + super(config); + for (const customization of customizations) { + this.middlewareStack.use(customization); + } + } + }; +}; +const getDefaultRoleAssumer = (stsOptions = {}, stsPlugins) => getDefaultRoleAssumer$1(stsOptions, getCustomizableStsClientCtor(STSClient.STSClient, stsPlugins)); +const getDefaultRoleAssumerWithWebIdentity = (stsOptions = {}, stsPlugins) => getDefaultRoleAssumerWithWebIdentity$1(stsOptions, getCustomizableStsClientCtor(STSClient.STSClient, stsPlugins)); +const decorateDefaultCredentialProvider = (provider) => (input) => provider({ + roleAssumer: getDefaultRoleAssumer(input), + roleAssumerWithWebIdentity: getDefaultRoleAssumerWithWebIdentity(input), + ...input, +}); + +Object.defineProperty(exports, "$Command", ({ + enumerable: true, + get: function () { return smithyClient.Command; } +})); +exports.AssumeRoleCommand = AssumeRoleCommand; +exports.AssumeRoleResponseFilterSensitiveLog = AssumeRoleResponseFilterSensitiveLog; +exports.AssumeRoleWithWebIdentityCommand = AssumeRoleWithWebIdentityCommand; +exports.AssumeRoleWithWebIdentityRequestFilterSensitiveLog = AssumeRoleWithWebIdentityRequestFilterSensitiveLog; +exports.AssumeRoleWithWebIdentityResponseFilterSensitiveLog = AssumeRoleWithWebIdentityResponseFilterSensitiveLog; +exports.CredentialsFilterSensitiveLog = CredentialsFilterSensitiveLog; +exports.ExpiredTokenException = ExpiredTokenException; +exports.IDPCommunicationErrorException = IDPCommunicationErrorException; +exports.IDPRejectedClaimException = IDPRejectedClaimException; +exports.InvalidIdentityTokenException = InvalidIdentityTokenException; +exports.MalformedPolicyDocumentException = MalformedPolicyDocumentException; +exports.PackedPolicyTooLargeException = PackedPolicyTooLargeException; +exports.RegionDisabledException = RegionDisabledException; +exports.STS = STS; +exports.STSServiceException = STSServiceException; +exports.decorateDefaultCredentialProvider = decorateDefaultCredentialProvider; +exports.getDefaultRoleAssumer = getDefaultRoleAssumer; +exports.getDefaultRoleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity; +Object.keys(STSClient).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return STSClient[k]; } + }); +}); + + +/***/ }), + +/***/ 6578: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const tslib_1 = __webpack_require__(1860); +const package_json_1 = tslib_1.__importDefault(__webpack_require__(9955)); +const core_1 = __webpack_require__(8704); +const util_user_agent_node_1 = __webpack_require__(1656); +const config_resolver_1 = __webpack_require__(9316); +const core_2 = __webpack_require__(402); +const hash_node_1 = __webpack_require__(5092); +const middleware_retry_1 = __webpack_require__(9618); +const node_config_provider_1 = __webpack_require__(5704); +const node_http_handler_1 = __webpack_require__(1279); +const util_body_length_node_1 = __webpack_require__(3638); +const util_retry_1 = __webpack_require__(5518); +const runtimeConfig_shared_1 = __webpack_require__(4443); +const smithy_client_1 = __webpack_require__(1411); +const util_defaults_mode_node_1 = __webpack_require__(5435); +const smithy_client_2 = __webpack_require__(1411); +const getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + (0, core_1.emitWarningIfUnsupportedVersion)(process.version); + const loaderConfig = { + profile: config?.profile, + logger: clientSharedValues.logger, + }; + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + authSchemePreference: config?.authSchemePreference ?? (0, node_config_provider_1.loadConfig)(core_1.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, loaderConfig), + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? + (0, util_user_agent_node_1.createDefaultUserAgentProvider)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4") || + (async (idProps) => await config.credentialDefaultProvider(idProps?.__config || {})()), + signer: new core_1.AwsSdkSigV4Signer(), + }, + { + schemeId: "smithy.api#noAuth", + identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), + signer: new core_2.NoAuthSigner(), + }, + ], + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS, config), + region: config?.region ?? + (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, { ...config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS, ...loaderConfig }), + requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), + retryMode: config?.retryMode ?? + (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, + }, config), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, loaderConfig), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, loaderConfig), + userAgentAppId: config?.userAgentAppId ?? (0, node_config_provider_1.loadConfig)(util_user_agent_node_1.NODE_APP_ID_CONFIG_OPTIONS, loaderConfig), + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 4443: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const core_1 = __webpack_require__(8704); +const core_2 = __webpack_require__(402); +const smithy_client_1 = __webpack_require__(1411); +const url_parser_1 = __webpack_require__(4494); +const util_base64_1 = __webpack_require__(8385); +const util_utf8_1 = __webpack_require__(1577); +const httpAuthSchemeProvider_1 = __webpack_require__(7851); +const endpointResolver_1 = __webpack_require__(9765); +const getRuntimeConfig = (config) => { + return { + apiVersion: "2011-06-15", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSTSHttpAuthSchemeProvider, + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), + signer: new core_1.AwsSdkSigV4Signer(), + }, + { + schemeId: "smithy.api#noAuth", + identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), + signer: new core_2.NoAuthSigner(), + }, + ], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "STS", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 7742: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveRuntimeExtensions = void 0; +const region_config_resolver_1 = __webpack_require__(6463); +const protocol_http_1 = __webpack_require__(2356); +const smithy_client_1 = __webpack_require__(1411); +const httpAuthExtensionConfiguration_1 = __webpack_require__(4532); +const resolveRuntimeExtensions = (runtimeConfig, extensions) => { + const extensionConfiguration = Object.assign((0, region_config_resolver_1.getAwsRegionExtensionConfiguration)(runtimeConfig), (0, smithy_client_1.getDefaultExtensionConfiguration)(runtimeConfig), (0, protocol_http_1.getHttpHandlerExtensionConfiguration)(runtimeConfig), (0, httpAuthExtensionConfiguration_1.getHttpAuthExtensionConfiguration)(runtimeConfig)); + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return Object.assign(runtimeConfig, (0, region_config_resolver_1.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), (0, smithy_client_1.resolveDefaultRuntimeConfig)(extensionConfiguration), (0, protocol_http_1.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), (0, httpAuthExtensionConfiguration_1.resolveHttpAuthRuntimeConfig)(extensionConfiguration)); +}; +exports.resolveRuntimeExtensions = resolveRuntimeExtensions; + + +/***/ }), + +/***/ 9955: +/***/ ((module) => { + +module.exports = /*#__PURE__*/JSON.parse('{"name":"@aws-sdk/nested-clients","version":"3.922.0","description":"Nested clients for AWS SDK packages.","main":"./dist-cjs/index.js","module":"./dist-es/index.js","types":"./dist-types/index.d.ts","scripts":{"build":"yarn lint && concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"node ../../scripts/compilation/inline nested-clients","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","lint":"node ../../scripts/validation/submodules-linter.js --pkg nested-clients","test":"yarn g:vitest run","test:watch":"yarn g:vitest watch"},"engines":{"node":">=18.0.0"},"sideEffects":false,"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","dependencies":{"@aws-crypto/sha256-browser":"5.2.0","@aws-crypto/sha256-js":"5.2.0","@aws-sdk/core":"3.922.0","@aws-sdk/middleware-host-header":"3.922.0","@aws-sdk/middleware-logger":"3.922.0","@aws-sdk/middleware-recursion-detection":"3.922.0","@aws-sdk/middleware-user-agent":"3.922.0","@aws-sdk/region-config-resolver":"3.922.0","@aws-sdk/types":"3.922.0","@aws-sdk/util-endpoints":"3.922.0","@aws-sdk/util-user-agent-browser":"3.922.0","@aws-sdk/util-user-agent-node":"3.922.0","@smithy/config-resolver":"^4.4.1","@smithy/core":"^3.17.2","@smithy/fetch-http-handler":"^5.3.5","@smithy/hash-node":"^4.2.4","@smithy/invalid-dependency":"^4.2.4","@smithy/middleware-content-length":"^4.2.4","@smithy/middleware-endpoint":"^4.3.6","@smithy/middleware-retry":"^4.4.6","@smithy/middleware-serde":"^4.2.4","@smithy/middleware-stack":"^4.2.4","@smithy/node-config-provider":"^4.3.4","@smithy/node-http-handler":"^4.4.4","@smithy/protocol-http":"^5.3.4","@smithy/smithy-client":"^4.9.2","@smithy/types":"^4.8.1","@smithy/url-parser":"^4.2.4","@smithy/util-base64":"^4.3.0","@smithy/util-body-length-browser":"^4.2.0","@smithy/util-body-length-node":"^4.2.1","@smithy/util-defaults-mode-browser":"^4.3.5","@smithy/util-defaults-mode-node":"^4.2.7","@smithy/util-endpoints":"^3.2.4","@smithy/util-middleware":"^4.2.4","@smithy/util-retry":"^4.2.4","@smithy/util-utf8":"^4.2.0","tslib":"^2.6.2"},"devDependencies":{"concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typescript":"~5.8.3"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["./sso-oidc.d.ts","./sso-oidc.js","./sts.d.ts","./sts.js","dist-*/**"],"browser":{"./dist-es/submodules/sso-oidc/runtimeConfig":"./dist-es/submodules/sso-oidc/runtimeConfig.browser","./dist-es/submodules/sts/runtimeConfig":"./dist-es/submodules/sts/runtimeConfig.browser"},"react-native":{},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/packages/nested-clients","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"packages/nested-clients"},"exports":{"./sso-oidc":{"types":"./dist-types/submodules/sso-oidc/index.d.ts","module":"./dist-es/submodules/sso-oidc/index.js","node":"./dist-cjs/submodules/sso-oidc/index.js","import":"./dist-es/submodules/sso-oidc/index.js","require":"./dist-cjs/submodules/sso-oidc/index.js"},"./sts":{"types":"./dist-types/submodules/sts/index.d.ts","module":"./dist-es/submodules/sts/index.js","node":"./dist-cjs/submodules/sts/index.js","import":"./dist-es/submodules/sts/index.js","require":"./dist-cjs/submodules/sts/index.js"}}}'); + +/***/ }) + +}; +; \ No newline at end of file diff --git a/dist/360.index.js b/dist/360.index.js new file mode 100644 index 00000000..fbad95c0 --- /dev/null +++ b/dist/360.index.js @@ -0,0 +1,93 @@ +"use strict"; +exports.id = 360; +exports.ids = [360]; +exports.modules = { + +/***/ 5360: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + + +var sharedIniFileLoader = __webpack_require__(4964); +var propertyProvider = __webpack_require__(1238); +var child_process = __webpack_require__(5317); +var util = __webpack_require__(9023); +var client = __webpack_require__(5152); + +const getValidatedProcessCredentials = (profileName, data, profiles) => { + if (data.Version !== 1) { + throw Error(`Profile ${profileName} credential_process did not return Version 1.`); + } + if (data.AccessKeyId === undefined || data.SecretAccessKey === undefined) { + throw Error(`Profile ${profileName} credential_process returned invalid credentials.`); + } + if (data.Expiration) { + const currentTime = new Date(); + const expireTime = new Date(data.Expiration); + if (expireTime < currentTime) { + throw Error(`Profile ${profileName} credential_process returned expired credentials.`); + } + } + let accountId = data.AccountId; + if (!accountId && profiles?.[profileName]?.aws_account_id) { + accountId = profiles[profileName].aws_account_id; + } + const credentials = { + accessKeyId: data.AccessKeyId, + secretAccessKey: data.SecretAccessKey, + ...(data.SessionToken && { sessionToken: data.SessionToken }), + ...(data.Expiration && { expiration: new Date(data.Expiration) }), + ...(data.CredentialScope && { credentialScope: data.CredentialScope }), + ...(accountId && { accountId }), + }; + client.setCredentialFeature(credentials, "CREDENTIALS_PROCESS", "w"); + return credentials; +}; + +const resolveProcessCredentials = async (profileName, profiles, logger) => { + const profile = profiles[profileName]; + if (profiles[profileName]) { + const credentialProcess = profile["credential_process"]; + if (credentialProcess !== undefined) { + const execPromise = util.promisify(sharedIniFileLoader.externalDataInterceptor?.getTokenRecord?.().exec ?? child_process.exec); + try { + const { stdout } = await execPromise(credentialProcess); + let data; + try { + data = JSON.parse(stdout.trim()); + } + catch { + throw Error(`Profile ${profileName} credential_process returned invalid JSON.`); + } + return getValidatedProcessCredentials(profileName, data, profiles); + } + catch (error) { + throw new propertyProvider.CredentialsProviderError(error.message, { logger }); + } + } + else { + throw new propertyProvider.CredentialsProviderError(`Profile ${profileName} did not contain credential_process.`, { logger }); + } + } + else { + throw new propertyProvider.CredentialsProviderError(`Profile ${profileName} could not be found in shared credentials file.`, { + logger, + }); + } +}; + +const fromProcess = (init = {}) => async ({ callerClientConfig } = {}) => { + init.logger?.debug("@aws-sdk/credential-provider-process - fromProcess"); + const profiles = await sharedIniFileLoader.parseKnownFiles(init); + return resolveProcessCredentials(sharedIniFileLoader.getProfileName({ + profile: init.profile ?? callerClientConfig?.profile, + }), profiles, init.logger); +}; + +exports.fromProcess = fromProcess; + + +/***/ }) + +}; +; \ No newline at end of file diff --git a/dist/443.index.js b/dist/443.index.js new file mode 100644 index 00000000..5613cfcb --- /dev/null +++ b/dist/443.index.js @@ -0,0 +1,856 @@ +"use strict"; +exports.id = 443; +exports.ids = [443]; +exports.modules = { + +/***/ 8396: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpAuthSchemeConfig = exports.defaultSSOOIDCHttpAuthSchemeProvider = exports.defaultSSOOIDCHttpAuthSchemeParametersProvider = void 0; +const core_1 = __webpack_require__(8704); +const util_middleware_1 = __webpack_require__(6324); +const defaultSSOOIDCHttpAuthSchemeParametersProvider = async (config, context, input) => { + return { + operation: (0, util_middleware_1.getSmithyContext)(context).operation, + region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) || + (() => { + throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); + })(), + }; +}; +exports.defaultSSOOIDCHttpAuthSchemeParametersProvider = defaultSSOOIDCHttpAuthSchemeParametersProvider; +function createAwsAuthSigv4HttpAuthOption(authParameters) { + return { + schemeId: "aws.auth#sigv4", + signingProperties: { + name: "sso-oauth", + region: authParameters.region, + }, + propertiesExtractor: (config, context) => ({ + signingProperties: { + config, + context, + }, + }), + }; +} +function createSmithyApiNoAuthHttpAuthOption(authParameters) { + return { + schemeId: "smithy.api#noAuth", + }; +} +const defaultSSOOIDCHttpAuthSchemeProvider = (authParameters) => { + const options = []; + switch (authParameters.operation) { + case "CreateToken": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + default: { + options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + } + } + return options; +}; +exports.defaultSSOOIDCHttpAuthSchemeProvider = defaultSSOOIDCHttpAuthSchemeProvider; +const resolveHttpAuthSchemeConfig = (config) => { + const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); + return Object.assign(config_0, { + authSchemePreference: (0, util_middleware_1.normalizeProvider)(config.authSchemePreference ?? []), + }); +}; +exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; + + +/***/ }), + +/***/ 546: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultEndpointResolver = void 0; +const util_endpoints_1 = __webpack_require__(3068); +const util_endpoints_2 = __webpack_require__(9674); +const ruleset_1 = __webpack_require__(9947); +const cache = new util_endpoints_2.EndpointCache({ + size: 50, + params: ["Endpoint", "Region", "UseDualStack", "UseFIPS"], +}); +const defaultEndpointResolver = (endpointParams, context = {}) => { + return cache.get(endpointParams, () => (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams: endpointParams, + logger: context.logger, + })); +}; +exports.defaultEndpointResolver = defaultEndpointResolver; +util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; + + +/***/ }), + +/***/ 9947: +/***/ ((__unused_webpack_module, exports) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ruleSet = void 0; +const u = "required", v = "fn", w = "argv", x = "ref"; +const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = "getAttr", i = { [u]: false, "type": "string" }, j = { [u]: true, "default": false, "type": "boolean" }, k = { [x]: "Endpoint" }, l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }, m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }, n = {}, o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }, p = { [x]: g }, q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }, r = [l], s = [m], t = [{ [x]: "Region" }]; +const _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://oidc.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://oidc.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://oidc.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; +exports.ruleSet = _data; + + +/***/ }), + +/***/ 9443: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + +var __webpack_unused_export__; + + +var middlewareHostHeader = __webpack_require__(2590); +var middlewareLogger = __webpack_require__(5242); +var middlewareRecursionDetection = __webpack_require__(1568); +var middlewareUserAgent = __webpack_require__(2959); +var configResolver = __webpack_require__(9316); +var core = __webpack_require__(402); +var middlewareContentLength = __webpack_require__(7212); +var middlewareEndpoint = __webpack_require__(99); +var middlewareRetry = __webpack_require__(9618); +var smithyClient = __webpack_require__(1411); +var httpAuthSchemeProvider = __webpack_require__(8396); +var runtimeConfig = __webpack_require__(6901); +var regionConfigResolver = __webpack_require__(6463); +var protocolHttp = __webpack_require__(2356); +var middlewareSerde = __webpack_require__(3255); +var core$1 = __webpack_require__(8704); + +const resolveClientEndpointParameters = (options) => { + return Object.assign(options, { + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + defaultSigningName: "sso-oauth", + }); +}; +const commonParams = { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, +}; + +const getHttpAuthExtensionConfiguration = (runtimeConfig) => { + const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; + let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; + let _credentials = runtimeConfig.credentials; + return { + setHttpAuthScheme(httpAuthScheme) { + const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); + if (index === -1) { + _httpAuthSchemes.push(httpAuthScheme); + } + else { + _httpAuthSchemes.splice(index, 1, httpAuthScheme); + } + }, + httpAuthSchemes() { + return _httpAuthSchemes; + }, + setHttpAuthSchemeProvider(httpAuthSchemeProvider) { + _httpAuthSchemeProvider = httpAuthSchemeProvider; + }, + httpAuthSchemeProvider() { + return _httpAuthSchemeProvider; + }, + setCredentials(credentials) { + _credentials = credentials; + }, + credentials() { + return _credentials; + }, + }; +}; +const resolveHttpAuthRuntimeConfig = (config) => { + return { + httpAuthSchemes: config.httpAuthSchemes(), + httpAuthSchemeProvider: config.httpAuthSchemeProvider(), + credentials: config.credentials(), + }; +}; + +const resolveRuntimeExtensions = (runtimeConfig, extensions) => { + const extensionConfiguration = Object.assign(regionConfigResolver.getAwsRegionExtensionConfiguration(runtimeConfig), smithyClient.getDefaultExtensionConfiguration(runtimeConfig), protocolHttp.getHttpHandlerExtensionConfiguration(runtimeConfig), getHttpAuthExtensionConfiguration(runtimeConfig)); + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return Object.assign(runtimeConfig, regionConfigResolver.resolveAwsRegionExtensionConfiguration(extensionConfiguration), smithyClient.resolveDefaultRuntimeConfig(extensionConfiguration), protocolHttp.resolveHttpHandlerRuntimeConfig(extensionConfiguration), resolveHttpAuthRuntimeConfig(extensionConfiguration)); +}; + +class SSOOIDCClient extends smithyClient.Client { + config; + constructor(...[configuration]) { + const _config_0 = runtimeConfig.getRuntimeConfig(configuration || {}); + super(_config_0); + this.initConfig = _config_0; + const _config_1 = resolveClientEndpointParameters(_config_0); + const _config_2 = middlewareUserAgent.resolveUserAgentConfig(_config_1); + const _config_3 = middlewareRetry.resolveRetryConfig(_config_2); + const _config_4 = configResolver.resolveRegionConfig(_config_3); + const _config_5 = middlewareHostHeader.resolveHostHeaderConfig(_config_4); + const _config_6 = middlewareEndpoint.resolveEndpointConfig(_config_5); + const _config_7 = httpAuthSchemeProvider.resolveHttpAuthSchemeConfig(_config_6); + const _config_8 = resolveRuntimeExtensions(_config_7, configuration?.extensions || []); + this.config = _config_8; + this.middlewareStack.use(middlewareUserAgent.getUserAgentPlugin(this.config)); + this.middlewareStack.use(middlewareRetry.getRetryPlugin(this.config)); + this.middlewareStack.use(middlewareContentLength.getContentLengthPlugin(this.config)); + this.middlewareStack.use(middlewareHostHeader.getHostHeaderPlugin(this.config)); + this.middlewareStack.use(middlewareLogger.getLoggerPlugin(this.config)); + this.middlewareStack.use(middlewareRecursionDetection.getRecursionDetectionPlugin(this.config)); + this.middlewareStack.use(core.getHttpAuthSchemeEndpointRuleSetPlugin(this.config, { + httpAuthSchemeParametersProvider: httpAuthSchemeProvider.defaultSSOOIDCHttpAuthSchemeParametersProvider, + identityProviderConfigProvider: async (config) => new core.DefaultIdentityProviderConfig({ + "aws.auth#sigv4": config.credentials, + }), + })); + this.middlewareStack.use(core.getHttpSigningPlugin(this.config)); + } + destroy() { + super.destroy(); + } +} + +class SSOOIDCServiceException extends smithyClient.ServiceException { + constructor(options) { + super(options); + Object.setPrototypeOf(this, SSOOIDCServiceException.prototype); + } +} + +const AccessDeniedExceptionReason = { + KMS_ACCESS_DENIED: "KMS_AccessDeniedException", +}; +class AccessDeniedException extends SSOOIDCServiceException { + name = "AccessDeniedException"; + $fault = "client"; + error; + reason; + error_description; + constructor(opts) { + super({ + name: "AccessDeniedException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, AccessDeniedException.prototype); + this.error = opts.error; + this.reason = opts.reason; + this.error_description = opts.error_description; + } +} +class AuthorizationPendingException extends SSOOIDCServiceException { + name = "AuthorizationPendingException"; + $fault = "client"; + error; + error_description; + constructor(opts) { + super({ + name: "AuthorizationPendingException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, AuthorizationPendingException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +} +const CreateTokenRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.clientSecret && { clientSecret: smithyClient.SENSITIVE_STRING }), + ...(obj.refreshToken && { refreshToken: smithyClient.SENSITIVE_STRING }), + ...(obj.codeVerifier && { codeVerifier: smithyClient.SENSITIVE_STRING }), +}); +const CreateTokenResponseFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.accessToken && { accessToken: smithyClient.SENSITIVE_STRING }), + ...(obj.refreshToken && { refreshToken: smithyClient.SENSITIVE_STRING }), + ...(obj.idToken && { idToken: smithyClient.SENSITIVE_STRING }), +}); +class ExpiredTokenException extends SSOOIDCServiceException { + name = "ExpiredTokenException"; + $fault = "client"; + error; + error_description; + constructor(opts) { + super({ + name: "ExpiredTokenException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ExpiredTokenException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +} +class InternalServerException extends SSOOIDCServiceException { + name = "InternalServerException"; + $fault = "server"; + error; + error_description; + constructor(opts) { + super({ + name: "InternalServerException", + $fault: "server", + ...opts, + }); + Object.setPrototypeOf(this, InternalServerException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +} +class InvalidClientException extends SSOOIDCServiceException { + name = "InvalidClientException"; + $fault = "client"; + error; + error_description; + constructor(opts) { + super({ + name: "InvalidClientException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, InvalidClientException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +} +class InvalidGrantException extends SSOOIDCServiceException { + name = "InvalidGrantException"; + $fault = "client"; + error; + error_description; + constructor(opts) { + super({ + name: "InvalidGrantException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, InvalidGrantException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +} +const InvalidRequestExceptionReason = { + KMS_DISABLED_KEY: "KMS_DisabledException", + KMS_INVALID_KEY_USAGE: "KMS_InvalidKeyUsageException", + KMS_INVALID_STATE: "KMS_InvalidStateException", + KMS_KEY_NOT_FOUND: "KMS_NotFoundException", +}; +class InvalidRequestException extends SSOOIDCServiceException { + name = "InvalidRequestException"; + $fault = "client"; + error; + reason; + error_description; + constructor(opts) { + super({ + name: "InvalidRequestException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, InvalidRequestException.prototype); + this.error = opts.error; + this.reason = opts.reason; + this.error_description = opts.error_description; + } +} +class InvalidScopeException extends SSOOIDCServiceException { + name = "InvalidScopeException"; + $fault = "client"; + error; + error_description; + constructor(opts) { + super({ + name: "InvalidScopeException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, InvalidScopeException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +} +class SlowDownException extends SSOOIDCServiceException { + name = "SlowDownException"; + $fault = "client"; + error; + error_description; + constructor(opts) { + super({ + name: "SlowDownException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, SlowDownException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +} +class UnauthorizedClientException extends SSOOIDCServiceException { + name = "UnauthorizedClientException"; + $fault = "client"; + error; + error_description; + constructor(opts) { + super({ + name: "UnauthorizedClientException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, UnauthorizedClientException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +} +class UnsupportedGrantTypeException extends SSOOIDCServiceException { + name = "UnsupportedGrantTypeException"; + $fault = "client"; + error; + error_description; + constructor(opts) { + super({ + name: "UnsupportedGrantTypeException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, UnsupportedGrantTypeException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +} + +const se_CreateTokenCommand = async (input, context) => { + const b = core.requestBuilder(input, context); + const headers = { + "content-type": "application/json", + }; + b.bp("/token"); + let body; + body = JSON.stringify(smithyClient.take(input, { + clientId: [], + clientSecret: [], + code: [], + codeVerifier: [], + deviceCode: [], + grantType: [], + redirectUri: [], + refreshToken: [], + scope: (_) => smithyClient._json(_), + })); + b.m("POST").h(headers).b(body); + return b.build(); +}; +const de_CreateTokenCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = smithyClient.map({ + $metadata: deserializeMetadata(output), + }); + const data = smithyClient.expectNonNull(smithyClient.expectObject(await core$1.parseJsonBody(output.body, context)), "body"); + const doc = smithyClient.take(data, { + accessToken: smithyClient.expectString, + expiresIn: smithyClient.expectInt32, + idToken: smithyClient.expectString, + refreshToken: smithyClient.expectString, + tokenType: smithyClient.expectString, + }); + Object.assign(contents, doc); + return contents; +}; +const de_CommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await core$1.parseJsonErrorBody(output.body, context), + }; + const errorCode = core$1.loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "AccessDeniedException": + case "com.amazonaws.ssooidc#AccessDeniedException": + throw await de_AccessDeniedExceptionRes(parsedOutput); + case "AuthorizationPendingException": + case "com.amazonaws.ssooidc#AuthorizationPendingException": + throw await de_AuthorizationPendingExceptionRes(parsedOutput); + case "ExpiredTokenException": + case "com.amazonaws.ssooidc#ExpiredTokenException": + throw await de_ExpiredTokenExceptionRes(parsedOutput); + case "InternalServerException": + case "com.amazonaws.ssooidc#InternalServerException": + throw await de_InternalServerExceptionRes(parsedOutput); + case "InvalidClientException": + case "com.amazonaws.ssooidc#InvalidClientException": + throw await de_InvalidClientExceptionRes(parsedOutput); + case "InvalidGrantException": + case "com.amazonaws.ssooidc#InvalidGrantException": + throw await de_InvalidGrantExceptionRes(parsedOutput); + case "InvalidRequestException": + case "com.amazonaws.ssooidc#InvalidRequestException": + throw await de_InvalidRequestExceptionRes(parsedOutput); + case "InvalidScopeException": + case "com.amazonaws.ssooidc#InvalidScopeException": + throw await de_InvalidScopeExceptionRes(parsedOutput); + case "SlowDownException": + case "com.amazonaws.ssooidc#SlowDownException": + throw await de_SlowDownExceptionRes(parsedOutput); + case "UnauthorizedClientException": + case "com.amazonaws.ssooidc#UnauthorizedClientException": + throw await de_UnauthorizedClientExceptionRes(parsedOutput); + case "UnsupportedGrantTypeException": + case "com.amazonaws.ssooidc#UnsupportedGrantTypeException": + throw await de_UnsupportedGrantTypeExceptionRes(parsedOutput); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const throwDefaultError = smithyClient.withBaseException(SSOOIDCServiceException); +const de_AccessDeniedExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + error: smithyClient.expectString, + error_description: smithyClient.expectString, + reason: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new AccessDeniedException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const de_AuthorizationPendingExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + error: smithyClient.expectString, + error_description: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new AuthorizationPendingException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const de_ExpiredTokenExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + error: smithyClient.expectString, + error_description: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new ExpiredTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const de_InternalServerExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + error: smithyClient.expectString, + error_description: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new InternalServerException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const de_InvalidClientExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + error: smithyClient.expectString, + error_description: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new InvalidClientException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const de_InvalidGrantExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + error: smithyClient.expectString, + error_description: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new InvalidGrantException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const de_InvalidRequestExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + error: smithyClient.expectString, + error_description: smithyClient.expectString, + reason: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new InvalidRequestException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const de_InvalidScopeExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + error: smithyClient.expectString, + error_description: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new InvalidScopeException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const de_SlowDownExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + error: smithyClient.expectString, + error_description: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new SlowDownException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const de_UnauthorizedClientExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + error: smithyClient.expectString, + error_description: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new UnauthorizedClientException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const de_UnsupportedGrantTypeExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + error: smithyClient.expectString, + error_description: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new UnsupportedGrantTypeException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const deserializeMetadata = (output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"], +}); + +class CreateTokenCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AWSSSOOIDCService", "CreateToken", {}) + .n("SSOOIDCClient", "CreateTokenCommand") + .f(CreateTokenRequestFilterSensitiveLog, CreateTokenResponseFilterSensitiveLog) + .ser(se_CreateTokenCommand) + .de(de_CreateTokenCommand) + .build() { +} + +const commands = { + CreateTokenCommand, +}; +class SSOOIDC extends SSOOIDCClient { +} +smithyClient.createAggregatedClient(commands, SSOOIDC); + +__webpack_unused_export__ = ({ + enumerable: true, + get: function () { return smithyClient.Command; } +}); +__webpack_unused_export__ = ({ + enumerable: true, + get: function () { return smithyClient.Client; } +}); +__webpack_unused_export__ = AccessDeniedException; +__webpack_unused_export__ = AccessDeniedExceptionReason; +__webpack_unused_export__ = AuthorizationPendingException; +exports.CreateTokenCommand = CreateTokenCommand; +__webpack_unused_export__ = CreateTokenRequestFilterSensitiveLog; +__webpack_unused_export__ = CreateTokenResponseFilterSensitiveLog; +__webpack_unused_export__ = ExpiredTokenException; +__webpack_unused_export__ = InternalServerException; +__webpack_unused_export__ = InvalidClientException; +__webpack_unused_export__ = InvalidGrantException; +__webpack_unused_export__ = InvalidRequestException; +__webpack_unused_export__ = InvalidRequestExceptionReason; +__webpack_unused_export__ = InvalidScopeException; +__webpack_unused_export__ = SSOOIDC; +exports.SSOOIDCClient = SSOOIDCClient; +__webpack_unused_export__ = SSOOIDCServiceException; +__webpack_unused_export__ = SlowDownException; +__webpack_unused_export__ = UnauthorizedClientException; +__webpack_unused_export__ = UnsupportedGrantTypeException; + + +/***/ }), + +/***/ 6901: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const tslib_1 = __webpack_require__(1860); +const package_json_1 = tslib_1.__importDefault(__webpack_require__(9955)); +const core_1 = __webpack_require__(8704); +const util_user_agent_node_1 = __webpack_require__(1656); +const config_resolver_1 = __webpack_require__(9316); +const hash_node_1 = __webpack_require__(5092); +const middleware_retry_1 = __webpack_require__(9618); +const node_config_provider_1 = __webpack_require__(5704); +const node_http_handler_1 = __webpack_require__(1279); +const util_body_length_node_1 = __webpack_require__(3638); +const util_retry_1 = __webpack_require__(5518); +const runtimeConfig_shared_1 = __webpack_require__(1546); +const smithy_client_1 = __webpack_require__(1411); +const util_defaults_mode_node_1 = __webpack_require__(5435); +const smithy_client_2 = __webpack_require__(1411); +const getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + (0, core_1.emitWarningIfUnsupportedVersion)(process.version); + const loaderConfig = { + profile: config?.profile, + logger: clientSharedValues.logger, + }; + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + authSchemePreference: config?.authSchemePreference ?? (0, node_config_provider_1.loadConfig)(core_1.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, loaderConfig), + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? + (0, util_user_agent_node_1.createDefaultUserAgentProvider)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS, config), + region: config?.region ?? + (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, { ...config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS, ...loaderConfig }), + requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), + retryMode: config?.retryMode ?? + (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, + }, config), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, loaderConfig), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, loaderConfig), + userAgentAppId: config?.userAgentAppId ?? (0, node_config_provider_1.loadConfig)(util_user_agent_node_1.NODE_APP_ID_CONFIG_OPTIONS, loaderConfig), + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 1546: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const core_1 = __webpack_require__(8704); +const core_2 = __webpack_require__(402); +const smithy_client_1 = __webpack_require__(1411); +const url_parser_1 = __webpack_require__(4494); +const util_base64_1 = __webpack_require__(8385); +const util_utf8_1 = __webpack_require__(1577); +const httpAuthSchemeProvider_1 = __webpack_require__(8396); +const endpointResolver_1 = __webpack_require__(546); +const getRuntimeConfig = (config) => { + return { + apiVersion: "2019-06-10", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSSOOIDCHttpAuthSchemeProvider, + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), + signer: new core_1.AwsSdkSigV4Signer(), + }, + { + schemeId: "smithy.api#noAuth", + identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), + signer: new core_2.NoAuthSigner(), + }, + ], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "SSO OIDC", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 9955: +/***/ ((module) => { + +module.exports = /*#__PURE__*/JSON.parse('{"name":"@aws-sdk/nested-clients","version":"3.922.0","description":"Nested clients for AWS SDK packages.","main":"./dist-cjs/index.js","module":"./dist-es/index.js","types":"./dist-types/index.d.ts","scripts":{"build":"yarn lint && concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"node ../../scripts/compilation/inline nested-clients","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","lint":"node ../../scripts/validation/submodules-linter.js --pkg nested-clients","test":"yarn g:vitest run","test:watch":"yarn g:vitest watch"},"engines":{"node":">=18.0.0"},"sideEffects":false,"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","dependencies":{"@aws-crypto/sha256-browser":"5.2.0","@aws-crypto/sha256-js":"5.2.0","@aws-sdk/core":"3.922.0","@aws-sdk/middleware-host-header":"3.922.0","@aws-sdk/middleware-logger":"3.922.0","@aws-sdk/middleware-recursion-detection":"3.922.0","@aws-sdk/middleware-user-agent":"3.922.0","@aws-sdk/region-config-resolver":"3.922.0","@aws-sdk/types":"3.922.0","@aws-sdk/util-endpoints":"3.922.0","@aws-sdk/util-user-agent-browser":"3.922.0","@aws-sdk/util-user-agent-node":"3.922.0","@smithy/config-resolver":"^4.4.1","@smithy/core":"^3.17.2","@smithy/fetch-http-handler":"^5.3.5","@smithy/hash-node":"^4.2.4","@smithy/invalid-dependency":"^4.2.4","@smithy/middleware-content-length":"^4.2.4","@smithy/middleware-endpoint":"^4.3.6","@smithy/middleware-retry":"^4.4.6","@smithy/middleware-serde":"^4.2.4","@smithy/middleware-stack":"^4.2.4","@smithy/node-config-provider":"^4.3.4","@smithy/node-http-handler":"^4.4.4","@smithy/protocol-http":"^5.3.4","@smithy/smithy-client":"^4.9.2","@smithy/types":"^4.8.1","@smithy/url-parser":"^4.2.4","@smithy/util-base64":"^4.3.0","@smithy/util-body-length-browser":"^4.2.0","@smithy/util-body-length-node":"^4.2.1","@smithy/util-defaults-mode-browser":"^4.3.5","@smithy/util-defaults-mode-node":"^4.2.7","@smithy/util-endpoints":"^3.2.4","@smithy/util-middleware":"^4.2.4","@smithy/util-retry":"^4.2.4","@smithy/util-utf8":"^4.2.0","tslib":"^2.6.2"},"devDependencies":{"concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typescript":"~5.8.3"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["./sso-oidc.d.ts","./sso-oidc.js","./sts.d.ts","./sts.js","dist-*/**"],"browser":{"./dist-es/submodules/sso-oidc/runtimeConfig":"./dist-es/submodules/sso-oidc/runtimeConfig.browser","./dist-es/submodules/sts/runtimeConfig":"./dist-es/submodules/sts/runtimeConfig.browser"},"react-native":{},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/packages/nested-clients","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"packages/nested-clients"},"exports":{"./sso-oidc":{"types":"./dist-types/submodules/sso-oidc/index.d.ts","module":"./dist-es/submodules/sso-oidc/index.js","node":"./dist-cjs/submodules/sso-oidc/index.js","import":"./dist-es/submodules/sso-oidc/index.js","require":"./dist-cjs/submodules/sso-oidc/index.js"},"./sts":{"types":"./dist-types/submodules/sts/index.d.ts","module":"./dist-es/submodules/sts/index.js","node":"./dist-cjs/submodules/sts/index.js","import":"./dist-es/submodules/sts/index.js","require":"./dist-cjs/submodules/sts/index.js"}}}'); + +/***/ }) + +}; +; \ No newline at end of file diff --git a/dist/566.index.js b/dist/566.index.js new file mode 100644 index 00000000..651d6dca --- /dev/null +++ b/dist/566.index.js @@ -0,0 +1,387 @@ +"use strict"; +exports.id = 566; +exports.ids = [566]; +exports.modules = { + +/***/ 566: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + +var __webpack_unused_export__; + + +var propertyProvider = __webpack_require__(1238); +var url = __webpack_require__(7016); +var buffer = __webpack_require__(181); +var http = __webpack_require__(8611); +var nodeConfigProvider = __webpack_require__(5704); +var urlParser = __webpack_require__(4494); + +function httpRequest(options) { + return new Promise((resolve, reject) => { + const req = http.request({ + method: "GET", + ...options, + hostname: options.hostname?.replace(/^\[(.+)\]$/, "$1"), + }); + req.on("error", (err) => { + reject(Object.assign(new propertyProvider.ProviderError("Unable to connect to instance metadata service"), err)); + req.destroy(); + }); + req.on("timeout", () => { + reject(new propertyProvider.ProviderError("TimeoutError from instance metadata service")); + req.destroy(); + }); + req.on("response", (res) => { + const { statusCode = 400 } = res; + if (statusCode < 200 || 300 <= statusCode) { + reject(Object.assign(new propertyProvider.ProviderError("Error response received from instance metadata service"), { statusCode })); + req.destroy(); + } + const chunks = []; + res.on("data", (chunk) => { + chunks.push(chunk); + }); + res.on("end", () => { + resolve(buffer.Buffer.concat(chunks)); + req.destroy(); + }); + }); + req.end(); + }); +} + +const isImdsCredentials = (arg) => Boolean(arg) && + typeof arg === "object" && + typeof arg.AccessKeyId === "string" && + typeof arg.SecretAccessKey === "string" && + typeof arg.Token === "string" && + typeof arg.Expiration === "string"; +const fromImdsCredentials = (creds) => ({ + accessKeyId: creds.AccessKeyId, + secretAccessKey: creds.SecretAccessKey, + sessionToken: creds.Token, + expiration: new Date(creds.Expiration), + ...(creds.AccountId && { accountId: creds.AccountId }), +}); + +const DEFAULT_TIMEOUT = 1000; +const DEFAULT_MAX_RETRIES = 0; +const providerConfigFromInit = ({ maxRetries = DEFAULT_MAX_RETRIES, timeout = DEFAULT_TIMEOUT, }) => ({ maxRetries, timeout }); + +const retry = (toRetry, maxRetries) => { + let promise = toRetry(); + for (let i = 0; i < maxRetries; i++) { + promise = promise.catch(toRetry); + } + return promise; +}; + +const ENV_CMDS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; +const ENV_CMDS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; +const ENV_CMDS_AUTH_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; +const fromContainerMetadata = (init = {}) => { + const { timeout, maxRetries } = providerConfigFromInit(init); + return () => retry(async () => { + const requestOptions = await getCmdsUri({ logger: init.logger }); + const credsResponse = JSON.parse(await requestFromEcsImds(timeout, requestOptions)); + if (!isImdsCredentials(credsResponse)) { + throw new propertyProvider.CredentialsProviderError("Invalid response received from instance metadata service.", { + logger: init.logger, + }); + } + return fromImdsCredentials(credsResponse); + }, maxRetries); +}; +const requestFromEcsImds = async (timeout, options) => { + if (process.env[ENV_CMDS_AUTH_TOKEN]) { + options.headers = { + ...options.headers, + Authorization: process.env[ENV_CMDS_AUTH_TOKEN], + }; + } + const buffer = await httpRequest({ + ...options, + timeout, + }); + return buffer.toString(); +}; +const CMDS_IP = "169.254.170.2"; +const GREENGRASS_HOSTS = { + localhost: true, + "127.0.0.1": true, +}; +const GREENGRASS_PROTOCOLS = { + "http:": true, + "https:": true, +}; +const getCmdsUri = async ({ logger }) => { + if (process.env[ENV_CMDS_RELATIVE_URI]) { + return { + hostname: CMDS_IP, + path: process.env[ENV_CMDS_RELATIVE_URI], + }; + } + if (process.env[ENV_CMDS_FULL_URI]) { + const parsed = url.parse(process.env[ENV_CMDS_FULL_URI]); + if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) { + throw new propertyProvider.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, { + tryNextLink: false, + logger, + }); + } + if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) { + throw new propertyProvider.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, { + tryNextLink: false, + logger, + }); + } + return { + ...parsed, + port: parsed.port ? parseInt(parsed.port, 10) : undefined, + }; + } + throw new propertyProvider.CredentialsProviderError("The container metadata credential provider cannot be used unless" + + ` the ${ENV_CMDS_RELATIVE_URI} or ${ENV_CMDS_FULL_URI} environment` + + " variable is set", { + tryNextLink: false, + logger, + }); +}; + +class InstanceMetadataV1FallbackError extends propertyProvider.CredentialsProviderError { + tryNextLink; + name = "InstanceMetadataV1FallbackError"; + constructor(message, tryNextLink = true) { + super(message, tryNextLink); + this.tryNextLink = tryNextLink; + Object.setPrototypeOf(this, InstanceMetadataV1FallbackError.prototype); + } +} + +exports.yI = void 0; +(function (Endpoint) { + Endpoint["IPv4"] = "http://169.254.169.254"; + Endpoint["IPv6"] = "http://[fd00:ec2::254]"; +})(exports.yI || (exports.yI = {})); + +const ENV_ENDPOINT_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT"; +const CONFIG_ENDPOINT_NAME = "ec2_metadata_service_endpoint"; +const ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_ENDPOINT_NAME], + configFileSelector: (profile) => profile[CONFIG_ENDPOINT_NAME], + default: undefined, +}; + +var EndpointMode; +(function (EndpointMode) { + EndpointMode["IPv4"] = "IPv4"; + EndpointMode["IPv6"] = "IPv6"; +})(EndpointMode || (EndpointMode = {})); + +const ENV_ENDPOINT_MODE_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT_MODE"; +const CONFIG_ENDPOINT_MODE_NAME = "ec2_metadata_service_endpoint_mode"; +const ENDPOINT_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_ENDPOINT_MODE_NAME], + configFileSelector: (profile) => profile[CONFIG_ENDPOINT_MODE_NAME], + default: EndpointMode.IPv4, +}; + +const getInstanceMetadataEndpoint = async () => urlParser.parseUrl((await getFromEndpointConfig()) || (await getFromEndpointModeConfig())); +const getFromEndpointConfig = async () => nodeConfigProvider.loadConfig(ENDPOINT_CONFIG_OPTIONS)(); +const getFromEndpointModeConfig = async () => { + const endpointMode = await nodeConfigProvider.loadConfig(ENDPOINT_MODE_CONFIG_OPTIONS)(); + switch (endpointMode) { + case EndpointMode.IPv4: + return exports.yI.IPv4; + case EndpointMode.IPv6: + return exports.yI.IPv6; + default: + throw new Error(`Unsupported endpoint mode: ${endpointMode}.` + ` Select from ${Object.values(EndpointMode)}`); + } +}; + +const STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60; +const STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60; +const STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html"; +const getExtendedInstanceMetadataCredentials = (credentials, logger) => { + const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS + + Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS); + const newExpiration = new Date(Date.now() + refreshInterval * 1000); + logger.warn("Attempting credential expiration extension due to a credential service availability issue. A refresh of these " + + `credentials will be attempted after ${new Date(newExpiration)}.\nFor more information, please visit: ` + + STATIC_STABILITY_DOC_URL); + const originalExpiration = credentials.originalExpiration ?? credentials.expiration; + return { + ...credentials, + ...(originalExpiration ? { originalExpiration } : {}), + expiration: newExpiration, + }; +}; + +const staticStabilityProvider = (provider, options = {}) => { + const logger = options?.logger || console; + let pastCredentials; + return async () => { + let credentials; + try { + credentials = await provider(); + if (credentials.expiration && credentials.expiration.getTime() < Date.now()) { + credentials = getExtendedInstanceMetadataCredentials(credentials, logger); + } + } + catch (e) { + if (pastCredentials) { + logger.warn("Credential renew failed: ", e); + credentials = getExtendedInstanceMetadataCredentials(pastCredentials, logger); + } + else { + throw e; + } + } + pastCredentials = credentials; + return credentials; + }; +}; + +const IMDS_PATH = "/latest/meta-data/iam/security-credentials/"; +const IMDS_TOKEN_PATH = "/latest/api/token"; +const AWS_EC2_METADATA_V1_DISABLED = "AWS_EC2_METADATA_V1_DISABLED"; +const PROFILE_AWS_EC2_METADATA_V1_DISABLED = "ec2_metadata_v1_disabled"; +const X_AWS_EC2_METADATA_TOKEN = "x-aws-ec2-metadata-token"; +const fromInstanceMetadata = (init = {}) => staticStabilityProvider(getInstanceMetadataProvider(init), { logger: init.logger }); +const getInstanceMetadataProvider = (init = {}) => { + let disableFetchToken = false; + const { logger, profile } = init; + const { timeout, maxRetries } = providerConfigFromInit(init); + const getCredentials = async (maxRetries, options) => { + const isImdsV1Fallback = disableFetchToken || options.headers?.[X_AWS_EC2_METADATA_TOKEN] == null; + if (isImdsV1Fallback) { + let fallbackBlockedFromProfile = false; + let fallbackBlockedFromProcessEnv = false; + const configValue = await nodeConfigProvider.loadConfig({ + environmentVariableSelector: (env) => { + const envValue = env[AWS_EC2_METADATA_V1_DISABLED]; + fallbackBlockedFromProcessEnv = !!envValue && envValue !== "false"; + if (envValue === undefined) { + throw new propertyProvider.CredentialsProviderError(`${AWS_EC2_METADATA_V1_DISABLED} not set in env, checking config file next.`, { logger: init.logger }); + } + return fallbackBlockedFromProcessEnv; + }, + configFileSelector: (profile) => { + const profileValue = profile[PROFILE_AWS_EC2_METADATA_V1_DISABLED]; + fallbackBlockedFromProfile = !!profileValue && profileValue !== "false"; + return fallbackBlockedFromProfile; + }, + default: false, + }, { + profile, + })(); + if (init.ec2MetadataV1Disabled || configValue) { + const causes = []; + if (init.ec2MetadataV1Disabled) + causes.push("credential provider initialization (runtime option ec2MetadataV1Disabled)"); + if (fallbackBlockedFromProfile) + causes.push(`config file profile (${PROFILE_AWS_EC2_METADATA_V1_DISABLED})`); + if (fallbackBlockedFromProcessEnv) + causes.push(`process environment variable (${AWS_EC2_METADATA_V1_DISABLED})`); + throw new InstanceMetadataV1FallbackError(`AWS EC2 Metadata v1 fallback has been blocked by AWS SDK configuration in the following: [${causes.join(", ")}].`); + } + } + const imdsProfile = (await retry(async () => { + let profile; + try { + profile = await getProfile(options); + } + catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; + } + throw err; + } + return profile; + }, maxRetries)).trim(); + return retry(async () => { + let creds; + try { + creds = await getCredentialsFromProfile(imdsProfile, options, init); + } + catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; + } + throw err; + } + return creds; + }, maxRetries); + }; + return async () => { + const endpoint = await getInstanceMetadataEndpoint(); + if (disableFetchToken) { + logger?.debug("AWS SDK Instance Metadata", "using v1 fallback (no token fetch)"); + return getCredentials(maxRetries, { ...endpoint, timeout }); + } + else { + let token; + try { + token = (await getMetadataToken({ ...endpoint, timeout })).toString(); + } + catch (error) { + if (error?.statusCode === 400) { + throw Object.assign(error, { + message: "EC2 Metadata token request returned error", + }); + } + else if (error.message === "TimeoutError" || [403, 404, 405].includes(error.statusCode)) { + disableFetchToken = true; + } + logger?.debug("AWS SDK Instance Metadata", "using v1 fallback (initial)"); + return getCredentials(maxRetries, { ...endpoint, timeout }); + } + return getCredentials(maxRetries, { + ...endpoint, + headers: { + [X_AWS_EC2_METADATA_TOKEN]: token, + }, + timeout, + }); + } + }; +}; +const getMetadataToken = async (options) => httpRequest({ + ...options, + path: IMDS_TOKEN_PATH, + method: "PUT", + headers: { + "x-aws-ec2-metadata-token-ttl-seconds": "21600", + }, +}); +const getProfile = async (options) => (await httpRequest({ ...options, path: IMDS_PATH })).toString(); +const getCredentialsFromProfile = async (profile, options, init) => { + const credentialsResponse = JSON.parse((await httpRequest({ + ...options, + path: IMDS_PATH + profile, + })).toString()); + if (!isImdsCredentials(credentialsResponse)) { + throw new propertyProvider.CredentialsProviderError("Invalid response received from instance metadata service.", { + logger: init.logger, + }); + } + return fromImdsCredentials(credentialsResponse); +}; + +__webpack_unused_export__ = DEFAULT_MAX_RETRIES; +__webpack_unused_export__ = DEFAULT_TIMEOUT; +__webpack_unused_export__ = ENV_CMDS_AUTH_TOKEN; +exports.ENV_CMDS_FULL_URI = ENV_CMDS_FULL_URI; +exports.ENV_CMDS_RELATIVE_URI = ENV_CMDS_RELATIVE_URI; +exports.fromContainerMetadata = fromContainerMetadata; +exports.fromInstanceMetadata = fromInstanceMetadata; +exports.getInstanceMetadataEndpoint = getInstanceMetadataEndpoint; +exports.httpRequest = httpRequest; +__webpack_unused_export__ = providerConfigFromInit; + + +/***/ }) + +}; +; \ No newline at end of file diff --git a/dist/579.index.js b/dist/579.index.js new file mode 100644 index 00000000..b155f767 --- /dev/null +++ b/dist/579.index.js @@ -0,0 +1,225 @@ +"use strict"; +exports.id = 579; +exports.ids = [579]; +exports.modules = { + +/***/ 6579: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + + +var utilUtf8 = __webpack_require__(1577); + +class EventStreamSerde { + marshaller; + serializer; + deserializer; + serdeContext; + defaultContentType; + constructor({ marshaller, serializer, deserializer, serdeContext, defaultContentType, }) { + this.marshaller = marshaller; + this.serializer = serializer; + this.deserializer = deserializer; + this.serdeContext = serdeContext; + this.defaultContentType = defaultContentType; + } + async serializeEventStream({ eventStream, requestSchema, initialRequest, }) { + const marshaller = this.marshaller; + const eventStreamMember = requestSchema.getEventStreamMember(); + const unionSchema = requestSchema.getMemberSchema(eventStreamMember); + const serializer = this.serializer; + const defaultContentType = this.defaultContentType; + const initialRequestMarker = Symbol("initialRequestMarker"); + const eventStreamIterable = { + async *[Symbol.asyncIterator]() { + if (initialRequest) { + const headers = { + ":event-type": { type: "string", value: "initial-request" }, + ":message-type": { type: "string", value: "event" }, + ":content-type": { type: "string", value: defaultContentType }, + }; + serializer.write(requestSchema, initialRequest); + const body = serializer.flush(); + yield { + [initialRequestMarker]: true, + headers, + body, + }; + } + for await (const page of eventStream) { + yield page; + } + }, + }; + return marshaller.serialize(eventStreamIterable, (event) => { + if (event[initialRequestMarker]) { + return { + headers: event.headers, + body: event.body, + }; + } + const unionMember = Object.keys(event).find((key) => { + return key !== "__type"; + }) ?? ""; + const { additionalHeaders, body, eventType, explicitPayloadContentType } = this.writeEventBody(unionMember, unionSchema, event); + const headers = { + ":event-type": { type: "string", value: eventType }, + ":message-type": { type: "string", value: "event" }, + ":content-type": { type: "string", value: explicitPayloadContentType ?? defaultContentType }, + ...additionalHeaders, + }; + return { + headers, + body, + }; + }); + } + async deserializeEventStream({ response, responseSchema, initialResponseContainer, }) { + const marshaller = this.marshaller; + const eventStreamMember = responseSchema.getEventStreamMember(); + const unionSchema = responseSchema.getMemberSchema(eventStreamMember); + const memberSchemas = unionSchema.getMemberSchemas(); + const initialResponseMarker = Symbol("initialResponseMarker"); + const asyncIterable = marshaller.deserialize(response.body, async (event) => { + const unionMember = Object.keys(event).find((key) => { + return key !== "__type"; + }) ?? ""; + if (unionMember === "initial-response") { + const dataObject = await this.deserializer.read(responseSchema, event[unionMember].body); + delete dataObject[eventStreamMember]; + return { + [initialResponseMarker]: true, + ...dataObject, + }; + } + else if (unionMember in memberSchemas) { + const eventStreamSchema = memberSchemas[unionMember]; + return { + [unionMember]: await this.deserializer.read(eventStreamSchema, event[unionMember].body), + }; + } + else { + return { + $unknown: event, + }; + } + }); + const asyncIterator = asyncIterable[Symbol.asyncIterator](); + const firstEvent = await asyncIterator.next(); + if (firstEvent.done) { + return asyncIterable; + } + if (firstEvent.value?.[initialResponseMarker]) { + if (!responseSchema) { + throw new Error("@smithy::core/protocols - initial-response event encountered in event stream but no response schema given."); + } + for (const [key, value] of Object.entries(firstEvent.value)) { + initialResponseContainer[key] = value; + } + } + return { + async *[Symbol.asyncIterator]() { + if (!firstEvent?.value?.[initialResponseMarker]) { + yield firstEvent.value; + } + while (true) { + const { done, value } = await asyncIterator.next(); + if (done) { + break; + } + yield value; + } + }, + }; + } + writeEventBody(unionMember, unionSchema, event) { + const serializer = this.serializer; + let eventType = unionMember; + let explicitPayloadMember = null; + let explicitPayloadContentType; + const isKnownSchema = (() => { + const struct = unionSchema.getSchema(); + return struct[4].includes(unionMember); + })(); + const additionalHeaders = {}; + if (!isKnownSchema) { + const [type, value] = event[unionMember]; + eventType = type; + serializer.write(15, value); + } + else { + const eventSchema = unionSchema.getMemberSchema(unionMember); + if (eventSchema.isStructSchema()) { + for (const [memberName, memberSchema] of eventSchema.structIterator()) { + const { eventHeader, eventPayload } = memberSchema.getMergedTraits(); + if (eventPayload) { + explicitPayloadMember = memberName; + break; + } + else if (eventHeader) { + const value = event[unionMember][memberName]; + let type = "binary"; + if (memberSchema.isNumericSchema()) { + if ((-2) ** 31 <= value && value <= 2 ** 31 - 1) { + type = "integer"; + } + else { + type = "long"; + } + } + else if (memberSchema.isTimestampSchema()) { + type = "timestamp"; + } + else if (memberSchema.isStringSchema()) { + type = "string"; + } + else if (memberSchema.isBooleanSchema()) { + type = "boolean"; + } + if (value != null) { + additionalHeaders[memberName] = { + type, + value, + }; + delete event[unionMember][memberName]; + } + } + } + if (explicitPayloadMember !== null) { + const payloadSchema = eventSchema.getMemberSchema(explicitPayloadMember); + if (payloadSchema.isBlobSchema()) { + explicitPayloadContentType = "application/octet-stream"; + } + else if (payloadSchema.isStringSchema()) { + explicitPayloadContentType = "text/plain"; + } + serializer.write(payloadSchema, event[unionMember][explicitPayloadMember]); + } + else { + serializer.write(eventSchema, event[unionMember]); + } + } + else { + throw new Error("@smithy/core/event-streams - non-struct member not supported in event stream union."); + } + } + const messageSerialization = serializer.flush(); + const body = typeof messageSerialization === "string" + ? (this.serdeContext?.utf8Decoder ?? utilUtf8.fromUtf8)(messageSerialization) + : messageSerialization; + return { + body, + eventType, + explicitPayloadContentType, + additionalHeaders, + }; + } +} + +exports.EventStreamSerde = EventStreamSerde; + + +/***/ }) + +}; +; \ No newline at end of file diff --git a/dist/605.index.js b/dist/605.index.js new file mode 100644 index 00000000..a54c54e9 --- /dev/null +++ b/dist/605.index.js @@ -0,0 +1,234 @@ +"use strict"; +exports.id = 605; +exports.ids = [605]; +exports.modules = { + +/***/ 1509: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.checkUrl = void 0; +const property_provider_1 = __webpack_require__(1238); +const LOOPBACK_CIDR_IPv4 = "127.0.0.0/8"; +const LOOPBACK_CIDR_IPv6 = "::1/128"; +const ECS_CONTAINER_HOST = "169.254.170.2"; +const EKS_CONTAINER_HOST_IPv4 = "169.254.170.23"; +const EKS_CONTAINER_HOST_IPv6 = "[fd00:ec2::23]"; +const checkUrl = (url, logger) => { + if (url.protocol === "https:") { + return; + } + if (url.hostname === ECS_CONTAINER_HOST || + url.hostname === EKS_CONTAINER_HOST_IPv4 || + url.hostname === EKS_CONTAINER_HOST_IPv6) { + return; + } + if (url.hostname.includes("[")) { + if (url.hostname === "[::1]" || url.hostname === "[0000:0000:0000:0000:0000:0000:0000:0001]") { + return; + } + } + else { + if (url.hostname === "localhost") { + return; + } + const ipComponents = url.hostname.split("."); + const inRange = (component) => { + const num = parseInt(component, 10); + return 0 <= num && num <= 255; + }; + if (ipComponents[0] === "127" && + inRange(ipComponents[1]) && + inRange(ipComponents[2]) && + inRange(ipComponents[3]) && + ipComponents.length === 4) { + return; + } + } + throw new property_provider_1.CredentialsProviderError(`URL not accepted. It must either be HTTPS or match one of the following: + - loopback CIDR 127.0.0.0/8 or [::1/128] + - ECS container host 169.254.170.2 + - EKS container host 169.254.170.23 or [fd00:ec2::23]`, { logger }); +}; +exports.checkUrl = checkUrl; + + +/***/ }), + +/***/ 8712: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromHttp = void 0; +const tslib_1 = __webpack_require__(1860); +const client_1 = __webpack_require__(5152); +const node_http_handler_1 = __webpack_require__(1279); +const property_provider_1 = __webpack_require__(1238); +const promises_1 = tslib_1.__importDefault(__webpack_require__(1943)); +const checkUrl_1 = __webpack_require__(1509); +const requestHelpers_1 = __webpack_require__(8914); +const retry_wrapper_1 = __webpack_require__(1122); +const AWS_CONTAINER_CREDENTIALS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; +const DEFAULT_LINK_LOCAL_HOST = "http://169.254.170.2"; +const AWS_CONTAINER_CREDENTIALS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; +const AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE = "AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE"; +const AWS_CONTAINER_AUTHORIZATION_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; +const fromHttp = (options = {}) => { + options.logger?.debug("@aws-sdk/credential-provider-http - fromHttp"); + let host; + const relative = options.awsContainerCredentialsRelativeUri ?? process.env[AWS_CONTAINER_CREDENTIALS_RELATIVE_URI]; + const full = options.awsContainerCredentialsFullUri ?? process.env[AWS_CONTAINER_CREDENTIALS_FULL_URI]; + const token = options.awsContainerAuthorizationToken ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN]; + const tokenFile = options.awsContainerAuthorizationTokenFile ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE]; + const warn = options.logger?.constructor?.name === "NoOpLogger" || !options.logger?.warn + ? console.warn + : options.logger.warn.bind(options.logger); + if (relative && full) { + warn("@aws-sdk/credential-provider-http: " + + "you have set both awsContainerCredentialsRelativeUri and awsContainerCredentialsFullUri."); + warn("awsContainerCredentialsFullUri will take precedence."); + } + if (token && tokenFile) { + warn("@aws-sdk/credential-provider-http: " + + "you have set both awsContainerAuthorizationToken and awsContainerAuthorizationTokenFile."); + warn("awsContainerAuthorizationToken will take precedence."); + } + if (full) { + host = full; + } + else if (relative) { + host = `${DEFAULT_LINK_LOCAL_HOST}${relative}`; + } + else { + throw new property_provider_1.CredentialsProviderError(`No HTTP credential provider host provided. +Set AWS_CONTAINER_CREDENTIALS_FULL_URI or AWS_CONTAINER_CREDENTIALS_RELATIVE_URI.`, { logger: options.logger }); + } + const url = new URL(host); + (0, checkUrl_1.checkUrl)(url, options.logger); + const requestHandler = node_http_handler_1.NodeHttpHandler.create({ + requestTimeout: options.timeout ?? 1000, + connectionTimeout: options.timeout ?? 1000, + }); + return (0, retry_wrapper_1.retryWrapper)(async () => { + const request = (0, requestHelpers_1.createGetRequest)(url); + if (token) { + request.headers.Authorization = token; + } + else if (tokenFile) { + request.headers.Authorization = (await promises_1.default.readFile(tokenFile)).toString(); + } + try { + const result = await requestHandler.handle(request); + return (0, requestHelpers_1.getCredentials)(result.response).then((creds) => (0, client_1.setCredentialFeature)(creds, "CREDENTIALS_HTTP", "z")); + } + catch (e) { + throw new property_provider_1.CredentialsProviderError(String(e), { logger: options.logger }); + } + }, options.maxRetries ?? 3, options.timeout ?? 1000); +}; +exports.fromHttp = fromHttp; + + +/***/ }), + +/***/ 8914: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.createGetRequest = createGetRequest; +exports.getCredentials = getCredentials; +const property_provider_1 = __webpack_require__(1238); +const protocol_http_1 = __webpack_require__(2356); +const smithy_client_1 = __webpack_require__(1411); +const util_stream_1 = __webpack_require__(4252); +function createGetRequest(url) { + return new protocol_http_1.HttpRequest({ + protocol: url.protocol, + hostname: url.hostname, + port: Number(url.port), + path: url.pathname, + query: Array.from(url.searchParams.entries()).reduce((acc, [k, v]) => { + acc[k] = v; + return acc; + }, {}), + fragment: url.hash, + }); +} +async function getCredentials(response, logger) { + const stream = (0, util_stream_1.sdkStreamMixin)(response.body); + const str = await stream.transformToString(); + if (response.statusCode === 200) { + const parsed = JSON.parse(str); + if (typeof parsed.AccessKeyId !== "string" || + typeof parsed.SecretAccessKey !== "string" || + typeof parsed.Token !== "string" || + typeof parsed.Expiration !== "string") { + throw new property_provider_1.CredentialsProviderError("HTTP credential provider response not of the required format, an object matching: " + + "{ AccessKeyId: string, SecretAccessKey: string, Token: string, Expiration: string(rfc3339) }", { logger }); + } + return { + accessKeyId: parsed.AccessKeyId, + secretAccessKey: parsed.SecretAccessKey, + sessionToken: parsed.Token, + expiration: (0, smithy_client_1.parseRfc3339DateTime)(parsed.Expiration), + }; + } + if (response.statusCode >= 400 && response.statusCode < 500) { + let parsedBody = {}; + try { + parsedBody = JSON.parse(str); + } + catch (e) { } + throw Object.assign(new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }), { + Code: parsedBody.Code, + Message: parsedBody.Message, + }); + } + throw new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }); +} + + +/***/ }), + +/***/ 1122: +/***/ ((__unused_webpack_module, exports) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.retryWrapper = void 0; +const retryWrapper = (toRetry, maxRetries, delayMs) => { + return async () => { + for (let i = 0; i < maxRetries; ++i) { + try { + return await toRetry(); + } + catch (e) { + await new Promise((resolve) => setTimeout(resolve, delayMs)); + } + } + return await toRetry(); + }; +}; +exports.retryWrapper = retryWrapper; + + +/***/ }), + +/***/ 8605: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + +var __webpack_unused_export__; + +__webpack_unused_export__ = ({ value: true }); +exports.fromHttp = void 0; +var fromHttp_1 = __webpack_require__(8712); +Object.defineProperty(exports, "fromHttp", ({ enumerable: true, get: function () { return fromHttp_1.fromHttp; } })); + + +/***/ }) + +}; +; \ No newline at end of file diff --git a/dist/869.index.js b/dist/869.index.js new file mode 100644 index 00000000..9dc6e6de --- /dev/null +++ b/dist/869.index.js @@ -0,0 +1,225 @@ +"use strict"; +exports.id = 869; +exports.ids = [869]; +exports.modules = { + +/***/ 5869: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + + +var sharedIniFileLoader = __webpack_require__(4964); +var propertyProvider = __webpack_require__(1238); +var client = __webpack_require__(5152); + +const resolveCredentialSource = (credentialSource, profileName, logger) => { + const sourceProvidersMap = { + EcsContainer: async (options) => { + const { fromHttp } = await __webpack_require__.e(/* import() */ 605).then(__webpack_require__.bind(__webpack_require__, 8605)); + const { fromContainerMetadata } = await __webpack_require__.e(/* import() */ 566).then(__webpack_require__.t.bind(__webpack_require__, 566, 19)); + logger?.debug("@aws-sdk/credential-provider-ini - credential_source is EcsContainer"); + return async () => propertyProvider.chain(fromHttp(options ?? {}), fromContainerMetadata(options))().then(setNamedProvider); + }, + Ec2InstanceMetadata: async (options) => { + logger?.debug("@aws-sdk/credential-provider-ini - credential_source is Ec2InstanceMetadata"); + const { fromInstanceMetadata } = await __webpack_require__.e(/* import() */ 566).then(__webpack_require__.t.bind(__webpack_require__, 566, 19)); + return async () => fromInstanceMetadata(options)().then(setNamedProvider); + }, + Environment: async (options) => { + logger?.debug("@aws-sdk/credential-provider-ini - credential_source is Environment"); + const { fromEnv } = await Promise.resolve(/* import() */).then(__webpack_require__.t.bind(__webpack_require__, 5606, 19)); + return async () => fromEnv(options)().then(setNamedProvider); + }, + }; + if (credentialSource in sourceProvidersMap) { + return sourceProvidersMap[credentialSource]; + } + else { + throw new propertyProvider.CredentialsProviderError(`Unsupported credential source in profile ${profileName}. Got ${credentialSource}, ` + + `expected EcsContainer or Ec2InstanceMetadata or Environment.`, { logger }); + } +}; +const setNamedProvider = (creds) => client.setCredentialFeature(creds, "CREDENTIALS_PROFILE_NAMED_PROVIDER", "p"); + +const isAssumeRoleProfile = (arg, { profile = "default", logger } = {}) => { + return (Boolean(arg) && + typeof arg === "object" && + typeof arg.role_arn === "string" && + ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1 && + ["undefined", "string"].indexOf(typeof arg.external_id) > -1 && + ["undefined", "string"].indexOf(typeof arg.mfa_serial) > -1 && + (isAssumeRoleWithSourceProfile(arg, { profile, logger }) || isCredentialSourceProfile(arg, { profile, logger }))); +}; +const isAssumeRoleWithSourceProfile = (arg, { profile, logger }) => { + const withSourceProfile = typeof arg.source_profile === "string" && typeof arg.credential_source === "undefined"; + if (withSourceProfile) { + logger?.debug?.(` ${profile} isAssumeRoleWithSourceProfile source_profile=${arg.source_profile}`); + } + return withSourceProfile; +}; +const isCredentialSourceProfile = (arg, { profile, logger }) => { + const withProviderProfile = typeof arg.credential_source === "string" && typeof arg.source_profile === "undefined"; + if (withProviderProfile) { + logger?.debug?.(` ${profile} isCredentialSourceProfile credential_source=${arg.credential_source}`); + } + return withProviderProfile; +}; +const resolveAssumeRoleCredentials = async (profileName, profiles, options, visitedProfiles = {}, resolveProfileData) => { + options.logger?.debug("@aws-sdk/credential-provider-ini - resolveAssumeRoleCredentials (STS)"); + const profileData = profiles[profileName]; + const { source_profile, region } = profileData; + if (!options.roleAssumer) { + const { getDefaultRoleAssumer } = await __webpack_require__.e(/* import() */ 136).then(__webpack_require__.t.bind(__webpack_require__, 1136, 23)); + options.roleAssumer = getDefaultRoleAssumer({ + ...options.clientConfig, + credentialProviderLogger: options.logger, + parentClientConfig: { + ...options?.parentClientConfig, + region: region ?? options?.parentClientConfig?.region, + }, + }, options.clientPlugins); + } + if (source_profile && source_profile in visitedProfiles) { + throw new propertyProvider.CredentialsProviderError(`Detected a cycle attempting to resolve credentials for profile` + + ` ${sharedIniFileLoader.getProfileName(options)}. Profiles visited: ` + + Object.keys(visitedProfiles).join(", "), { logger: options.logger }); + } + options.logger?.debug(`@aws-sdk/credential-provider-ini - finding credential resolver using ${source_profile ? `source_profile=[${source_profile}]` : `profile=[${profileName}]`}`); + const sourceCredsProvider = source_profile + ? resolveProfileData(source_profile, profiles, options, { + ...visitedProfiles, + [source_profile]: true, + }, isCredentialSourceWithoutRoleArn(profiles[source_profile] ?? {})) + : (await resolveCredentialSource(profileData.credential_source, profileName, options.logger)(options))(); + if (isCredentialSourceWithoutRoleArn(profileData)) { + return sourceCredsProvider.then((creds) => client.setCredentialFeature(creds, "CREDENTIALS_PROFILE_SOURCE_PROFILE", "o")); + } + else { + const params = { + RoleArn: profileData.role_arn, + RoleSessionName: profileData.role_session_name || `aws-sdk-js-${Date.now()}`, + ExternalId: profileData.external_id, + DurationSeconds: parseInt(profileData.duration_seconds || "3600", 10), + }; + const { mfa_serial } = profileData; + if (mfa_serial) { + if (!options.mfaCodeProvider) { + throw new propertyProvider.CredentialsProviderError(`Profile ${profileName} requires multi-factor authentication, but no MFA code callback was provided.`, { logger: options.logger, tryNextLink: false }); + } + params.SerialNumber = mfa_serial; + params.TokenCode = await options.mfaCodeProvider(mfa_serial); + } + const sourceCreds = await sourceCredsProvider; + return options.roleAssumer(sourceCreds, params).then((creds) => client.setCredentialFeature(creds, "CREDENTIALS_PROFILE_SOURCE_PROFILE", "o")); + } +}; +const isCredentialSourceWithoutRoleArn = (section) => { + return !section.role_arn && !!section.credential_source; +}; + +const isProcessProfile = (arg) => Boolean(arg) && typeof arg === "object" && typeof arg.credential_process === "string"; +const resolveProcessCredentials = async (options, profile) => __webpack_require__.e(/* import() */ 360).then(__webpack_require__.t.bind(__webpack_require__, 5360, 19)).then(({ fromProcess }) => fromProcess({ + ...options, + profile, +})().then((creds) => client.setCredentialFeature(creds, "CREDENTIALS_PROFILE_PROCESS", "v"))); + +const resolveSsoCredentials = async (profile, profileData, options = {}) => { + const { fromSSO } = await __webpack_require__.e(/* import() */ 998).then(__webpack_require__.t.bind(__webpack_require__, 998, 19)); + return fromSSO({ + profile, + logger: options.logger, + parentClientConfig: options.parentClientConfig, + clientConfig: options.clientConfig, + })().then((creds) => { + if (profileData.sso_session) { + return client.setCredentialFeature(creds, "CREDENTIALS_PROFILE_SSO", "r"); + } + else { + return client.setCredentialFeature(creds, "CREDENTIALS_PROFILE_SSO_LEGACY", "t"); + } + }); +}; +const isSsoProfile = (arg) => arg && + (typeof arg.sso_start_url === "string" || + typeof arg.sso_account_id === "string" || + typeof arg.sso_session === "string" || + typeof arg.sso_region === "string" || + typeof arg.sso_role_name === "string"); + +const isStaticCredsProfile = (arg) => Boolean(arg) && + typeof arg === "object" && + typeof arg.aws_access_key_id === "string" && + typeof arg.aws_secret_access_key === "string" && + ["undefined", "string"].indexOf(typeof arg.aws_session_token) > -1 && + ["undefined", "string"].indexOf(typeof arg.aws_account_id) > -1; +const resolveStaticCredentials = async (profile, options) => { + options?.logger?.debug("@aws-sdk/credential-provider-ini - resolveStaticCredentials"); + const credentials = { + accessKeyId: profile.aws_access_key_id, + secretAccessKey: profile.aws_secret_access_key, + sessionToken: profile.aws_session_token, + ...(profile.aws_credential_scope && { credentialScope: profile.aws_credential_scope }), + ...(profile.aws_account_id && { accountId: profile.aws_account_id }), + }; + return client.setCredentialFeature(credentials, "CREDENTIALS_PROFILE", "n"); +}; + +const isWebIdentityProfile = (arg) => Boolean(arg) && + typeof arg === "object" && + typeof arg.web_identity_token_file === "string" && + typeof arg.role_arn === "string" && + ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1; +const resolveWebIdentityCredentials = async (profile, options) => Promise.all(/* import() */[__webpack_require__.e(136), __webpack_require__.e(956)]).then(__webpack_require__.t.bind(__webpack_require__, 9956, 23)).then(({ fromTokenFile }) => fromTokenFile({ + webIdentityTokenFile: profile.web_identity_token_file, + roleArn: profile.role_arn, + roleSessionName: profile.role_session_name, + roleAssumerWithWebIdentity: options.roleAssumerWithWebIdentity, + logger: options.logger, + parentClientConfig: options.parentClientConfig, +})().then((creds) => client.setCredentialFeature(creds, "CREDENTIALS_PROFILE_STS_WEB_ID_TOKEN", "q"))); + +const resolveProfileData = async (profileName, profiles, options, visitedProfiles = {}, isAssumeRoleRecursiveCall = false) => { + const data = profiles[profileName]; + if (Object.keys(visitedProfiles).length > 0 && isStaticCredsProfile(data)) { + return resolveStaticCredentials(data, options); + } + if (isAssumeRoleRecursiveCall || isAssumeRoleProfile(data, { profile: profileName, logger: options.logger })) { + return resolveAssumeRoleCredentials(profileName, profiles, options, visitedProfiles, resolveProfileData); + } + if (isStaticCredsProfile(data)) { + return resolveStaticCredentials(data, options); + } + if (isWebIdentityProfile(data)) { + return resolveWebIdentityCredentials(data, options); + } + if (isProcessProfile(data)) { + return resolveProcessCredentials(options, profileName); + } + if (isSsoProfile(data)) { + return await resolveSsoCredentials(profileName, data, options); + } + throw new propertyProvider.CredentialsProviderError(`Could not resolve credentials using profile: [${profileName}] in configuration/credentials file(s).`, { logger: options.logger }); +}; + +const fromIni = (_init = {}) => async ({ callerClientConfig } = {}) => { + const init = { + ..._init, + parentClientConfig: { + ...callerClientConfig, + ..._init.parentClientConfig, + }, + }; + init.logger?.debug("@aws-sdk/credential-provider-ini - fromIni"); + const profiles = await sharedIniFileLoader.parseKnownFiles(init); + return resolveProfileData(sharedIniFileLoader.getProfileName({ + profile: _init.profile ?? callerClientConfig?.profile, + }), profiles, init); +}; + +exports.fromIni = fromIni; + + +/***/ }) + +}; +; \ No newline at end of file diff --git a/dist/956.index.js b/dist/956.index.js new file mode 100644 index 00000000..35bfc9e7 --- /dev/null +++ b/dist/956.index.js @@ -0,0 +1,143 @@ +"use strict"; +exports.id = 956; +exports.ids = [956]; +exports.modules = { + +/***/ 8079: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromTokenFile = void 0; +const client_1 = __webpack_require__(5152); +const property_provider_1 = __webpack_require__(1238); +const shared_ini_file_loader_1 = __webpack_require__(4964); +const fs_1 = __webpack_require__(9896); +const fromWebToken_1 = __webpack_require__(4453); +const ENV_TOKEN_FILE = "AWS_WEB_IDENTITY_TOKEN_FILE"; +const ENV_ROLE_ARN = "AWS_ROLE_ARN"; +const ENV_ROLE_SESSION_NAME = "AWS_ROLE_SESSION_NAME"; +const fromTokenFile = (init = {}) => async (awsIdentityProperties) => { + init.logger?.debug("@aws-sdk/credential-provider-web-identity - fromTokenFile"); + const webIdentityTokenFile = init?.webIdentityTokenFile ?? process.env[ENV_TOKEN_FILE]; + const roleArn = init?.roleArn ?? process.env[ENV_ROLE_ARN]; + const roleSessionName = init?.roleSessionName ?? process.env[ENV_ROLE_SESSION_NAME]; + if (!webIdentityTokenFile || !roleArn) { + throw new property_provider_1.CredentialsProviderError("Web identity configuration not specified", { + logger: init.logger, + }); + } + const credentials = await (0, fromWebToken_1.fromWebToken)({ + ...init, + webIdentityToken: shared_ini_file_loader_1.externalDataInterceptor?.getTokenRecord?.()[webIdentityTokenFile] ?? + (0, fs_1.readFileSync)(webIdentityTokenFile, { encoding: "ascii" }), + roleArn, + roleSessionName, + })(awsIdentityProperties); + if (webIdentityTokenFile === process.env[ENV_TOKEN_FILE]) { + (0, client_1.setCredentialFeature)(credentials, "CREDENTIALS_ENV_VARS_STS_WEB_ID_TOKEN", "h"); + } + return credentials; +}; +exports.fromTokenFile = fromTokenFile; + + +/***/ }), + +/***/ 4453: +/***/ (function(__unused_webpack_module, exports, __webpack_require__) { + + +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; + } + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || (function () { + var ownKeys = function(o) { + ownKeys = Object.getOwnPropertyNames || function (o) { + var ar = []; + for (var k in o) if (Object.prototype.hasOwnProperty.call(o, k)) ar[ar.length] = k; + return ar; + }; + return ownKeys(o); + }; + return function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k = ownKeys(mod), i = 0; i < k.length; i++) if (k[i] !== "default") __createBinding(result, mod, k[i]); + __setModuleDefault(result, mod); + return result; + }; +})(); +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromWebToken = void 0; +const fromWebToken = (init) => async (awsIdentityProperties) => { + init.logger?.debug("@aws-sdk/credential-provider-web-identity - fromWebToken"); + const { roleArn, roleSessionName, webIdentityToken, providerId, policyArns, policy, durationSeconds } = init; + let { roleAssumerWithWebIdentity } = init; + if (!roleAssumerWithWebIdentity) { + const { getDefaultRoleAssumerWithWebIdentity } = await Promise.resolve().then(() => __importStar(__webpack_require__(1136))); + roleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity({ + ...init.clientConfig, + credentialProviderLogger: init.logger, + parentClientConfig: { + ...awsIdentityProperties?.callerClientConfig, + ...init.parentClientConfig, + }, + }, init.clientPlugins); + } + return roleAssumerWithWebIdentity({ + RoleArn: roleArn, + RoleSessionName: roleSessionName ?? `aws-sdk-js-session-${Date.now()}`, + WebIdentityToken: webIdentityToken, + ProviderId: providerId, + PolicyArns: policyArns, + Policy: policy, + DurationSeconds: durationSeconds, + }); +}; +exports.fromWebToken = fromWebToken; + + +/***/ }), + +/***/ 9956: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + + +var fromTokenFile = __webpack_require__(8079); +var fromWebToken = __webpack_require__(4453); + + + +Object.keys(fromTokenFile).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return fromTokenFile[k]; } + }); +}); +Object.keys(fromWebToken).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return fromWebToken[k]; } + }); +}); + + +/***/ }) + +}; +; \ No newline at end of file diff --git a/dist/998.index.js b/dist/998.index.js new file mode 100644 index 00000000..9fd7bdb1 --- /dev/null +++ b/dist/998.index.js @@ -0,0 +1,1446 @@ +"use strict"; +exports.id = 998; +exports.ids = [998]; +exports.modules = { + +/***/ 2041: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpAuthSchemeConfig = exports.defaultSSOHttpAuthSchemeProvider = exports.defaultSSOHttpAuthSchemeParametersProvider = void 0; +const core_1 = __webpack_require__(8704); +const util_middleware_1 = __webpack_require__(6324); +const defaultSSOHttpAuthSchemeParametersProvider = async (config, context, input) => { + return { + operation: (0, util_middleware_1.getSmithyContext)(context).operation, + region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) || + (() => { + throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); + })(), + }; +}; +exports.defaultSSOHttpAuthSchemeParametersProvider = defaultSSOHttpAuthSchemeParametersProvider; +function createAwsAuthSigv4HttpAuthOption(authParameters) { + return { + schemeId: "aws.auth#sigv4", + signingProperties: { + name: "awsssoportal", + region: authParameters.region, + }, + propertiesExtractor: (config, context) => ({ + signingProperties: { + config, + context, + }, + }), + }; +} +function createSmithyApiNoAuthHttpAuthOption(authParameters) { + return { + schemeId: "smithy.api#noAuth", + }; +} +const defaultSSOHttpAuthSchemeProvider = (authParameters) => { + const options = []; + switch (authParameters.operation) { + case "GetRoleCredentials": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "ListAccountRoles": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "ListAccounts": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "Logout": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + default: { + options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + } + } + return options; +}; +exports.defaultSSOHttpAuthSchemeProvider = defaultSSOHttpAuthSchemeProvider; +const resolveHttpAuthSchemeConfig = (config) => { + const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); + return Object.assign(config_0, { + authSchemePreference: (0, util_middleware_1.normalizeProvider)(config.authSchemePreference ?? []), + }); +}; +exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; + + +/***/ }), + +/***/ 3903: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultEndpointResolver = void 0; +const util_endpoints_1 = __webpack_require__(3068); +const util_endpoints_2 = __webpack_require__(9674); +const ruleset_1 = __webpack_require__(1308); +const cache = new util_endpoints_2.EndpointCache({ + size: 50, + params: ["Endpoint", "Region", "UseDualStack", "UseFIPS"], +}); +const defaultEndpointResolver = (endpointParams, context = {}) => { + return cache.get(endpointParams, () => (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams: endpointParams, + logger: context.logger, + })); +}; +exports.defaultEndpointResolver = defaultEndpointResolver; +util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; + + +/***/ }), + +/***/ 1308: +/***/ ((__unused_webpack_module, exports) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ruleSet = void 0; +const u = "required", v = "fn", w = "argv", x = "ref"; +const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = "getAttr", i = { [u]: false, "type": "string" }, j = { [u]: true, "default": false, "type": "boolean" }, k = { [x]: "Endpoint" }, l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }, m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }, n = {}, o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }, p = { [x]: g }, q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }, r = [l], s = [m], t = [{ [x]: "Region" }]; +const _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://portal.sso.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; +exports.ruleSet = _data; + + +/***/ }), + +/***/ 2054: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + + +var middlewareHostHeader = __webpack_require__(2590); +var middlewareLogger = __webpack_require__(5242); +var middlewareRecursionDetection = __webpack_require__(1568); +var middlewareUserAgent = __webpack_require__(2959); +var configResolver = __webpack_require__(9316); +var core = __webpack_require__(402); +var middlewareContentLength = __webpack_require__(7212); +var middlewareEndpoint = __webpack_require__(99); +var middlewareRetry = __webpack_require__(9618); +var smithyClient = __webpack_require__(1411); +var httpAuthSchemeProvider = __webpack_require__(2041); +var runtimeConfig = __webpack_require__(2696); +var regionConfigResolver = __webpack_require__(6463); +var protocolHttp = __webpack_require__(2356); +var middlewareSerde = __webpack_require__(3255); +var core$1 = __webpack_require__(8704); + +const resolveClientEndpointParameters = (options) => { + return Object.assign(options, { + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + defaultSigningName: "awsssoportal", + }); +}; +const commonParams = { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, +}; + +const getHttpAuthExtensionConfiguration = (runtimeConfig) => { + const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; + let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; + let _credentials = runtimeConfig.credentials; + return { + setHttpAuthScheme(httpAuthScheme) { + const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); + if (index === -1) { + _httpAuthSchemes.push(httpAuthScheme); + } + else { + _httpAuthSchemes.splice(index, 1, httpAuthScheme); + } + }, + httpAuthSchemes() { + return _httpAuthSchemes; + }, + setHttpAuthSchemeProvider(httpAuthSchemeProvider) { + _httpAuthSchemeProvider = httpAuthSchemeProvider; + }, + httpAuthSchemeProvider() { + return _httpAuthSchemeProvider; + }, + setCredentials(credentials) { + _credentials = credentials; + }, + credentials() { + return _credentials; + }, + }; +}; +const resolveHttpAuthRuntimeConfig = (config) => { + return { + httpAuthSchemes: config.httpAuthSchemes(), + httpAuthSchemeProvider: config.httpAuthSchemeProvider(), + credentials: config.credentials(), + }; +}; + +const resolveRuntimeExtensions = (runtimeConfig, extensions) => { + const extensionConfiguration = Object.assign(regionConfigResolver.getAwsRegionExtensionConfiguration(runtimeConfig), smithyClient.getDefaultExtensionConfiguration(runtimeConfig), protocolHttp.getHttpHandlerExtensionConfiguration(runtimeConfig), getHttpAuthExtensionConfiguration(runtimeConfig)); + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return Object.assign(runtimeConfig, regionConfigResolver.resolveAwsRegionExtensionConfiguration(extensionConfiguration), smithyClient.resolveDefaultRuntimeConfig(extensionConfiguration), protocolHttp.resolveHttpHandlerRuntimeConfig(extensionConfiguration), resolveHttpAuthRuntimeConfig(extensionConfiguration)); +}; + +class SSOClient extends smithyClient.Client { + config; + constructor(...[configuration]) { + const _config_0 = runtimeConfig.getRuntimeConfig(configuration || {}); + super(_config_0); + this.initConfig = _config_0; + const _config_1 = resolveClientEndpointParameters(_config_0); + const _config_2 = middlewareUserAgent.resolveUserAgentConfig(_config_1); + const _config_3 = middlewareRetry.resolveRetryConfig(_config_2); + const _config_4 = configResolver.resolveRegionConfig(_config_3); + const _config_5 = middlewareHostHeader.resolveHostHeaderConfig(_config_4); + const _config_6 = middlewareEndpoint.resolveEndpointConfig(_config_5); + const _config_7 = httpAuthSchemeProvider.resolveHttpAuthSchemeConfig(_config_6); + const _config_8 = resolveRuntimeExtensions(_config_7, configuration?.extensions || []); + this.config = _config_8; + this.middlewareStack.use(middlewareUserAgent.getUserAgentPlugin(this.config)); + this.middlewareStack.use(middlewareRetry.getRetryPlugin(this.config)); + this.middlewareStack.use(middlewareContentLength.getContentLengthPlugin(this.config)); + this.middlewareStack.use(middlewareHostHeader.getHostHeaderPlugin(this.config)); + this.middlewareStack.use(middlewareLogger.getLoggerPlugin(this.config)); + this.middlewareStack.use(middlewareRecursionDetection.getRecursionDetectionPlugin(this.config)); + this.middlewareStack.use(core.getHttpAuthSchemeEndpointRuleSetPlugin(this.config, { + httpAuthSchemeParametersProvider: httpAuthSchemeProvider.defaultSSOHttpAuthSchemeParametersProvider, + identityProviderConfigProvider: async (config) => new core.DefaultIdentityProviderConfig({ + "aws.auth#sigv4": config.credentials, + }), + })); + this.middlewareStack.use(core.getHttpSigningPlugin(this.config)); + } + destroy() { + super.destroy(); + } +} + +class SSOServiceException extends smithyClient.ServiceException { + constructor(options) { + super(options); + Object.setPrototypeOf(this, SSOServiceException.prototype); + } +} + +class InvalidRequestException extends SSOServiceException { + name = "InvalidRequestException"; + $fault = "client"; + constructor(opts) { + super({ + name: "InvalidRequestException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, InvalidRequestException.prototype); + } +} +class ResourceNotFoundException extends SSOServiceException { + name = "ResourceNotFoundException"; + $fault = "client"; + constructor(opts) { + super({ + name: "ResourceNotFoundException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ResourceNotFoundException.prototype); + } +} +class TooManyRequestsException extends SSOServiceException { + name = "TooManyRequestsException"; + $fault = "client"; + constructor(opts) { + super({ + name: "TooManyRequestsException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, TooManyRequestsException.prototype); + } +} +class UnauthorizedException extends SSOServiceException { + name = "UnauthorizedException"; + $fault = "client"; + constructor(opts) { + super({ + name: "UnauthorizedException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, UnauthorizedException.prototype); + } +} +const GetRoleCredentialsRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.accessToken && { accessToken: smithyClient.SENSITIVE_STRING }), +}); +const RoleCredentialsFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.secretAccessKey && { secretAccessKey: smithyClient.SENSITIVE_STRING }), + ...(obj.sessionToken && { sessionToken: smithyClient.SENSITIVE_STRING }), +}); +const GetRoleCredentialsResponseFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.roleCredentials && { roleCredentials: RoleCredentialsFilterSensitiveLog(obj.roleCredentials) }), +}); +const ListAccountRolesRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.accessToken && { accessToken: smithyClient.SENSITIVE_STRING }), +}); +const ListAccountsRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.accessToken && { accessToken: smithyClient.SENSITIVE_STRING }), +}); +const LogoutRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.accessToken && { accessToken: smithyClient.SENSITIVE_STRING }), +}); + +const se_GetRoleCredentialsCommand = async (input, context) => { + const b = core.requestBuilder(input, context); + const headers = smithyClient.map({}, smithyClient.isSerializableHeaderValue, { + [_xasbt]: input[_aT], + }); + b.bp("/federation/credentials"); + const query = smithyClient.map({ + [_rn]: [, smithyClient.expectNonNull(input[_rN], `roleName`)], + [_ai]: [, smithyClient.expectNonNull(input[_aI], `accountId`)], + }); + let body; + b.m("GET").h(headers).q(query).b(body); + return b.build(); +}; +const se_ListAccountRolesCommand = async (input, context) => { + const b = core.requestBuilder(input, context); + const headers = smithyClient.map({}, smithyClient.isSerializableHeaderValue, { + [_xasbt]: input[_aT], + }); + b.bp("/assignment/roles"); + const query = smithyClient.map({ + [_nt]: [, input[_nT]], + [_mr]: [() => input.maxResults !== void 0, () => input[_mR].toString()], + [_ai]: [, smithyClient.expectNonNull(input[_aI], `accountId`)], + }); + let body; + b.m("GET").h(headers).q(query).b(body); + return b.build(); +}; +const se_ListAccountsCommand = async (input, context) => { + const b = core.requestBuilder(input, context); + const headers = smithyClient.map({}, smithyClient.isSerializableHeaderValue, { + [_xasbt]: input[_aT], + }); + b.bp("/assignment/accounts"); + const query = smithyClient.map({ + [_nt]: [, input[_nT]], + [_mr]: [() => input.maxResults !== void 0, () => input[_mR].toString()], + }); + let body; + b.m("GET").h(headers).q(query).b(body); + return b.build(); +}; +const se_LogoutCommand = async (input, context) => { + const b = core.requestBuilder(input, context); + const headers = smithyClient.map({}, smithyClient.isSerializableHeaderValue, { + [_xasbt]: input[_aT], + }); + b.bp("/logout"); + let body; + b.m("POST").h(headers).b(body); + return b.build(); +}; +const de_GetRoleCredentialsCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = smithyClient.map({ + $metadata: deserializeMetadata(output), + }); + const data = smithyClient.expectNonNull(smithyClient.expectObject(await core$1.parseJsonBody(output.body, context)), "body"); + const doc = smithyClient.take(data, { + roleCredentials: smithyClient._json, + }); + Object.assign(contents, doc); + return contents; +}; +const de_ListAccountRolesCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = smithyClient.map({ + $metadata: deserializeMetadata(output), + }); + const data = smithyClient.expectNonNull(smithyClient.expectObject(await core$1.parseJsonBody(output.body, context)), "body"); + const doc = smithyClient.take(data, { + nextToken: smithyClient.expectString, + roleList: smithyClient._json, + }); + Object.assign(contents, doc); + return contents; +}; +const de_ListAccountsCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = smithyClient.map({ + $metadata: deserializeMetadata(output), + }); + const data = smithyClient.expectNonNull(smithyClient.expectObject(await core$1.parseJsonBody(output.body, context)), "body"); + const doc = smithyClient.take(data, { + accountList: smithyClient._json, + nextToken: smithyClient.expectString, + }); + Object.assign(contents, doc); + return contents; +}; +const de_LogoutCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = smithyClient.map({ + $metadata: deserializeMetadata(output), + }); + await smithyClient.collectBody(output.body, context); + return contents; +}; +const de_CommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await core$1.parseJsonErrorBody(output.body, context), + }; + const errorCode = core$1.loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidRequestException": + case "com.amazonaws.sso#InvalidRequestException": + throw await de_InvalidRequestExceptionRes(parsedOutput); + case "ResourceNotFoundException": + case "com.amazonaws.sso#ResourceNotFoundException": + throw await de_ResourceNotFoundExceptionRes(parsedOutput); + case "TooManyRequestsException": + case "com.amazonaws.sso#TooManyRequestsException": + throw await de_TooManyRequestsExceptionRes(parsedOutput); + case "UnauthorizedException": + case "com.amazonaws.sso#UnauthorizedException": + throw await de_UnauthorizedExceptionRes(parsedOutput); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const throwDefaultError = smithyClient.withBaseException(SSOServiceException); +const de_InvalidRequestExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + message: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new InvalidRequestException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const de_ResourceNotFoundExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + message: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new ResourceNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const de_TooManyRequestsExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + message: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new TooManyRequestsException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const de_UnauthorizedExceptionRes = async (parsedOutput, context) => { + const contents = smithyClient.map({}); + const data = parsedOutput.body; + const doc = smithyClient.take(data, { + message: smithyClient.expectString, + }); + Object.assign(contents, doc); + const exception = new UnauthorizedException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return smithyClient.decorateServiceException(exception, parsedOutput.body); +}; +const deserializeMetadata = (output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"], +}); +const _aI = "accountId"; +const _aT = "accessToken"; +const _ai = "account_id"; +const _mR = "maxResults"; +const _mr = "max_result"; +const _nT = "nextToken"; +const _nt = "next_token"; +const _rN = "roleName"; +const _rn = "role_name"; +const _xasbt = "x-amz-sso_bearer_token"; + +class GetRoleCredentialsCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("SWBPortalService", "GetRoleCredentials", {}) + .n("SSOClient", "GetRoleCredentialsCommand") + .f(GetRoleCredentialsRequestFilterSensitiveLog, GetRoleCredentialsResponseFilterSensitiveLog) + .ser(se_GetRoleCredentialsCommand) + .de(de_GetRoleCredentialsCommand) + .build() { +} + +class ListAccountRolesCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("SWBPortalService", "ListAccountRoles", {}) + .n("SSOClient", "ListAccountRolesCommand") + .f(ListAccountRolesRequestFilterSensitiveLog, void 0) + .ser(se_ListAccountRolesCommand) + .de(de_ListAccountRolesCommand) + .build() { +} + +class ListAccountsCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("SWBPortalService", "ListAccounts", {}) + .n("SSOClient", "ListAccountsCommand") + .f(ListAccountsRequestFilterSensitiveLog, void 0) + .ser(se_ListAccountsCommand) + .de(de_ListAccountsCommand) + .build() { +} + +class LogoutCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("SWBPortalService", "Logout", {}) + .n("SSOClient", "LogoutCommand") + .f(LogoutRequestFilterSensitiveLog, void 0) + .ser(se_LogoutCommand) + .de(de_LogoutCommand) + .build() { +} + +const commands = { + GetRoleCredentialsCommand, + ListAccountRolesCommand, + ListAccountsCommand, + LogoutCommand, +}; +class SSO extends SSOClient { +} +smithyClient.createAggregatedClient(commands, SSO); + +const paginateListAccountRoles = core.createPaginator(SSOClient, ListAccountRolesCommand, "nextToken", "nextToken", "maxResults"); + +const paginateListAccounts = core.createPaginator(SSOClient, ListAccountsCommand, "nextToken", "nextToken", "maxResults"); + +Object.defineProperty(exports, "$Command", ({ + enumerable: true, + get: function () { return smithyClient.Command; } +})); +Object.defineProperty(exports, "__Client", ({ + enumerable: true, + get: function () { return smithyClient.Client; } +})); +exports.GetRoleCredentialsCommand = GetRoleCredentialsCommand; +exports.GetRoleCredentialsRequestFilterSensitiveLog = GetRoleCredentialsRequestFilterSensitiveLog; +exports.GetRoleCredentialsResponseFilterSensitiveLog = GetRoleCredentialsResponseFilterSensitiveLog; +exports.InvalidRequestException = InvalidRequestException; +exports.ListAccountRolesCommand = ListAccountRolesCommand; +exports.ListAccountRolesRequestFilterSensitiveLog = ListAccountRolesRequestFilterSensitiveLog; +exports.ListAccountsCommand = ListAccountsCommand; +exports.ListAccountsRequestFilterSensitiveLog = ListAccountsRequestFilterSensitiveLog; +exports.LogoutCommand = LogoutCommand; +exports.LogoutRequestFilterSensitiveLog = LogoutRequestFilterSensitiveLog; +exports.ResourceNotFoundException = ResourceNotFoundException; +exports.RoleCredentialsFilterSensitiveLog = RoleCredentialsFilterSensitiveLog; +exports.SSO = SSO; +exports.SSOClient = SSOClient; +exports.SSOServiceException = SSOServiceException; +exports.TooManyRequestsException = TooManyRequestsException; +exports.UnauthorizedException = UnauthorizedException; +exports.paginateListAccountRoles = paginateListAccountRoles; +exports.paginateListAccounts = paginateListAccounts; + + +/***/ }), + +/***/ 2696: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const tslib_1 = __webpack_require__(1860); +const package_json_1 = tslib_1.__importDefault(__webpack_require__(5188)); +const core_1 = __webpack_require__(8704); +const util_user_agent_node_1 = __webpack_require__(1656); +const config_resolver_1 = __webpack_require__(9316); +const hash_node_1 = __webpack_require__(5092); +const middleware_retry_1 = __webpack_require__(9618); +const node_config_provider_1 = __webpack_require__(5704); +const node_http_handler_1 = __webpack_require__(1279); +const util_body_length_node_1 = __webpack_require__(3638); +const util_retry_1 = __webpack_require__(5518); +const runtimeConfig_shared_1 = __webpack_require__(8073); +const smithy_client_1 = __webpack_require__(1411); +const util_defaults_mode_node_1 = __webpack_require__(5435); +const smithy_client_2 = __webpack_require__(1411); +const getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + (0, core_1.emitWarningIfUnsupportedVersion)(process.version); + const loaderConfig = { + profile: config?.profile, + logger: clientSharedValues.logger, + }; + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + authSchemePreference: config?.authSchemePreference ?? (0, node_config_provider_1.loadConfig)(core_1.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, loaderConfig), + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? + (0, util_user_agent_node_1.createDefaultUserAgentProvider)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS, config), + region: config?.region ?? + (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, { ...config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS, ...loaderConfig }), + requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), + retryMode: config?.retryMode ?? + (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, + }, config), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, loaderConfig), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, loaderConfig), + userAgentAppId: config?.userAgentAppId ?? (0, node_config_provider_1.loadConfig)(util_user_agent_node_1.NODE_APP_ID_CONFIG_OPTIONS, loaderConfig), + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 8073: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const core_1 = __webpack_require__(8704); +const core_2 = __webpack_require__(402); +const smithy_client_1 = __webpack_require__(1411); +const url_parser_1 = __webpack_require__(4494); +const util_base64_1 = __webpack_require__(8385); +const util_utf8_1 = __webpack_require__(1577); +const httpAuthSchemeProvider_1 = __webpack_require__(2041); +const endpointResolver_1 = __webpack_require__(3903); +const getRuntimeConfig = (config) => { + return { + apiVersion: "2019-06-10", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSSOHttpAuthSchemeProvider, + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), + signer: new core_1.AwsSdkSigV4Signer(), + }, + { + schemeId: "smithy.api#noAuth", + identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), + signer: new core_2.NoAuthSigner(), + }, + ], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "SSO", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 7523: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + + +var protocolHttp = __webpack_require__(2356); +var core = __webpack_require__(402); +var propertyProvider = __webpack_require__(1238); +var client = __webpack_require__(5152); +var signatureV4 = __webpack_require__(5118); + +const getDateHeader = (response) => protocolHttp.HttpResponse.isInstance(response) ? response.headers?.date ?? response.headers?.Date : undefined; + +const getSkewCorrectedDate = (systemClockOffset) => new Date(Date.now() + systemClockOffset); + +const isClockSkewed = (clockTime, systemClockOffset) => Math.abs(getSkewCorrectedDate(systemClockOffset).getTime() - clockTime) >= 300000; + +const getUpdatedSystemClockOffset = (clockTime, currentSystemClockOffset) => { + const clockTimeInMs = Date.parse(clockTime); + if (isClockSkewed(clockTimeInMs, currentSystemClockOffset)) { + return clockTimeInMs - Date.now(); + } + return currentSystemClockOffset; +}; + +const throwSigningPropertyError = (name, property) => { + if (!property) { + throw new Error(`Property \`${name}\` is not resolved for AWS SDK SigV4Auth`); + } + return property; +}; +const validateSigningProperties = async (signingProperties) => { + const context = throwSigningPropertyError("context", signingProperties.context); + const config = throwSigningPropertyError("config", signingProperties.config); + const authScheme = context.endpointV2?.properties?.authSchemes?.[0]; + const signerFunction = throwSigningPropertyError("signer", config.signer); + const signer = await signerFunction(authScheme); + const signingRegion = signingProperties?.signingRegion; + const signingRegionSet = signingProperties?.signingRegionSet; + const signingName = signingProperties?.signingName; + return { + config, + signer, + signingRegion, + signingRegionSet, + signingName, + }; +}; +class AwsSdkSigV4Signer { + async sign(httpRequest, identity, signingProperties) { + if (!protocolHttp.HttpRequest.isInstance(httpRequest)) { + throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); + } + const validatedProps = await validateSigningProperties(signingProperties); + const { config, signer } = validatedProps; + let { signingRegion, signingName } = validatedProps; + const handlerExecutionContext = signingProperties.context; + if (handlerExecutionContext?.authSchemes?.length ?? 0 > 1) { + const [first, second] = handlerExecutionContext.authSchemes; + if (first?.name === "sigv4a" && second?.name === "sigv4") { + signingRegion = second?.signingRegion ?? signingRegion; + signingName = second?.signingName ?? signingName; + } + } + const signedRequest = await signer.sign(httpRequest, { + signingDate: getSkewCorrectedDate(config.systemClockOffset), + signingRegion: signingRegion, + signingService: signingName, + }); + return signedRequest; + } + errorHandler(signingProperties) { + return (error) => { + const serverTime = error.ServerTime ?? getDateHeader(error.$response); + if (serverTime) { + const config = throwSigningPropertyError("config", signingProperties.config); + const initialSystemClockOffset = config.systemClockOffset; + config.systemClockOffset = getUpdatedSystemClockOffset(serverTime, config.systemClockOffset); + const clockSkewCorrected = config.systemClockOffset !== initialSystemClockOffset; + if (clockSkewCorrected && error.$metadata) { + error.$metadata.clockSkewCorrected = true; + } + } + throw error; + }; + } + successHandler(httpResponse, signingProperties) { + const dateHeader = getDateHeader(httpResponse); + if (dateHeader) { + const config = throwSigningPropertyError("config", signingProperties.config); + config.systemClockOffset = getUpdatedSystemClockOffset(dateHeader, config.systemClockOffset); + } + } +} +const AWSSDKSigV4Signer = AwsSdkSigV4Signer; + +class AwsSdkSigV4ASigner extends AwsSdkSigV4Signer { + async sign(httpRequest, identity, signingProperties) { + if (!protocolHttp.HttpRequest.isInstance(httpRequest)) { + throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); + } + const { config, signer, signingRegion, signingRegionSet, signingName } = await validateSigningProperties(signingProperties); + const configResolvedSigningRegionSet = await config.sigv4aSigningRegionSet?.(); + const multiRegionOverride = (configResolvedSigningRegionSet ?? + signingRegionSet ?? [signingRegion]).join(","); + const signedRequest = await signer.sign(httpRequest, { + signingDate: getSkewCorrectedDate(config.systemClockOffset), + signingRegion: multiRegionOverride, + signingService: signingName, + }); + return signedRequest; + } +} + +const getArrayForCommaSeparatedString = (str) => typeof str === "string" && str.length > 0 ? str.split(",").map((item) => item.trim()) : []; + +const getBearerTokenEnvKey = (signingName) => `AWS_BEARER_TOKEN_${signingName.replace(/[\s-]/g, "_").toUpperCase()}`; + +const NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY = "AWS_AUTH_SCHEME_PREFERENCE"; +const NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY = "auth_scheme_preference"; +const NODE_AUTH_SCHEME_PREFERENCE_OPTIONS = { + environmentVariableSelector: (env, options) => { + if (options?.signingName) { + const bearerTokenKey = getBearerTokenEnvKey(options.signingName); + if (bearerTokenKey in env) + return ["httpBearerAuth"]; + } + if (!(NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY in env)) + return undefined; + return getArrayForCommaSeparatedString(env[NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY]); + }, + configFileSelector: (profile) => { + if (!(NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY in profile)) + return undefined; + return getArrayForCommaSeparatedString(profile[NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY]); + }, + default: [], +}; + +const resolveAwsSdkSigV4AConfig = (config) => { + config.sigv4aSigningRegionSet = core.normalizeProvider(config.sigv4aSigningRegionSet); + return config; +}; +const NODE_SIGV4A_CONFIG_OPTIONS = { + environmentVariableSelector(env) { + if (env.AWS_SIGV4A_SIGNING_REGION_SET) { + return env.AWS_SIGV4A_SIGNING_REGION_SET.split(",").map((_) => _.trim()); + } + throw new propertyProvider.ProviderError("AWS_SIGV4A_SIGNING_REGION_SET not set in env.", { + tryNextLink: true, + }); + }, + configFileSelector(profile) { + if (profile.sigv4a_signing_region_set) { + return (profile.sigv4a_signing_region_set ?? "").split(",").map((_) => _.trim()); + } + throw new propertyProvider.ProviderError("sigv4a_signing_region_set not set in profile.", { + tryNextLink: true, + }); + }, + default: undefined, +}; + +const resolveAwsSdkSigV4Config = (config) => { + let inputCredentials = config.credentials; + let isUserSupplied = !!config.credentials; + let resolvedCredentials = undefined; + Object.defineProperty(config, "credentials", { + set(credentials) { + if (credentials && credentials !== inputCredentials && credentials !== resolvedCredentials) { + isUserSupplied = true; + } + inputCredentials = credentials; + const memoizedProvider = normalizeCredentialProvider(config, { + credentials: inputCredentials, + credentialDefaultProvider: config.credentialDefaultProvider, + }); + const boundProvider = bindCallerConfig(config, memoizedProvider); + if (isUserSupplied && !boundProvider.attributed) { + resolvedCredentials = async (options) => boundProvider(options).then((creds) => client.setCredentialFeature(creds, "CREDENTIALS_CODE", "e")); + resolvedCredentials.memoized = boundProvider.memoized; + resolvedCredentials.configBound = boundProvider.configBound; + resolvedCredentials.attributed = true; + } + else { + resolvedCredentials = boundProvider; + } + }, + get() { + return resolvedCredentials; + }, + enumerable: true, + configurable: true, + }); + config.credentials = inputCredentials; + const { signingEscapePath = true, systemClockOffset = config.systemClockOffset || 0, sha256, } = config; + let signer; + if (config.signer) { + signer = core.normalizeProvider(config.signer); + } + else if (config.regionInfoProvider) { + signer = () => core.normalizeProvider(config.region)() + .then(async (region) => [ + (await config.regionInfoProvider(region, { + useFipsEndpoint: await config.useFipsEndpoint(), + useDualstackEndpoint: await config.useDualstackEndpoint(), + })) || {}, + region, + ]) + .then(([regionInfo, region]) => { + const { signingRegion, signingService } = regionInfo; + config.signingRegion = config.signingRegion || signingRegion || region; + config.signingName = config.signingName || signingService || config.serviceId; + const params = { + ...config, + credentials: config.credentials, + region: config.signingRegion, + service: config.signingName, + sha256, + uriEscapePath: signingEscapePath, + }; + const SignerCtor = config.signerConstructor || signatureV4.SignatureV4; + return new SignerCtor(params); + }); + } + else { + signer = async (authScheme) => { + authScheme = Object.assign({}, { + name: "sigv4", + signingName: config.signingName || config.defaultSigningName, + signingRegion: await core.normalizeProvider(config.region)(), + properties: {}, + }, authScheme); + const signingRegion = authScheme.signingRegion; + const signingService = authScheme.signingName; + config.signingRegion = config.signingRegion || signingRegion; + config.signingName = config.signingName || signingService || config.serviceId; + const params = { + ...config, + credentials: config.credentials, + region: config.signingRegion, + service: config.signingName, + sha256, + uriEscapePath: signingEscapePath, + }; + const SignerCtor = config.signerConstructor || signatureV4.SignatureV4; + return new SignerCtor(params); + }; + } + const resolvedConfig = Object.assign(config, { + systemClockOffset, + signingEscapePath, + signer, + }); + return resolvedConfig; +}; +const resolveAWSSDKSigV4Config = resolveAwsSdkSigV4Config; +function normalizeCredentialProvider(config, { credentials, credentialDefaultProvider, }) { + let credentialsProvider; + if (credentials) { + if (!credentials?.memoized) { + credentialsProvider = core.memoizeIdentityProvider(credentials, core.isIdentityExpired, core.doesIdentityRequireRefresh); + } + else { + credentialsProvider = credentials; + } + } + else { + if (credentialDefaultProvider) { + credentialsProvider = core.normalizeProvider(credentialDefaultProvider(Object.assign({}, config, { + parentClientConfig: config, + }))); + } + else { + credentialsProvider = async () => { + throw new Error("@aws-sdk/core::resolveAwsSdkSigV4Config - `credentials` not provided and no credentialDefaultProvider was configured."); + }; + } + } + credentialsProvider.memoized = true; + return credentialsProvider; +} +function bindCallerConfig(config, credentialsProvider) { + if (credentialsProvider.configBound) { + return credentialsProvider; + } + const fn = async (options) => credentialsProvider({ ...options, callerClientConfig: config }); + fn.memoized = credentialsProvider.memoized; + fn.configBound = true; + return fn; +} + +exports.AWSSDKSigV4Signer = AWSSDKSigV4Signer; +exports.AwsSdkSigV4ASigner = AwsSdkSigV4ASigner; +exports.AwsSdkSigV4Signer = AwsSdkSigV4Signer; +exports.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS = NODE_AUTH_SCHEME_PREFERENCE_OPTIONS; +exports.NODE_SIGV4A_CONFIG_OPTIONS = NODE_SIGV4A_CONFIG_OPTIONS; +exports.getBearerTokenEnvKey = getBearerTokenEnvKey; +exports.resolveAWSSDKSigV4Config = resolveAWSSDKSigV4Config; +exports.resolveAwsSdkSigV4AConfig = resolveAwsSdkSigV4AConfig; +exports.resolveAwsSdkSigV4Config = resolveAwsSdkSigV4Config; +exports.validateSigningProperties = validateSigningProperties; + + +/***/ }), + +/***/ 998: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + +var __webpack_unused_export__; + + +var propertyProvider = __webpack_require__(1238); +var sharedIniFileLoader = __webpack_require__(4964); +var client = __webpack_require__(5152); +var tokenProviders = __webpack_require__(5433); + +const isSsoProfile = (arg) => arg && + (typeof arg.sso_start_url === "string" || + typeof arg.sso_account_id === "string" || + typeof arg.sso_session === "string" || + typeof arg.sso_region === "string" || + typeof arg.sso_role_name === "string"); + +const SHOULD_FAIL_CREDENTIAL_CHAIN = false; +const resolveSSOCredentials = async ({ ssoStartUrl, ssoSession, ssoAccountId, ssoRegion, ssoRoleName, ssoClient, clientConfig, parentClientConfig, profile, filepath, configFilepath, ignoreCache, logger, }) => { + let token; + const refreshMessage = `To refresh this SSO session run aws sso login with the corresponding profile.`; + if (ssoSession) { + try { + const _token = await tokenProviders.fromSso({ + profile, + filepath, + configFilepath, + ignoreCache, + })(); + token = { + accessToken: _token.token, + expiresAt: new Date(_token.expiration).toISOString(), + }; + } + catch (e) { + throw new propertyProvider.CredentialsProviderError(e.message, { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger, + }); + } + } + else { + try { + token = await sharedIniFileLoader.getSSOTokenFromFile(ssoStartUrl); + } + catch (e) { + throw new propertyProvider.CredentialsProviderError(`The SSO session associated with this profile is invalid. ${refreshMessage}`, { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger, + }); + } + } + if (new Date(token.expiresAt).getTime() - Date.now() <= 0) { + throw new propertyProvider.CredentialsProviderError(`The SSO session associated with this profile has expired. ${refreshMessage}`, { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger, + }); + } + const { accessToken } = token; + const { SSOClient, GetRoleCredentialsCommand } = await Promise.resolve().then(function () { return __webpack_require__(6553); }); + const sso = ssoClient || + new SSOClient(Object.assign({}, clientConfig ?? {}, { + logger: clientConfig?.logger ?? parentClientConfig?.logger, + region: clientConfig?.region ?? ssoRegion, + userAgentAppId: clientConfig?.userAgentAppId ?? parentClientConfig?.userAgentAppId, + })); + let ssoResp; + try { + ssoResp = await sso.send(new GetRoleCredentialsCommand({ + accountId: ssoAccountId, + roleName: ssoRoleName, + accessToken, + })); + } + catch (e) { + throw new propertyProvider.CredentialsProviderError(e, { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger, + }); + } + const { roleCredentials: { accessKeyId, secretAccessKey, sessionToken, expiration, credentialScope, accountId } = {}, } = ssoResp; + if (!accessKeyId || !secretAccessKey || !sessionToken || !expiration) { + throw new propertyProvider.CredentialsProviderError("SSO returns an invalid temporary credential.", { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger, + }); + } + const credentials = { + accessKeyId, + secretAccessKey, + sessionToken, + expiration: new Date(expiration), + ...(credentialScope && { credentialScope }), + ...(accountId && { accountId }), + }; + if (ssoSession) { + client.setCredentialFeature(credentials, "CREDENTIALS_SSO", "s"); + } + else { + client.setCredentialFeature(credentials, "CREDENTIALS_SSO_LEGACY", "u"); + } + return credentials; +}; + +const validateSsoProfile = (profile, logger) => { + const { sso_start_url, sso_account_id, sso_region, sso_role_name } = profile; + if (!sso_start_url || !sso_account_id || !sso_region || !sso_role_name) { + throw new propertyProvider.CredentialsProviderError(`Profile is configured with invalid SSO credentials. Required parameters "sso_account_id", ` + + `"sso_region", "sso_role_name", "sso_start_url". Got ${Object.keys(profile).join(", ")}\nReference: https://docs.aws.amazon.com/cli/latest/userguide/cli-configure-sso.html`, { tryNextLink: false, logger }); + } + return profile; +}; + +const fromSSO = (init = {}) => async ({ callerClientConfig } = {}) => { + init.logger?.debug("@aws-sdk/credential-provider-sso - fromSSO"); + const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoSession } = init; + const { ssoClient } = init; + const profileName = sharedIniFileLoader.getProfileName({ + profile: init.profile ?? callerClientConfig?.profile, + }); + if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) { + const profiles = await sharedIniFileLoader.parseKnownFiles(init); + const profile = profiles[profileName]; + if (!profile) { + throw new propertyProvider.CredentialsProviderError(`Profile ${profileName} was not found.`, { logger: init.logger }); + } + if (!isSsoProfile(profile)) { + throw new propertyProvider.CredentialsProviderError(`Profile ${profileName} is not configured with SSO credentials.`, { + logger: init.logger, + }); + } + if (profile?.sso_session) { + const ssoSessions = await sharedIniFileLoader.loadSsoSessionData(init); + const session = ssoSessions[profile.sso_session]; + const conflictMsg = ` configurations in profile ${profileName} and sso-session ${profile.sso_session}`; + if (ssoRegion && ssoRegion !== session.sso_region) { + throw new propertyProvider.CredentialsProviderError(`Conflicting SSO region` + conflictMsg, { + tryNextLink: false, + logger: init.logger, + }); + } + if (ssoStartUrl && ssoStartUrl !== session.sso_start_url) { + throw new propertyProvider.CredentialsProviderError(`Conflicting SSO start_url` + conflictMsg, { + tryNextLink: false, + logger: init.logger, + }); + } + profile.sso_region = session.sso_region; + profile.sso_start_url = session.sso_start_url; + } + const { sso_start_url, sso_account_id, sso_region, sso_role_name, sso_session } = validateSsoProfile(profile, init.logger); + return resolveSSOCredentials({ + ssoStartUrl: sso_start_url, + ssoSession: sso_session, + ssoAccountId: sso_account_id, + ssoRegion: sso_region, + ssoRoleName: sso_role_name, + ssoClient: ssoClient, + clientConfig: init.clientConfig, + parentClientConfig: init.parentClientConfig, + profile: profileName, + filepath: init.filepath, + configFilepath: init.configFilepath, + ignoreCache: init.ignoreCache, + logger: init.logger, + }); + } + else if (!ssoStartUrl || !ssoAccountId || !ssoRegion || !ssoRoleName) { + throw new propertyProvider.CredentialsProviderError("Incomplete configuration. The fromSSO() argument hash must include " + + '"ssoStartUrl", "ssoAccountId", "ssoRegion", "ssoRoleName"', { tryNextLink: false, logger: init.logger }); + } + else { + return resolveSSOCredentials({ + ssoStartUrl, + ssoSession, + ssoAccountId, + ssoRegion, + ssoRoleName, + ssoClient, + clientConfig: init.clientConfig, + parentClientConfig: init.parentClientConfig, + profile: profileName, + filepath: init.filepath, + configFilepath: init.configFilepath, + ignoreCache: init.ignoreCache, + logger: init.logger, + }); + } +}; + +exports.fromSSO = fromSSO; +__webpack_unused_export__ = isSsoProfile; +__webpack_unused_export__ = validateSsoProfile; + + +/***/ }), + +/***/ 6553: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + + +var clientSso = __webpack_require__(2054); + + + +Object.defineProperty(exports, "GetRoleCredentialsCommand", ({ + enumerable: true, + get: function () { return clientSso.GetRoleCredentialsCommand; } +})); +Object.defineProperty(exports, "SSOClient", ({ + enumerable: true, + get: function () { return clientSso.SSOClient; } +})); + + +/***/ }), + +/***/ 5433: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + + + +var client = __webpack_require__(5152); +var httpAuthSchemes = __webpack_require__(7523); +var propertyProvider = __webpack_require__(1238); +var sharedIniFileLoader = __webpack_require__(4964); +var fs = __webpack_require__(9896); + +const fromEnvSigningName = ({ logger, signingName } = {}) => async () => { + logger?.debug?.("@aws-sdk/token-providers - fromEnvSigningName"); + if (!signingName) { + throw new propertyProvider.TokenProviderError("Please pass 'signingName' to compute environment variable key", { logger }); + } + const bearerTokenKey = httpAuthSchemes.getBearerTokenEnvKey(signingName); + if (!(bearerTokenKey in process.env)) { + throw new propertyProvider.TokenProviderError(`Token not present in '${bearerTokenKey}' environment variable`, { logger }); + } + const token = { token: process.env[bearerTokenKey] }; + client.setTokenFeature(token, "BEARER_SERVICE_ENV_VARS", "3"); + return token; +}; + +const EXPIRE_WINDOW_MS = 5 * 60 * 1000; +const REFRESH_MESSAGE = `To refresh this SSO session run 'aws sso login' with the corresponding profile.`; + +const getSsoOidcClient = async (ssoRegion, init = {}) => { + const { SSOOIDCClient } = await __webpack_require__.e(/* import() */ 443).then(__webpack_require__.t.bind(__webpack_require__, 9443, 19)); + const coalesce = (prop) => init.clientConfig?.[prop] ?? init.parentClientConfig?.[prop]; + const ssoOidcClient = new SSOOIDCClient(Object.assign({}, init.clientConfig ?? {}, { + region: ssoRegion ?? init.clientConfig?.region, + logger: coalesce("logger"), + userAgentAppId: coalesce("userAgentAppId"), + })); + return ssoOidcClient; +}; + +const getNewSsoOidcToken = async (ssoToken, ssoRegion, init = {}) => { + const { CreateTokenCommand } = await __webpack_require__.e(/* import() */ 443).then(__webpack_require__.t.bind(__webpack_require__, 9443, 19)); + const ssoOidcClient = await getSsoOidcClient(ssoRegion, init); + return ssoOidcClient.send(new CreateTokenCommand({ + clientId: ssoToken.clientId, + clientSecret: ssoToken.clientSecret, + refreshToken: ssoToken.refreshToken, + grantType: "refresh_token", + })); +}; + +const validateTokenExpiry = (token) => { + if (token.expiration && token.expiration.getTime() < Date.now()) { + throw new propertyProvider.TokenProviderError(`Token is expired. ${REFRESH_MESSAGE}`, false); + } +}; + +const validateTokenKey = (key, value, forRefresh = false) => { + if (typeof value === "undefined") { + throw new propertyProvider.TokenProviderError(`Value not present for '${key}' in SSO Token${forRefresh ? ". Cannot refresh" : ""}. ${REFRESH_MESSAGE}`, false); + } +}; + +const { writeFile } = fs.promises; +const writeSSOTokenToFile = (id, ssoToken) => { + const tokenFilepath = sharedIniFileLoader.getSSOTokenFilepath(id); + const tokenString = JSON.stringify(ssoToken, null, 2); + return writeFile(tokenFilepath, tokenString); +}; + +const lastRefreshAttemptTime = new Date(0); +const fromSso = (_init = {}) => async ({ callerClientConfig } = {}) => { + const init = { + ..._init, + parentClientConfig: { + ...callerClientConfig, + ..._init.parentClientConfig, + }, + }; + init.logger?.debug("@aws-sdk/token-providers - fromSso"); + const profiles = await sharedIniFileLoader.parseKnownFiles(init); + const profileName = sharedIniFileLoader.getProfileName({ + profile: init.profile ?? callerClientConfig?.profile, + }); + const profile = profiles[profileName]; + if (!profile) { + throw new propertyProvider.TokenProviderError(`Profile '${profileName}' could not be found in shared credentials file.`, false); + } + else if (!profile["sso_session"]) { + throw new propertyProvider.TokenProviderError(`Profile '${profileName}' is missing required property 'sso_session'.`); + } + const ssoSessionName = profile["sso_session"]; + const ssoSessions = await sharedIniFileLoader.loadSsoSessionData(init); + const ssoSession = ssoSessions[ssoSessionName]; + if (!ssoSession) { + throw new propertyProvider.TokenProviderError(`Sso session '${ssoSessionName}' could not be found in shared credentials file.`, false); + } + for (const ssoSessionRequiredKey of ["sso_start_url", "sso_region"]) { + if (!ssoSession[ssoSessionRequiredKey]) { + throw new propertyProvider.TokenProviderError(`Sso session '${ssoSessionName}' is missing required property '${ssoSessionRequiredKey}'.`, false); + } + } + ssoSession["sso_start_url"]; + const ssoRegion = ssoSession["sso_region"]; + let ssoToken; + try { + ssoToken = await sharedIniFileLoader.getSSOTokenFromFile(ssoSessionName); + } + catch (e) { + throw new propertyProvider.TokenProviderError(`The SSO session token associated with profile=${profileName} was not found or is invalid. ${REFRESH_MESSAGE}`, false); + } + validateTokenKey("accessToken", ssoToken.accessToken); + validateTokenKey("expiresAt", ssoToken.expiresAt); + const { accessToken, expiresAt } = ssoToken; + const existingToken = { token: accessToken, expiration: new Date(expiresAt) }; + if (existingToken.expiration.getTime() - Date.now() > EXPIRE_WINDOW_MS) { + return existingToken; + } + if (Date.now() - lastRefreshAttemptTime.getTime() < 30 * 1000) { + validateTokenExpiry(existingToken); + return existingToken; + } + validateTokenKey("clientId", ssoToken.clientId, true); + validateTokenKey("clientSecret", ssoToken.clientSecret, true); + validateTokenKey("refreshToken", ssoToken.refreshToken, true); + try { + lastRefreshAttemptTime.setTime(Date.now()); + const newSsoOidcToken = await getNewSsoOidcToken(ssoToken, ssoRegion, init); + validateTokenKey("accessToken", newSsoOidcToken.accessToken); + validateTokenKey("expiresIn", newSsoOidcToken.expiresIn); + const newTokenExpiration = new Date(Date.now() + newSsoOidcToken.expiresIn * 1000); + try { + await writeSSOTokenToFile(ssoSessionName, { + ...ssoToken, + accessToken: newSsoOidcToken.accessToken, + expiresAt: newTokenExpiration.toISOString(), + refreshToken: newSsoOidcToken.refreshToken, + }); + } + catch (error) { + } + return { + token: newSsoOidcToken.accessToken, + expiration: newTokenExpiration, + }; + } + catch (error) { + validateTokenExpiry(existingToken); + return existingToken; + } +}; + +const fromStatic = ({ token, logger }) => async () => { + logger?.debug("@aws-sdk/token-providers - fromStatic"); + if (!token || !token.token) { + throw new propertyProvider.TokenProviderError(`Please pass a valid token to fromStatic`, false); + } + return token; +}; + +const nodeProvider = (init = {}) => propertyProvider.memoize(propertyProvider.chain(fromSso(init), async () => { + throw new propertyProvider.TokenProviderError("Could not load token from any providers", false); +}), (token) => token.expiration !== undefined && token.expiration.getTime() - Date.now() < 300000, (token) => token.expiration !== undefined); + +exports.fromEnvSigningName = fromEnvSigningName; +exports.fromSso = fromSso; +exports.fromStatic = fromStatic; +exports.nodeProvider = nodeProvider; + + +/***/ }), + +/***/ 5188: +/***/ ((module) => { + +module.exports = /*#__PURE__*/JSON.parse('{"name":"@aws-sdk/client-sso","description":"AWS SDK for JavaScript Sso Client for Node.js, Browser and React Native","version":"3.922.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"node ../../scripts/compilation/inline client-sso","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo sso"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"5.2.0","@aws-crypto/sha256-js":"5.2.0","@aws-sdk/core":"3.922.0","@aws-sdk/middleware-host-header":"3.922.0","@aws-sdk/middleware-logger":"3.922.0","@aws-sdk/middleware-recursion-detection":"3.922.0","@aws-sdk/middleware-user-agent":"3.922.0","@aws-sdk/region-config-resolver":"3.922.0","@aws-sdk/types":"3.922.0","@aws-sdk/util-endpoints":"3.922.0","@aws-sdk/util-user-agent-browser":"3.922.0","@aws-sdk/util-user-agent-node":"3.922.0","@smithy/config-resolver":"^4.4.1","@smithy/core":"^3.17.2","@smithy/fetch-http-handler":"^5.3.5","@smithy/hash-node":"^4.2.4","@smithy/invalid-dependency":"^4.2.4","@smithy/middleware-content-length":"^4.2.4","@smithy/middleware-endpoint":"^4.3.6","@smithy/middleware-retry":"^4.4.6","@smithy/middleware-serde":"^4.2.4","@smithy/middleware-stack":"^4.2.4","@smithy/node-config-provider":"^4.3.4","@smithy/node-http-handler":"^4.4.4","@smithy/protocol-http":"^5.3.4","@smithy/smithy-client":"^4.9.2","@smithy/types":"^4.8.1","@smithy/url-parser":"^4.2.4","@smithy/util-base64":"^4.3.0","@smithy/util-body-length-browser":"^4.2.0","@smithy/util-body-length-node":"^4.2.1","@smithy/util-defaults-mode-browser":"^4.3.5","@smithy/util-defaults-mode-node":"^4.2.7","@smithy/util-endpoints":"^3.2.4","@smithy/util-middleware":"^4.2.4","@smithy/util-retry":"^4.2.4","@smithy/util-utf8":"^4.2.0","tslib":"^2.6.2"},"devDependencies":{"@tsconfig/node18":"18.2.4","@types/node":"^18.19.69","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typescript":"~5.8.3"},"engines":{"node":">=18.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sso","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sso"}}'); + +/***/ }) + +}; +; \ No newline at end of file diff --git a/dist/index.js b/dist/index.js index 68303671..14c74f6b 100644 --- a/dist/index.js +++ b/dist/index.js @@ -3574,7 +3574,7 @@ util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunct Object.defineProperty(exports, "__esModule", ({ value: true })); exports.ruleSet = void 0; const s = "required", t = "fn", u = "argv", v = "ref"; -const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = { [s]: false, "type": "String" }, i = { [s]: true, "default": false, "type": "Boolean" }, j = { [v]: "Endpoint" }, k = { [t]: c, [u]: [{ [v]: "UseFIPS" }, true] }, l = { [t]: c, [u]: [{ [v]: "UseDualStack" }, true] }, m = {}, n = { [t]: "getAttr", [u]: [{ [v]: g }, "supportsFIPS"] }, o = { [t]: c, [u]: [true, { [t]: "getAttr", [u]: [{ [v]: g }, "supportsDualStack"] }] }, p = [k], q = [l], r = [{ [v]: "Region" }]; +const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = { [s]: false, "type": "string" }, i = { [s]: true, "default": false, "type": "boolean" }, j = { [v]: "Endpoint" }, k = { [t]: c, [u]: [{ [v]: "UseFIPS" }, true] }, l = { [t]: c, [u]: [{ [v]: "UseDualStack" }, true] }, m = {}, n = { [t]: "getAttr", [u]: [{ [v]: g }, "supportsFIPS"] }, o = { [t]: c, [u]: [true, { [t]: "getAttr", [u]: [{ [v]: g }, "supportsDualStack"] }] }, p = [k], q = [l], r = [{ [v]: "Region" }]; const _data = { version: "1.0", parameters: { Region: h, UseDualStack: i, UseFIPS: i, Endpoint: h }, rules: [{ conditions: [{ [t]: b, [u]: [j] }], rules: [{ conditions: p, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: q, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: j, properties: m, headers: m }, type: e }], type: f }, { conditions: [{ [t]: b, [u]: r }], rules: [{ conditions: [{ [t]: "aws.partition", [u]: r, assign: g }], rules: [{ conditions: [k, l], rules: [{ conditions: [{ [t]: c, [u]: [a, n] }, o], rules: [{ endpoint: { url: "https://ecs-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: m, headers: m }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: p, rules: [{ conditions: [{ [t]: c, [u]: [n, a] }], rules: [{ endpoint: { url: "https://ecs-fips.{Region}.{PartitionResult#dnsSuffix}", properties: m, headers: m }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: q, rules: [{ conditions: [o], rules: [{ endpoint: { url: "https://ecs.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: m, headers: m }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://ecs.{Region}.{PartitionResult#dnsSuffix}", properties: m, headers: m }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; exports.ruleSet = _data; @@ -3582,4794 +3582,5052 @@ exports.ruleSet = _data; /***/ }), /***/ 212: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - AccessDeniedException: () => AccessDeniedException, - AgentUpdateStatus: () => AgentUpdateStatus, - ApplicationProtocol: () => ApplicationProtocol, - AssignPublicIp: () => AssignPublicIp, - AttributeLimitExceededException: () => AttributeLimitExceededException, - AvailabilityZoneRebalancing: () => AvailabilityZoneRebalancing, - BlockedException: () => BlockedException, - CPUArchitecture: () => CPUArchitecture, - CapacityProviderField: () => CapacityProviderField, - CapacityProviderStatus: () => CapacityProviderStatus, - CapacityProviderUpdateStatus: () => CapacityProviderUpdateStatus, - ClientException: () => ClientException, - ClusterContainsContainerInstancesException: () => ClusterContainsContainerInstancesException, - ClusterContainsServicesException: () => ClusterContainsServicesException, - ClusterContainsTasksException: () => ClusterContainsTasksException, - ClusterField: () => ClusterField, - ClusterNotFoundException: () => ClusterNotFoundException, - ClusterSettingName: () => ClusterSettingName, - Compatibility: () => Compatibility, - ConflictException: () => ConflictException, - Connectivity: () => Connectivity, - ContainerCondition: () => ContainerCondition, - ContainerInstanceField: () => ContainerInstanceField, - ContainerInstanceStatus: () => ContainerInstanceStatus, - CreateCapacityProviderCommand: () => CreateCapacityProviderCommand, - CreateClusterCommand: () => CreateClusterCommand, - CreateServiceCommand: () => CreateServiceCommand, - CreateTaskSetCommand: () => CreateTaskSetCommand, - DeleteAccountSettingCommand: () => DeleteAccountSettingCommand, - DeleteAttributesCommand: () => DeleteAttributesCommand, - DeleteCapacityProviderCommand: () => DeleteCapacityProviderCommand, - DeleteClusterCommand: () => DeleteClusterCommand, - DeleteServiceCommand: () => DeleteServiceCommand, - DeleteTaskDefinitionsCommand: () => DeleteTaskDefinitionsCommand, - DeleteTaskSetCommand: () => DeleteTaskSetCommand, - DeploymentControllerType: () => DeploymentControllerType, - DeploymentLifecycleHookStage: () => DeploymentLifecycleHookStage, - DeploymentRolloutState: () => DeploymentRolloutState, - DeploymentStrategy: () => DeploymentStrategy, - DeregisterContainerInstanceCommand: () => DeregisterContainerInstanceCommand, - DeregisterTaskDefinitionCommand: () => DeregisterTaskDefinitionCommand, - DescribeCapacityProvidersCommand: () => DescribeCapacityProvidersCommand, - DescribeClustersCommand: () => DescribeClustersCommand, - DescribeContainerInstancesCommand: () => DescribeContainerInstancesCommand, - DescribeServiceDeploymentsCommand: () => DescribeServiceDeploymentsCommand, - DescribeServiceRevisionsCommand: () => DescribeServiceRevisionsCommand, - DescribeServicesCommand: () => DescribeServicesCommand, - DescribeTaskDefinitionCommand: () => DescribeTaskDefinitionCommand, - DescribeTaskSetsCommand: () => DescribeTaskSetsCommand, - DescribeTasksCommand: () => DescribeTasksCommand, - DesiredStatus: () => DesiredStatus, - DeviceCgroupPermission: () => DeviceCgroupPermission, - DiscoverPollEndpointCommand: () => DiscoverPollEndpointCommand, - EBSResourceType: () => EBSResourceType, - ECS: () => ECS, - ECSClient: () => ECSClient, - ECSServiceException: () => ECSServiceException, - EFSAuthorizationConfigIAM: () => EFSAuthorizationConfigIAM, - EFSTransitEncryption: () => EFSTransitEncryption, - EnvironmentFileType: () => EnvironmentFileType, - ExecuteCommandCommand: () => ExecuteCommandCommand, - ExecuteCommandLogging: () => ExecuteCommandLogging, - ExecuteCommandResponseFilterSensitiveLog: () => ExecuteCommandResponseFilterSensitiveLog, - FirelensConfigurationType: () => FirelensConfigurationType, - GetTaskProtectionCommand: () => GetTaskProtectionCommand, - HealthStatus: () => HealthStatus, - InstanceHealthCheckState: () => InstanceHealthCheckState, - InstanceHealthCheckType: () => InstanceHealthCheckType, - InvalidParameterException: () => InvalidParameterException, - IpcMode: () => IpcMode, - LaunchType: () => LaunchType, - LimitExceededException: () => LimitExceededException, - ListAccountSettingsCommand: () => ListAccountSettingsCommand, - ListAttributesCommand: () => ListAttributesCommand, - ListClustersCommand: () => ListClustersCommand, - ListContainerInstancesCommand: () => ListContainerInstancesCommand, - ListServiceDeploymentsCommand: () => ListServiceDeploymentsCommand, - ListServicesByNamespaceCommand: () => ListServicesByNamespaceCommand, - ListServicesCommand: () => ListServicesCommand, - ListTagsForResourceCommand: () => ListTagsForResourceCommand, - ListTaskDefinitionFamiliesCommand: () => ListTaskDefinitionFamiliesCommand, - ListTaskDefinitionsCommand: () => ListTaskDefinitionsCommand, - ListTasksCommand: () => ListTasksCommand, - LogDriver: () => LogDriver, - ManagedAgentName: () => ManagedAgentName, - ManagedDraining: () => ManagedDraining, - ManagedScalingStatus: () => ManagedScalingStatus, - ManagedTerminationProtection: () => ManagedTerminationProtection, - MissingVersionException: () => MissingVersionException, - NamespaceNotFoundException: () => NamespaceNotFoundException, - NetworkMode: () => NetworkMode, - NoUpdateAvailableException: () => NoUpdateAvailableException, - OSFamily: () => OSFamily, - PidMode: () => PidMode, - PlacementConstraintType: () => PlacementConstraintType, - PlacementStrategyType: () => PlacementStrategyType, - PlatformDeviceType: () => PlatformDeviceType, - PlatformTaskDefinitionIncompatibilityException: () => PlatformTaskDefinitionIncompatibilityException, - PlatformUnknownException: () => PlatformUnknownException, - PropagateTags: () => PropagateTags, - ProxyConfigurationType: () => ProxyConfigurationType, - PutAccountSettingCommand: () => PutAccountSettingCommand, - PutAccountSettingDefaultCommand: () => PutAccountSettingDefaultCommand, - PutAttributesCommand: () => PutAttributesCommand, - PutClusterCapacityProvidersCommand: () => PutClusterCapacityProvidersCommand, - RegisterContainerInstanceCommand: () => RegisterContainerInstanceCommand, - RegisterTaskDefinitionCommand: () => RegisterTaskDefinitionCommand, - ResourceInUseException: () => ResourceInUseException, - ResourceNotFoundException: () => ResourceNotFoundException, - ResourceType: () => ResourceType, - RunTaskCommand: () => RunTaskCommand, - ScaleUnit: () => ScaleUnit, - SchedulingStrategy: () => SchedulingStrategy, - Scope: () => Scope, - ServerException: () => ServerException, - ServiceDeploymentLifecycleStage: () => ServiceDeploymentLifecycleStage, - ServiceDeploymentNotFoundException: () => ServiceDeploymentNotFoundException, - ServiceDeploymentRollbackMonitorsStatus: () => ServiceDeploymentRollbackMonitorsStatus, - ServiceDeploymentStatus: () => ServiceDeploymentStatus, - ServiceField: () => ServiceField, - ServiceNotActiveException: () => ServiceNotActiveException, - ServiceNotFoundException: () => ServiceNotFoundException, - SessionFilterSensitiveLog: () => SessionFilterSensitiveLog, - SettingName: () => SettingName, - SettingType: () => SettingType, - SortOrder: () => SortOrder, - StabilityStatus: () => StabilityStatus, - StartTaskCommand: () => StartTaskCommand, - StopServiceDeploymentCommand: () => StopServiceDeploymentCommand, - StopServiceDeploymentStopType: () => StopServiceDeploymentStopType, - StopTaskCommand: () => StopTaskCommand, - SubmitAttachmentStateChangesCommand: () => SubmitAttachmentStateChangesCommand, - SubmitContainerStateChangeCommand: () => SubmitContainerStateChangeCommand, - SubmitTaskStateChangeCommand: () => SubmitTaskStateChangeCommand, - TagResourceCommand: () => TagResourceCommand, - TargetNotConnectedException: () => TargetNotConnectedException, - TargetNotFoundException: () => TargetNotFoundException, - TargetType: () => TargetType, - TaskDefinitionFamilyStatus: () => TaskDefinitionFamilyStatus, - TaskDefinitionField: () => TaskDefinitionField, - TaskDefinitionPlacementConstraintType: () => TaskDefinitionPlacementConstraintType, - TaskDefinitionStatus: () => TaskDefinitionStatus, - TaskField: () => TaskField, - TaskFilesystemType: () => TaskFilesystemType, - TaskSetField: () => TaskSetField, - TaskSetNotFoundException: () => TaskSetNotFoundException, - TaskStopCode: () => TaskStopCode, - TransportProtocol: () => TransportProtocol, - UlimitName: () => UlimitName, - UnsupportedFeatureException: () => UnsupportedFeatureException, - UntagResourceCommand: () => UntagResourceCommand, - UpdateCapacityProviderCommand: () => UpdateCapacityProviderCommand, - UpdateClusterCommand: () => UpdateClusterCommand, - UpdateClusterSettingsCommand: () => UpdateClusterSettingsCommand, - UpdateContainerAgentCommand: () => UpdateContainerAgentCommand, - UpdateContainerInstancesStateCommand: () => UpdateContainerInstancesStateCommand, - UpdateInProgressException: () => UpdateInProgressException, - UpdateServiceCommand: () => UpdateServiceCommand, - UpdateServicePrimaryTaskSetCommand: () => UpdateServicePrimaryTaskSetCommand, - UpdateTaskProtectionCommand: () => UpdateTaskProtectionCommand, - UpdateTaskSetCommand: () => UpdateTaskSetCommand, - VersionConsistency: () => VersionConsistency, - __Client: () => import_smithy_client.Client, - paginateListAccountSettings: () => paginateListAccountSettings, - paginateListAttributes: () => paginateListAttributes, - paginateListClusters: () => paginateListClusters, - paginateListContainerInstances: () => paginateListContainerInstances, - paginateListServices: () => paginateListServices, - paginateListServicesByNamespace: () => paginateListServicesByNamespace, - paginateListTaskDefinitionFamilies: () => paginateListTaskDefinitionFamilies, - paginateListTaskDefinitions: () => paginateListTaskDefinitions, - paginateListTasks: () => paginateListTasks, - waitForServicesInactive: () => waitForServicesInactive, - waitForServicesStable: () => waitForServicesStable, - waitForTasksRunning: () => waitForTasksRunning, - waitForTasksStopped: () => waitForTasksStopped, - waitUntilServicesInactive: () => waitUntilServicesInactive, - waitUntilServicesStable: () => waitUntilServicesStable, - waitUntilTasksRunning: () => waitUntilTasksRunning, - waitUntilTasksStopped: () => waitUntilTasksStopped -}); -module.exports = __toCommonJS(index_exports); - -// src/ECSClient.ts -var import_middleware_host_header = __nccwpck_require__(2590); -var import_middleware_logger = __nccwpck_require__(5242); -var import_middleware_recursion_detection = __nccwpck_require__(1568); -var import_middleware_user_agent = __nccwpck_require__(2959); -var import_config_resolver = __nccwpck_require__(9316); -var import_core = __nccwpck_require__(402); -var import_middleware_content_length = __nccwpck_require__(7212); -var import_middleware_endpoint = __nccwpck_require__(99); -var import_middleware_retry = __nccwpck_require__(9618); - -var import_httpAuthSchemeProvider = __nccwpck_require__(1367); - -// src/endpoint/EndpointParameters.ts -var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { - return Object.assign(options, { - useDualstackEndpoint: options.useDualstackEndpoint ?? false, - useFipsEndpoint: options.useFipsEndpoint ?? false, - defaultSigningName: "ecs" - }); -}, "resolveClientEndpointParameters"); -var commonParams = { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } -}; - -// src/ECSClient.ts -var import_runtimeConfig = __nccwpck_require__(1142); - -// src/runtimeExtensions.ts -var import_region_config_resolver = __nccwpck_require__(6463); -var import_protocol_http = __nccwpck_require__(2356); -var import_smithy_client = __nccwpck_require__(1411); - -// src/auth/httpAuthExtensionConfiguration.ts -var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; - let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; - let _credentials = runtimeConfig.credentials; - return { - setHttpAuthScheme(httpAuthScheme) { - const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); - if (index === -1) { - _httpAuthSchemes.push(httpAuthScheme); - } else { - _httpAuthSchemes.splice(index, 1, httpAuthScheme); - } - }, - httpAuthSchemes() { - return _httpAuthSchemes; - }, - setHttpAuthSchemeProvider(httpAuthSchemeProvider) { - _httpAuthSchemeProvider = httpAuthSchemeProvider; - }, - httpAuthSchemeProvider() { - return _httpAuthSchemeProvider; - }, - setCredentials(credentials) { - _credentials = credentials; - }, - credentials() { - return _credentials; - } - }; -}, "getHttpAuthExtensionConfiguration"); -var resolveHttpAuthRuntimeConfig = /* @__PURE__ */ __name((config) => { - return { - httpAuthSchemes: config.httpAuthSchemes(), - httpAuthSchemeProvider: config.httpAuthSchemeProvider(), - credentials: config.credentials() - }; -}, "resolveHttpAuthRuntimeConfig"); - -// src/runtimeExtensions.ts -var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { - const extensionConfiguration = Object.assign( - (0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig), - (0, import_smithy_client.getDefaultExtensionConfiguration)(runtimeConfig), - (0, import_protocol_http.getHttpHandlerExtensionConfiguration)(runtimeConfig), - getHttpAuthExtensionConfiguration(runtimeConfig) - ); - extensions.forEach((extension) => extension.configure(extensionConfiguration)); - return Object.assign( - runtimeConfig, - (0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), - (0, import_smithy_client.resolveDefaultRuntimeConfig)(extensionConfiguration), - (0, import_protocol_http.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), - resolveHttpAuthRuntimeConfig(extensionConfiguration) - ); -}, "resolveRuntimeExtensions"); +var middlewareHostHeader = __nccwpck_require__(2590); +var middlewareLogger = __nccwpck_require__(5242); +var middlewareRecursionDetection = __nccwpck_require__(1568); +var middlewareUserAgent = __nccwpck_require__(2959); +var configResolver = __nccwpck_require__(9316); +var core = __nccwpck_require__(402); +var middlewareContentLength = __nccwpck_require__(7212); +var middlewareEndpoint = __nccwpck_require__(99); +var middlewareRetry = __nccwpck_require__(9618); +var smithyClient = __nccwpck_require__(1411); +var httpAuthSchemeProvider = __nccwpck_require__(1367); +var runtimeConfig = __nccwpck_require__(1142); +var regionConfigResolver = __nccwpck_require__(6463); +var protocolHttp = __nccwpck_require__(2356); +var middlewareSerde = __nccwpck_require__(3255); +var core$1 = __nccwpck_require__(8704); +var uuid = __nccwpck_require__(266); +var utilWaiter = __nccwpck_require__(5290); -// src/ECSClient.ts -var ECSClient = class extends import_smithy_client.Client { - static { - __name(this, "ECSClient"); - } - /** - * The resolved configuration of ECSClient class. This is resolved and normalized from the {@link ECSClientConfig | constructor configuration interface}. - */ - config; - constructor(...[configuration]) { - const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); - super(_config_0); - this.initConfig = _config_0; - const _config_1 = resolveClientEndpointParameters(_config_0); - const _config_2 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_1); - const _config_3 = (0, import_middleware_retry.resolveRetryConfig)(_config_2); - const _config_4 = (0, import_config_resolver.resolveRegionConfig)(_config_3); - const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, import_middleware_endpoint.resolveEndpointConfig)(_config_5); - const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); - const _config_8 = resolveRuntimeExtensions(_config_7, configuration?.extensions || []); - this.config = _config_8; - this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_retry.getRetryPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_recursion_detection.getRecursionDetectionPlugin)(this.config)); - this.middlewareStack.use( - (0, import_core.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { - httpAuthSchemeParametersProvider: import_httpAuthSchemeProvider.defaultECSHttpAuthSchemeParametersProvider, - identityProviderConfigProvider: /* @__PURE__ */ __name(async (config) => new import_core.DefaultIdentityProviderConfig({ - "aws.auth#sigv4": config.credentials - }), "identityProviderConfigProvider") - }) - ); - this.middlewareStack.use((0, import_core.getHttpSigningPlugin)(this.config)); - } - /** - * Destroy underlying resources, like sockets. It's usually not necessary to do this. - * However in Node.js, it's best to explicitly shut down the client's agent when it is no longer needed. - * Otherwise, sockets might stay open for quite a long time before the server terminates them. - */ - destroy() { - super.destroy(); - } +const resolveClientEndpointParameters = (options) => { + return Object.assign(options, { + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + defaultSigningName: "ecs", + }); +}; +const commonParams = { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, }; -// src/ECS.ts - - -// src/commands/CreateCapacityProviderCommand.ts - -var import_middleware_serde = __nccwpck_require__(3255); - - -// src/protocols/Aws_json1_1.ts -var import_core2 = __nccwpck_require__(8704); - +const getHttpAuthExtensionConfiguration = (runtimeConfig) => { + const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; + let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; + let _credentials = runtimeConfig.credentials; + return { + setHttpAuthScheme(httpAuthScheme) { + const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); + if (index === -1) { + _httpAuthSchemes.push(httpAuthScheme); + } + else { + _httpAuthSchemes.splice(index, 1, httpAuthScheme); + } + }, + httpAuthSchemes() { + return _httpAuthSchemes; + }, + setHttpAuthSchemeProvider(httpAuthSchemeProvider) { + _httpAuthSchemeProvider = httpAuthSchemeProvider; + }, + httpAuthSchemeProvider() { + return _httpAuthSchemeProvider; + }, + setCredentials(credentials) { + _credentials = credentials; + }, + credentials() { + return _credentials; + }, + }; +}; +const resolveHttpAuthRuntimeConfig = (config) => { + return { + httpAuthSchemes: config.httpAuthSchemes(), + httpAuthSchemeProvider: config.httpAuthSchemeProvider(), + credentials: config.credentials(), + }; +}; -var import_uuid = __nccwpck_require__(2048); +const resolveRuntimeExtensions = (runtimeConfig, extensions) => { + const extensionConfiguration = Object.assign(regionConfigResolver.getAwsRegionExtensionConfiguration(runtimeConfig), smithyClient.getDefaultExtensionConfiguration(runtimeConfig), protocolHttp.getHttpHandlerExtensionConfiguration(runtimeConfig), getHttpAuthExtensionConfiguration(runtimeConfig)); + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return Object.assign(runtimeConfig, regionConfigResolver.resolveAwsRegionExtensionConfiguration(extensionConfiguration), smithyClient.resolveDefaultRuntimeConfig(extensionConfiguration), protocolHttp.resolveHttpHandlerRuntimeConfig(extensionConfiguration), resolveHttpAuthRuntimeConfig(extensionConfiguration)); +}; -// src/models/ECSServiceException.ts +class ECSClient extends smithyClient.Client { + config; + constructor(...[configuration]) { + const _config_0 = runtimeConfig.getRuntimeConfig(configuration || {}); + super(_config_0); + this.initConfig = _config_0; + const _config_1 = resolveClientEndpointParameters(_config_0); + const _config_2 = middlewareUserAgent.resolveUserAgentConfig(_config_1); + const _config_3 = middlewareRetry.resolveRetryConfig(_config_2); + const _config_4 = configResolver.resolveRegionConfig(_config_3); + const _config_5 = middlewareHostHeader.resolveHostHeaderConfig(_config_4); + const _config_6 = middlewareEndpoint.resolveEndpointConfig(_config_5); + const _config_7 = httpAuthSchemeProvider.resolveHttpAuthSchemeConfig(_config_6); + const _config_8 = resolveRuntimeExtensions(_config_7, configuration?.extensions || []); + this.config = _config_8; + this.middlewareStack.use(middlewareUserAgent.getUserAgentPlugin(this.config)); + this.middlewareStack.use(middlewareRetry.getRetryPlugin(this.config)); + this.middlewareStack.use(middlewareContentLength.getContentLengthPlugin(this.config)); + this.middlewareStack.use(middlewareHostHeader.getHostHeaderPlugin(this.config)); + this.middlewareStack.use(middlewareLogger.getLoggerPlugin(this.config)); + this.middlewareStack.use(middlewareRecursionDetection.getRecursionDetectionPlugin(this.config)); + this.middlewareStack.use(core.getHttpAuthSchemeEndpointRuleSetPlugin(this.config, { + httpAuthSchemeParametersProvider: httpAuthSchemeProvider.defaultECSHttpAuthSchemeParametersProvider, + identityProviderConfigProvider: async (config) => new core.DefaultIdentityProviderConfig({ + "aws.auth#sigv4": config.credentials, + }), + })); + this.middlewareStack.use(core.getHttpSigningPlugin(this.config)); + } + destroy() { + super.destroy(); + } +} -var ECSServiceException = class _ECSServiceException extends import_smithy_client.ServiceException { - static { - __name(this, "ECSServiceException"); - } - /** - * @internal - */ - constructor(options) { - super(options); - Object.setPrototypeOf(this, _ECSServiceException.prototype); - } +class ECSServiceException extends smithyClient.ServiceException { + constructor(options) { + super(options); + Object.setPrototypeOf(this, ECSServiceException.prototype); + } +} + +const AcceleratorManufacturer = { + AMAZON_WEB_SERVICES: "amazon-web-services", + AMD: "amd", + HABANA: "habana", + NVIDIA: "nvidia", + XILINX: "xilinx", +}; +const AcceleratorName = { + A100: "a100", + A10G: "a10g", + H100: "h100", + INFERENTIA: "inferentia", + K520: "k520", + K80: "k80", + M60: "m60", + RADEON_PRO_V520: "radeon-pro-v520", + T4: "t4", + T4G: "t4g", + V100: "v100", + VU9P: "vu9p", +}; +const AcceleratorType = { + FPGA: "fpga", + GPU: "gpu", + INFERENCE: "inference", +}; +class AccessDeniedException extends ECSServiceException { + name = "AccessDeniedException"; + $fault = "client"; + constructor(opts) { + super({ + name: "AccessDeniedException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, AccessDeniedException.prototype); + } +} +const AgentUpdateStatus = { + FAILED: "FAILED", + PENDING: "PENDING", + STAGED: "STAGED", + STAGING: "STAGING", + UPDATED: "UPDATED", + UPDATING: "UPDATING", +}; +class ClientException extends ECSServiceException { + name = "ClientException"; + $fault = "client"; + constructor(opts) { + super({ + name: "ClientException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ClientException.prototype); + } +} +class ClusterNotFoundException extends ECSServiceException { + name = "ClusterNotFoundException"; + $fault = "client"; + constructor(opts) { + super({ + name: "ClusterNotFoundException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ClusterNotFoundException.prototype); + } +} +const ManagedDraining = { + DISABLED: "DISABLED", + ENABLED: "ENABLED", +}; +const ManagedScalingStatus = { + DISABLED: "DISABLED", + ENABLED: "ENABLED", +}; +const ManagedTerminationProtection = { + DISABLED: "DISABLED", + ENABLED: "ENABLED", +}; +const BareMetal = { + EXCLUDED: "excluded", + INCLUDED: "included", + REQUIRED: "required", +}; +const BurstablePerformance = { + EXCLUDED: "excluded", + INCLUDED: "included", + REQUIRED: "required", +}; +const CpuManufacturer = { + AMAZON_WEB_SERVICES: "amazon-web-services", + AMD: "amd", + INTEL: "intel", +}; +const InstanceGeneration = { + CURRENT: "current", + PREVIOUS: "previous", +}; +const LocalStorage = { + EXCLUDED: "excluded", + INCLUDED: "included", + REQUIRED: "required", +}; +const LocalStorageType = { + HDD: "hdd", + SSD: "ssd", +}; +const ManagedInstancesMonitoringOptions = { + BASIC: "BASIC", + DETAILED: "DETAILED", +}; +const PropagateMITags = { + CAPACITY_PROVIDER: "CAPACITY_PROVIDER", + NONE: "NONE", +}; +const CapacityProviderStatus = { + ACTIVE: "ACTIVE", + DEPROVISIONING: "DEPROVISIONING", + INACTIVE: "INACTIVE", + PROVISIONING: "PROVISIONING", +}; +const CapacityProviderType = { + EC2_AUTOSCALING: "EC2_AUTOSCALING", + FARGATE: "FARGATE", + FARGATE_SPOT: "FARGATE_SPOT", + MANAGED_INSTANCES: "MANAGED_INSTANCES", +}; +const CapacityProviderUpdateStatus = { + CREATE_COMPLETE: "CREATE_COMPLETE", + CREATE_FAILED: "CREATE_FAILED", + CREATE_IN_PROGRESS: "CREATE_IN_PROGRESS", + DELETE_COMPLETE: "DELETE_COMPLETE", + DELETE_FAILED: "DELETE_FAILED", + DELETE_IN_PROGRESS: "DELETE_IN_PROGRESS", + UPDATE_COMPLETE: "UPDATE_COMPLETE", + UPDATE_FAILED: "UPDATE_FAILED", + UPDATE_IN_PROGRESS: "UPDATE_IN_PROGRESS", +}; +class InvalidParameterException extends ECSServiceException { + name = "InvalidParameterException"; + $fault = "client"; + constructor(opts) { + super({ + name: "InvalidParameterException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, InvalidParameterException.prototype); + } +} +class LimitExceededException extends ECSServiceException { + name = "LimitExceededException"; + $fault = "client"; + constructor(opts) { + super({ + name: "LimitExceededException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, LimitExceededException.prototype); + } +} +class ServerException extends ECSServiceException { + name = "ServerException"; + $fault = "server"; + constructor(opts) { + super({ + name: "ServerException", + $fault: "server", + ...opts, + }); + Object.setPrototypeOf(this, ServerException.prototype); + } +} +class UnsupportedFeatureException extends ECSServiceException { + name = "UnsupportedFeatureException"; + $fault = "client"; + constructor(opts) { + super({ + name: "UnsupportedFeatureException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, UnsupportedFeatureException.prototype); + } +} +class UpdateInProgressException extends ECSServiceException { + name = "UpdateInProgressException"; + $fault = "client"; + constructor(opts) { + super({ + name: "UpdateInProgressException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, UpdateInProgressException.prototype); + } +} +const ExecuteCommandLogging = { + DEFAULT: "DEFAULT", + NONE: "NONE", + OVERRIDE: "OVERRIDE", }; +const ClusterSettingName = { + CONTAINER_INSIGHTS: "containerInsights", +}; +class NamespaceNotFoundException extends ECSServiceException { + name = "NamespaceNotFoundException"; + $fault = "client"; + constructor(opts) { + super({ + name: "NamespaceNotFoundException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, NamespaceNotFoundException.prototype); + } +} +const AvailabilityZoneRebalancing = { + DISABLED: "DISABLED", + ENABLED: "ENABLED", +}; +const DeploymentLifecycleHookStage = { + POST_PRODUCTION_TRAFFIC_SHIFT: "POST_PRODUCTION_TRAFFIC_SHIFT", + POST_SCALE_UP: "POST_SCALE_UP", + POST_TEST_TRAFFIC_SHIFT: "POST_TEST_TRAFFIC_SHIFT", + PRE_SCALE_UP: "PRE_SCALE_UP", + PRODUCTION_TRAFFIC_SHIFT: "PRODUCTION_TRAFFIC_SHIFT", + RECONCILE_SERVICE: "RECONCILE_SERVICE", + TEST_TRAFFIC_SHIFT: "TEST_TRAFFIC_SHIFT", +}; +const DeploymentStrategy = { + BLUE_GREEN: "BLUE_GREEN", + CANARY: "CANARY", + LINEAR: "LINEAR", + ROLLING: "ROLLING", +}; +const DeploymentControllerType = { + CODE_DEPLOY: "CODE_DEPLOY", + ECS: "ECS", + EXTERNAL: "EXTERNAL", +}; +const LaunchType = { + EC2: "EC2", + EXTERNAL: "EXTERNAL", + FARGATE: "FARGATE", + MANAGED_INSTANCES: "MANAGED_INSTANCES", +}; +const AssignPublicIp = { + DISABLED: "DISABLED", + ENABLED: "ENABLED", +}; +const PlacementConstraintType = { + DISTINCT_INSTANCE: "distinctInstance", + MEMBER_OF: "memberOf", +}; +const PlacementStrategyType = { + BINPACK: "binpack", + RANDOM: "random", + SPREAD: "spread", +}; +const PropagateTags = { + NONE: "NONE", + SERVICE: "SERVICE", + TASK_DEFINITION: "TASK_DEFINITION", +}; +const SchedulingStrategy = { + DAEMON: "DAEMON", + REPLICA: "REPLICA", +}; +const ServiceConnectAccessLoggingFormat = { + JSON: "JSON", + TEXT: "TEXT", +}; +const ServiceConnectIncludeQueryParameters = { + DISABLED: "DISABLED", + ENABLED: "ENABLED", +}; +const LogDriver = { + AWSFIRELENS: "awsfirelens", + AWSLOGS: "awslogs", + FLUENTD: "fluentd", + GELF: "gelf", + JOURNALD: "journald", + JSON_FILE: "json-file", + SPLUNK: "splunk", + SYSLOG: "syslog", +}; +const TaskFilesystemType = { + EXT3: "ext3", + EXT4: "ext4", + NTFS: "ntfs", + XFS: "xfs", +}; +const EBSResourceType = { + VOLUME: "volume", +}; +const DeploymentRolloutState = { + COMPLETED: "COMPLETED", + FAILED: "FAILED", + IN_PROGRESS: "IN_PROGRESS", +}; +const ScaleUnit = { + PERCENT: "PERCENT", +}; +const StabilityStatus = { + STABILIZING: "STABILIZING", + STEADY_STATE: "STEADY_STATE", +}; +class PlatformTaskDefinitionIncompatibilityException extends ECSServiceException { + name = "PlatformTaskDefinitionIncompatibilityException"; + $fault = "client"; + constructor(opts) { + super({ + name: "PlatformTaskDefinitionIncompatibilityException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, PlatformTaskDefinitionIncompatibilityException.prototype); + } +} +class PlatformUnknownException extends ECSServiceException { + name = "PlatformUnknownException"; + $fault = "client"; + constructor(opts) { + super({ + name: "PlatformUnknownException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, PlatformUnknownException.prototype); + } +} +class ServiceNotActiveException extends ECSServiceException { + name = "ServiceNotActiveException"; + $fault = "client"; + constructor(opts) { + super({ + name: "ServiceNotActiveException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ServiceNotActiveException.prototype); + } +} +class ServiceNotFoundException extends ECSServiceException { + name = "ServiceNotFoundException"; + $fault = "client"; + constructor(opts) { + super({ + name: "ServiceNotFoundException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ServiceNotFoundException.prototype); + } +} +const SettingName = { + AWSVPC_TRUNKING: "awsvpcTrunking", + CONTAINER_INSIGHTS: "containerInsights", + CONTAINER_INSTANCE_LONG_ARN_FORMAT: "containerInstanceLongArnFormat", + DEFAULT_LOG_DRIVER_MODE: "defaultLogDriverMode", + FARGATE_FIPS_MODE: "fargateFIPSMode", + FARGATE_TASK_RETIREMENT_WAIT_PERIOD: "fargateTaskRetirementWaitPeriod", + GUARD_DUTY_ACTIVATE: "guardDutyActivate", + SERVICE_LONG_ARN_FORMAT: "serviceLongArnFormat", + TAG_RESOURCE_AUTHORIZATION: "tagResourceAuthorization", + TASK_LONG_ARN_FORMAT: "taskLongArnFormat", +}; +const SettingType = { + AWS_MANAGED: "aws_managed", + USER: "user", +}; +const TargetType = { + CONTAINER_INSTANCE: "container-instance", +}; +class TargetNotFoundException extends ECSServiceException { + name = "TargetNotFoundException"; + $fault = "client"; + constructor(opts) { + super({ + name: "TargetNotFoundException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, TargetNotFoundException.prototype); + } +} +class ClusterContainsCapacityProviderException extends ECSServiceException { + name = "ClusterContainsCapacityProviderException"; + $fault = "client"; + constructor(opts) { + super({ + name: "ClusterContainsCapacityProviderException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ClusterContainsCapacityProviderException.prototype); + } +} +class ClusterContainsContainerInstancesException extends ECSServiceException { + name = "ClusterContainsContainerInstancesException"; + $fault = "client"; + constructor(opts) { + super({ + name: "ClusterContainsContainerInstancesException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ClusterContainsContainerInstancesException.prototype); + } +} +class ClusterContainsServicesException extends ECSServiceException { + name = "ClusterContainsServicesException"; + $fault = "client"; + constructor(opts) { + super({ + name: "ClusterContainsServicesException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ClusterContainsServicesException.prototype); + } +} +class ClusterContainsTasksException extends ECSServiceException { + name = "ClusterContainsTasksException"; + $fault = "client"; + constructor(opts) { + super({ + name: "ClusterContainsTasksException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ClusterContainsTasksException.prototype); + } +} +const Compatibility = { + EC2: "EC2", + EXTERNAL: "EXTERNAL", + FARGATE: "FARGATE", + MANAGED_INSTANCES: "MANAGED_INSTANCES", +}; +const ContainerCondition = { + COMPLETE: "COMPLETE", + HEALTHY: "HEALTHY", + START: "START", + SUCCESS: "SUCCESS", +}; +const EnvironmentFileType = { + S3: "s3", +}; +const FirelensConfigurationType = { + FLUENTBIT: "fluentbit", + FLUENTD: "fluentd", +}; +const DeviceCgroupPermission = { + MKNOD: "mknod", + READ: "read", + WRITE: "write", +}; +const ApplicationProtocol = { + GRPC: "grpc", + HTTP: "http", + HTTP2: "http2", +}; +const TransportProtocol = { + TCP: "tcp", + UDP: "udp", +}; +const ResourceType = { + GPU: "GPU", + INFERENCE_ACCELERATOR: "InferenceAccelerator", +}; +const UlimitName = { + CORE: "core", + CPU: "cpu", + DATA: "data", + FSIZE: "fsize", + LOCKS: "locks", + MEMLOCK: "memlock", + MSGQUEUE: "msgqueue", + NICE: "nice", + NOFILE: "nofile", + NPROC: "nproc", + RSS: "rss", + RTPRIO: "rtprio", + RTTIME: "rttime", + SIGPENDING: "sigpending", + STACK: "stack", +}; +const VersionConsistency = { + DISABLED: "disabled", + ENABLED: "enabled", +}; +const IpcMode = { + HOST: "host", + NONE: "none", + TASK: "task", +}; +const NetworkMode = { + AWSVPC: "awsvpc", + BRIDGE: "bridge", + HOST: "host", + NONE: "none", +}; +const PidMode = { + HOST: "host", + TASK: "task", +}; +const TaskDefinitionPlacementConstraintType = { + MEMBER_OF: "memberOf", +}; +const ProxyConfigurationType = { + APPMESH: "APPMESH", +}; +const CPUArchitecture = { + ARM64: "ARM64", + X86_64: "X86_64", +}; +const OSFamily = { + LINUX: "LINUX", + WINDOWS_SERVER_2004_CORE: "WINDOWS_SERVER_2004_CORE", + WINDOWS_SERVER_2016_FULL: "WINDOWS_SERVER_2016_FULL", + WINDOWS_SERVER_2019_CORE: "WINDOWS_SERVER_2019_CORE", + WINDOWS_SERVER_2019_FULL: "WINDOWS_SERVER_2019_FULL", + WINDOWS_SERVER_2022_CORE: "WINDOWS_SERVER_2022_CORE", + WINDOWS_SERVER_2022_FULL: "WINDOWS_SERVER_2022_FULL", + WINDOWS_SERVER_2025_CORE: "WINDOWS_SERVER_2025_CORE", + WINDOWS_SERVER_2025_FULL: "WINDOWS_SERVER_2025_FULL", + WINDOWS_SERVER_20H2_CORE: "WINDOWS_SERVER_20H2_CORE", +}; +const TaskDefinitionStatus = { + ACTIVE: "ACTIVE", + DELETE_IN_PROGRESS: "DELETE_IN_PROGRESS", + INACTIVE: "INACTIVE", +}; +const Scope = { + SHARED: "shared", + TASK: "task", +}; +const EFSAuthorizationConfigIAM = { + DISABLED: "DISABLED", + ENABLED: "ENABLED", +}; +const EFSTransitEncryption = { + DISABLED: "DISABLED", + ENABLED: "ENABLED", +}; +class TaskSetNotFoundException extends ECSServiceException { + name = "TaskSetNotFoundException"; + $fault = "client"; + constructor(opts) { + super({ + name: "TaskSetNotFoundException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, TaskSetNotFoundException.prototype); + } +} +const InstanceHealthCheckState = { + IMPAIRED: "IMPAIRED", + INITIALIZING: "INITIALIZING", + INSUFFICIENT_DATA: "INSUFFICIENT_DATA", + OK: "OK", +}; +const InstanceHealthCheckType = { + CONTAINER_RUNTIME: "CONTAINER_RUNTIME", +}; +const CapacityProviderField = { + TAGS: "TAGS", +}; +const ClusterField = { + ATTACHMENTS: "ATTACHMENTS", + CONFIGURATIONS: "CONFIGURATIONS", + SETTINGS: "SETTINGS", + STATISTICS: "STATISTICS", + TAGS: "TAGS", +}; +const ContainerInstanceField = { + CONTAINER_INSTANCE_HEALTH: "CONTAINER_INSTANCE_HEALTH", + TAGS: "TAGS", +}; +const ServiceDeploymentRollbackMonitorsStatus = { + DISABLED: "DISABLED", + MONITORING: "MONITORING", + MONITORING_COMPLETE: "MONITORING_COMPLETE", + TRIGGERED: "TRIGGERED", +}; +const ServiceDeploymentLifecycleStage = { + BAKE_TIME: "BAKE_TIME", + CLEAN_UP: "CLEAN_UP", + POST_PRODUCTION_TRAFFIC_SHIFT: "POST_PRODUCTION_TRAFFIC_SHIFT", + POST_SCALE_UP: "POST_SCALE_UP", + POST_TEST_TRAFFIC_SHIFT: "POST_TEST_TRAFFIC_SHIFT", + PRE_SCALE_UP: "PRE_SCALE_UP", + PRODUCTION_TRAFFIC_SHIFT: "PRODUCTION_TRAFFIC_SHIFT", + RECONCILE_SERVICE: "RECONCILE_SERVICE", + SCALE_UP: "SCALE_UP", + TEST_TRAFFIC_SHIFT: "TEST_TRAFFIC_SHIFT", +}; +const ServiceDeploymentStatus = { + IN_PROGRESS: "IN_PROGRESS", + PENDING: "PENDING", + ROLLBACK_FAILED: "ROLLBACK_FAILED", + ROLLBACK_IN_PROGRESS: "ROLLBACK_IN_PROGRESS", + ROLLBACK_REQUESTED: "ROLLBACK_REQUESTED", + ROLLBACK_SUCCESSFUL: "ROLLBACK_SUCCESSFUL", + STOPPED: "STOPPED", + STOP_REQUESTED: "STOP_REQUESTED", + SUCCESSFUL: "SUCCESSFUL", +}; +const ServiceField = { + TAGS: "TAGS", +}; +const TaskDefinitionField = { + TAGS: "TAGS", +}; +const TaskField = { + TAGS: "TAGS", +}; +const Connectivity = { + CONNECTED: "CONNECTED", + DISCONNECTED: "DISCONNECTED", +}; +const HealthStatus = { + HEALTHY: "HEALTHY", + UNHEALTHY: "UNHEALTHY", + UNKNOWN: "UNKNOWN", +}; +const ManagedAgentName = { + ExecuteCommandAgent: "ExecuteCommandAgent", +}; +const TaskStopCode = { + ESSENTIAL_CONTAINER_EXITED: "EssentialContainerExited", + SERVICE_SCHEDULER_INITIATED: "ServiceSchedulerInitiated", + SPOT_INTERRUPTION: "SpotInterruption", + TASK_FAILED_TO_START: "TaskFailedToStart", + TERMINATION_NOTICE: "TerminationNotice", + USER_INITIATED: "UserInitiated", +}; +const TaskSetField = { + TAGS: "TAGS", +}; +class TargetNotConnectedException extends ECSServiceException { + name = "TargetNotConnectedException"; + $fault = "client"; + constructor(opts) { + super({ + name: "TargetNotConnectedException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, TargetNotConnectedException.prototype); + } +} +class ResourceNotFoundException extends ECSServiceException { + name = "ResourceNotFoundException"; + $fault = "client"; + constructor(opts) { + super({ + name: "ResourceNotFoundException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ResourceNotFoundException.prototype); + } +} +const ContainerInstanceStatus = { + ACTIVE: "ACTIVE", + DEREGISTERING: "DEREGISTERING", + DRAINING: "DRAINING", + REGISTERING: "REGISTERING", + REGISTRATION_FAILED: "REGISTRATION_FAILED", +}; +const TaskDefinitionFamilyStatus = { + ACTIVE: "ACTIVE", + ALL: "ALL", + INACTIVE: "INACTIVE", +}; +const SortOrder = { + ASC: "ASC", + DESC: "DESC", +}; +const SessionFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.tokenValue && { tokenValue: smithyClient.SENSITIVE_STRING }), +}); +const ExecuteCommandResponseFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.session && { session: SessionFilterSensitiveLog(obj.session) }), +}); -// src/models/models_0.ts - -var AccessDeniedException = class _AccessDeniedException extends ECSServiceException { - static { - __name(this, "AccessDeniedException"); - } - name = "AccessDeniedException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "AccessDeniedException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _AccessDeniedException.prototype); - } +const DesiredStatus = { + PENDING: "PENDING", + RUNNING: "RUNNING", + STOPPED: "STOPPED", +}; +class AttributeLimitExceededException extends ECSServiceException { + name = "AttributeLimitExceededException"; + $fault = "client"; + constructor(opts) { + super({ + name: "AttributeLimitExceededException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, AttributeLimitExceededException.prototype); + } +} +class ResourceInUseException extends ECSServiceException { + name = "ResourceInUseException"; + $fault = "client"; + constructor(opts) { + super({ + name: "ResourceInUseException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ResourceInUseException.prototype); + } +} +const PlatformDeviceType = { + GPU: "GPU", }; -var AgentUpdateStatus = { - FAILED: "FAILED", - PENDING: "PENDING", - STAGED: "STAGED", - STAGING: "STAGING", - UPDATED: "UPDATED", - UPDATING: "UPDATING" +class BlockedException extends ECSServiceException { + name = "BlockedException"; + $fault = "client"; + constructor(opts) { + super({ + name: "BlockedException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, BlockedException.prototype); + } +} +class ConflictException extends ECSServiceException { + name = "ConflictException"; + $fault = "client"; + resourceIds; + constructor(opts) { + super({ + name: "ConflictException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ConflictException.prototype); + this.resourceIds = opts.resourceIds; + } +} +class ServiceDeploymentNotFoundException extends ECSServiceException { + name = "ServiceDeploymentNotFoundException"; + $fault = "client"; + constructor(opts) { + super({ + name: "ServiceDeploymentNotFoundException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, ServiceDeploymentNotFoundException.prototype); + } +} +const StopServiceDeploymentStopType = { + ABORT: "ABORT", + ROLLBACK: "ROLLBACK", }; -var ClientException = class _ClientException extends ECSServiceException { - static { - __name(this, "ClientException"); - } - name = "ClientException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ClientException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ClientException.prototype); - } +class MissingVersionException extends ECSServiceException { + name = "MissingVersionException"; + $fault = "client"; + constructor(opts) { + super({ + name: "MissingVersionException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, MissingVersionException.prototype); + } +} +class NoUpdateAvailableException extends ECSServiceException { + name = "NoUpdateAvailableException"; + $fault = "client"; + constructor(opts) { + super({ + name: "NoUpdateAvailableException", + $fault: "client", + ...opts, + }); + Object.setPrototypeOf(this, NoUpdateAvailableException.prototype); + } +} + +const se_CreateCapacityProviderCommand = async (input, context) => { + const headers = sharedHeaders("CreateCapacityProvider"); + let body; + body = JSON.stringify(se_CreateCapacityProviderRequest(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_CreateClusterCommand = async (input, context) => { + const headers = sharedHeaders("CreateCluster"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_CreateServiceCommand = async (input, context) => { + const headers = sharedHeaders("CreateService"); + let body; + body = JSON.stringify(se_CreateServiceRequest(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_CreateTaskSetCommand = async (input, context) => { + const headers = sharedHeaders("CreateTaskSet"); + let body; + body = JSON.stringify(se_CreateTaskSetRequest(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DeleteAccountSettingCommand = async (input, context) => { + const headers = sharedHeaders("DeleteAccountSetting"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DeleteAttributesCommand = async (input, context) => { + const headers = sharedHeaders("DeleteAttributes"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DeleteCapacityProviderCommand = async (input, context) => { + const headers = sharedHeaders("DeleteCapacityProvider"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DeleteClusterCommand = async (input, context) => { + const headers = sharedHeaders("DeleteCluster"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DeleteServiceCommand = async (input, context) => { + const headers = sharedHeaders("DeleteService"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DeleteTaskDefinitionsCommand = async (input, context) => { + const headers = sharedHeaders("DeleteTaskDefinitions"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DeleteTaskSetCommand = async (input, context) => { + const headers = sharedHeaders("DeleteTaskSet"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DeregisterContainerInstanceCommand = async (input, context) => { + const headers = sharedHeaders("DeregisterContainerInstance"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DeregisterTaskDefinitionCommand = async (input, context) => { + const headers = sharedHeaders("DeregisterTaskDefinition"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DescribeCapacityProvidersCommand = async (input, context) => { + const headers = sharedHeaders("DescribeCapacityProviders"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DescribeClustersCommand = async (input, context) => { + const headers = sharedHeaders("DescribeClusters"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DescribeContainerInstancesCommand = async (input, context) => { + const headers = sharedHeaders("DescribeContainerInstances"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DescribeServiceDeploymentsCommand = async (input, context) => { + const headers = sharedHeaders("DescribeServiceDeployments"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DescribeServiceRevisionsCommand = async (input, context) => { + const headers = sharedHeaders("DescribeServiceRevisions"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DescribeServicesCommand = async (input, context) => { + const headers = sharedHeaders("DescribeServices"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DescribeTaskDefinitionCommand = async (input, context) => { + const headers = sharedHeaders("DescribeTaskDefinition"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DescribeTasksCommand = async (input, context) => { + const headers = sharedHeaders("DescribeTasks"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DescribeTaskSetsCommand = async (input, context) => { + const headers = sharedHeaders("DescribeTaskSets"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_DiscoverPollEndpointCommand = async (input, context) => { + const headers = sharedHeaders("DiscoverPollEndpoint"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_ExecuteCommandCommand = async (input, context) => { + const headers = sharedHeaders("ExecuteCommand"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_GetTaskProtectionCommand = async (input, context) => { + const headers = sharedHeaders("GetTaskProtection"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_ListAccountSettingsCommand = async (input, context) => { + const headers = sharedHeaders("ListAccountSettings"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_ListAttributesCommand = async (input, context) => { + const headers = sharedHeaders("ListAttributes"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_ListClustersCommand = async (input, context) => { + const headers = sharedHeaders("ListClusters"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_ListContainerInstancesCommand = async (input, context) => { + const headers = sharedHeaders("ListContainerInstances"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_ListServiceDeploymentsCommand = async (input, context) => { + const headers = sharedHeaders("ListServiceDeployments"); + let body; + body = JSON.stringify(se_ListServiceDeploymentsRequest(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_ListServicesCommand = async (input, context) => { + const headers = sharedHeaders("ListServices"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_ListServicesByNamespaceCommand = async (input, context) => { + const headers = sharedHeaders("ListServicesByNamespace"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_ListTagsForResourceCommand = async (input, context) => { + const headers = sharedHeaders("ListTagsForResource"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_ListTaskDefinitionFamiliesCommand = async (input, context) => { + const headers = sharedHeaders("ListTaskDefinitionFamilies"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_ListTaskDefinitionsCommand = async (input, context) => { + const headers = sharedHeaders("ListTaskDefinitions"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_ListTasksCommand = async (input, context) => { + const headers = sharedHeaders("ListTasks"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_PutAccountSettingCommand = async (input, context) => { + const headers = sharedHeaders("PutAccountSetting"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_PutAccountSettingDefaultCommand = async (input, context) => { + const headers = sharedHeaders("PutAccountSettingDefault"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_PutAttributesCommand = async (input, context) => { + const headers = sharedHeaders("PutAttributes"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_PutClusterCapacityProvidersCommand = async (input, context) => { + const headers = sharedHeaders("PutClusterCapacityProviders"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_RegisterContainerInstanceCommand = async (input, context) => { + const headers = sharedHeaders("RegisterContainerInstance"); + let body; + body = JSON.stringify(se_RegisterContainerInstanceRequest(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_RegisterTaskDefinitionCommand = async (input, context) => { + const headers = sharedHeaders("RegisterTaskDefinition"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_RunTaskCommand = async (input, context) => { + const headers = sharedHeaders("RunTask"); + let body; + body = JSON.stringify(se_RunTaskRequest(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_StartTaskCommand = async (input, context) => { + const headers = sharedHeaders("StartTask"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_StopServiceDeploymentCommand = async (input, context) => { + const headers = sharedHeaders("StopServiceDeployment"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_StopTaskCommand = async (input, context) => { + const headers = sharedHeaders("StopTask"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_SubmitAttachmentStateChangesCommand = async (input, context) => { + const headers = sharedHeaders("SubmitAttachmentStateChanges"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_SubmitContainerStateChangeCommand = async (input, context) => { + const headers = sharedHeaders("SubmitContainerStateChange"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_SubmitTaskStateChangeCommand = async (input, context) => { + const headers = sharedHeaders("SubmitTaskStateChange"); + let body; + body = JSON.stringify(se_SubmitTaskStateChangeRequest(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_TagResourceCommand = async (input, context) => { + const headers = sharedHeaders("TagResource"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_UntagResourceCommand = async (input, context) => { + const headers = sharedHeaders("UntagResource"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_UpdateCapacityProviderCommand = async (input, context) => { + const headers = sharedHeaders("UpdateCapacityProvider"); + let body; + body = JSON.stringify(se_UpdateCapacityProviderRequest(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_UpdateClusterCommand = async (input, context) => { + const headers = sharedHeaders("UpdateCluster"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_UpdateClusterSettingsCommand = async (input, context) => { + const headers = sharedHeaders("UpdateClusterSettings"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_UpdateContainerAgentCommand = async (input, context) => { + const headers = sharedHeaders("UpdateContainerAgent"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_UpdateContainerInstancesStateCommand = async (input, context) => { + const headers = sharedHeaders("UpdateContainerInstancesState"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_UpdateServiceCommand = async (input, context) => { + const headers = sharedHeaders("UpdateService"); + let body; + body = JSON.stringify(se_UpdateServiceRequest(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_UpdateServicePrimaryTaskSetCommand = async (input, context) => { + const headers = sharedHeaders("UpdateServicePrimaryTaskSet"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_UpdateTaskProtectionCommand = async (input, context) => { + const headers = sharedHeaders("UpdateTaskProtection"); + let body; + body = JSON.stringify(smithyClient._json(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const se_UpdateTaskSetCommand = async (input, context) => { + const headers = sharedHeaders("UpdateTaskSet"); + let body; + body = JSON.stringify(se_UpdateTaskSetRequest(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +const de_CreateCapacityProviderCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_CreateCapacityProviderResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ManagedDraining = { - DISABLED: "DISABLED", - ENABLED: "ENABLED" +const de_CreateClusterCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ManagedScalingStatus = { - DISABLED: "DISABLED", - ENABLED: "ENABLED" +const de_CreateServiceCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_CreateServiceResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ManagedTerminationProtection = { - DISABLED: "DISABLED", - ENABLED: "ENABLED" +const de_CreateTaskSetCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_CreateTaskSetResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var CapacityProviderStatus = { - ACTIVE: "ACTIVE", - INACTIVE: "INACTIVE" +const de_DeleteAccountSettingCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var CapacityProviderUpdateStatus = { - DELETE_COMPLETE: "DELETE_COMPLETE", - DELETE_FAILED: "DELETE_FAILED", - DELETE_IN_PROGRESS: "DELETE_IN_PROGRESS", - UPDATE_COMPLETE: "UPDATE_COMPLETE", - UPDATE_FAILED: "UPDATE_FAILED", - UPDATE_IN_PROGRESS: "UPDATE_IN_PROGRESS" +const de_DeleteAttributesCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var InvalidParameterException = class _InvalidParameterException extends ECSServiceException { - static { - __name(this, "InvalidParameterException"); - } - name = "InvalidParameterException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "InvalidParameterException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _InvalidParameterException.prototype); - } +const de_DeleteCapacityProviderCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DeleteCapacityProviderResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var LimitExceededException = class _LimitExceededException extends ECSServiceException { - static { - __name(this, "LimitExceededException"); - } - name = "LimitExceededException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "LimitExceededException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _LimitExceededException.prototype); - } +const de_DeleteClusterCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ServerException = class _ServerException extends ECSServiceException { - static { - __name(this, "ServerException"); - } - name = "ServerException"; - $fault = "server"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ServerException", - $fault: "server", - ...opts - }); - Object.setPrototypeOf(this, _ServerException.prototype); - } +const de_DeleteServiceCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DeleteServiceResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var UpdateInProgressException = class _UpdateInProgressException extends ECSServiceException { - static { - __name(this, "UpdateInProgressException"); - } - name = "UpdateInProgressException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "UpdateInProgressException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _UpdateInProgressException.prototype); - } +const de_DeleteTaskDefinitionsCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DeleteTaskDefinitionsResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ExecuteCommandLogging = { - DEFAULT: "DEFAULT", - NONE: "NONE", - OVERRIDE: "OVERRIDE" +const de_DeleteTaskSetCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DeleteTaskSetResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ClusterSettingName = { - CONTAINER_INSIGHTS: "containerInsights" +const de_DeregisterContainerInstanceCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DeregisterContainerInstanceResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var NamespaceNotFoundException = class _NamespaceNotFoundException extends ECSServiceException { - static { - __name(this, "NamespaceNotFoundException"); - } - name = "NamespaceNotFoundException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "NamespaceNotFoundException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _NamespaceNotFoundException.prototype); - } +const de_DeregisterTaskDefinitionCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DeregisterTaskDefinitionResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ClusterNotFoundException = class _ClusterNotFoundException extends ECSServiceException { - static { - __name(this, "ClusterNotFoundException"); - } - name = "ClusterNotFoundException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ClusterNotFoundException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ClusterNotFoundException.prototype); - } -}; -var AvailabilityZoneRebalancing = { - DISABLED: "DISABLED", - ENABLED: "ENABLED" -}; -var DeploymentLifecycleHookStage = { - POST_PRODUCTION_TRAFFIC_SHIFT: "POST_PRODUCTION_TRAFFIC_SHIFT", - POST_SCALE_UP: "POST_SCALE_UP", - POST_TEST_TRAFFIC_SHIFT: "POST_TEST_TRAFFIC_SHIFT", - PRE_SCALE_UP: "PRE_SCALE_UP", - PRODUCTION_TRAFFIC_SHIFT: "PRODUCTION_TRAFFIC_SHIFT", - RECONCILE_SERVICE: "RECONCILE_SERVICE", - TEST_TRAFFIC_SHIFT: "TEST_TRAFFIC_SHIFT" -}; -var DeploymentStrategy = { - BLUE_GREEN: "BLUE_GREEN", - ROLLING: "ROLLING" -}; -var DeploymentControllerType = { - CODE_DEPLOY: "CODE_DEPLOY", - ECS: "ECS", - EXTERNAL: "EXTERNAL" -}; -var LaunchType = { - EC2: "EC2", - EXTERNAL: "EXTERNAL", - FARGATE: "FARGATE" -}; -var AssignPublicIp = { - DISABLED: "DISABLED", - ENABLED: "ENABLED" -}; -var PlacementConstraintType = { - DISTINCT_INSTANCE: "distinctInstance", - MEMBER_OF: "memberOf" -}; -var PlacementStrategyType = { - BINPACK: "binpack", - RANDOM: "random", - SPREAD: "spread" -}; -var PropagateTags = { - NONE: "NONE", - SERVICE: "SERVICE", - TASK_DEFINITION: "TASK_DEFINITION" -}; -var SchedulingStrategy = { - DAEMON: "DAEMON", - REPLICA: "REPLICA" -}; -var LogDriver = { - AWSFIRELENS: "awsfirelens", - AWSLOGS: "awslogs", - FLUENTD: "fluentd", - GELF: "gelf", - JOURNALD: "journald", - JSON_FILE: "json-file", - SPLUNK: "splunk", - SYSLOG: "syslog" -}; -var TaskFilesystemType = { - EXT3: "ext3", - EXT4: "ext4", - NTFS: "ntfs", - XFS: "xfs" -}; -var EBSResourceType = { - VOLUME: "volume" -}; -var DeploymentRolloutState = { - COMPLETED: "COMPLETED", - FAILED: "FAILED", - IN_PROGRESS: "IN_PROGRESS" -}; -var ScaleUnit = { - PERCENT: "PERCENT" -}; -var StabilityStatus = { - STABILIZING: "STABILIZING", - STEADY_STATE: "STEADY_STATE" -}; -var PlatformTaskDefinitionIncompatibilityException = class _PlatformTaskDefinitionIncompatibilityException extends ECSServiceException { - static { - __name(this, "PlatformTaskDefinitionIncompatibilityException"); - } - name = "PlatformTaskDefinitionIncompatibilityException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "PlatformTaskDefinitionIncompatibilityException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _PlatformTaskDefinitionIncompatibilityException.prototype); - } +const de_DescribeCapacityProvidersCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DescribeCapacityProvidersResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var PlatformUnknownException = class _PlatformUnknownException extends ECSServiceException { - static { - __name(this, "PlatformUnknownException"); - } - name = "PlatformUnknownException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "PlatformUnknownException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _PlatformUnknownException.prototype); - } +const de_DescribeClustersCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var UnsupportedFeatureException = class _UnsupportedFeatureException extends ECSServiceException { - static { - __name(this, "UnsupportedFeatureException"); - } - name = "UnsupportedFeatureException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "UnsupportedFeatureException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _UnsupportedFeatureException.prototype); - } +const de_DescribeContainerInstancesCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DescribeContainerInstancesResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ServiceNotActiveException = class _ServiceNotActiveException extends ECSServiceException { - static { - __name(this, "ServiceNotActiveException"); - } - name = "ServiceNotActiveException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ServiceNotActiveException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ServiceNotActiveException.prototype); - } +const de_DescribeServiceDeploymentsCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DescribeServiceDeploymentsResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ServiceNotFoundException = class _ServiceNotFoundException extends ECSServiceException { - static { - __name(this, "ServiceNotFoundException"); - } - name = "ServiceNotFoundException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ServiceNotFoundException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ServiceNotFoundException.prototype); - } -}; -var SettingName = { - AWSVPC_TRUNKING: "awsvpcTrunking", - CONTAINER_INSIGHTS: "containerInsights", - CONTAINER_INSTANCE_LONG_ARN_FORMAT: "containerInstanceLongArnFormat", - DEFAULT_LOG_DRIVER_MODE: "defaultLogDriverMode", - FARGATE_FIPS_MODE: "fargateFIPSMode", - FARGATE_TASK_RETIREMENT_WAIT_PERIOD: "fargateTaskRetirementWaitPeriod", - GUARD_DUTY_ACTIVATE: "guardDutyActivate", - SERVICE_LONG_ARN_FORMAT: "serviceLongArnFormat", - TAG_RESOURCE_AUTHORIZATION: "tagResourceAuthorization", - TASK_LONG_ARN_FORMAT: "taskLongArnFormat" -}; -var SettingType = { - AWS_MANAGED: "aws_managed", - USER: "user" -}; -var TargetType = { - CONTAINER_INSTANCE: "container-instance" -}; -var TargetNotFoundException = class _TargetNotFoundException extends ECSServiceException { - static { - __name(this, "TargetNotFoundException"); - } - name = "TargetNotFoundException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "TargetNotFoundException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _TargetNotFoundException.prototype); - } +const de_DescribeServiceRevisionsCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DescribeServiceRevisionsResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ClusterContainsContainerInstancesException = class _ClusterContainsContainerInstancesException extends ECSServiceException { - static { - __name(this, "ClusterContainsContainerInstancesException"); - } - name = "ClusterContainsContainerInstancesException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ClusterContainsContainerInstancesException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ClusterContainsContainerInstancesException.prototype); - } +const de_DescribeServicesCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DescribeServicesResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ClusterContainsServicesException = class _ClusterContainsServicesException extends ECSServiceException { - static { - __name(this, "ClusterContainsServicesException"); - } - name = "ClusterContainsServicesException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ClusterContainsServicesException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ClusterContainsServicesException.prototype); - } +const de_DescribeTaskDefinitionCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DescribeTaskDefinitionResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ClusterContainsTasksException = class _ClusterContainsTasksException extends ECSServiceException { - static { - __name(this, "ClusterContainsTasksException"); - } - name = "ClusterContainsTasksException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ClusterContainsTasksException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ClusterContainsTasksException.prototype); - } -}; -var Compatibility = { - EC2: "EC2", - EXTERNAL: "EXTERNAL", - FARGATE: "FARGATE" -}; -var ContainerCondition = { - COMPLETE: "COMPLETE", - HEALTHY: "HEALTHY", - START: "START", - SUCCESS: "SUCCESS" -}; -var EnvironmentFileType = { - S3: "s3" -}; -var FirelensConfigurationType = { - FLUENTBIT: "fluentbit", - FLUENTD: "fluentd" -}; -var DeviceCgroupPermission = { - MKNOD: "mknod", - READ: "read", - WRITE: "write" -}; -var ApplicationProtocol = { - GRPC: "grpc", - HTTP: "http", - HTTP2: "http2" -}; -var TransportProtocol = { - TCP: "tcp", - UDP: "udp" -}; -var ResourceType = { - GPU: "GPU", - INFERENCE_ACCELERATOR: "InferenceAccelerator" -}; -var UlimitName = { - CORE: "core", - CPU: "cpu", - DATA: "data", - FSIZE: "fsize", - LOCKS: "locks", - MEMLOCK: "memlock", - MSGQUEUE: "msgqueue", - NICE: "nice", - NOFILE: "nofile", - NPROC: "nproc", - RSS: "rss", - RTPRIO: "rtprio", - RTTIME: "rttime", - SIGPENDING: "sigpending", - STACK: "stack" -}; -var VersionConsistency = { - DISABLED: "disabled", - ENABLED: "enabled" -}; -var IpcMode = { - HOST: "host", - NONE: "none", - TASK: "task" -}; -var NetworkMode = { - AWSVPC: "awsvpc", - BRIDGE: "bridge", - HOST: "host", - NONE: "none" -}; -var PidMode = { - HOST: "host", - TASK: "task" -}; -var TaskDefinitionPlacementConstraintType = { - MEMBER_OF: "memberOf" -}; -var ProxyConfigurationType = { - APPMESH: "APPMESH" -}; -var CPUArchitecture = { - ARM64: "ARM64", - X86_64: "X86_64" -}; -var OSFamily = { - LINUX: "LINUX", - WINDOWS_SERVER_2004_CORE: "WINDOWS_SERVER_2004_CORE", - WINDOWS_SERVER_2016_FULL: "WINDOWS_SERVER_2016_FULL", - WINDOWS_SERVER_2019_CORE: "WINDOWS_SERVER_2019_CORE", - WINDOWS_SERVER_2019_FULL: "WINDOWS_SERVER_2019_FULL", - WINDOWS_SERVER_2022_CORE: "WINDOWS_SERVER_2022_CORE", - WINDOWS_SERVER_2022_FULL: "WINDOWS_SERVER_2022_FULL", - WINDOWS_SERVER_2025_CORE: "WINDOWS_SERVER_2025_CORE", - WINDOWS_SERVER_2025_FULL: "WINDOWS_SERVER_2025_FULL", - WINDOWS_SERVER_20H2_CORE: "WINDOWS_SERVER_20H2_CORE" -}; -var TaskDefinitionStatus = { - ACTIVE: "ACTIVE", - DELETE_IN_PROGRESS: "DELETE_IN_PROGRESS", - INACTIVE: "INACTIVE" -}; -var Scope = { - SHARED: "shared", - TASK: "task" -}; -var EFSAuthorizationConfigIAM = { - DISABLED: "DISABLED", - ENABLED: "ENABLED" -}; -var EFSTransitEncryption = { - DISABLED: "DISABLED", - ENABLED: "ENABLED" -}; -var TaskSetNotFoundException = class _TaskSetNotFoundException extends ECSServiceException { - static { - __name(this, "TaskSetNotFoundException"); - } - name = "TaskSetNotFoundException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "TaskSetNotFoundException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _TaskSetNotFoundException.prototype); - } -}; -var InstanceHealthCheckState = { - IMPAIRED: "IMPAIRED", - INITIALIZING: "INITIALIZING", - INSUFFICIENT_DATA: "INSUFFICIENT_DATA", - OK: "OK" -}; -var InstanceHealthCheckType = { - CONTAINER_RUNTIME: "CONTAINER_RUNTIME" -}; -var CapacityProviderField = { - TAGS: "TAGS" -}; -var ClusterField = { - ATTACHMENTS: "ATTACHMENTS", - CONFIGURATIONS: "CONFIGURATIONS", - SETTINGS: "SETTINGS", - STATISTICS: "STATISTICS", - TAGS: "TAGS" -}; -var ContainerInstanceField = { - CONTAINER_INSTANCE_HEALTH: "CONTAINER_INSTANCE_HEALTH", - TAGS: "TAGS" -}; -var ServiceDeploymentRollbackMonitorsStatus = { - DISABLED: "DISABLED", - MONITORING: "MONITORING", - MONITORING_COMPLETE: "MONITORING_COMPLETE", - TRIGGERED: "TRIGGERED" -}; -var ServiceDeploymentLifecycleStage = { - BAKE_TIME: "BAKE_TIME", - CLEAN_UP: "CLEAN_UP", - POST_PRODUCTION_TRAFFIC_SHIFT: "POST_PRODUCTION_TRAFFIC_SHIFT", - POST_SCALE_UP: "POST_SCALE_UP", - POST_TEST_TRAFFIC_SHIFT: "POST_TEST_TRAFFIC_SHIFT", - PRE_SCALE_UP: "PRE_SCALE_UP", - PRODUCTION_TRAFFIC_SHIFT: "PRODUCTION_TRAFFIC_SHIFT", - RECONCILE_SERVICE: "RECONCILE_SERVICE", - SCALE_UP: "SCALE_UP", - TEST_TRAFFIC_SHIFT: "TEST_TRAFFIC_SHIFT" -}; -var ServiceDeploymentStatus = { - IN_PROGRESS: "IN_PROGRESS", - PENDING: "PENDING", - ROLLBACK_FAILED: "ROLLBACK_FAILED", - ROLLBACK_IN_PROGRESS: "ROLLBACK_IN_PROGRESS", - ROLLBACK_REQUESTED: "ROLLBACK_REQUESTED", - ROLLBACK_SUCCESSFUL: "ROLLBACK_SUCCESSFUL", - STOPPED: "STOPPED", - STOP_REQUESTED: "STOP_REQUESTED", - SUCCESSFUL: "SUCCESSFUL" -}; -var ServiceField = { - TAGS: "TAGS" -}; -var TaskDefinitionField = { - TAGS: "TAGS" -}; -var TaskField = { - TAGS: "TAGS" -}; -var Connectivity = { - CONNECTED: "CONNECTED", - DISCONNECTED: "DISCONNECTED" -}; -var HealthStatus = { - HEALTHY: "HEALTHY", - UNHEALTHY: "UNHEALTHY", - UNKNOWN: "UNKNOWN" -}; -var ManagedAgentName = { - ExecuteCommandAgent: "ExecuteCommandAgent" -}; -var TaskStopCode = { - ESSENTIAL_CONTAINER_EXITED: "EssentialContainerExited", - SERVICE_SCHEDULER_INITIATED: "ServiceSchedulerInitiated", - SPOT_INTERRUPTION: "SpotInterruption", - TASK_FAILED_TO_START: "TaskFailedToStart", - TERMINATION_NOTICE: "TerminationNotice", - USER_INITIATED: "UserInitiated" -}; -var TaskSetField = { - TAGS: "TAGS" -}; -var TargetNotConnectedException = class _TargetNotConnectedException extends ECSServiceException { - static { - __name(this, "TargetNotConnectedException"); - } - name = "TargetNotConnectedException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "TargetNotConnectedException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _TargetNotConnectedException.prototype); - } +const de_DescribeTasksCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DescribeTasksResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ResourceNotFoundException = class _ResourceNotFoundException extends ECSServiceException { - static { - __name(this, "ResourceNotFoundException"); - } - name = "ResourceNotFoundException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ResourceNotFoundException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ResourceNotFoundException.prototype); - } +const de_DescribeTaskSetsCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_DescribeTaskSetsResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ContainerInstanceStatus = { - ACTIVE: "ACTIVE", - DEREGISTERING: "DEREGISTERING", - DRAINING: "DRAINING", - REGISTERING: "REGISTERING", - REGISTRATION_FAILED: "REGISTRATION_FAILED" +const de_DiscoverPollEndpointCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var TaskDefinitionFamilyStatus = { - ACTIVE: "ACTIVE", - ALL: "ALL", - INACTIVE: "INACTIVE" +const de_ExecuteCommandCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var SortOrder = { - ASC: "ASC", - DESC: "DESC" +const de_GetTaskProtectionCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_GetTaskProtectionResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var DesiredStatus = { - PENDING: "PENDING", - RUNNING: "RUNNING", - STOPPED: "STOPPED" +const de_ListAccountSettingsCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var AttributeLimitExceededException = class _AttributeLimitExceededException extends ECSServiceException { - static { - __name(this, "AttributeLimitExceededException"); - } - name = "AttributeLimitExceededException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "AttributeLimitExceededException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _AttributeLimitExceededException.prototype); - } +const de_ListAttributesCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ResourceInUseException = class _ResourceInUseException extends ECSServiceException { - static { - __name(this, "ResourceInUseException"); - } - name = "ResourceInUseException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ResourceInUseException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ResourceInUseException.prototype); - } +const de_ListClustersCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var PlatformDeviceType = { - GPU: "GPU" +const de_ListContainerInstancesCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var BlockedException = class _BlockedException extends ECSServiceException { - static { - __name(this, "BlockedException"); - } - name = "BlockedException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "BlockedException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _BlockedException.prototype); - } +const de_ListServiceDeploymentsCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_ListServiceDeploymentsResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ConflictException = class _ConflictException extends ECSServiceException { - static { - __name(this, "ConflictException"); - } - name = "ConflictException"; - $fault = "client"; - /** - *

The existing task ARNs which are already associated with the - * clientToken.

- * @public - */ - resourceIds; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ConflictException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ConflictException.prototype); - this.resourceIds = opts.resourceIds; - } +const de_ListServicesCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var ServiceDeploymentNotFoundException = class _ServiceDeploymentNotFoundException extends ECSServiceException { - static { - __name(this, "ServiceDeploymentNotFoundException"); - } - name = "ServiceDeploymentNotFoundException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ServiceDeploymentNotFoundException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ServiceDeploymentNotFoundException.prototype); - } +const de_ListServicesByNamespaceCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var StopServiceDeploymentStopType = { - ABORT: "ABORT", - ROLLBACK: "ROLLBACK" +const de_ListTagsForResourceCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var SessionFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.tokenValue && { tokenValue: import_smithy_client.SENSITIVE_STRING } -}), "SessionFilterSensitiveLog"); -var ExecuteCommandResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.session && { session: SessionFilterSensitiveLog(obj.session) } -}), "ExecuteCommandResponseFilterSensitiveLog"); - -// src/models/models_1.ts -var MissingVersionException = class _MissingVersionException extends ECSServiceException { - static { - __name(this, "MissingVersionException"); - } - name = "MissingVersionException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "MissingVersionException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _MissingVersionException.prototype); - } +const de_ListTaskDefinitionFamiliesCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; -var NoUpdateAvailableException = class _NoUpdateAvailableException extends ECSServiceException { - static { - __name(this, "NoUpdateAvailableException"); - } - name = "NoUpdateAvailableException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "NoUpdateAvailableException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _NoUpdateAvailableException.prototype); - } -}; - -// src/protocols/Aws_json1_1.ts -var se_CreateCapacityProviderCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("CreateCapacityProvider"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_CreateCapacityProviderCommand"); -var se_CreateClusterCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("CreateCluster"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_CreateClusterCommand"); -var se_CreateServiceCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("CreateService"); - let body; - body = JSON.stringify(se_CreateServiceRequest(input, context)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_CreateServiceCommand"); -var se_CreateTaskSetCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("CreateTaskSet"); - let body; - body = JSON.stringify(se_CreateTaskSetRequest(input, context)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_CreateTaskSetCommand"); -var se_DeleteAccountSettingCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DeleteAccountSetting"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DeleteAccountSettingCommand"); -var se_DeleteAttributesCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DeleteAttributes"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DeleteAttributesCommand"); -var se_DeleteCapacityProviderCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DeleteCapacityProvider"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DeleteCapacityProviderCommand"); -var se_DeleteClusterCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DeleteCluster"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DeleteClusterCommand"); -var se_DeleteServiceCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DeleteService"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DeleteServiceCommand"); -var se_DeleteTaskDefinitionsCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DeleteTaskDefinitions"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DeleteTaskDefinitionsCommand"); -var se_DeleteTaskSetCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DeleteTaskSet"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DeleteTaskSetCommand"); -var se_DeregisterContainerInstanceCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DeregisterContainerInstance"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DeregisterContainerInstanceCommand"); -var se_DeregisterTaskDefinitionCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DeregisterTaskDefinition"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DeregisterTaskDefinitionCommand"); -var se_DescribeCapacityProvidersCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DescribeCapacityProviders"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DescribeCapacityProvidersCommand"); -var se_DescribeClustersCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DescribeClusters"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DescribeClustersCommand"); -var se_DescribeContainerInstancesCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DescribeContainerInstances"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DescribeContainerInstancesCommand"); -var se_DescribeServiceDeploymentsCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DescribeServiceDeployments"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DescribeServiceDeploymentsCommand"); -var se_DescribeServiceRevisionsCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DescribeServiceRevisions"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DescribeServiceRevisionsCommand"); -var se_DescribeServicesCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DescribeServices"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DescribeServicesCommand"); -var se_DescribeTaskDefinitionCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DescribeTaskDefinition"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DescribeTaskDefinitionCommand"); -var se_DescribeTasksCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DescribeTasks"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DescribeTasksCommand"); -var se_DescribeTaskSetsCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DescribeTaskSets"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DescribeTaskSetsCommand"); -var se_DiscoverPollEndpointCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("DiscoverPollEndpoint"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_DiscoverPollEndpointCommand"); -var se_ExecuteCommandCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("ExecuteCommand"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_ExecuteCommandCommand"); -var se_GetTaskProtectionCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("GetTaskProtection"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_GetTaskProtectionCommand"); -var se_ListAccountSettingsCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("ListAccountSettings"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_ListAccountSettingsCommand"); -var se_ListAttributesCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("ListAttributes"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_ListAttributesCommand"); -var se_ListClustersCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("ListClusters"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_ListClustersCommand"); -var se_ListContainerInstancesCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("ListContainerInstances"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_ListContainerInstancesCommand"); -var se_ListServiceDeploymentsCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("ListServiceDeployments"); - let body; - body = JSON.stringify(se_ListServiceDeploymentsRequest(input, context)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_ListServiceDeploymentsCommand"); -var se_ListServicesCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("ListServices"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_ListServicesCommand"); -var se_ListServicesByNamespaceCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("ListServicesByNamespace"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_ListServicesByNamespaceCommand"); -var se_ListTagsForResourceCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("ListTagsForResource"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_ListTagsForResourceCommand"); -var se_ListTaskDefinitionFamiliesCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("ListTaskDefinitionFamilies"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_ListTaskDefinitionFamiliesCommand"); -var se_ListTaskDefinitionsCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("ListTaskDefinitions"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_ListTaskDefinitionsCommand"); -var se_ListTasksCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("ListTasks"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_ListTasksCommand"); -var se_PutAccountSettingCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("PutAccountSetting"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_PutAccountSettingCommand"); -var se_PutAccountSettingDefaultCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("PutAccountSettingDefault"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_PutAccountSettingDefaultCommand"); -var se_PutAttributesCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("PutAttributes"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_PutAttributesCommand"); -var se_PutClusterCapacityProvidersCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("PutClusterCapacityProviders"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_PutClusterCapacityProvidersCommand"); -var se_RegisterContainerInstanceCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("RegisterContainerInstance"); - let body; - body = JSON.stringify(se_RegisterContainerInstanceRequest(input, context)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_RegisterContainerInstanceCommand"); -var se_RegisterTaskDefinitionCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("RegisterTaskDefinition"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_RegisterTaskDefinitionCommand"); -var se_RunTaskCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("RunTask"); - let body; - body = JSON.stringify(se_RunTaskRequest(input, context)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_RunTaskCommand"); -var se_StartTaskCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("StartTask"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_StartTaskCommand"); -var se_StopServiceDeploymentCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("StopServiceDeployment"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_StopServiceDeploymentCommand"); -var se_StopTaskCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("StopTask"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_StopTaskCommand"); -var se_SubmitAttachmentStateChangesCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("SubmitAttachmentStateChanges"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_SubmitAttachmentStateChangesCommand"); -var se_SubmitContainerStateChangeCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("SubmitContainerStateChange"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_SubmitContainerStateChangeCommand"); -var se_SubmitTaskStateChangeCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("SubmitTaskStateChange"); - let body; - body = JSON.stringify(se_SubmitTaskStateChangeRequest(input, context)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_SubmitTaskStateChangeCommand"); -var se_TagResourceCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("TagResource"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_TagResourceCommand"); -var se_UntagResourceCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("UntagResource"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_UntagResourceCommand"); -var se_UpdateCapacityProviderCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("UpdateCapacityProvider"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_UpdateCapacityProviderCommand"); -var se_UpdateClusterCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("UpdateCluster"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_UpdateClusterCommand"); -var se_UpdateClusterSettingsCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("UpdateClusterSettings"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_UpdateClusterSettingsCommand"); -var se_UpdateContainerAgentCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("UpdateContainerAgent"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_UpdateContainerAgentCommand"); -var se_UpdateContainerInstancesStateCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("UpdateContainerInstancesState"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_UpdateContainerInstancesStateCommand"); -var se_UpdateServiceCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("UpdateService"); - let body; - body = JSON.stringify(se_UpdateServiceRequest(input, context)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_UpdateServiceCommand"); -var se_UpdateServicePrimaryTaskSetCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("UpdateServicePrimaryTaskSet"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_UpdateServicePrimaryTaskSetCommand"); -var se_UpdateTaskProtectionCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("UpdateTaskProtection"); - let body; - body = JSON.stringify((0, import_smithy_client._json)(input)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_UpdateTaskProtectionCommand"); -var se_UpdateTaskSetCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = sharedHeaders("UpdateTaskSet"); - let body; - body = JSON.stringify(se_UpdateTaskSetRequest(input, context)); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_UpdateTaskSetCommand"); -var de_CreateCapacityProviderCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_CreateCapacityProviderCommand"); -var de_CreateClusterCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_CreateClusterCommand"); -var de_CreateServiceCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_CreateServiceResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_CreateServiceCommand"); -var de_CreateTaskSetCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_CreateTaskSetResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_CreateTaskSetCommand"); -var de_DeleteAccountSettingCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DeleteAccountSettingCommand"); -var de_DeleteAttributesCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DeleteAttributesCommand"); -var de_DeleteCapacityProviderCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DeleteCapacityProviderCommand"); -var de_DeleteClusterCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DeleteClusterCommand"); -var de_DeleteServiceCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_DeleteServiceResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DeleteServiceCommand"); -var de_DeleteTaskDefinitionsCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_DeleteTaskDefinitionsResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DeleteTaskDefinitionsCommand"); -var de_DeleteTaskSetCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_DeleteTaskSetResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DeleteTaskSetCommand"); -var de_DeregisterContainerInstanceCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_DeregisterContainerInstanceResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DeregisterContainerInstanceCommand"); -var de_DeregisterTaskDefinitionCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_DeregisterTaskDefinitionResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DeregisterTaskDefinitionCommand"); -var de_DescribeCapacityProvidersCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DescribeCapacityProvidersCommand"); -var de_DescribeClustersCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DescribeClustersCommand"); -var de_DescribeContainerInstancesCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_DescribeContainerInstancesResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DescribeContainerInstancesCommand"); -var de_DescribeServiceDeploymentsCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_DescribeServiceDeploymentsResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DescribeServiceDeploymentsCommand"); -var de_DescribeServiceRevisionsCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_DescribeServiceRevisionsResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DescribeServiceRevisionsCommand"); -var de_DescribeServicesCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_DescribeServicesResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DescribeServicesCommand"); -var de_DescribeTaskDefinitionCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_DescribeTaskDefinitionResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DescribeTaskDefinitionCommand"); -var de_DescribeTasksCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_DescribeTasksResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DescribeTasksCommand"); -var de_DescribeTaskSetsCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_DescribeTaskSetsResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DescribeTaskSetsCommand"); -var de_DiscoverPollEndpointCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_DiscoverPollEndpointCommand"); -var de_ExecuteCommandCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_ExecuteCommandCommand"); -var de_GetTaskProtectionCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_GetTaskProtectionResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_GetTaskProtectionCommand"); -var de_ListAccountSettingsCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_ListAccountSettingsCommand"); -var de_ListAttributesCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_ListAttributesCommand"); -var de_ListClustersCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_ListClustersCommand"); -var de_ListContainerInstancesCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_ListContainerInstancesCommand"); -var de_ListServiceDeploymentsCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_ListServiceDeploymentsResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_ListServiceDeploymentsCommand"); -var de_ListServicesCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_ListServicesCommand"); -var de_ListServicesByNamespaceCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_ListServicesByNamespaceCommand"); -var de_ListTagsForResourceCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_ListTagsForResourceCommand"); -var de_ListTaskDefinitionFamiliesCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_ListTaskDefinitionFamiliesCommand"); -var de_ListTaskDefinitionsCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_ListTaskDefinitionsCommand"); -var de_ListTasksCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_ListTasksCommand"); -var de_PutAccountSettingCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_PutAccountSettingCommand"); -var de_PutAccountSettingDefaultCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_PutAccountSettingDefaultCommand"); -var de_PutAttributesCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_PutAttributesCommand"); -var de_PutClusterCapacityProvidersCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_PutClusterCapacityProvidersCommand"); -var de_RegisterContainerInstanceCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_RegisterContainerInstanceResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_RegisterContainerInstanceCommand"); -var de_RegisterTaskDefinitionCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_RegisterTaskDefinitionResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_RegisterTaskDefinitionCommand"); -var de_RunTaskCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_RunTaskResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_RunTaskCommand"); -var de_StartTaskCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_StartTaskResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_StartTaskCommand"); -var de_StopServiceDeploymentCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_StopServiceDeploymentCommand"); -var de_StopTaskCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_StopTaskResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_StopTaskCommand"); -var de_SubmitAttachmentStateChangesCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_SubmitAttachmentStateChangesCommand"); -var de_SubmitContainerStateChangeCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_SubmitContainerStateChangeCommand"); -var de_SubmitTaskStateChangeCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_SubmitTaskStateChangeCommand"); -var de_TagResourceCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_TagResourceCommand"); -var de_UntagResourceCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_UntagResourceCommand"); -var de_UpdateCapacityProviderCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_UpdateCapacityProviderCommand"); -var de_UpdateClusterCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_UpdateClusterCommand"); -var de_UpdateClusterSettingsCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = (0, import_smithy_client._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_UpdateClusterSettingsCommand"); -var de_UpdateContainerAgentCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_UpdateContainerAgentResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_UpdateContainerAgentCommand"); -var de_UpdateContainerInstancesStateCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_UpdateContainerInstancesStateResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_UpdateContainerInstancesStateCommand"); -var de_UpdateServiceCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_UpdateServiceResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_UpdateServiceCommand"); -var de_UpdateServicePrimaryTaskSetCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_UpdateServicePrimaryTaskSetResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_UpdateServicePrimaryTaskSetCommand"); -var de_UpdateTaskProtectionCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_UpdateTaskProtectionResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_UpdateTaskProtectionCommand"); -var de_UpdateTaskSetCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core2.parseJsonBody)(output.body, context); - let contents = {}; - contents = de_UpdateTaskSetResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_UpdateTaskSetCommand"); -var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { - const parsedOutput = { - ...output, - body: await (0, import_core2.parseJsonErrorBody)(output.body, context) - }; - const errorCode = (0, import_core2.loadRestJsonErrorCode)(output, parsedOutput.body); - switch (errorCode) { - case "ClientException": - case "com.amazonaws.ecs#ClientException": - throw await de_ClientExceptionRes(parsedOutput, context); - case "InvalidParameterException": - case "com.amazonaws.ecs#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "LimitExceededException": - case "com.amazonaws.ecs#LimitExceededException": - throw await de_LimitExceededExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecs#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "UpdateInProgressException": - case "com.amazonaws.ecs#UpdateInProgressException": - throw await de_UpdateInProgressExceptionRes(parsedOutput, context); - case "NamespaceNotFoundException": - case "com.amazonaws.ecs#NamespaceNotFoundException": - throw await de_NamespaceNotFoundExceptionRes(parsedOutput, context); - case "AccessDeniedException": - case "com.amazonaws.ecs#AccessDeniedException": - throw await de_AccessDeniedExceptionRes(parsedOutput, context); - case "ClusterNotFoundException": - case "com.amazonaws.ecs#ClusterNotFoundException": - throw await de_ClusterNotFoundExceptionRes(parsedOutput, context); - case "PlatformTaskDefinitionIncompatibilityException": - case "com.amazonaws.ecs#PlatformTaskDefinitionIncompatibilityException": - throw await de_PlatformTaskDefinitionIncompatibilityExceptionRes(parsedOutput, context); - case "PlatformUnknownException": - case "com.amazonaws.ecs#PlatformUnknownException": - throw await de_PlatformUnknownExceptionRes(parsedOutput, context); - case "UnsupportedFeatureException": - case "com.amazonaws.ecs#UnsupportedFeatureException": - throw await de_UnsupportedFeatureExceptionRes(parsedOutput, context); - case "ServiceNotActiveException": - case "com.amazonaws.ecs#ServiceNotActiveException": - throw await de_ServiceNotActiveExceptionRes(parsedOutput, context); - case "ServiceNotFoundException": - case "com.amazonaws.ecs#ServiceNotFoundException": - throw await de_ServiceNotFoundExceptionRes(parsedOutput, context); - case "TargetNotFoundException": - case "com.amazonaws.ecs#TargetNotFoundException": - throw await de_TargetNotFoundExceptionRes(parsedOutput, context); - case "ClusterContainsContainerInstancesException": - case "com.amazonaws.ecs#ClusterContainsContainerInstancesException": - throw await de_ClusterContainsContainerInstancesExceptionRes(parsedOutput, context); - case "ClusterContainsServicesException": - case "com.amazonaws.ecs#ClusterContainsServicesException": - throw await de_ClusterContainsServicesExceptionRes(parsedOutput, context); - case "ClusterContainsTasksException": - case "com.amazonaws.ecs#ClusterContainsTasksException": - throw await de_ClusterContainsTasksExceptionRes(parsedOutput, context); - case "TaskSetNotFoundException": - case "com.amazonaws.ecs#TaskSetNotFoundException": - throw await de_TaskSetNotFoundExceptionRes(parsedOutput, context); - case "TargetNotConnectedException": - case "com.amazonaws.ecs#TargetNotConnectedException": - throw await de_TargetNotConnectedExceptionRes(parsedOutput, context); - case "ResourceNotFoundException": - case "com.amazonaws.ecs#ResourceNotFoundException": - throw await de_ResourceNotFoundExceptionRes(parsedOutput, context); - case "AttributeLimitExceededException": - case "com.amazonaws.ecs#AttributeLimitExceededException": - throw await de_AttributeLimitExceededExceptionRes(parsedOutput, context); - case "ResourceInUseException": - case "com.amazonaws.ecs#ResourceInUseException": - throw await de_ResourceInUseExceptionRes(parsedOutput, context); - case "BlockedException": - case "com.amazonaws.ecs#BlockedException": - throw await de_BlockedExceptionRes(parsedOutput, context); - case "ConflictException": - case "com.amazonaws.ecs#ConflictException": - throw await de_ConflictExceptionRes(parsedOutput, context); - case "ServiceDeploymentNotFoundException": - case "com.amazonaws.ecs#ServiceDeploymentNotFoundException": - throw await de_ServiceDeploymentNotFoundExceptionRes(parsedOutput, context); - case "MissingVersionException": - case "com.amazonaws.ecs#MissingVersionException": - throw await de_MissingVersionExceptionRes(parsedOutput, context); - case "NoUpdateAvailableException": - case "com.amazonaws.ecs#NoUpdateAvailableException": - throw await de_NoUpdateAvailableExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode - }); - } -}, "de_CommandError"); -var de_AccessDeniedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new AccessDeniedException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_AccessDeniedExceptionRes"); -var de_AttributeLimitExceededExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new AttributeLimitExceededException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_AttributeLimitExceededExceptionRes"); -var de_BlockedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new BlockedException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_BlockedExceptionRes"); -var de_ClientExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new ClientException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_ClientExceptionRes"); -var de_ClusterContainsContainerInstancesExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new ClusterContainsContainerInstancesException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_ClusterContainsContainerInstancesExceptionRes"); -var de_ClusterContainsServicesExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new ClusterContainsServicesException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_ClusterContainsServicesExceptionRes"); -var de_ClusterContainsTasksExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new ClusterContainsTasksException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_ClusterContainsTasksExceptionRes"); -var de_ClusterNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new ClusterNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_ClusterNotFoundExceptionRes"); -var de_ConflictExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new ConflictException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_ConflictExceptionRes"); -var de_InvalidParameterExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new InvalidParameterException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_InvalidParameterExceptionRes"); -var de_LimitExceededExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new LimitExceededException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_LimitExceededExceptionRes"); -var de_MissingVersionExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new MissingVersionException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_MissingVersionExceptionRes"); -var de_NamespaceNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new NamespaceNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_NamespaceNotFoundExceptionRes"); -var de_NoUpdateAvailableExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new NoUpdateAvailableException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_NoUpdateAvailableExceptionRes"); -var de_PlatformTaskDefinitionIncompatibilityExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new PlatformTaskDefinitionIncompatibilityException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_PlatformTaskDefinitionIncompatibilityExceptionRes"); -var de_PlatformUnknownExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new PlatformUnknownException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_PlatformUnknownExceptionRes"); -var de_ResourceInUseExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new ResourceInUseException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_ResourceInUseExceptionRes"); -var de_ResourceNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new ResourceNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_ResourceNotFoundExceptionRes"); -var de_ServerExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new ServerException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_ServerExceptionRes"); -var de_ServiceDeploymentNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new ServiceDeploymentNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_ServiceDeploymentNotFoundExceptionRes"); -var de_ServiceNotActiveExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new ServiceNotActiveException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_ServiceNotActiveExceptionRes"); -var de_ServiceNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new ServiceNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_ServiceNotFoundExceptionRes"); -var de_TargetNotConnectedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new TargetNotConnectedException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_TargetNotConnectedExceptionRes"); -var de_TargetNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new TargetNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_TargetNotFoundExceptionRes"); -var de_TaskSetNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new TaskSetNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_TaskSetNotFoundExceptionRes"); -var de_UnsupportedFeatureExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new UnsupportedFeatureException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_UnsupportedFeatureExceptionRes"); -var de_UpdateInProgressExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, import_smithy_client._json)(body); - const exception = new UpdateInProgressException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client.decorateServiceException)(exception, body); -}, "de_UpdateInProgressExceptionRes"); -var se_CreatedAt = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client.take)(input, { - after: /* @__PURE__ */ __name((_) => _.getTime() / 1e3, "after"), - before: /* @__PURE__ */ __name((_) => _.getTime() / 1e3, "before") - }); -}, "se_CreatedAt"); -var se_CreateServiceRequest = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client.take)(input, { - availabilityZoneRebalancing: [], - capacityProviderStrategy: import_smithy_client._json, - clientToken: [], - cluster: [], - deploymentConfiguration: /* @__PURE__ */ __name((_) => se_DeploymentConfiguration(_, context), "deploymentConfiguration"), - deploymentController: import_smithy_client._json, - desiredCount: [], - enableECSManagedTags: [], - enableExecuteCommand: [], - healthCheckGracePeriodSeconds: [], - launchType: [], - loadBalancers: import_smithy_client._json, - networkConfiguration: import_smithy_client._json, - placementConstraints: import_smithy_client._json, - placementStrategy: import_smithy_client._json, - platformVersion: [], - propagateTags: [], - role: [], - schedulingStrategy: [], - serviceConnectConfiguration: import_smithy_client._json, - serviceName: [], - serviceRegistries: import_smithy_client._json, - tags: import_smithy_client._json, - taskDefinition: [], - volumeConfigurations: import_smithy_client._json, - vpcLatticeConfigurations: import_smithy_client._json - }); -}, "se_CreateServiceRequest"); -var se_CreateTaskSetRequest = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client.take)(input, { - capacityProviderStrategy: import_smithy_client._json, - clientToken: [], - cluster: [], - externalId: [], - launchType: [], - loadBalancers: import_smithy_client._json, - networkConfiguration: import_smithy_client._json, - platformVersion: [], - scale: /* @__PURE__ */ __name((_) => se_Scale(_, context), "scale"), - service: [], - serviceRegistries: import_smithy_client._json, - tags: import_smithy_client._json, - taskDefinition: [] - }); -}, "se_CreateTaskSetRequest"); -var se_DeploymentConfiguration = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client.take)(input, { - alarms: import_smithy_client._json, - bakeTimeInMinutes: [], - deploymentCircuitBreaker: import_smithy_client._json, - lifecycleHooks: /* @__PURE__ */ __name((_) => se_DeploymentLifecycleHookList(_, context), "lifecycleHooks"), - maximumPercent: [], - minimumHealthyPercent: [], - strategy: [] - }); -}, "se_DeploymentConfiguration"); -var se_DeploymentLifecycleHook = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client.take)(input, { - hookDetails: /* @__PURE__ */ __name((_) => se_HookDetails(_, context), "hookDetails"), - hookTargetArn: [], - lifecycleStages: import_smithy_client._json, - roleArn: [] - }); -}, "se_DeploymentLifecycleHook"); -var se_DeploymentLifecycleHookList = /* @__PURE__ */ __name((input, context) => { - return input.filter((e) => e != null).map((entry) => { - return se_DeploymentLifecycleHook(entry, context); - }); -}, "se_DeploymentLifecycleHookList"); -var se_HookDetails = /* @__PURE__ */ __name((input, context) => { - return input; -}, "se_HookDetails"); -var se_ListServiceDeploymentsRequest = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client.take)(input, { - cluster: [], - createdAt: /* @__PURE__ */ __name((_) => se_CreatedAt(_, context), "createdAt"), - maxResults: [], - nextToken: [], - service: [], - status: import_smithy_client._json - }); -}, "se_ListServiceDeploymentsRequest"); -var se_RegisterContainerInstanceRequest = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client.take)(input, { - attributes: import_smithy_client._json, - cluster: [], - containerInstanceArn: [], - instanceIdentityDocument: [], - instanceIdentityDocumentSignature: [], - platformDevices: import_smithy_client._json, - tags: import_smithy_client._json, - totalResources: /* @__PURE__ */ __name((_) => se_Resources(_, context), "totalResources"), - versionInfo: import_smithy_client._json - }); -}, "se_RegisterContainerInstanceRequest"); -var se_Resource = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client.take)(input, { - doubleValue: import_smithy_client.serializeFloat, - integerValue: [], - longValue: [], - name: [], - stringSetValue: import_smithy_client._json, - type: [] - }); -}, "se_Resource"); -var se_Resources = /* @__PURE__ */ __name((input, context) => { - return input.filter((e) => e != null).map((entry) => { - return se_Resource(entry, context); - }); -}, "se_Resources"); -var se_RunTaskRequest = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client.take)(input, { - capacityProviderStrategy: import_smithy_client._json, - clientToken: [true, (_) => _ ?? (0, import_uuid.v4)()], - cluster: [], - count: [], - enableECSManagedTags: [], - enableExecuteCommand: [], - group: [], - launchType: [], - networkConfiguration: import_smithy_client._json, - overrides: import_smithy_client._json, - placementConstraints: import_smithy_client._json, - placementStrategy: import_smithy_client._json, - platformVersion: [], - propagateTags: [], - referenceId: [], - startedBy: [], - tags: import_smithy_client._json, - taskDefinition: [], - volumeConfigurations: import_smithy_client._json - }); -}, "se_RunTaskRequest"); -var se_Scale = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client.take)(input, { - unit: [], - value: import_smithy_client.serializeFloat - }); -}, "se_Scale"); -var se_SubmitTaskStateChangeRequest = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client.take)(input, { - attachments: import_smithy_client._json, - cluster: [], - containers: import_smithy_client._json, - executionStoppedAt: /* @__PURE__ */ __name((_) => _.getTime() / 1e3, "executionStoppedAt"), - managedAgents: import_smithy_client._json, - pullStartedAt: /* @__PURE__ */ __name((_) => _.getTime() / 1e3, "pullStartedAt"), - pullStoppedAt: /* @__PURE__ */ __name((_) => _.getTime() / 1e3, "pullStoppedAt"), - reason: [], - status: [], - task: [] - }); -}, "se_SubmitTaskStateChangeRequest"); -var se_UpdateServiceRequest = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client.take)(input, { - availabilityZoneRebalancing: [], - capacityProviderStrategy: import_smithy_client._json, - cluster: [], - deploymentConfiguration: /* @__PURE__ */ __name((_) => se_DeploymentConfiguration(_, context), "deploymentConfiguration"), - deploymentController: import_smithy_client._json, - desiredCount: [], - enableECSManagedTags: [], - enableExecuteCommand: [], - forceNewDeployment: [], - healthCheckGracePeriodSeconds: [], - loadBalancers: import_smithy_client._json, - networkConfiguration: import_smithy_client._json, - placementConstraints: import_smithy_client._json, - placementStrategy: import_smithy_client._json, - platformVersion: [], - propagateTags: [], - service: [], - serviceConnectConfiguration: import_smithy_client._json, - serviceRegistries: import_smithy_client._json, - taskDefinition: [], - volumeConfigurations: import_smithy_client._json, - vpcLatticeConfigurations: import_smithy_client._json - }); -}, "se_UpdateServiceRequest"); -var se_UpdateTaskSetRequest = /* @__PURE__ */ __name((input, context) => { - return (0, import_smithy_client.take)(input, { - cluster: [], - scale: /* @__PURE__ */ __name((_) => se_Scale(_, context), "scale"), - service: [], - taskSet: [] - }); -}, "se_UpdateTaskSetRequest"); -var de_Container = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - containerArn: import_smithy_client.expectString, - cpu: import_smithy_client.expectString, - exitCode: import_smithy_client.expectInt32, - gpuIds: import_smithy_client._json, - healthStatus: import_smithy_client.expectString, - image: import_smithy_client.expectString, - imageDigest: import_smithy_client.expectString, - lastStatus: import_smithy_client.expectString, - managedAgents: /* @__PURE__ */ __name((_) => de_ManagedAgents(_, context), "managedAgents"), - memory: import_smithy_client.expectString, - memoryReservation: import_smithy_client.expectString, - name: import_smithy_client.expectString, - networkBindings: import_smithy_client._json, - networkInterfaces: import_smithy_client._json, - reason: import_smithy_client.expectString, - runtimeId: import_smithy_client.expectString, - taskArn: import_smithy_client.expectString - }); -}, "de_Container"); -var de_ContainerInstance = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - agentConnected: import_smithy_client.expectBoolean, - agentUpdateStatus: import_smithy_client.expectString, - attachments: import_smithy_client._json, - attributes: import_smithy_client._json, - capacityProviderName: import_smithy_client.expectString, - containerInstanceArn: import_smithy_client.expectString, - ec2InstanceId: import_smithy_client.expectString, - healthStatus: /* @__PURE__ */ __name((_) => de_ContainerInstanceHealthStatus(_, context), "healthStatus"), - pendingTasksCount: import_smithy_client.expectInt32, - registeredAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "registeredAt"), - registeredResources: /* @__PURE__ */ __name((_) => de_Resources(_, context), "registeredResources"), - remainingResources: /* @__PURE__ */ __name((_) => de_Resources(_, context), "remainingResources"), - runningTasksCount: import_smithy_client.expectInt32, - status: import_smithy_client.expectString, - statusReason: import_smithy_client.expectString, - tags: import_smithy_client._json, - version: import_smithy_client.expectLong, - versionInfo: import_smithy_client._json - }); -}, "de_ContainerInstance"); -var de_ContainerInstanceHealthStatus = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - details: /* @__PURE__ */ __name((_) => de_InstanceHealthCheckResultList(_, context), "details"), - overallStatus: import_smithy_client.expectString - }); -}, "de_ContainerInstanceHealthStatus"); -var de_ContainerInstances = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_ContainerInstance(entry, context); - }); - return retVal; -}, "de_ContainerInstances"); -var de_Containers = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_Container(entry, context); - }); - return retVal; -}, "de_Containers"); -var de_CreateServiceResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - service: /* @__PURE__ */ __name((_) => de_Service(_, context), "service") - }); -}, "de_CreateServiceResponse"); -var de_CreateTaskSetResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - taskSet: /* @__PURE__ */ __name((_) => de_TaskSet(_, context), "taskSet") - }); -}, "de_CreateTaskSetResponse"); -var de_DeleteServiceResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - service: /* @__PURE__ */ __name((_) => de_Service(_, context), "service") - }); -}, "de_DeleteServiceResponse"); -var de_DeleteTaskDefinitionsResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - failures: import_smithy_client._json, - taskDefinitions: /* @__PURE__ */ __name((_) => de_TaskDefinitionList(_, context), "taskDefinitions") - }); -}, "de_DeleteTaskDefinitionsResponse"); -var de_DeleteTaskSetResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - taskSet: /* @__PURE__ */ __name((_) => de_TaskSet(_, context), "taskSet") - }); -}, "de_DeleteTaskSetResponse"); -var de_Deployment = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - capacityProviderStrategy: import_smithy_client._json, - createdAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "createdAt"), - desiredCount: import_smithy_client.expectInt32, - failedTasks: import_smithy_client.expectInt32, - fargateEphemeralStorage: import_smithy_client._json, - id: import_smithy_client.expectString, - launchType: import_smithy_client.expectString, - networkConfiguration: import_smithy_client._json, - pendingCount: import_smithy_client.expectInt32, - platformFamily: import_smithy_client.expectString, - platformVersion: import_smithy_client.expectString, - rolloutState: import_smithy_client.expectString, - rolloutStateReason: import_smithy_client.expectString, - runningCount: import_smithy_client.expectInt32, - serviceConnectConfiguration: import_smithy_client._json, - serviceConnectResources: import_smithy_client._json, - status: import_smithy_client.expectString, - taskDefinition: import_smithy_client.expectString, - updatedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "updatedAt"), - volumeConfigurations: import_smithy_client._json, - vpcLatticeConfigurations: import_smithy_client._json - }); -}, "de_Deployment"); -var de_DeploymentConfiguration = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - alarms: import_smithy_client._json, - bakeTimeInMinutes: import_smithy_client.expectInt32, - deploymentCircuitBreaker: import_smithy_client._json, - lifecycleHooks: /* @__PURE__ */ __name((_) => de_DeploymentLifecycleHookList(_, context), "lifecycleHooks"), - maximumPercent: import_smithy_client.expectInt32, - minimumHealthyPercent: import_smithy_client.expectInt32, - strategy: import_smithy_client.expectString - }); -}, "de_DeploymentConfiguration"); -var de_DeploymentLifecycleHook = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - hookDetails: /* @__PURE__ */ __name((_) => de_HookDetails(_, context), "hookDetails"), - hookTargetArn: import_smithy_client.expectString, - lifecycleStages: import_smithy_client._json, - roleArn: import_smithy_client.expectString - }); -}, "de_DeploymentLifecycleHook"); -var de_DeploymentLifecycleHookList = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_DeploymentLifecycleHook(entry, context); - }); - return retVal; -}, "de_DeploymentLifecycleHookList"); -var de_Deployments = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_Deployment(entry, context); - }); - return retVal; -}, "de_Deployments"); -var de_DeregisterContainerInstanceResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - containerInstance: /* @__PURE__ */ __name((_) => de_ContainerInstance(_, context), "containerInstance") - }); -}, "de_DeregisterContainerInstanceResponse"); -var de_DeregisterTaskDefinitionResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - taskDefinition: /* @__PURE__ */ __name((_) => de_TaskDefinition(_, context), "taskDefinition") - }); -}, "de_DeregisterTaskDefinitionResponse"); -var de_DescribeContainerInstancesResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - containerInstances: /* @__PURE__ */ __name((_) => de_ContainerInstances(_, context), "containerInstances"), - failures: import_smithy_client._json - }); -}, "de_DescribeContainerInstancesResponse"); -var de_DescribeServiceDeploymentsResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - failures: import_smithy_client._json, - serviceDeployments: /* @__PURE__ */ __name((_) => de_ServiceDeployments(_, context), "serviceDeployments") - }); -}, "de_DescribeServiceDeploymentsResponse"); -var de_DescribeServiceRevisionsResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - failures: import_smithy_client._json, - serviceRevisions: /* @__PURE__ */ __name((_) => de_ServiceRevisions(_, context), "serviceRevisions") - }); -}, "de_DescribeServiceRevisionsResponse"); -var de_DescribeServicesResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - failures: import_smithy_client._json, - services: /* @__PURE__ */ __name((_) => de_Services(_, context), "services") - }); -}, "de_DescribeServicesResponse"); -var de_DescribeTaskDefinitionResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - tags: import_smithy_client._json, - taskDefinition: /* @__PURE__ */ __name((_) => de_TaskDefinition(_, context), "taskDefinition") - }); -}, "de_DescribeTaskDefinitionResponse"); -var de_DescribeTaskSetsResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - failures: import_smithy_client._json, - taskSets: /* @__PURE__ */ __name((_) => de_TaskSets(_, context), "taskSets") - }); -}, "de_DescribeTaskSetsResponse"); -var de_DescribeTasksResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - failures: import_smithy_client._json, - tasks: /* @__PURE__ */ __name((_) => de_Tasks(_, context), "tasks") - }); -}, "de_DescribeTasksResponse"); -var de_GetTaskProtectionResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - failures: import_smithy_client._json, - protectedTasks: /* @__PURE__ */ __name((_) => de_ProtectedTasks(_, context), "protectedTasks") - }); -}, "de_GetTaskProtectionResponse"); -var de_HookDetails = /* @__PURE__ */ __name((output, context) => { - return output; -}, "de_HookDetails"); -var de_InstanceHealthCheckResult = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - lastStatusChange: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "lastStatusChange"), - lastUpdated: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "lastUpdated"), - status: import_smithy_client.expectString, - type: import_smithy_client.expectString - }); -}, "de_InstanceHealthCheckResult"); -var de_InstanceHealthCheckResultList = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_InstanceHealthCheckResult(entry, context); - }); - return retVal; -}, "de_InstanceHealthCheckResultList"); -var de_ListServiceDeploymentsResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - nextToken: import_smithy_client.expectString, - serviceDeployments: /* @__PURE__ */ __name((_) => de_ServiceDeploymentsBrief(_, context), "serviceDeployments") - }); -}, "de_ListServiceDeploymentsResponse"); -var de_ManagedAgent = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - lastStartedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "lastStartedAt"), - lastStatus: import_smithy_client.expectString, - name: import_smithy_client.expectString, - reason: import_smithy_client.expectString - }); -}, "de_ManagedAgent"); -var de_ManagedAgents = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_ManagedAgent(entry, context); - }); - return retVal; -}, "de_ManagedAgents"); -var de_ProtectedTask = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - expirationDate: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "expirationDate"), - protectionEnabled: import_smithy_client.expectBoolean, - taskArn: import_smithy_client.expectString - }); -}, "de_ProtectedTask"); -var de_ProtectedTasks = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_ProtectedTask(entry, context); - }); - return retVal; -}, "de_ProtectedTasks"); -var de_RegisterContainerInstanceResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - containerInstance: /* @__PURE__ */ __name((_) => de_ContainerInstance(_, context), "containerInstance") - }); -}, "de_RegisterContainerInstanceResponse"); -var de_RegisterTaskDefinitionResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - tags: import_smithy_client._json, - taskDefinition: /* @__PURE__ */ __name((_) => de_TaskDefinition(_, context), "taskDefinition") - }); -}, "de_RegisterTaskDefinitionResponse"); -var de_Resource = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - doubleValue: import_smithy_client.limitedParseDouble, - integerValue: import_smithy_client.expectInt32, - longValue: import_smithy_client.expectLong, - name: import_smithy_client.expectString, - stringSetValue: import_smithy_client._json, - type: import_smithy_client.expectString - }); -}, "de_Resource"); -var de_Resources = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_Resource(entry, context); - }); - return retVal; -}, "de_Resources"); -var de_Rollback = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - reason: import_smithy_client.expectString, - serviceRevisionArn: import_smithy_client.expectString, - startedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "startedAt") - }); -}, "de_Rollback"); -var de_RunTaskResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - failures: import_smithy_client._json, - tasks: /* @__PURE__ */ __name((_) => de_Tasks(_, context), "tasks") - }); -}, "de_RunTaskResponse"); -var de_Scale = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - unit: import_smithy_client.expectString, - value: import_smithy_client.limitedParseDouble - }); -}, "de_Scale"); -var de_Service = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - availabilityZoneRebalancing: import_smithy_client.expectString, - capacityProviderStrategy: import_smithy_client._json, - clusterArn: import_smithy_client.expectString, - createdAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "createdAt"), - createdBy: import_smithy_client.expectString, - deploymentConfiguration: /* @__PURE__ */ __name((_) => de_DeploymentConfiguration(_, context), "deploymentConfiguration"), - deploymentController: import_smithy_client._json, - deployments: /* @__PURE__ */ __name((_) => de_Deployments(_, context), "deployments"), - desiredCount: import_smithy_client.expectInt32, - enableECSManagedTags: import_smithy_client.expectBoolean, - enableExecuteCommand: import_smithy_client.expectBoolean, - events: /* @__PURE__ */ __name((_) => de_ServiceEvents(_, context), "events"), - healthCheckGracePeriodSeconds: import_smithy_client.expectInt32, - launchType: import_smithy_client.expectString, - loadBalancers: import_smithy_client._json, - networkConfiguration: import_smithy_client._json, - pendingCount: import_smithy_client.expectInt32, - placementConstraints: import_smithy_client._json, - placementStrategy: import_smithy_client._json, - platformFamily: import_smithy_client.expectString, - platformVersion: import_smithy_client.expectString, - propagateTags: import_smithy_client.expectString, - roleArn: import_smithy_client.expectString, - runningCount: import_smithy_client.expectInt32, - schedulingStrategy: import_smithy_client.expectString, - serviceArn: import_smithy_client.expectString, - serviceName: import_smithy_client.expectString, - serviceRegistries: import_smithy_client._json, - status: import_smithy_client.expectString, - tags: import_smithy_client._json, - taskDefinition: import_smithy_client.expectString, - taskSets: /* @__PURE__ */ __name((_) => de_TaskSets(_, context), "taskSets") - }); -}, "de_Service"); -var de_ServiceDeployment = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - alarms: import_smithy_client._json, - clusterArn: import_smithy_client.expectString, - createdAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "createdAt"), - deploymentCircuitBreaker: import_smithy_client._json, - deploymentConfiguration: /* @__PURE__ */ __name((_) => de_DeploymentConfiguration(_, context), "deploymentConfiguration"), - finishedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "finishedAt"), - lifecycleStage: import_smithy_client.expectString, - rollback: /* @__PURE__ */ __name((_) => de_Rollback(_, context), "rollback"), - serviceArn: import_smithy_client.expectString, - serviceDeploymentArn: import_smithy_client.expectString, - sourceServiceRevisions: import_smithy_client._json, - startedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "startedAt"), - status: import_smithy_client.expectString, - statusReason: import_smithy_client.expectString, - stoppedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "stoppedAt"), - targetServiceRevision: import_smithy_client._json, - updatedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "updatedAt") - }); -}, "de_ServiceDeployment"); -var de_ServiceDeploymentBrief = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - clusterArn: import_smithy_client.expectString, - createdAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "createdAt"), - finishedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "finishedAt"), - serviceArn: import_smithy_client.expectString, - serviceDeploymentArn: import_smithy_client.expectString, - startedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "startedAt"), - status: import_smithy_client.expectString, - statusReason: import_smithy_client.expectString, - targetServiceRevisionArn: import_smithy_client.expectString - }); -}, "de_ServiceDeploymentBrief"); -var de_ServiceDeployments = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_ServiceDeployment(entry, context); - }); - return retVal; -}, "de_ServiceDeployments"); -var de_ServiceDeploymentsBrief = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_ServiceDeploymentBrief(entry, context); - }); - return retVal; -}, "de_ServiceDeploymentsBrief"); -var de_ServiceEvent = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - createdAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "createdAt"), - id: import_smithy_client.expectString, - message: import_smithy_client.expectString - }); -}, "de_ServiceEvent"); -var de_ServiceEvents = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_ServiceEvent(entry, context); - }); - return retVal; -}, "de_ServiceEvents"); -var de_ServiceRevision = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - capacityProviderStrategy: import_smithy_client._json, - clusterArn: import_smithy_client.expectString, - containerImages: import_smithy_client._json, - createdAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "createdAt"), - fargateEphemeralStorage: import_smithy_client._json, - guardDutyEnabled: import_smithy_client.expectBoolean, - launchType: import_smithy_client.expectString, - loadBalancers: import_smithy_client._json, - networkConfiguration: import_smithy_client._json, - platformFamily: import_smithy_client.expectString, - platformVersion: import_smithy_client.expectString, - resolvedConfiguration: import_smithy_client._json, - serviceArn: import_smithy_client.expectString, - serviceConnectConfiguration: import_smithy_client._json, - serviceRegistries: import_smithy_client._json, - serviceRevisionArn: import_smithy_client.expectString, - taskDefinition: import_smithy_client.expectString, - volumeConfigurations: import_smithy_client._json, - vpcLatticeConfigurations: import_smithy_client._json - }); -}, "de_ServiceRevision"); -var de_ServiceRevisions = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_ServiceRevision(entry, context); - }); - return retVal; -}, "de_ServiceRevisions"); -var de_Services = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_Service(entry, context); - }); - return retVal; -}, "de_Services"); -var de_StartTaskResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - failures: import_smithy_client._json, - tasks: /* @__PURE__ */ __name((_) => de_Tasks(_, context), "tasks") - }); -}, "de_StartTaskResponse"); -var de_StopTaskResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - task: /* @__PURE__ */ __name((_) => de_Task(_, context), "task") - }); -}, "de_StopTaskResponse"); -var de_Task = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - attachments: import_smithy_client._json, - attributes: import_smithy_client._json, - availabilityZone: import_smithy_client.expectString, - capacityProviderName: import_smithy_client.expectString, - clusterArn: import_smithy_client.expectString, - connectivity: import_smithy_client.expectString, - connectivityAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "connectivityAt"), - containerInstanceArn: import_smithy_client.expectString, - containers: /* @__PURE__ */ __name((_) => de_Containers(_, context), "containers"), - cpu: import_smithy_client.expectString, - createdAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "createdAt"), - desiredStatus: import_smithy_client.expectString, - enableExecuteCommand: import_smithy_client.expectBoolean, - ephemeralStorage: import_smithy_client._json, - executionStoppedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "executionStoppedAt"), - fargateEphemeralStorage: import_smithy_client._json, - group: import_smithy_client.expectString, - healthStatus: import_smithy_client.expectString, - inferenceAccelerators: import_smithy_client._json, - lastStatus: import_smithy_client.expectString, - launchType: import_smithy_client.expectString, - memory: import_smithy_client.expectString, - overrides: import_smithy_client._json, - platformFamily: import_smithy_client.expectString, - platformVersion: import_smithy_client.expectString, - pullStartedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "pullStartedAt"), - pullStoppedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "pullStoppedAt"), - startedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "startedAt"), - startedBy: import_smithy_client.expectString, - stopCode: import_smithy_client.expectString, - stoppedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "stoppedAt"), - stoppedReason: import_smithy_client.expectString, - stoppingAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "stoppingAt"), - tags: import_smithy_client._json, - taskArn: import_smithy_client.expectString, - taskDefinitionArn: import_smithy_client.expectString, - version: import_smithy_client.expectLong - }); -}, "de_Task"); -var de_TaskDefinition = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - compatibilities: import_smithy_client._json, - containerDefinitions: import_smithy_client._json, - cpu: import_smithy_client.expectString, - deregisteredAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "deregisteredAt"), - enableFaultInjection: import_smithy_client.expectBoolean, - ephemeralStorage: import_smithy_client._json, - executionRoleArn: import_smithy_client.expectString, - family: import_smithy_client.expectString, - inferenceAccelerators: import_smithy_client._json, - ipcMode: import_smithy_client.expectString, - memory: import_smithy_client.expectString, - networkMode: import_smithy_client.expectString, - pidMode: import_smithy_client.expectString, - placementConstraints: import_smithy_client._json, - proxyConfiguration: import_smithy_client._json, - registeredAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "registeredAt"), - registeredBy: import_smithy_client.expectString, - requiresAttributes: import_smithy_client._json, - requiresCompatibilities: import_smithy_client._json, - revision: import_smithy_client.expectInt32, - runtimePlatform: import_smithy_client._json, - status: import_smithy_client.expectString, - taskDefinitionArn: import_smithy_client.expectString, - taskRoleArn: import_smithy_client.expectString, - volumes: import_smithy_client._json - }); -}, "de_TaskDefinition"); -var de_TaskDefinitionList = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_TaskDefinition(entry, context); - }); - return retVal; -}, "de_TaskDefinitionList"); -var de_Tasks = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_Task(entry, context); - }); - return retVal; -}, "de_Tasks"); -var de_TaskSet = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - capacityProviderStrategy: import_smithy_client._json, - clusterArn: import_smithy_client.expectString, - computedDesiredCount: import_smithy_client.expectInt32, - createdAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "createdAt"), - externalId: import_smithy_client.expectString, - fargateEphemeralStorage: import_smithy_client._json, - id: import_smithy_client.expectString, - launchType: import_smithy_client.expectString, - loadBalancers: import_smithy_client._json, - networkConfiguration: import_smithy_client._json, - pendingCount: import_smithy_client.expectInt32, - platformFamily: import_smithy_client.expectString, - platformVersion: import_smithy_client.expectString, - runningCount: import_smithy_client.expectInt32, - scale: /* @__PURE__ */ __name((_) => de_Scale(_, context), "scale"), - serviceArn: import_smithy_client.expectString, - serviceRegistries: import_smithy_client._json, - stabilityStatus: import_smithy_client.expectString, - stabilityStatusAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "stabilityStatusAt"), - startedBy: import_smithy_client.expectString, - status: import_smithy_client.expectString, - tags: import_smithy_client._json, - taskDefinition: import_smithy_client.expectString, - taskSetArn: import_smithy_client.expectString, - updatedAt: /* @__PURE__ */ __name((_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), "updatedAt") - }); -}, "de_TaskSet"); -var de_TaskSets = /* @__PURE__ */ __name((output, context) => { - const retVal = (output || []).filter((e) => e != null).map((entry) => { - return de_TaskSet(entry, context); - }); - return retVal; -}, "de_TaskSets"); -var de_UpdateContainerAgentResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - containerInstance: /* @__PURE__ */ __name((_) => de_ContainerInstance(_, context), "containerInstance") - }); -}, "de_UpdateContainerAgentResponse"); -var de_UpdateContainerInstancesStateResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - containerInstances: /* @__PURE__ */ __name((_) => de_ContainerInstances(_, context), "containerInstances"), - failures: import_smithy_client._json - }); -}, "de_UpdateContainerInstancesStateResponse"); -var de_UpdateServicePrimaryTaskSetResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - taskSet: /* @__PURE__ */ __name((_) => de_TaskSet(_, context), "taskSet") - }); -}, "de_UpdateServicePrimaryTaskSetResponse"); -var de_UpdateServiceResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - service: /* @__PURE__ */ __name((_) => de_Service(_, context), "service") - }); -}, "de_UpdateServiceResponse"); -var de_UpdateTaskProtectionResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - failures: import_smithy_client._json, - protectedTasks: /* @__PURE__ */ __name((_) => de_ProtectedTasks(_, context), "protectedTasks") - }); -}, "de_UpdateTaskProtectionResponse"); -var de_UpdateTaskSetResponse = /* @__PURE__ */ __name((output, context) => { - return (0, import_smithy_client.take)(output, { - taskSet: /* @__PURE__ */ __name((_) => de_TaskSet(_, context), "taskSet") - }); -}, "de_UpdateTaskSetResponse"); -var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"] -}), "deserializeMetadata"); -var throwDefaultError = (0, import_smithy_client.withBaseException)(ECSServiceException); -var buildHttpRpcRequest = /* @__PURE__ */ __name(async (context, headers, path, resolvedHostname, body) => { - const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); - const contents = { - protocol, - hostname, - port, - method: "POST", - path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, - headers - }; - if (resolvedHostname !== void 0) { - contents.hostname = resolvedHostname; - } - if (body !== void 0) { - contents.body = body; - } - return new import_protocol_http.HttpRequest(contents); -}, "buildHttpRpcRequest"); -function sharedHeaders(operation) { - return { - "content-type": "application/x-amz-json-1.1", - "x-amz-target": `AmazonEC2ContainerServiceV20141113.${operation}` - }; -} -__name(sharedHeaders, "sharedHeaders"); - -// src/commands/CreateCapacityProviderCommand.ts -var CreateCapacityProviderCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "CreateCapacityProvider", {}).n("ECSClient", "CreateCapacityProviderCommand").f(void 0, void 0).ser(se_CreateCapacityProviderCommand).de(de_CreateCapacityProviderCommand).build() { - static { - __name(this, "CreateCapacityProviderCommand"); - } +const de_ListTaskDefinitionsCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/CreateClusterCommand.ts - - - -var CreateClusterCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "CreateCluster", {}).n("ECSClient", "CreateClusterCommand").f(void 0, void 0).ser(se_CreateClusterCommand).de(de_CreateClusterCommand).build() { - static { - __name(this, "CreateClusterCommand"); - } +const de_ListTasksCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/CreateServiceCommand.ts - - - -var CreateServiceCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "CreateService", {}).n("ECSClient", "CreateServiceCommand").f(void 0, void 0).ser(se_CreateServiceCommand).de(de_CreateServiceCommand).build() { - static { - __name(this, "CreateServiceCommand"); - } +const de_PutAccountSettingCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/CreateTaskSetCommand.ts - - - -var CreateTaskSetCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "CreateTaskSet", {}).n("ECSClient", "CreateTaskSetCommand").f(void 0, void 0).ser(se_CreateTaskSetCommand).de(de_CreateTaskSetCommand).build() { - static { - __name(this, "CreateTaskSetCommand"); - } +const de_PutAccountSettingDefaultCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DeleteAccountSettingCommand.ts - - - -var DeleteAccountSettingCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DeleteAccountSetting", {}).n("ECSClient", "DeleteAccountSettingCommand").f(void 0, void 0).ser(se_DeleteAccountSettingCommand).de(de_DeleteAccountSettingCommand).build() { - static { - __name(this, "DeleteAccountSettingCommand"); - } +const de_PutAttributesCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DeleteAttributesCommand.ts - - - -var DeleteAttributesCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DeleteAttributes", {}).n("ECSClient", "DeleteAttributesCommand").f(void 0, void 0).ser(se_DeleteAttributesCommand).de(de_DeleteAttributesCommand).build() { - static { - __name(this, "DeleteAttributesCommand"); - } +const de_PutClusterCapacityProvidersCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DeleteCapacityProviderCommand.ts - - - -var DeleteCapacityProviderCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DeleteCapacityProvider", {}).n("ECSClient", "DeleteCapacityProviderCommand").f(void 0, void 0).ser(se_DeleteCapacityProviderCommand).de(de_DeleteCapacityProviderCommand).build() { - static { - __name(this, "DeleteCapacityProviderCommand"); - } +const de_RegisterContainerInstanceCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_RegisterContainerInstanceResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DeleteClusterCommand.ts - - - -var DeleteClusterCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DeleteCluster", {}).n("ECSClient", "DeleteClusterCommand").f(void 0, void 0).ser(se_DeleteClusterCommand).de(de_DeleteClusterCommand).build() { - static { - __name(this, "DeleteClusterCommand"); - } +const de_RegisterTaskDefinitionCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_RegisterTaskDefinitionResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DeleteServiceCommand.ts - - - -var DeleteServiceCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DeleteService", {}).n("ECSClient", "DeleteServiceCommand").f(void 0, void 0).ser(se_DeleteServiceCommand).de(de_DeleteServiceCommand).build() { - static { - __name(this, "DeleteServiceCommand"); - } +const de_RunTaskCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_RunTaskResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DeleteTaskDefinitionsCommand.ts - - - -var DeleteTaskDefinitionsCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DeleteTaskDefinitions", {}).n("ECSClient", "DeleteTaskDefinitionsCommand").f(void 0, void 0).ser(se_DeleteTaskDefinitionsCommand).de(de_DeleteTaskDefinitionsCommand).build() { - static { - __name(this, "DeleteTaskDefinitionsCommand"); - } +const de_StartTaskCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_StartTaskResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DeleteTaskSetCommand.ts - - - -var DeleteTaskSetCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DeleteTaskSet", {}).n("ECSClient", "DeleteTaskSetCommand").f(void 0, void 0).ser(se_DeleteTaskSetCommand).de(de_DeleteTaskSetCommand).build() { - static { - __name(this, "DeleteTaskSetCommand"); - } +const de_StopServiceDeploymentCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DeregisterContainerInstanceCommand.ts - - - -var DeregisterContainerInstanceCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DeregisterContainerInstance", {}).n("ECSClient", "DeregisterContainerInstanceCommand").f(void 0, void 0).ser(se_DeregisterContainerInstanceCommand).de(de_DeregisterContainerInstanceCommand).build() { - static { - __name(this, "DeregisterContainerInstanceCommand"); - } +const de_StopTaskCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_StopTaskResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DeregisterTaskDefinitionCommand.ts - - - -var DeregisterTaskDefinitionCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DeregisterTaskDefinition", {}).n("ECSClient", "DeregisterTaskDefinitionCommand").f(void 0, void 0).ser(se_DeregisterTaskDefinitionCommand).de(de_DeregisterTaskDefinitionCommand).build() { - static { - __name(this, "DeregisterTaskDefinitionCommand"); - } +const de_SubmitAttachmentStateChangesCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DescribeCapacityProvidersCommand.ts - - - -var DescribeCapacityProvidersCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DescribeCapacityProviders", {}).n("ECSClient", "DescribeCapacityProvidersCommand").f(void 0, void 0).ser(se_DescribeCapacityProvidersCommand).de(de_DescribeCapacityProvidersCommand).build() { - static { - __name(this, "DescribeCapacityProvidersCommand"); - } +const de_SubmitContainerStateChangeCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DescribeClustersCommand.ts - - - -var DescribeClustersCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DescribeClusters", {}).n("ECSClient", "DescribeClustersCommand").f(void 0, void 0).ser(se_DescribeClustersCommand).de(de_DescribeClustersCommand).build() { - static { - __name(this, "DescribeClustersCommand"); - } +const de_SubmitTaskStateChangeCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DescribeContainerInstancesCommand.ts - - - -var DescribeContainerInstancesCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DescribeContainerInstances", {}).n("ECSClient", "DescribeContainerInstancesCommand").f(void 0, void 0).ser(se_DescribeContainerInstancesCommand).de(de_DescribeContainerInstancesCommand).build() { - static { - __name(this, "DescribeContainerInstancesCommand"); - } +const de_TagResourceCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DescribeServiceDeploymentsCommand.ts - - - -var DescribeServiceDeploymentsCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DescribeServiceDeployments", {}).n("ECSClient", "DescribeServiceDeploymentsCommand").f(void 0, void 0).ser(se_DescribeServiceDeploymentsCommand).de(de_DescribeServiceDeploymentsCommand).build() { - static { - __name(this, "DescribeServiceDeploymentsCommand"); - } +const de_UntagResourceCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DescribeServiceRevisionsCommand.ts - - - -var DescribeServiceRevisionsCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DescribeServiceRevisions", {}).n("ECSClient", "DescribeServiceRevisionsCommand").f(void 0, void 0).ser(se_DescribeServiceRevisionsCommand).de(de_DescribeServiceRevisionsCommand).build() { - static { - __name(this, "DescribeServiceRevisionsCommand"); - } +const de_UpdateCapacityProviderCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_UpdateCapacityProviderResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DescribeServicesCommand.ts - - - -var DescribeServicesCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DescribeServices", {}).n("ECSClient", "DescribeServicesCommand").f(void 0, void 0).ser(se_DescribeServicesCommand).de(de_DescribeServicesCommand).build() { - static { - __name(this, "DescribeServicesCommand"); - } +const de_UpdateClusterCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DescribeTaskDefinitionCommand.ts - - - -var DescribeTaskDefinitionCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DescribeTaskDefinition", {}).n("ECSClient", "DescribeTaskDefinitionCommand").f(void 0, void 0).ser(se_DescribeTaskDefinitionCommand).de(de_DescribeTaskDefinitionCommand).build() { - static { - __name(this, "DescribeTaskDefinitionCommand"); - } +const de_UpdateClusterSettingsCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = smithyClient._json(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DescribeTasksCommand.ts - - - -var DescribeTasksCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DescribeTasks", {}).n("ECSClient", "DescribeTasksCommand").f(void 0, void 0).ser(se_DescribeTasksCommand).de(de_DescribeTasksCommand).build() { - static { - __name(this, "DescribeTasksCommand"); - } +const de_UpdateContainerAgentCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_UpdateContainerAgentResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DescribeTaskSetsCommand.ts - - - -var DescribeTaskSetsCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DescribeTaskSets", {}).n("ECSClient", "DescribeTaskSetsCommand").f(void 0, void 0).ser(se_DescribeTaskSetsCommand).de(de_DescribeTaskSetsCommand).build() { - static { - __name(this, "DescribeTaskSetsCommand"); - } +const de_UpdateContainerInstancesStateCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_UpdateContainerInstancesStateResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/DiscoverPollEndpointCommand.ts - - - -var DiscoverPollEndpointCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "DiscoverPollEndpoint", {}).n("ECSClient", "DiscoverPollEndpointCommand").f(void 0, void 0).ser(se_DiscoverPollEndpointCommand).de(de_DiscoverPollEndpointCommand).build() { - static { - __name(this, "DiscoverPollEndpointCommand"); - } +const de_UpdateServiceCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_UpdateServiceResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/ExecuteCommandCommand.ts - - - -var ExecuteCommandCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "ExecuteCommand", {}).n("ECSClient", "ExecuteCommandCommand").f(void 0, ExecuteCommandResponseFilterSensitiveLog).ser(se_ExecuteCommandCommand).de(de_ExecuteCommandCommand).build() { - static { - __name(this, "ExecuteCommandCommand"); - } +const de_UpdateServicePrimaryTaskSetCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_UpdateServicePrimaryTaskSetResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/GetTaskProtectionCommand.ts - - - -var GetTaskProtectionCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "GetTaskProtection", {}).n("ECSClient", "GetTaskProtectionCommand").f(void 0, void 0).ser(se_GetTaskProtectionCommand).de(de_GetTaskProtectionCommand).build() { - static { - __name(this, "GetTaskProtectionCommand"); - } +const de_UpdateTaskProtectionCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_UpdateTaskProtectionResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/ListAccountSettingsCommand.ts - - - -var ListAccountSettingsCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "ListAccountSettings", {}).n("ECSClient", "ListAccountSettingsCommand").f(void 0, void 0).ser(se_ListAccountSettingsCommand).de(de_ListAccountSettingsCommand).build() { - static { - __name(this, "ListAccountSettingsCommand"); - } +const de_UpdateTaskSetCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await core$1.parseJsonBody(output.body, context); + let contents = {}; + contents = de_UpdateTaskSetResponse(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; }; - -// src/commands/ListAttributesCommand.ts - - - -var ListAttributesCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "ListAttributes", {}).n("ECSClient", "ListAttributesCommand").f(void 0, void 0).ser(se_ListAttributesCommand).de(de_ListAttributesCommand).build() { - static { - __name(this, "ListAttributesCommand"); - } +const de_CommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await core$1.parseJsonErrorBody(output.body, context), + }; + const errorCode = core$1.loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ClientException": + case "com.amazonaws.ecs#ClientException": + throw await de_ClientExceptionRes(parsedOutput); + case "ClusterNotFoundException": + case "com.amazonaws.ecs#ClusterNotFoundException": + throw await de_ClusterNotFoundExceptionRes(parsedOutput); + case "InvalidParameterException": + case "com.amazonaws.ecs#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput); + case "LimitExceededException": + case "com.amazonaws.ecs#LimitExceededException": + throw await de_LimitExceededExceptionRes(parsedOutput); + case "ServerException": + case "com.amazonaws.ecs#ServerException": + throw await de_ServerExceptionRes(parsedOutput); + case "UnsupportedFeatureException": + case "com.amazonaws.ecs#UnsupportedFeatureException": + throw await de_UnsupportedFeatureExceptionRes(parsedOutput); + case "UpdateInProgressException": + case "com.amazonaws.ecs#UpdateInProgressException": + throw await de_UpdateInProgressExceptionRes(parsedOutput); + case "NamespaceNotFoundException": + case "com.amazonaws.ecs#NamespaceNotFoundException": + throw await de_NamespaceNotFoundExceptionRes(parsedOutput); + case "AccessDeniedException": + case "com.amazonaws.ecs#AccessDeniedException": + throw await de_AccessDeniedExceptionRes(parsedOutput); + case "PlatformTaskDefinitionIncompatibilityException": + case "com.amazonaws.ecs#PlatformTaskDefinitionIncompatibilityException": + throw await de_PlatformTaskDefinitionIncompatibilityExceptionRes(parsedOutput); + case "PlatformUnknownException": + case "com.amazonaws.ecs#PlatformUnknownException": + throw await de_PlatformUnknownExceptionRes(parsedOutput); + case "ServiceNotActiveException": + case "com.amazonaws.ecs#ServiceNotActiveException": + throw await de_ServiceNotActiveExceptionRes(parsedOutput); + case "ServiceNotFoundException": + case "com.amazonaws.ecs#ServiceNotFoundException": + throw await de_ServiceNotFoundExceptionRes(parsedOutput); + case "TargetNotFoundException": + case "com.amazonaws.ecs#TargetNotFoundException": + throw await de_TargetNotFoundExceptionRes(parsedOutput); + case "ClusterContainsCapacityProviderException": + case "com.amazonaws.ecs#ClusterContainsCapacityProviderException": + throw await de_ClusterContainsCapacityProviderExceptionRes(parsedOutput); + case "ClusterContainsContainerInstancesException": + case "com.amazonaws.ecs#ClusterContainsContainerInstancesException": + throw await de_ClusterContainsContainerInstancesExceptionRes(parsedOutput); + case "ClusterContainsServicesException": + case "com.amazonaws.ecs#ClusterContainsServicesException": + throw await de_ClusterContainsServicesExceptionRes(parsedOutput); + case "ClusterContainsTasksException": + case "com.amazonaws.ecs#ClusterContainsTasksException": + throw await de_ClusterContainsTasksExceptionRes(parsedOutput); + case "TaskSetNotFoundException": + case "com.amazonaws.ecs#TaskSetNotFoundException": + throw await de_TaskSetNotFoundExceptionRes(parsedOutput); + case "TargetNotConnectedException": + case "com.amazonaws.ecs#TargetNotConnectedException": + throw await de_TargetNotConnectedExceptionRes(parsedOutput); + case "ResourceNotFoundException": + case "com.amazonaws.ecs#ResourceNotFoundException": + throw await de_ResourceNotFoundExceptionRes(parsedOutput); + case "AttributeLimitExceededException": + case "com.amazonaws.ecs#AttributeLimitExceededException": + throw await de_AttributeLimitExceededExceptionRes(parsedOutput); + case "ResourceInUseException": + case "com.amazonaws.ecs#ResourceInUseException": + throw await de_ResourceInUseExceptionRes(parsedOutput); + case "BlockedException": + case "com.amazonaws.ecs#BlockedException": + throw await de_BlockedExceptionRes(parsedOutput); + case "ConflictException": + case "com.amazonaws.ecs#ConflictException": + throw await de_ConflictExceptionRes(parsedOutput); + case "ServiceDeploymentNotFoundException": + case "com.amazonaws.ecs#ServiceDeploymentNotFoundException": + throw await de_ServiceDeploymentNotFoundExceptionRes(parsedOutput); + case "MissingVersionException": + case "com.amazonaws.ecs#MissingVersionException": + throw await de_MissingVersionExceptionRes(parsedOutput); + case "NoUpdateAvailableException": + case "com.amazonaws.ecs#NoUpdateAvailableException": + throw await de_NoUpdateAvailableExceptionRes(parsedOutput); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } }; - -// src/commands/ListClustersCommand.ts - - - -var ListClustersCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "ListClusters", {}).n("ECSClient", "ListClustersCommand").f(void 0, void 0).ser(se_ListClustersCommand).de(de_ListClustersCommand).build() { - static { - __name(this, "ListClustersCommand"); - } +const de_AccessDeniedExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new AccessDeniedException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_AttributeLimitExceededExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new AttributeLimitExceededException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_BlockedExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new BlockedException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_ClientExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new ClientException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_ClusterContainsCapacityProviderExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new ClusterContainsCapacityProviderException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_ClusterContainsContainerInstancesExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new ClusterContainsContainerInstancesException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_ClusterContainsServicesExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new ClusterContainsServicesException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_ClusterContainsTasksExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new ClusterContainsTasksException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_ClusterNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new ClusterNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_ConflictExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new ConflictException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_InvalidParameterExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new InvalidParameterException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_LimitExceededExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new LimitExceededException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_MissingVersionExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new MissingVersionException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_NamespaceNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new NamespaceNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_NoUpdateAvailableExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new NoUpdateAvailableException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_PlatformTaskDefinitionIncompatibilityExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new PlatformTaskDefinitionIncompatibilityException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_PlatformUnknownExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new PlatformUnknownException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_ResourceInUseExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new ResourceInUseException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_ResourceNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new ResourceNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_ServerExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new ServerException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_ServiceDeploymentNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new ServiceDeploymentNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_ServiceNotActiveExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new ServiceNotActiveException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_ServiceNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new ServiceNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_TargetNotConnectedExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new TargetNotConnectedException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_TargetNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new TargetNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_TaskSetNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new TaskSetNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_UnsupportedFeatureExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new UnsupportedFeatureException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); +}; +const de_UpdateInProgressExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = smithyClient._json(body); + const exception = new UpdateInProgressException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return smithyClient.decorateServiceException(exception, body); }; - -// src/commands/ListContainerInstancesCommand.ts - - - -var ListContainerInstancesCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "ListContainerInstances", {}).n("ECSClient", "ListContainerInstancesCommand").f(void 0, void 0).ser(se_ListContainerInstancesCommand).de(de_ListContainerInstancesCommand).build() { - static { - __name(this, "ListContainerInstancesCommand"); - } +const se_CanaryConfiguration = (input, context) => { + return smithyClient.take(input, { + canaryBakeTimeInMinutes: [], + canaryPercent: smithyClient.serializeFloat, + }); }; - -// src/commands/ListServiceDeploymentsCommand.ts - - - -var ListServiceDeploymentsCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "ListServiceDeployments", {}).n("ECSClient", "ListServiceDeploymentsCommand").f(void 0, void 0).ser(se_ListServiceDeploymentsCommand).de(de_ListServiceDeploymentsCommand).build() { - static { - __name(this, "ListServiceDeploymentsCommand"); - } +const se_CreateCapacityProviderRequest = (input, context) => { + return smithyClient.take(input, { + autoScalingGroupProvider: smithyClient._json, + cluster: [], + managedInstancesProvider: (_) => se_CreateManagedInstancesProviderConfiguration(_), + name: [], + tags: smithyClient._json, + }); }; - -// src/commands/ListServicesByNamespaceCommand.ts - - - -var ListServicesByNamespaceCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "ListServicesByNamespace", {}).n("ECSClient", "ListServicesByNamespaceCommand").f(void 0, void 0).ser(se_ListServicesByNamespaceCommand).de(de_ListServicesByNamespaceCommand).build() { - static { - __name(this, "ListServicesByNamespaceCommand"); - } +const se_CreatedAt = (input, context) => { + return smithyClient.take(input, { + after: (_) => _.getTime() / 1_000, + before: (_) => _.getTime() / 1_000, + }); }; - -// src/commands/ListServicesCommand.ts - - - -var ListServicesCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "ListServices", {}).n("ECSClient", "ListServicesCommand").f(void 0, void 0).ser(se_ListServicesCommand).de(de_ListServicesCommand).build() { - static { - __name(this, "ListServicesCommand"); - } +const se_CreateManagedInstancesProviderConfiguration = (input, context) => { + return smithyClient.take(input, { + infrastructureRoleArn: [], + instanceLaunchTemplate: (_) => se_InstanceLaunchTemplate(_), + propagateTags: [], + }); }; - -// src/commands/ListTagsForResourceCommand.ts - - - -var ListTagsForResourceCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "ListTagsForResource", {}).n("ECSClient", "ListTagsForResourceCommand").f(void 0, void 0).ser(se_ListTagsForResourceCommand).de(de_ListTagsForResourceCommand).build() { - static { - __name(this, "ListTagsForResourceCommand"); - } +const se_CreateServiceRequest = (input, context) => { + return smithyClient.take(input, { + availabilityZoneRebalancing: [], + capacityProviderStrategy: smithyClient._json, + clientToken: [], + cluster: [], + deploymentConfiguration: (_) => se_DeploymentConfiguration(_), + deploymentController: smithyClient._json, + desiredCount: [], + enableECSManagedTags: [], + enableExecuteCommand: [], + healthCheckGracePeriodSeconds: [], + launchType: [], + loadBalancers: smithyClient._json, + networkConfiguration: smithyClient._json, + placementConstraints: smithyClient._json, + placementStrategy: smithyClient._json, + platformVersion: [], + propagateTags: [], + role: [], + schedulingStrategy: [], + serviceConnectConfiguration: smithyClient._json, + serviceName: [], + serviceRegistries: smithyClient._json, + tags: smithyClient._json, + taskDefinition: [], + volumeConfigurations: smithyClient._json, + vpcLatticeConfigurations: smithyClient._json, + }); }; - -// src/commands/ListTaskDefinitionFamiliesCommand.ts - - - -var ListTaskDefinitionFamiliesCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "ListTaskDefinitionFamilies", {}).n("ECSClient", "ListTaskDefinitionFamiliesCommand").f(void 0, void 0).ser(se_ListTaskDefinitionFamiliesCommand).de(de_ListTaskDefinitionFamiliesCommand).build() { - static { - __name(this, "ListTaskDefinitionFamiliesCommand"); - } +const se_CreateTaskSetRequest = (input, context) => { + return smithyClient.take(input, { + capacityProviderStrategy: smithyClient._json, + clientToken: [], + cluster: [], + externalId: [], + launchType: [], + loadBalancers: smithyClient._json, + networkConfiguration: smithyClient._json, + platformVersion: [], + scale: (_) => se_Scale(_), + service: [], + serviceRegistries: smithyClient._json, + tags: smithyClient._json, + taskDefinition: [], + }); }; - -// src/commands/ListTaskDefinitionsCommand.ts - - - -var ListTaskDefinitionsCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "ListTaskDefinitions", {}).n("ECSClient", "ListTaskDefinitionsCommand").f(void 0, void 0).ser(se_ListTaskDefinitionsCommand).de(de_ListTaskDefinitionsCommand).build() { - static { - __name(this, "ListTaskDefinitionsCommand"); - } +const se_DeploymentConfiguration = (input, context) => { + return smithyClient.take(input, { + alarms: smithyClient._json, + bakeTimeInMinutes: [], + canaryConfiguration: (_) => se_CanaryConfiguration(_), + deploymentCircuitBreaker: smithyClient._json, + lifecycleHooks: (_) => se_DeploymentLifecycleHookList(_), + linearConfiguration: (_) => se_LinearConfiguration(_), + maximumPercent: [], + minimumHealthyPercent: [], + strategy: [], + }); }; - -// src/commands/ListTasksCommand.ts - - - -var ListTasksCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "ListTasks", {}).n("ECSClient", "ListTasksCommand").f(void 0, void 0).ser(se_ListTasksCommand).de(de_ListTasksCommand).build() { - static { - __name(this, "ListTasksCommand"); - } +const se_DeploymentLifecycleHook = (input, context) => { + return smithyClient.take(input, { + hookDetails: (_) => se_HookDetails(_), + hookTargetArn: [], + lifecycleStages: smithyClient._json, + roleArn: [], + }); }; - -// src/commands/PutAccountSettingCommand.ts - - - -var PutAccountSettingCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "PutAccountSetting", {}).n("ECSClient", "PutAccountSettingCommand").f(void 0, void 0).ser(se_PutAccountSettingCommand).de(de_PutAccountSettingCommand).build() { - static { - __name(this, "PutAccountSettingCommand"); - } +const se_DeploymentLifecycleHookList = (input, context) => { + return input + .filter((e) => e != null) + .map((entry) => { + return se_DeploymentLifecycleHook(entry); + }); }; - -// src/commands/PutAccountSettingDefaultCommand.ts - - - -var PutAccountSettingDefaultCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "PutAccountSettingDefault", {}).n("ECSClient", "PutAccountSettingDefaultCommand").f(void 0, void 0).ser(se_PutAccountSettingDefaultCommand).de(de_PutAccountSettingDefaultCommand).build() { - static { - __name(this, "PutAccountSettingDefaultCommand"); - } +const se_HookDetails = (input, context) => { + return input; }; - -// src/commands/PutAttributesCommand.ts - - - -var PutAttributesCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "PutAttributes", {}).n("ECSClient", "PutAttributesCommand").f(void 0, void 0).ser(se_PutAttributesCommand).de(de_PutAttributesCommand).build() { - static { - __name(this, "PutAttributesCommand"); - } +const se_InstanceLaunchTemplate = (input, context) => { + return smithyClient.take(input, { + ec2InstanceProfileArn: [], + instanceRequirements: (_) => se_InstanceRequirementsRequest(_), + monitoring: [], + networkConfiguration: smithyClient._json, + storageConfiguration: smithyClient._json, + }); }; - -// src/commands/PutClusterCapacityProvidersCommand.ts - - - -var PutClusterCapacityProvidersCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "PutClusterCapacityProviders", {}).n("ECSClient", "PutClusterCapacityProvidersCommand").f(void 0, void 0).ser(se_PutClusterCapacityProvidersCommand).de(de_PutClusterCapacityProvidersCommand).build() { - static { - __name(this, "PutClusterCapacityProvidersCommand"); - } +const se_InstanceLaunchTemplateUpdate = (input, context) => { + return smithyClient.take(input, { + ec2InstanceProfileArn: [], + instanceRequirements: (_) => se_InstanceRequirementsRequest(_), + monitoring: [], + networkConfiguration: smithyClient._json, + storageConfiguration: smithyClient._json, + }); }; - -// src/commands/RegisterContainerInstanceCommand.ts - - - -var RegisterContainerInstanceCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "RegisterContainerInstance", {}).n("ECSClient", "RegisterContainerInstanceCommand").f(void 0, void 0).ser(se_RegisterContainerInstanceCommand).de(de_RegisterContainerInstanceCommand).build() { - static { - __name(this, "RegisterContainerInstanceCommand"); - } +const se_InstanceRequirementsRequest = (input, context) => { + return smithyClient.take(input, { + acceleratorCount: smithyClient._json, + acceleratorManufacturers: smithyClient._json, + acceleratorNames: smithyClient._json, + acceleratorTotalMemoryMiB: smithyClient._json, + acceleratorTypes: smithyClient._json, + allowedInstanceTypes: smithyClient._json, + bareMetal: [], + baselineEbsBandwidthMbps: smithyClient._json, + burstablePerformance: [], + cpuManufacturers: smithyClient._json, + excludedInstanceTypes: smithyClient._json, + instanceGenerations: smithyClient._json, + localStorage: [], + localStorageTypes: smithyClient._json, + maxSpotPriceAsPercentageOfOptimalOnDemandPrice: [], + memoryGiBPerVCpu: (_) => se_MemoryGiBPerVCpuRequest(_), + memoryMiB: smithyClient._json, + networkBandwidthGbps: (_) => se_NetworkBandwidthGbpsRequest(_), + networkInterfaceCount: smithyClient._json, + onDemandMaxPricePercentageOverLowestPrice: [], + requireHibernateSupport: [], + spotMaxPricePercentageOverLowestPrice: [], + totalLocalStorageGB: (_) => se_TotalLocalStorageGBRequest(_), + vCpuCount: smithyClient._json, + }); }; - -// src/commands/RegisterTaskDefinitionCommand.ts - - - -var RegisterTaskDefinitionCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "RegisterTaskDefinition", {}).n("ECSClient", "RegisterTaskDefinitionCommand").f(void 0, void 0).ser(se_RegisterTaskDefinitionCommand).de(de_RegisterTaskDefinitionCommand).build() { - static { - __name(this, "RegisterTaskDefinitionCommand"); - } +const se_LinearConfiguration = (input, context) => { + return smithyClient.take(input, { + stepBakeTimeInMinutes: [], + stepPercent: smithyClient.serializeFloat, + }); }; - -// src/commands/RunTaskCommand.ts - - - -var RunTaskCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "RunTask", {}).n("ECSClient", "RunTaskCommand").f(void 0, void 0).ser(se_RunTaskCommand).de(de_RunTaskCommand).build() { - static { - __name(this, "RunTaskCommand"); - } +const se_ListServiceDeploymentsRequest = (input, context) => { + return smithyClient.take(input, { + cluster: [], + createdAt: (_) => se_CreatedAt(_), + maxResults: [], + nextToken: [], + service: [], + status: smithyClient._json, + }); }; - -// src/commands/StartTaskCommand.ts - - - -var StartTaskCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "StartTask", {}).n("ECSClient", "StartTaskCommand").f(void 0, void 0).ser(se_StartTaskCommand).de(de_StartTaskCommand).build() { - static { - __name(this, "StartTaskCommand"); - } +const se_MemoryGiBPerVCpuRequest = (input, context) => { + return smithyClient.take(input, { + max: smithyClient.serializeFloat, + min: smithyClient.serializeFloat, + }); }; - -// src/commands/StopServiceDeploymentCommand.ts - - - -var StopServiceDeploymentCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "StopServiceDeployment", {}).n("ECSClient", "StopServiceDeploymentCommand").f(void 0, void 0).ser(se_StopServiceDeploymentCommand).de(de_StopServiceDeploymentCommand).build() { - static { - __name(this, "StopServiceDeploymentCommand"); - } +const se_NetworkBandwidthGbpsRequest = (input, context) => { + return smithyClient.take(input, { + max: smithyClient.serializeFloat, + min: smithyClient.serializeFloat, + }); }; - -// src/commands/StopTaskCommand.ts - - - -var StopTaskCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "StopTask", {}).n("ECSClient", "StopTaskCommand").f(void 0, void 0).ser(se_StopTaskCommand).de(de_StopTaskCommand).build() { - static { - __name(this, "StopTaskCommand"); - } +const se_RegisterContainerInstanceRequest = (input, context) => { + return smithyClient.take(input, { + attributes: smithyClient._json, + cluster: [], + containerInstanceArn: [], + instanceIdentityDocument: [], + instanceIdentityDocumentSignature: [], + platformDevices: smithyClient._json, + tags: smithyClient._json, + totalResources: (_) => se_Resources(_), + versionInfo: smithyClient._json, + }); }; - -// src/commands/SubmitAttachmentStateChangesCommand.ts - - - -var SubmitAttachmentStateChangesCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "SubmitAttachmentStateChanges", {}).n("ECSClient", "SubmitAttachmentStateChangesCommand").f(void 0, void 0).ser(se_SubmitAttachmentStateChangesCommand).de(de_SubmitAttachmentStateChangesCommand).build() { - static { - __name(this, "SubmitAttachmentStateChangesCommand"); - } +const se_Resource = (input, context) => { + return smithyClient.take(input, { + doubleValue: smithyClient.serializeFloat, + integerValue: [], + longValue: [], + name: [], + stringSetValue: smithyClient._json, + type: [], + }); }; - -// src/commands/SubmitContainerStateChangeCommand.ts - - - -var SubmitContainerStateChangeCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "SubmitContainerStateChange", {}).n("ECSClient", "SubmitContainerStateChangeCommand").f(void 0, void 0).ser(se_SubmitContainerStateChangeCommand).de(de_SubmitContainerStateChangeCommand).build() { - static { - __name(this, "SubmitContainerStateChangeCommand"); - } +const se_Resources = (input, context) => { + return input + .filter((e) => e != null) + .map((entry) => { + return se_Resource(entry); + }); }; - -// src/commands/SubmitTaskStateChangeCommand.ts - - - -var SubmitTaskStateChangeCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "SubmitTaskStateChange", {}).n("ECSClient", "SubmitTaskStateChangeCommand").f(void 0, void 0).ser(se_SubmitTaskStateChangeCommand).de(de_SubmitTaskStateChangeCommand).build() { - static { - __name(this, "SubmitTaskStateChangeCommand"); - } +const se_RunTaskRequest = (input, context) => { + return smithyClient.take(input, { + capacityProviderStrategy: smithyClient._json, + clientToken: [true, (_) => _ ?? uuid.v4()], + cluster: [], + count: [], + enableECSManagedTags: [], + enableExecuteCommand: [], + group: [], + launchType: [], + networkConfiguration: smithyClient._json, + overrides: smithyClient._json, + placementConstraints: smithyClient._json, + placementStrategy: smithyClient._json, + platformVersion: [], + propagateTags: [], + referenceId: [], + startedBy: [], + tags: smithyClient._json, + taskDefinition: [], + volumeConfigurations: smithyClient._json, + }); }; - -// src/commands/TagResourceCommand.ts - - - -var TagResourceCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "TagResource", {}).n("ECSClient", "TagResourceCommand").f(void 0, void 0).ser(se_TagResourceCommand).de(de_TagResourceCommand).build() { - static { - __name(this, "TagResourceCommand"); - } +const se_Scale = (input, context) => { + return smithyClient.take(input, { + unit: [], + value: smithyClient.serializeFloat, + }); }; - -// src/commands/UntagResourceCommand.ts - - - -var UntagResourceCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "UntagResource", {}).n("ECSClient", "UntagResourceCommand").f(void 0, void 0).ser(se_UntagResourceCommand).de(de_UntagResourceCommand).build() { - static { - __name(this, "UntagResourceCommand"); - } +const se_SubmitTaskStateChangeRequest = (input, context) => { + return smithyClient.take(input, { + attachments: smithyClient._json, + cluster: [], + containers: smithyClient._json, + executionStoppedAt: (_) => _.getTime() / 1_000, + managedAgents: smithyClient._json, + pullStartedAt: (_) => _.getTime() / 1_000, + pullStoppedAt: (_) => _.getTime() / 1_000, + reason: [], + status: [], + task: [], + }); }; - -// src/commands/UpdateCapacityProviderCommand.ts - - - -var UpdateCapacityProviderCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "UpdateCapacityProvider", {}).n("ECSClient", "UpdateCapacityProviderCommand").f(void 0, void 0).ser(se_UpdateCapacityProviderCommand).de(de_UpdateCapacityProviderCommand).build() { - static { - __name(this, "UpdateCapacityProviderCommand"); - } +const se_TotalLocalStorageGBRequest = (input, context) => { + return smithyClient.take(input, { + max: smithyClient.serializeFloat, + min: smithyClient.serializeFloat, + }); }; - -// src/commands/UpdateClusterCommand.ts - - - -var UpdateClusterCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "UpdateCluster", {}).n("ECSClient", "UpdateClusterCommand").f(void 0, void 0).ser(se_UpdateClusterCommand).de(de_UpdateClusterCommand).build() { - static { - __name(this, "UpdateClusterCommand"); - } +const se_UpdateCapacityProviderRequest = (input, context) => { + return smithyClient.take(input, { + autoScalingGroupProvider: smithyClient._json, + cluster: [], + managedInstancesProvider: (_) => se_UpdateManagedInstancesProviderConfiguration(_), + name: [], + }); }; - -// src/commands/UpdateClusterSettingsCommand.ts - - - -var UpdateClusterSettingsCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "UpdateClusterSettings", {}).n("ECSClient", "UpdateClusterSettingsCommand").f(void 0, void 0).ser(se_UpdateClusterSettingsCommand).de(de_UpdateClusterSettingsCommand).build() { - static { - __name(this, "UpdateClusterSettingsCommand"); - } +const se_UpdateManagedInstancesProviderConfiguration = (input, context) => { + return smithyClient.take(input, { + infrastructureRoleArn: [], + instanceLaunchTemplate: (_) => se_InstanceLaunchTemplateUpdate(_), + propagateTags: [], + }); }; - -// src/commands/UpdateContainerAgentCommand.ts - - - -var UpdateContainerAgentCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "UpdateContainerAgent", {}).n("ECSClient", "UpdateContainerAgentCommand").f(void 0, void 0).ser(se_UpdateContainerAgentCommand).de(de_UpdateContainerAgentCommand).build() { - static { - __name(this, "UpdateContainerAgentCommand"); - } +const se_UpdateServiceRequest = (input, context) => { + return smithyClient.take(input, { + availabilityZoneRebalancing: [], + capacityProviderStrategy: smithyClient._json, + cluster: [], + deploymentConfiguration: (_) => se_DeploymentConfiguration(_), + deploymentController: smithyClient._json, + desiredCount: [], + enableECSManagedTags: [], + enableExecuteCommand: [], + forceNewDeployment: [], + healthCheckGracePeriodSeconds: [], + loadBalancers: smithyClient._json, + networkConfiguration: smithyClient._json, + placementConstraints: smithyClient._json, + placementStrategy: smithyClient._json, + platformVersion: [], + propagateTags: [], + service: [], + serviceConnectConfiguration: smithyClient._json, + serviceRegistries: smithyClient._json, + taskDefinition: [], + volumeConfigurations: smithyClient._json, + vpcLatticeConfigurations: smithyClient._json, + }); }; - -// src/commands/UpdateContainerInstancesStateCommand.ts - - - -var UpdateContainerInstancesStateCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "UpdateContainerInstancesState", {}).n("ECSClient", "UpdateContainerInstancesStateCommand").f(void 0, void 0).ser(se_UpdateContainerInstancesStateCommand).de(de_UpdateContainerInstancesStateCommand).build() { - static { - __name(this, "UpdateContainerInstancesStateCommand"); - } +const se_UpdateTaskSetRequest = (input, context) => { + return smithyClient.take(input, { + cluster: [], + scale: (_) => se_Scale(_), + service: [], + taskSet: [], + }); }; - -// src/commands/UpdateServiceCommand.ts - - - -var UpdateServiceCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "UpdateService", {}).n("ECSClient", "UpdateServiceCommand").f(void 0, void 0).ser(se_UpdateServiceCommand).de(de_UpdateServiceCommand).build() { - static { - __name(this, "UpdateServiceCommand"); - } +const de_CanaryConfiguration = (output, context) => { + return smithyClient.take(output, { + canaryBakeTimeInMinutes: smithyClient.expectInt32, + canaryPercent: smithyClient.limitedParseDouble, + }); }; - -// src/commands/UpdateServicePrimaryTaskSetCommand.ts - - - -var UpdateServicePrimaryTaskSetCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "UpdateServicePrimaryTaskSet", {}).n("ECSClient", "UpdateServicePrimaryTaskSetCommand").f(void 0, void 0).ser(se_UpdateServicePrimaryTaskSetCommand).de(de_UpdateServicePrimaryTaskSetCommand).build() { - static { - __name(this, "UpdateServicePrimaryTaskSetCommand"); - } +const de_CapacityProvider = (output, context) => { + return smithyClient.take(output, { + autoScalingGroupProvider: smithyClient._json, + capacityProviderArn: smithyClient.expectString, + cluster: smithyClient.expectString, + managedInstancesProvider: (_) => de_ManagedInstancesProvider(_), + name: smithyClient.expectString, + status: smithyClient.expectString, + tags: smithyClient._json, + type: smithyClient.expectString, + updateStatus: smithyClient.expectString, + updateStatusReason: smithyClient.expectString, + }); }; - -// src/commands/UpdateTaskProtectionCommand.ts - - - -var UpdateTaskProtectionCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "UpdateTaskProtection", {}).n("ECSClient", "UpdateTaskProtectionCommand").f(void 0, void 0).ser(se_UpdateTaskProtectionCommand).de(de_UpdateTaskProtectionCommand).build() { - static { - __name(this, "UpdateTaskProtectionCommand"); - } +const de_CapacityProviders = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_CapacityProvider(entry); + }); + return retVal; +}; +const de_Container = (output, context) => { + return smithyClient.take(output, { + containerArn: smithyClient.expectString, + cpu: smithyClient.expectString, + exitCode: smithyClient.expectInt32, + gpuIds: smithyClient._json, + healthStatus: smithyClient.expectString, + image: smithyClient.expectString, + imageDigest: smithyClient.expectString, + lastStatus: smithyClient.expectString, + managedAgents: (_) => de_ManagedAgents(_), + memory: smithyClient.expectString, + memoryReservation: smithyClient.expectString, + name: smithyClient.expectString, + networkBindings: smithyClient._json, + networkInterfaces: smithyClient._json, + reason: smithyClient.expectString, + runtimeId: smithyClient.expectString, + taskArn: smithyClient.expectString, + }); }; - -// src/commands/UpdateTaskSetCommand.ts - - - -var UpdateTaskSetCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AmazonEC2ContainerServiceV20141113", "UpdateTaskSet", {}).n("ECSClient", "UpdateTaskSetCommand").f(void 0, void 0).ser(se_UpdateTaskSetCommand).de(de_UpdateTaskSetCommand).build() { - static { - __name(this, "UpdateTaskSetCommand"); - } +const de_ContainerInstance = (output, context) => { + return smithyClient.take(output, { + agentConnected: smithyClient.expectBoolean, + agentUpdateStatus: smithyClient.expectString, + attachments: smithyClient._json, + attributes: smithyClient._json, + capacityProviderName: smithyClient.expectString, + containerInstanceArn: smithyClient.expectString, + ec2InstanceId: smithyClient.expectString, + healthStatus: (_) => de_ContainerInstanceHealthStatus(_), + pendingTasksCount: smithyClient.expectInt32, + registeredAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + registeredResources: (_) => de_Resources(_), + remainingResources: (_) => de_Resources(_), + runningTasksCount: smithyClient.expectInt32, + status: smithyClient.expectString, + statusReason: smithyClient.expectString, + tags: smithyClient._json, + version: smithyClient.expectLong, + versionInfo: smithyClient._json, + }); }; - -// src/ECS.ts -var commands = { - CreateCapacityProviderCommand, - CreateClusterCommand, - CreateServiceCommand, - CreateTaskSetCommand, - DeleteAccountSettingCommand, - DeleteAttributesCommand, - DeleteCapacityProviderCommand, - DeleteClusterCommand, - DeleteServiceCommand, - DeleteTaskDefinitionsCommand, - DeleteTaskSetCommand, - DeregisterContainerInstanceCommand, - DeregisterTaskDefinitionCommand, - DescribeCapacityProvidersCommand, - DescribeClustersCommand, - DescribeContainerInstancesCommand, - DescribeServiceDeploymentsCommand, - DescribeServiceRevisionsCommand, - DescribeServicesCommand, - DescribeTaskDefinitionCommand, - DescribeTasksCommand, - DescribeTaskSetsCommand, - DiscoverPollEndpointCommand, - ExecuteCommandCommand, - GetTaskProtectionCommand, - ListAccountSettingsCommand, - ListAttributesCommand, - ListClustersCommand, - ListContainerInstancesCommand, - ListServiceDeploymentsCommand, - ListServicesCommand, - ListServicesByNamespaceCommand, - ListTagsForResourceCommand, - ListTaskDefinitionFamiliesCommand, - ListTaskDefinitionsCommand, - ListTasksCommand, - PutAccountSettingCommand, - PutAccountSettingDefaultCommand, - PutAttributesCommand, - PutClusterCapacityProvidersCommand, - RegisterContainerInstanceCommand, - RegisterTaskDefinitionCommand, - RunTaskCommand, - StartTaskCommand, - StopServiceDeploymentCommand, - StopTaskCommand, - SubmitAttachmentStateChangesCommand, - SubmitContainerStateChangeCommand, - SubmitTaskStateChangeCommand, - TagResourceCommand, - UntagResourceCommand, - UpdateCapacityProviderCommand, - UpdateClusterCommand, - UpdateClusterSettingsCommand, - UpdateContainerAgentCommand, - UpdateContainerInstancesStateCommand, - UpdateServiceCommand, - UpdateServicePrimaryTaskSetCommand, - UpdateTaskProtectionCommand, - UpdateTaskSetCommand +const de_ContainerInstanceHealthStatus = (output, context) => { + return smithyClient.take(output, { + details: (_) => de_InstanceHealthCheckResultList(_), + overallStatus: smithyClient.expectString, + }); }; -var ECS = class extends ECSClient { - static { - __name(this, "ECS"); - } +const de_ContainerInstances = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_ContainerInstance(entry); + }); + return retVal; }; -(0, import_smithy_client.createAggregatedClient)(commands, ECS); - -// src/pagination/ListAccountSettingsPaginator.ts +const de_Containers = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_Container(entry); + }); + return retVal; +}; +const de_CreateCapacityProviderResponse = (output, context) => { + return smithyClient.take(output, { + capacityProvider: (_) => de_CapacityProvider(_), + }); +}; +const de_CreateServiceResponse = (output, context) => { + return smithyClient.take(output, { + service: (_) => de_Service(_), + }); +}; +const de_CreateTaskSetResponse = (output, context) => { + return smithyClient.take(output, { + taskSet: (_) => de_TaskSet(_), + }); +}; +const de_DeleteCapacityProviderResponse = (output, context) => { + return smithyClient.take(output, { + capacityProvider: (_) => de_CapacityProvider(_), + }); +}; +const de_DeleteServiceResponse = (output, context) => { + return smithyClient.take(output, { + service: (_) => de_Service(_), + }); +}; +const de_DeleteTaskDefinitionsResponse = (output, context) => { + return smithyClient.take(output, { + failures: smithyClient._json, + taskDefinitions: (_) => de_TaskDefinitionList(_), + }); +}; +const de_DeleteTaskSetResponse = (output, context) => { + return smithyClient.take(output, { + taskSet: (_) => de_TaskSet(_), + }); +}; +const de_Deployment = (output, context) => { + return smithyClient.take(output, { + capacityProviderStrategy: smithyClient._json, + createdAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + desiredCount: smithyClient.expectInt32, + failedTasks: smithyClient.expectInt32, + fargateEphemeralStorage: smithyClient._json, + id: smithyClient.expectString, + launchType: smithyClient.expectString, + networkConfiguration: smithyClient._json, + pendingCount: smithyClient.expectInt32, + platformFamily: smithyClient.expectString, + platformVersion: smithyClient.expectString, + rolloutState: smithyClient.expectString, + rolloutStateReason: smithyClient.expectString, + runningCount: smithyClient.expectInt32, + serviceConnectConfiguration: smithyClient._json, + serviceConnectResources: smithyClient._json, + status: smithyClient.expectString, + taskDefinition: smithyClient.expectString, + updatedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + volumeConfigurations: smithyClient._json, + vpcLatticeConfigurations: smithyClient._json, + }); +}; +const de_DeploymentConfiguration = (output, context) => { + return smithyClient.take(output, { + alarms: smithyClient._json, + bakeTimeInMinutes: smithyClient.expectInt32, + canaryConfiguration: (_) => de_CanaryConfiguration(_), + deploymentCircuitBreaker: smithyClient._json, + lifecycleHooks: (_) => de_DeploymentLifecycleHookList(_), + linearConfiguration: (_) => de_LinearConfiguration(_), + maximumPercent: smithyClient.expectInt32, + minimumHealthyPercent: smithyClient.expectInt32, + strategy: smithyClient.expectString, + }); +}; +const de_DeploymentLifecycleHook = (output, context) => { + return smithyClient.take(output, { + hookDetails: (_) => de_HookDetails(_), + hookTargetArn: smithyClient.expectString, + lifecycleStages: smithyClient._json, + roleArn: smithyClient.expectString, + }); +}; +const de_DeploymentLifecycleHookList = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_DeploymentLifecycleHook(entry); + }); + return retVal; +}; +const de_Deployments = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_Deployment(entry); + }); + return retVal; +}; +const de_DeregisterContainerInstanceResponse = (output, context) => { + return smithyClient.take(output, { + containerInstance: (_) => de_ContainerInstance(_), + }); +}; +const de_DeregisterTaskDefinitionResponse = (output, context) => { + return smithyClient.take(output, { + taskDefinition: (_) => de_TaskDefinition(_), + }); +}; +const de_DescribeCapacityProvidersResponse = (output, context) => { + return smithyClient.take(output, { + capacityProviders: (_) => de_CapacityProviders(_), + failures: smithyClient._json, + nextToken: smithyClient.expectString, + }); +}; +const de_DescribeContainerInstancesResponse = (output, context) => { + return smithyClient.take(output, { + containerInstances: (_) => de_ContainerInstances(_), + failures: smithyClient._json, + }); +}; +const de_DescribeServiceDeploymentsResponse = (output, context) => { + return smithyClient.take(output, { + failures: smithyClient._json, + serviceDeployments: (_) => de_ServiceDeployments(_), + }); +}; +const de_DescribeServiceRevisionsResponse = (output, context) => { + return smithyClient.take(output, { + failures: smithyClient._json, + serviceRevisions: (_) => de_ServiceRevisions(_), + }); +}; +const de_DescribeServicesResponse = (output, context) => { + return smithyClient.take(output, { + failures: smithyClient._json, + services: (_) => de_Services(_), + }); +}; +const de_DescribeTaskDefinitionResponse = (output, context) => { + return smithyClient.take(output, { + tags: smithyClient._json, + taskDefinition: (_) => de_TaskDefinition(_), + }); +}; +const de_DescribeTaskSetsResponse = (output, context) => { + return smithyClient.take(output, { + failures: smithyClient._json, + taskSets: (_) => de_TaskSets(_), + }); +}; +const de_DescribeTasksResponse = (output, context) => { + return smithyClient.take(output, { + failures: smithyClient._json, + tasks: (_) => de_Tasks(_), + }); +}; +const de_GetTaskProtectionResponse = (output, context) => { + return smithyClient.take(output, { + failures: smithyClient._json, + protectedTasks: (_) => de_ProtectedTasks(_), + }); +}; +const de_HookDetails = (output, context) => { + return output; +}; +const de_InstanceHealthCheckResult = (output, context) => { + return smithyClient.take(output, { + lastStatusChange: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + lastUpdated: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + status: smithyClient.expectString, + type: smithyClient.expectString, + }); +}; +const de_InstanceHealthCheckResultList = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_InstanceHealthCheckResult(entry); + }); + return retVal; +}; +const de_InstanceLaunchTemplate = (output, context) => { + return smithyClient.take(output, { + ec2InstanceProfileArn: smithyClient.expectString, + instanceRequirements: (_) => de_InstanceRequirementsRequest(_), + monitoring: smithyClient.expectString, + networkConfiguration: smithyClient._json, + storageConfiguration: smithyClient._json, + }); +}; +const de_InstanceRequirementsRequest = (output, context) => { + return smithyClient.take(output, { + acceleratorCount: smithyClient._json, + acceleratorManufacturers: smithyClient._json, + acceleratorNames: smithyClient._json, + acceleratorTotalMemoryMiB: smithyClient._json, + acceleratorTypes: smithyClient._json, + allowedInstanceTypes: smithyClient._json, + bareMetal: smithyClient.expectString, + baselineEbsBandwidthMbps: smithyClient._json, + burstablePerformance: smithyClient.expectString, + cpuManufacturers: smithyClient._json, + excludedInstanceTypes: smithyClient._json, + instanceGenerations: smithyClient._json, + localStorage: smithyClient.expectString, + localStorageTypes: smithyClient._json, + maxSpotPriceAsPercentageOfOptimalOnDemandPrice: smithyClient.expectInt32, + memoryGiBPerVCpu: (_) => de_MemoryGiBPerVCpuRequest(_), + memoryMiB: smithyClient._json, + networkBandwidthGbps: (_) => de_NetworkBandwidthGbpsRequest(_), + networkInterfaceCount: smithyClient._json, + onDemandMaxPricePercentageOverLowestPrice: smithyClient.expectInt32, + requireHibernateSupport: smithyClient.expectBoolean, + spotMaxPricePercentageOverLowestPrice: smithyClient.expectInt32, + totalLocalStorageGB: (_) => de_TotalLocalStorageGBRequest(_), + vCpuCount: smithyClient._json, + }); +}; +const de_LinearConfiguration = (output, context) => { + return smithyClient.take(output, { + stepBakeTimeInMinutes: smithyClient.expectInt32, + stepPercent: smithyClient.limitedParseDouble, + }); +}; +const de_ListServiceDeploymentsResponse = (output, context) => { + return smithyClient.take(output, { + nextToken: smithyClient.expectString, + serviceDeployments: (_) => de_ServiceDeploymentsBrief(_), + }); +}; +const de_ManagedAgent = (output, context) => { + return smithyClient.take(output, { + lastStartedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + lastStatus: smithyClient.expectString, + name: smithyClient.expectString, + reason: smithyClient.expectString, + }); +}; +const de_ManagedAgents = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_ManagedAgent(entry); + }); + return retVal; +}; +const de_ManagedInstancesProvider = (output, context) => { + return smithyClient.take(output, { + infrastructureRoleArn: smithyClient.expectString, + instanceLaunchTemplate: (_) => de_InstanceLaunchTemplate(_), + propagateTags: smithyClient.expectString, + }); +}; +const de_MemoryGiBPerVCpuRequest = (output, context) => { + return smithyClient.take(output, { + max: smithyClient.limitedParseDouble, + min: smithyClient.limitedParseDouble, + }); +}; +const de_NetworkBandwidthGbpsRequest = (output, context) => { + return smithyClient.take(output, { + max: smithyClient.limitedParseDouble, + min: smithyClient.limitedParseDouble, + }); +}; +const de_ProtectedTask = (output, context) => { + return smithyClient.take(output, { + expirationDate: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + protectionEnabled: smithyClient.expectBoolean, + taskArn: smithyClient.expectString, + }); +}; +const de_ProtectedTasks = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_ProtectedTask(entry); + }); + return retVal; +}; +const de_RegisterContainerInstanceResponse = (output, context) => { + return smithyClient.take(output, { + containerInstance: (_) => de_ContainerInstance(_), + }); +}; +const de_RegisterTaskDefinitionResponse = (output, context) => { + return smithyClient.take(output, { + tags: smithyClient._json, + taskDefinition: (_) => de_TaskDefinition(_), + }); +}; +const de_Resource = (output, context) => { + return smithyClient.take(output, { + doubleValue: smithyClient.limitedParseDouble, + integerValue: smithyClient.expectInt32, + longValue: smithyClient.expectLong, + name: smithyClient.expectString, + stringSetValue: smithyClient._json, + type: smithyClient.expectString, + }); +}; +const de_Resources = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_Resource(entry); + }); + return retVal; +}; +const de_Rollback = (output, context) => { + return smithyClient.take(output, { + reason: smithyClient.expectString, + serviceRevisionArn: smithyClient.expectString, + startedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + }); +}; +const de_RunTaskResponse = (output, context) => { + return smithyClient.take(output, { + failures: smithyClient._json, + tasks: (_) => de_Tasks(_), + }); +}; +const de_Scale = (output, context) => { + return smithyClient.take(output, { + unit: smithyClient.expectString, + value: smithyClient.limitedParseDouble, + }); +}; +const de_Service = (output, context) => { + return smithyClient.take(output, { + availabilityZoneRebalancing: smithyClient.expectString, + capacityProviderStrategy: smithyClient._json, + clusterArn: smithyClient.expectString, + createdAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + createdBy: smithyClient.expectString, + deploymentConfiguration: (_) => de_DeploymentConfiguration(_), + deploymentController: smithyClient._json, + deployments: (_) => de_Deployments(_), + desiredCount: smithyClient.expectInt32, + enableECSManagedTags: smithyClient.expectBoolean, + enableExecuteCommand: smithyClient.expectBoolean, + events: (_) => de_ServiceEvents(_), + healthCheckGracePeriodSeconds: smithyClient.expectInt32, + launchType: smithyClient.expectString, + loadBalancers: smithyClient._json, + networkConfiguration: smithyClient._json, + pendingCount: smithyClient.expectInt32, + placementConstraints: smithyClient._json, + placementStrategy: smithyClient._json, + platformFamily: smithyClient.expectString, + platformVersion: smithyClient.expectString, + propagateTags: smithyClient.expectString, + roleArn: smithyClient.expectString, + runningCount: smithyClient.expectInt32, + schedulingStrategy: smithyClient.expectString, + serviceArn: smithyClient.expectString, + serviceName: smithyClient.expectString, + serviceRegistries: smithyClient._json, + status: smithyClient.expectString, + tags: smithyClient._json, + taskDefinition: smithyClient.expectString, + taskSets: (_) => de_TaskSets(_), + }); +}; +const de_ServiceDeployment = (output, context) => { + return smithyClient.take(output, { + alarms: smithyClient._json, + clusterArn: smithyClient.expectString, + createdAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + deploymentCircuitBreaker: smithyClient._json, + deploymentConfiguration: (_) => de_DeploymentConfiguration(_), + finishedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + lifecycleStage: smithyClient.expectString, + rollback: (_) => de_Rollback(_), + serviceArn: smithyClient.expectString, + serviceDeploymentArn: smithyClient.expectString, + sourceServiceRevisions: (_) => de_ServiceRevisionsSummaryList(_), + startedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + status: smithyClient.expectString, + statusReason: smithyClient.expectString, + stoppedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + targetServiceRevision: (_) => de_ServiceRevisionSummary(_), + updatedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + }); +}; +const de_ServiceDeploymentBrief = (output, context) => { + return smithyClient.take(output, { + clusterArn: smithyClient.expectString, + createdAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + finishedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + serviceArn: smithyClient.expectString, + serviceDeploymentArn: smithyClient.expectString, + startedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + status: smithyClient.expectString, + statusReason: smithyClient.expectString, + targetServiceRevisionArn: smithyClient.expectString, + }); +}; +const de_ServiceDeployments = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_ServiceDeployment(entry); + }); + return retVal; +}; +const de_ServiceDeploymentsBrief = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_ServiceDeploymentBrief(entry); + }); + return retVal; +}; +const de_ServiceEvent = (output, context) => { + return smithyClient.take(output, { + createdAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + id: smithyClient.expectString, + message: smithyClient.expectString, + }); +}; +const de_ServiceEvents = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_ServiceEvent(entry); + }); + return retVal; +}; +const de_ServiceRevision = (output, context) => { + return smithyClient.take(output, { + capacityProviderStrategy: smithyClient._json, + clusterArn: smithyClient.expectString, + containerImages: smithyClient._json, + createdAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + fargateEphemeralStorage: smithyClient._json, + guardDutyEnabled: smithyClient.expectBoolean, + launchType: smithyClient.expectString, + loadBalancers: smithyClient._json, + networkConfiguration: smithyClient._json, + platformFamily: smithyClient.expectString, + platformVersion: smithyClient.expectString, + resolvedConfiguration: smithyClient._json, + serviceArn: smithyClient.expectString, + serviceConnectConfiguration: smithyClient._json, + serviceRegistries: smithyClient._json, + serviceRevisionArn: smithyClient.expectString, + taskDefinition: smithyClient.expectString, + volumeConfigurations: smithyClient._json, + vpcLatticeConfigurations: smithyClient._json, + }); +}; +const de_ServiceRevisions = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_ServiceRevision(entry); + }); + return retVal; +}; +const de_ServiceRevisionsSummaryList = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_ServiceRevisionSummary(entry); + }); + return retVal; +}; +const de_ServiceRevisionSummary = (output, context) => { + return smithyClient.take(output, { + arn: smithyClient.expectString, + pendingTaskCount: smithyClient.expectInt32, + requestedProductionTrafficWeight: smithyClient.limitedParseDouble, + requestedTaskCount: smithyClient.expectInt32, + requestedTestTrafficWeight: smithyClient.limitedParseDouble, + runningTaskCount: smithyClient.expectInt32, + }); +}; +const de_Services = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_Service(entry); + }); + return retVal; +}; +const de_StartTaskResponse = (output, context) => { + return smithyClient.take(output, { + failures: smithyClient._json, + tasks: (_) => de_Tasks(_), + }); +}; +const de_StopTaskResponse = (output, context) => { + return smithyClient.take(output, { + task: (_) => de_Task(_), + }); +}; +const de_Task = (output, context) => { + return smithyClient.take(output, { + attachments: smithyClient._json, + attributes: smithyClient._json, + availabilityZone: smithyClient.expectString, + capacityProviderName: smithyClient.expectString, + clusterArn: smithyClient.expectString, + connectivity: smithyClient.expectString, + connectivityAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + containerInstanceArn: smithyClient.expectString, + containers: (_) => de_Containers(_), + cpu: smithyClient.expectString, + createdAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + desiredStatus: smithyClient.expectString, + enableExecuteCommand: smithyClient.expectBoolean, + ephemeralStorage: smithyClient._json, + executionStoppedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + fargateEphemeralStorage: smithyClient._json, + group: smithyClient.expectString, + healthStatus: smithyClient.expectString, + inferenceAccelerators: smithyClient._json, + lastStatus: smithyClient.expectString, + launchType: smithyClient.expectString, + memory: smithyClient.expectString, + overrides: smithyClient._json, + platformFamily: smithyClient.expectString, + platformVersion: smithyClient.expectString, + pullStartedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + pullStoppedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + startedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + startedBy: smithyClient.expectString, + stopCode: smithyClient.expectString, + stoppedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + stoppedReason: smithyClient.expectString, + stoppingAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + tags: smithyClient._json, + taskArn: smithyClient.expectString, + taskDefinitionArn: smithyClient.expectString, + version: smithyClient.expectLong, + }); +}; +const de_TaskDefinition = (output, context) => { + return smithyClient.take(output, { + compatibilities: smithyClient._json, + containerDefinitions: smithyClient._json, + cpu: smithyClient.expectString, + deregisteredAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + enableFaultInjection: smithyClient.expectBoolean, + ephemeralStorage: smithyClient._json, + executionRoleArn: smithyClient.expectString, + family: smithyClient.expectString, + inferenceAccelerators: smithyClient._json, + ipcMode: smithyClient.expectString, + memory: smithyClient.expectString, + networkMode: smithyClient.expectString, + pidMode: smithyClient.expectString, + placementConstraints: smithyClient._json, + proxyConfiguration: smithyClient._json, + registeredAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + registeredBy: smithyClient.expectString, + requiresAttributes: smithyClient._json, + requiresCompatibilities: smithyClient._json, + revision: smithyClient.expectInt32, + runtimePlatform: smithyClient._json, + status: smithyClient.expectString, + taskDefinitionArn: smithyClient.expectString, + taskRoleArn: smithyClient.expectString, + volumes: smithyClient._json, + }); +}; +const de_TaskDefinitionList = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_TaskDefinition(entry); + }); + return retVal; +}; +const de_Tasks = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_Task(entry); + }); + return retVal; +}; +const de_TaskSet = (output, context) => { + return smithyClient.take(output, { + capacityProviderStrategy: smithyClient._json, + clusterArn: smithyClient.expectString, + computedDesiredCount: smithyClient.expectInt32, + createdAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + externalId: smithyClient.expectString, + fargateEphemeralStorage: smithyClient._json, + id: smithyClient.expectString, + launchType: smithyClient.expectString, + loadBalancers: smithyClient._json, + networkConfiguration: smithyClient._json, + pendingCount: smithyClient.expectInt32, + platformFamily: smithyClient.expectString, + platformVersion: smithyClient.expectString, + runningCount: smithyClient.expectInt32, + scale: (_) => de_Scale(_), + serviceArn: smithyClient.expectString, + serviceRegistries: smithyClient._json, + stabilityStatus: smithyClient.expectString, + stabilityStatusAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + startedBy: smithyClient.expectString, + status: smithyClient.expectString, + tags: smithyClient._json, + taskDefinition: smithyClient.expectString, + taskSetArn: smithyClient.expectString, + updatedAt: (_) => smithyClient.expectNonNull(smithyClient.parseEpochTimestamp(smithyClient.expectNumber(_))), + }); +}; +const de_TaskSets = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_TaskSet(entry); + }); + return retVal; +}; +const de_TotalLocalStorageGBRequest = (output, context) => { + return smithyClient.take(output, { + max: smithyClient.limitedParseDouble, + min: smithyClient.limitedParseDouble, + }); +}; +const de_UpdateCapacityProviderResponse = (output, context) => { + return smithyClient.take(output, { + capacityProvider: (_) => de_CapacityProvider(_), + }); +}; +const de_UpdateContainerAgentResponse = (output, context) => { + return smithyClient.take(output, { + containerInstance: (_) => de_ContainerInstance(_), + }); +}; +const de_UpdateContainerInstancesStateResponse = (output, context) => { + return smithyClient.take(output, { + containerInstances: (_) => de_ContainerInstances(_), + failures: smithyClient._json, + }); +}; +const de_UpdateServicePrimaryTaskSetResponse = (output, context) => { + return smithyClient.take(output, { + taskSet: (_) => de_TaskSet(_), + }); +}; +const de_UpdateServiceResponse = (output, context) => { + return smithyClient.take(output, { + service: (_) => de_Service(_), + }); +}; +const de_UpdateTaskProtectionResponse = (output, context) => { + return smithyClient.take(output, { + failures: smithyClient._json, + protectedTasks: (_) => de_ProtectedTasks(_), + }); +}; +const de_UpdateTaskSetResponse = (output, context) => { + return smithyClient.take(output, { + taskSet: (_) => de_TaskSet(_), + }); +}; +const deserializeMetadata = (output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"], +}); +const throwDefaultError = smithyClient.withBaseException(ECSServiceException); +const buildHttpRpcRequest = async (context, headers, path, resolvedHostname, body) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const contents = { + protocol, + hostname, + port, + method: "POST", + path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, + headers, + }; + if (body !== undefined) { + contents.body = body; + } + return new protocolHttp.HttpRequest(contents); +}; +function sharedHeaders(operation) { + return { + "content-type": "application/x-amz-json-1.1", + "x-amz-target": `AmazonEC2ContainerServiceV20141113.${operation}`, + }; +} -var paginateListAccountSettings = (0, import_core.createPaginator)(ECSClient, ListAccountSettingsCommand, "nextToken", "nextToken", "maxResults"); - -// src/pagination/ListAttributesPaginator.ts - -var paginateListAttributes = (0, import_core.createPaginator)(ECSClient, ListAttributesCommand, "nextToken", "nextToken", "maxResults"); - -// src/pagination/ListClustersPaginator.ts - -var paginateListClusters = (0, import_core.createPaginator)(ECSClient, ListClustersCommand, "nextToken", "nextToken", "maxResults"); - -// src/pagination/ListContainerInstancesPaginator.ts - -var paginateListContainerInstances = (0, import_core.createPaginator)(ECSClient, ListContainerInstancesCommand, "nextToken", "nextToken", "maxResults"); - -// src/pagination/ListServicesByNamespacePaginator.ts - -var paginateListServicesByNamespace = (0, import_core.createPaginator)(ECSClient, ListServicesByNamespaceCommand, "nextToken", "nextToken", "maxResults"); - -// src/pagination/ListServicesPaginator.ts - -var paginateListServices = (0, import_core.createPaginator)(ECSClient, ListServicesCommand, "nextToken", "nextToken", "maxResults"); - -// src/pagination/ListTaskDefinitionFamiliesPaginator.ts - -var paginateListTaskDefinitionFamilies = (0, import_core.createPaginator)(ECSClient, ListTaskDefinitionFamiliesCommand, "nextToken", "nextToken", "maxResults"); - -// src/pagination/ListTaskDefinitionsPaginator.ts - -var paginateListTaskDefinitions = (0, import_core.createPaginator)(ECSClient, ListTaskDefinitionsCommand, "nextToken", "nextToken", "maxResults"); - -// src/pagination/ListTasksPaginator.ts - -var paginateListTasks = (0, import_core.createPaginator)(ECSClient, ListTasksCommand, "nextToken", "nextToken", "maxResults"); - -// src/waiters/waitForServicesInactive.ts -var import_util_waiter = __nccwpck_require__(5290); -var checkState = /* @__PURE__ */ __name(async (client, input) => { - let reason; - try { - const result = await client.send(new DescribeServicesCommand(input)); - reason = result; +class CreateCapacityProviderCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "CreateCapacityProvider", {}) + .n("ECSClient", "CreateCapacityProviderCommand") + .f(void 0, void 0) + .ser(se_CreateCapacityProviderCommand) + .de(de_CreateCapacityProviderCommand) + .build() { +} + +class CreateClusterCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "CreateCluster", {}) + .n("ECSClient", "CreateClusterCommand") + .f(void 0, void 0) + .ser(se_CreateClusterCommand) + .de(de_CreateClusterCommand) + .build() { +} + +class CreateServiceCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "CreateService", {}) + .n("ECSClient", "CreateServiceCommand") + .f(void 0, void 0) + .ser(se_CreateServiceCommand) + .de(de_CreateServiceCommand) + .build() { +} + +class CreateTaskSetCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "CreateTaskSet", {}) + .n("ECSClient", "CreateTaskSetCommand") + .f(void 0, void 0) + .ser(se_CreateTaskSetCommand) + .de(de_CreateTaskSetCommand) + .build() { +} + +class DeleteAccountSettingCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DeleteAccountSetting", {}) + .n("ECSClient", "DeleteAccountSettingCommand") + .f(void 0, void 0) + .ser(se_DeleteAccountSettingCommand) + .de(de_DeleteAccountSettingCommand) + .build() { +} + +class DeleteAttributesCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DeleteAttributes", {}) + .n("ECSClient", "DeleteAttributesCommand") + .f(void 0, void 0) + .ser(se_DeleteAttributesCommand) + .de(de_DeleteAttributesCommand) + .build() { +} + +class DeleteCapacityProviderCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DeleteCapacityProvider", {}) + .n("ECSClient", "DeleteCapacityProviderCommand") + .f(void 0, void 0) + .ser(se_DeleteCapacityProviderCommand) + .de(de_DeleteCapacityProviderCommand) + .build() { +} + +class DeleteClusterCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DeleteCluster", {}) + .n("ECSClient", "DeleteClusterCommand") + .f(void 0, void 0) + .ser(se_DeleteClusterCommand) + .de(de_DeleteClusterCommand) + .build() { +} + +class DeleteServiceCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DeleteService", {}) + .n("ECSClient", "DeleteServiceCommand") + .f(void 0, void 0) + .ser(se_DeleteServiceCommand) + .de(de_DeleteServiceCommand) + .build() { +} + +class DeleteTaskDefinitionsCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DeleteTaskDefinitions", {}) + .n("ECSClient", "DeleteTaskDefinitionsCommand") + .f(void 0, void 0) + .ser(se_DeleteTaskDefinitionsCommand) + .de(de_DeleteTaskDefinitionsCommand) + .build() { +} + +class DeleteTaskSetCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DeleteTaskSet", {}) + .n("ECSClient", "DeleteTaskSetCommand") + .f(void 0, void 0) + .ser(se_DeleteTaskSetCommand) + .de(de_DeleteTaskSetCommand) + .build() { +} + +class DeregisterContainerInstanceCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DeregisterContainerInstance", {}) + .n("ECSClient", "DeregisterContainerInstanceCommand") + .f(void 0, void 0) + .ser(se_DeregisterContainerInstanceCommand) + .de(de_DeregisterContainerInstanceCommand) + .build() { +} + +class DeregisterTaskDefinitionCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DeregisterTaskDefinition", {}) + .n("ECSClient", "DeregisterTaskDefinitionCommand") + .f(void 0, void 0) + .ser(se_DeregisterTaskDefinitionCommand) + .de(de_DeregisterTaskDefinitionCommand) + .build() { +} + +class DescribeCapacityProvidersCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DescribeCapacityProviders", {}) + .n("ECSClient", "DescribeCapacityProvidersCommand") + .f(void 0, void 0) + .ser(se_DescribeCapacityProvidersCommand) + .de(de_DescribeCapacityProvidersCommand) + .build() { +} + +class DescribeClustersCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DescribeClusters", {}) + .n("ECSClient", "DescribeClustersCommand") + .f(void 0, void 0) + .ser(se_DescribeClustersCommand) + .de(de_DescribeClustersCommand) + .build() { +} + +class DescribeContainerInstancesCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DescribeContainerInstances", {}) + .n("ECSClient", "DescribeContainerInstancesCommand") + .f(void 0, void 0) + .ser(se_DescribeContainerInstancesCommand) + .de(de_DescribeContainerInstancesCommand) + .build() { +} + +class DescribeServiceDeploymentsCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DescribeServiceDeployments", {}) + .n("ECSClient", "DescribeServiceDeploymentsCommand") + .f(void 0, void 0) + .ser(se_DescribeServiceDeploymentsCommand) + .de(de_DescribeServiceDeploymentsCommand) + .build() { +} + +class DescribeServiceRevisionsCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DescribeServiceRevisions", {}) + .n("ECSClient", "DescribeServiceRevisionsCommand") + .f(void 0, void 0) + .ser(se_DescribeServiceRevisionsCommand) + .de(de_DescribeServiceRevisionsCommand) + .build() { +} + +class DescribeServicesCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DescribeServices", {}) + .n("ECSClient", "DescribeServicesCommand") + .f(void 0, void 0) + .ser(se_DescribeServicesCommand) + .de(de_DescribeServicesCommand) + .build() { +} + +class DescribeTaskDefinitionCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DescribeTaskDefinition", {}) + .n("ECSClient", "DescribeTaskDefinitionCommand") + .f(void 0, void 0) + .ser(se_DescribeTaskDefinitionCommand) + .de(de_DescribeTaskDefinitionCommand) + .build() { +} + +class DescribeTasksCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DescribeTasks", {}) + .n("ECSClient", "DescribeTasksCommand") + .f(void 0, void 0) + .ser(se_DescribeTasksCommand) + .de(de_DescribeTasksCommand) + .build() { +} + +class DescribeTaskSetsCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DescribeTaskSets", {}) + .n("ECSClient", "DescribeTaskSetsCommand") + .f(void 0, void 0) + .ser(se_DescribeTaskSetsCommand) + .de(de_DescribeTaskSetsCommand) + .build() { +} + +class DiscoverPollEndpointCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "DiscoverPollEndpoint", {}) + .n("ECSClient", "DiscoverPollEndpointCommand") + .f(void 0, void 0) + .ser(se_DiscoverPollEndpointCommand) + .de(de_DiscoverPollEndpointCommand) + .build() { +} + +class ExecuteCommandCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "ExecuteCommand", {}) + .n("ECSClient", "ExecuteCommandCommand") + .f(void 0, ExecuteCommandResponseFilterSensitiveLog) + .ser(se_ExecuteCommandCommand) + .de(de_ExecuteCommandCommand) + .build() { +} + +class GetTaskProtectionCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "GetTaskProtection", {}) + .n("ECSClient", "GetTaskProtectionCommand") + .f(void 0, void 0) + .ser(se_GetTaskProtectionCommand) + .de(de_GetTaskProtectionCommand) + .build() { +} + +class ListAccountSettingsCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "ListAccountSettings", {}) + .n("ECSClient", "ListAccountSettingsCommand") + .f(void 0, void 0) + .ser(se_ListAccountSettingsCommand) + .de(de_ListAccountSettingsCommand) + .build() { +} + +class ListAttributesCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "ListAttributes", {}) + .n("ECSClient", "ListAttributesCommand") + .f(void 0, void 0) + .ser(se_ListAttributesCommand) + .de(de_ListAttributesCommand) + .build() { +} + +class ListClustersCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "ListClusters", {}) + .n("ECSClient", "ListClustersCommand") + .f(void 0, void 0) + .ser(se_ListClustersCommand) + .de(de_ListClustersCommand) + .build() { +} + +class ListContainerInstancesCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "ListContainerInstances", {}) + .n("ECSClient", "ListContainerInstancesCommand") + .f(void 0, void 0) + .ser(se_ListContainerInstancesCommand) + .de(de_ListContainerInstancesCommand) + .build() { +} + +class ListServiceDeploymentsCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "ListServiceDeployments", {}) + .n("ECSClient", "ListServiceDeploymentsCommand") + .f(void 0, void 0) + .ser(se_ListServiceDeploymentsCommand) + .de(de_ListServiceDeploymentsCommand) + .build() { +} + +class ListServicesByNamespaceCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "ListServicesByNamespace", {}) + .n("ECSClient", "ListServicesByNamespaceCommand") + .f(void 0, void 0) + .ser(se_ListServicesByNamespaceCommand) + .de(de_ListServicesByNamespaceCommand) + .build() { +} + +class ListServicesCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "ListServices", {}) + .n("ECSClient", "ListServicesCommand") + .f(void 0, void 0) + .ser(se_ListServicesCommand) + .de(de_ListServicesCommand) + .build() { +} + +class ListTagsForResourceCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "ListTagsForResource", {}) + .n("ECSClient", "ListTagsForResourceCommand") + .f(void 0, void 0) + .ser(se_ListTagsForResourceCommand) + .de(de_ListTagsForResourceCommand) + .build() { +} + +class ListTaskDefinitionFamiliesCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "ListTaskDefinitionFamilies", {}) + .n("ECSClient", "ListTaskDefinitionFamiliesCommand") + .f(void 0, void 0) + .ser(se_ListTaskDefinitionFamiliesCommand) + .de(de_ListTaskDefinitionFamiliesCommand) + .build() { +} + +class ListTaskDefinitionsCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "ListTaskDefinitions", {}) + .n("ECSClient", "ListTaskDefinitionsCommand") + .f(void 0, void 0) + .ser(se_ListTaskDefinitionsCommand) + .de(de_ListTaskDefinitionsCommand) + .build() { +} + +class ListTasksCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "ListTasks", {}) + .n("ECSClient", "ListTasksCommand") + .f(void 0, void 0) + .ser(se_ListTasksCommand) + .de(de_ListTasksCommand) + .build() { +} + +class PutAccountSettingCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "PutAccountSetting", {}) + .n("ECSClient", "PutAccountSettingCommand") + .f(void 0, void 0) + .ser(se_PutAccountSettingCommand) + .de(de_PutAccountSettingCommand) + .build() { +} + +class PutAccountSettingDefaultCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "PutAccountSettingDefault", {}) + .n("ECSClient", "PutAccountSettingDefaultCommand") + .f(void 0, void 0) + .ser(se_PutAccountSettingDefaultCommand) + .de(de_PutAccountSettingDefaultCommand) + .build() { +} + +class PutAttributesCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "PutAttributes", {}) + .n("ECSClient", "PutAttributesCommand") + .f(void 0, void 0) + .ser(se_PutAttributesCommand) + .de(de_PutAttributesCommand) + .build() { +} + +class PutClusterCapacityProvidersCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "PutClusterCapacityProviders", {}) + .n("ECSClient", "PutClusterCapacityProvidersCommand") + .f(void 0, void 0) + .ser(se_PutClusterCapacityProvidersCommand) + .de(de_PutClusterCapacityProvidersCommand) + .build() { +} + +class RegisterContainerInstanceCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "RegisterContainerInstance", {}) + .n("ECSClient", "RegisterContainerInstanceCommand") + .f(void 0, void 0) + .ser(se_RegisterContainerInstanceCommand) + .de(de_RegisterContainerInstanceCommand) + .build() { +} + +class RegisterTaskDefinitionCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "RegisterTaskDefinition", {}) + .n("ECSClient", "RegisterTaskDefinitionCommand") + .f(void 0, void 0) + .ser(se_RegisterTaskDefinitionCommand) + .de(de_RegisterTaskDefinitionCommand) + .build() { +} + +class RunTaskCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "RunTask", {}) + .n("ECSClient", "RunTaskCommand") + .f(void 0, void 0) + .ser(se_RunTaskCommand) + .de(de_RunTaskCommand) + .build() { +} + +class StartTaskCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "StartTask", {}) + .n("ECSClient", "StartTaskCommand") + .f(void 0, void 0) + .ser(se_StartTaskCommand) + .de(de_StartTaskCommand) + .build() { +} + +class StopServiceDeploymentCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "StopServiceDeployment", {}) + .n("ECSClient", "StopServiceDeploymentCommand") + .f(void 0, void 0) + .ser(se_StopServiceDeploymentCommand) + .de(de_StopServiceDeploymentCommand) + .build() { +} + +class StopTaskCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "StopTask", {}) + .n("ECSClient", "StopTaskCommand") + .f(void 0, void 0) + .ser(se_StopTaskCommand) + .de(de_StopTaskCommand) + .build() { +} + +class SubmitAttachmentStateChangesCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "SubmitAttachmentStateChanges", {}) + .n("ECSClient", "SubmitAttachmentStateChangesCommand") + .f(void 0, void 0) + .ser(se_SubmitAttachmentStateChangesCommand) + .de(de_SubmitAttachmentStateChangesCommand) + .build() { +} + +class SubmitContainerStateChangeCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "SubmitContainerStateChange", {}) + .n("ECSClient", "SubmitContainerStateChangeCommand") + .f(void 0, void 0) + .ser(se_SubmitContainerStateChangeCommand) + .de(de_SubmitContainerStateChangeCommand) + .build() { +} + +class SubmitTaskStateChangeCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "SubmitTaskStateChange", {}) + .n("ECSClient", "SubmitTaskStateChangeCommand") + .f(void 0, void 0) + .ser(se_SubmitTaskStateChangeCommand) + .de(de_SubmitTaskStateChangeCommand) + .build() { +} + +class TagResourceCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "TagResource", {}) + .n("ECSClient", "TagResourceCommand") + .f(void 0, void 0) + .ser(se_TagResourceCommand) + .de(de_TagResourceCommand) + .build() { +} + +class UntagResourceCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "UntagResource", {}) + .n("ECSClient", "UntagResourceCommand") + .f(void 0, void 0) + .ser(se_UntagResourceCommand) + .de(de_UntagResourceCommand) + .build() { +} + +class UpdateCapacityProviderCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "UpdateCapacityProvider", {}) + .n("ECSClient", "UpdateCapacityProviderCommand") + .f(void 0, void 0) + .ser(se_UpdateCapacityProviderCommand) + .de(de_UpdateCapacityProviderCommand) + .build() { +} + +class UpdateClusterCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "UpdateCluster", {}) + .n("ECSClient", "UpdateClusterCommand") + .f(void 0, void 0) + .ser(se_UpdateClusterCommand) + .de(de_UpdateClusterCommand) + .build() { +} + +class UpdateClusterSettingsCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "UpdateClusterSettings", {}) + .n("ECSClient", "UpdateClusterSettingsCommand") + .f(void 0, void 0) + .ser(se_UpdateClusterSettingsCommand) + .de(de_UpdateClusterSettingsCommand) + .build() { +} + +class UpdateContainerAgentCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "UpdateContainerAgent", {}) + .n("ECSClient", "UpdateContainerAgentCommand") + .f(void 0, void 0) + .ser(se_UpdateContainerAgentCommand) + .de(de_UpdateContainerAgentCommand) + .build() { +} + +class UpdateContainerInstancesStateCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "UpdateContainerInstancesState", {}) + .n("ECSClient", "UpdateContainerInstancesStateCommand") + .f(void 0, void 0) + .ser(se_UpdateContainerInstancesStateCommand) + .de(de_UpdateContainerInstancesStateCommand) + .build() { +} + +class UpdateServiceCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "UpdateService", {}) + .n("ECSClient", "UpdateServiceCommand") + .f(void 0, void 0) + .ser(se_UpdateServiceCommand) + .de(de_UpdateServiceCommand) + .build() { +} + +class UpdateServicePrimaryTaskSetCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "UpdateServicePrimaryTaskSet", {}) + .n("ECSClient", "UpdateServicePrimaryTaskSetCommand") + .f(void 0, void 0) + .ser(se_UpdateServicePrimaryTaskSetCommand) + .de(de_UpdateServicePrimaryTaskSetCommand) + .build() { +} + +class UpdateTaskProtectionCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "UpdateTaskProtection", {}) + .n("ECSClient", "UpdateTaskProtectionCommand") + .f(void 0, void 0) + .ser(se_UpdateTaskProtectionCommand) + .de(de_UpdateTaskProtectionCommand) + .build() { +} + +class UpdateTaskSetCommand extends smithyClient.Command + .classBuilder() + .ep(commonParams) + .m(function (Command, cs, config, o) { + return [ + middlewareSerde.getSerdePlugin(config, this.serialize, this.deserialize), + middlewareEndpoint.getEndpointPlugin(config, Command.getEndpointParameterInstructions()), + ]; +}) + .s("AmazonEC2ContainerServiceV20141113", "UpdateTaskSet", {}) + .n("ECSClient", "UpdateTaskSetCommand") + .f(void 0, void 0) + .ser(se_UpdateTaskSetCommand) + .de(de_UpdateTaskSetCommand) + .build() { +} + +const commands = { + CreateCapacityProviderCommand, + CreateClusterCommand, + CreateServiceCommand, + CreateTaskSetCommand, + DeleteAccountSettingCommand, + DeleteAttributesCommand, + DeleteCapacityProviderCommand, + DeleteClusterCommand, + DeleteServiceCommand, + DeleteTaskDefinitionsCommand, + DeleteTaskSetCommand, + DeregisterContainerInstanceCommand, + DeregisterTaskDefinitionCommand, + DescribeCapacityProvidersCommand, + DescribeClustersCommand, + DescribeContainerInstancesCommand, + DescribeServiceDeploymentsCommand, + DescribeServiceRevisionsCommand, + DescribeServicesCommand, + DescribeTaskDefinitionCommand, + DescribeTasksCommand, + DescribeTaskSetsCommand, + DiscoverPollEndpointCommand, + ExecuteCommandCommand, + GetTaskProtectionCommand, + ListAccountSettingsCommand, + ListAttributesCommand, + ListClustersCommand, + ListContainerInstancesCommand, + ListServiceDeploymentsCommand, + ListServicesCommand, + ListServicesByNamespaceCommand, + ListTagsForResourceCommand, + ListTaskDefinitionFamiliesCommand, + ListTaskDefinitionsCommand, + ListTasksCommand, + PutAccountSettingCommand, + PutAccountSettingDefaultCommand, + PutAttributesCommand, + PutClusterCapacityProvidersCommand, + RegisterContainerInstanceCommand, + RegisterTaskDefinitionCommand, + RunTaskCommand, + StartTaskCommand, + StopServiceDeploymentCommand, + StopTaskCommand, + SubmitAttachmentStateChangesCommand, + SubmitContainerStateChangeCommand, + SubmitTaskStateChangeCommand, + TagResourceCommand, + UntagResourceCommand, + UpdateCapacityProviderCommand, + UpdateClusterCommand, + UpdateClusterSettingsCommand, + UpdateContainerAgentCommand, + UpdateContainerInstancesStateCommand, + UpdateServiceCommand, + UpdateServicePrimaryTaskSetCommand, + UpdateTaskProtectionCommand, + UpdateTaskSetCommand, +}; +class ECS extends ECSClient { +} +smithyClient.createAggregatedClient(commands, ECS); + +const paginateListAccountSettings = core.createPaginator(ECSClient, ListAccountSettingsCommand, "nextToken", "nextToken", "maxResults"); + +const paginateListAttributes = core.createPaginator(ECSClient, ListAttributesCommand, "nextToken", "nextToken", "maxResults"); + +const paginateListClusters = core.createPaginator(ECSClient, ListClustersCommand, "nextToken", "nextToken", "maxResults"); + +const paginateListContainerInstances = core.createPaginator(ECSClient, ListContainerInstancesCommand, "nextToken", "nextToken", "maxResults"); + +const paginateListServicesByNamespace = core.createPaginator(ECSClient, ListServicesByNamespaceCommand, "nextToken", "nextToken", "maxResults"); + +const paginateListServices = core.createPaginator(ECSClient, ListServicesCommand, "nextToken", "nextToken", "maxResults"); + +const paginateListTaskDefinitionFamilies = core.createPaginator(ECSClient, ListTaskDefinitionFamiliesCommand, "nextToken", "nextToken", "maxResults"); + +const paginateListTaskDefinitions = core.createPaginator(ECSClient, ListTaskDefinitionsCommand, "nextToken", "nextToken", "maxResults"); + +const paginateListTasks = core.createPaginator(ECSClient, ListTasksCommand, "nextToken", "nextToken", "maxResults"); + +const checkState$3 = async (client, input) => { + let reason; try { - const returnComparator = /* @__PURE__ */ __name(() => { - const flat_1 = [].concat(...result.failures); - const projection_3 = flat_1.map((element_2) => { - return element_2.reason; - }); - return projection_3; - }, "returnComparator"); - for (const anyStringEq_4 of returnComparator()) { - if (anyStringEq_4 == "MISSING") { - return { state: import_util_waiter.WaiterState.FAILURE, reason }; + const result = await client.send(new DescribeServicesCommand(input)); + reason = result; + try { + const returnComparator = () => { + const flat_1 = [].concat(...result.failures); + const projection_3 = flat_1.map((element_2) => { + return element_2.reason; + }); + return projection_3; + }; + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "MISSING") { + return { state: utilWaiter.WaiterState.FAILURE, reason }; + } + } } - } - } catch (e) { - } - try { - const returnComparator = /* @__PURE__ */ __name(() => { - const flat_1 = [].concat(...result.services); - const projection_3 = flat_1.map((element_2) => { - return element_2.status; - }); - return projection_3; - }, "returnComparator"); - for (const anyStringEq_4 of returnComparator()) { - if (anyStringEq_4 == "INACTIVE") { - return { state: import_util_waiter.WaiterState.SUCCESS, reason }; + catch (e) { } + try { + const returnComparator = () => { + const flat_1 = [].concat(...result.services); + const projection_3 = flat_1.map((element_2) => { + return element_2.status; + }); + return projection_3; + }; + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "INACTIVE") { + return { state: utilWaiter.WaiterState.SUCCESS, reason }; + } + } } - } - } catch (e) { + catch (e) { } } - } catch (exception) { - reason = exception; - } - return { state: import_util_waiter.WaiterState.RETRY, reason }; -}, "checkState"); -var waitForServicesInactive = /* @__PURE__ */ __name(async (params, input) => { - const serviceDefaults = { minDelay: 15, maxDelay: 120 }; - return (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState); -}, "waitForServicesInactive"); -var waitUntilServicesInactive = /* @__PURE__ */ __name(async (params, input) => { - const serviceDefaults = { minDelay: 15, maxDelay: 120 }; - const result = await (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState); - return (0, import_util_waiter.checkExceptions)(result); -}, "waitUntilServicesInactive"); - -// src/waiters/waitForServicesStable.ts - -var checkState2 = /* @__PURE__ */ __name(async (client, input) => { - let reason; - try { - const result = await client.send(new DescribeServicesCommand(input)); - reason = result; - try { - const returnComparator = /* @__PURE__ */ __name(() => { - const flat_1 = [].concat(...result.failures); - const projection_3 = flat_1.map((element_2) => { - return element_2.reason; - }); - return projection_3; - }, "returnComparator"); - for (const anyStringEq_4 of returnComparator()) { - if (anyStringEq_4 == "MISSING") { - return { state: import_util_waiter.WaiterState.FAILURE, reason }; - } - } - } catch (e) { + catch (exception) { + reason = exception; } + return { state: utilWaiter.WaiterState.RETRY, reason }; +}; +const waitForServicesInactive = async (params, input) => { + const serviceDefaults = { minDelay: 15, maxDelay: 120 }; + return utilWaiter.createWaiter({ ...serviceDefaults, ...params }, input, checkState$3); +}; +const waitUntilServicesInactive = async (params, input) => { + const serviceDefaults = { minDelay: 15, maxDelay: 120 }; + const result = await utilWaiter.createWaiter({ ...serviceDefaults, ...params }, input, checkState$3); + return utilWaiter.checkExceptions(result); +}; + +const checkState$2 = async (client, input) => { + let reason; try { - const returnComparator = /* @__PURE__ */ __name(() => { - const flat_1 = [].concat(...result.services); - const projection_3 = flat_1.map((element_2) => { - return element_2.status; - }); - return projection_3; - }, "returnComparator"); - for (const anyStringEq_4 of returnComparator()) { - if (anyStringEq_4 == "DRAINING") { - return { state: import_util_waiter.WaiterState.FAILURE, reason }; + const result = await client.send(new DescribeServicesCommand(input)); + reason = result; + try { + const returnComparator = () => { + const flat_1 = [].concat(...result.failures); + const projection_3 = flat_1.map((element_2) => { + return element_2.reason; + }); + return projection_3; + }; + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "MISSING") { + return { state: utilWaiter.WaiterState.FAILURE, reason }; + } + } } - } - } catch (e) { - } - try { - const returnComparator = /* @__PURE__ */ __name(() => { - const flat_1 = [].concat(...result.services); - const projection_3 = flat_1.map((element_2) => { - return element_2.status; - }); - return projection_3; - }, "returnComparator"); - for (const anyStringEq_4 of returnComparator()) { - if (anyStringEq_4 == "INACTIVE") { - return { state: import_util_waiter.WaiterState.FAILURE, reason }; + catch (e) { } + try { + const returnComparator = () => { + const flat_1 = [].concat(...result.services); + const projection_3 = flat_1.map((element_2) => { + return element_2.status; + }); + return projection_3; + }; + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "DRAINING") { + return { state: utilWaiter.WaiterState.FAILURE, reason }; + } + } } - } - } catch (e) { + catch (e) { } + try { + const returnComparator = () => { + const flat_1 = [].concat(...result.services); + const projection_3 = flat_1.map((element_2) => { + return element_2.status; + }); + return projection_3; + }; + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "INACTIVE") { + return { state: utilWaiter.WaiterState.FAILURE, reason }; + } + } + } + catch (e) { } + try { + const returnComparator = () => { + const filterRes_2 = result.services.filter((element_1) => { + return !(element_1.deployments.length == 1.0 && element_1.runningCount == element_1.desiredCount); + }); + return filterRes_2.length == 0.0; + }; + if (returnComparator() == true) { + return { state: utilWaiter.WaiterState.SUCCESS, reason }; + } + } + catch (e) { } } - try { - const returnComparator = /* @__PURE__ */ __name(() => { - const filterRes_2 = result.services.filter((element_1) => { - return !(element_1.deployments.length == 1 && element_1.runningCount == element_1.desiredCount); - }); - return filterRes_2.length == 0; - }, "returnComparator"); - if (returnComparator() == true) { - return { state: import_util_waiter.WaiterState.SUCCESS, reason }; - } - } catch (e) { + catch (exception) { + reason = exception; } - } catch (exception) { - reason = exception; - } - return { state: import_util_waiter.WaiterState.RETRY, reason }; -}, "checkState"); -var waitForServicesStable = /* @__PURE__ */ __name(async (params, input) => { - const serviceDefaults = { minDelay: 15, maxDelay: 120 }; - return (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState2); -}, "waitForServicesStable"); -var waitUntilServicesStable = /* @__PURE__ */ __name(async (params, input) => { - const serviceDefaults = { minDelay: 15, maxDelay: 120 }; - const result = await (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState2); - return (0, import_util_waiter.checkExceptions)(result); -}, "waitUntilServicesStable"); - -// src/waiters/waitForTasksRunning.ts - -var checkState3 = /* @__PURE__ */ __name(async (client, input) => { - let reason; - try { - const result = await client.send(new DescribeTasksCommand(input)); - reason = result; + return { state: utilWaiter.WaiterState.RETRY, reason }; +}; +const waitForServicesStable = async (params, input) => { + const serviceDefaults = { minDelay: 15, maxDelay: 120 }; + return utilWaiter.createWaiter({ ...serviceDefaults, ...params }, input, checkState$2); +}; +const waitUntilServicesStable = async (params, input) => { + const serviceDefaults = { minDelay: 15, maxDelay: 120 }; + const result = await utilWaiter.createWaiter({ ...serviceDefaults, ...params }, input, checkState$2); + return utilWaiter.checkExceptions(result); +}; + +const checkState$1 = async (client, input) => { + let reason; try { - const returnComparator = /* @__PURE__ */ __name(() => { - const flat_1 = [].concat(...result.tasks); - const projection_3 = flat_1.map((element_2) => { - return element_2.lastStatus; - }); - return projection_3; - }, "returnComparator"); - for (const anyStringEq_4 of returnComparator()) { - if (anyStringEq_4 == "STOPPED") { - return { state: import_util_waiter.WaiterState.FAILURE, reason }; + const result = await client.send(new DescribeTasksCommand(input)); + reason = result; + try { + const returnComparator = () => { + const flat_1 = [].concat(...result.tasks); + const projection_3 = flat_1.map((element_2) => { + return element_2.lastStatus; + }); + return projection_3; + }; + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "STOPPED") { + return { state: utilWaiter.WaiterState.FAILURE, reason }; + } + } } - } - } catch (e) { - } - try { - const returnComparator = /* @__PURE__ */ __name(() => { - const flat_1 = [].concat(...result.failures); - const projection_3 = flat_1.map((element_2) => { - return element_2.reason; - }); - return projection_3; - }, "returnComparator"); - for (const anyStringEq_4 of returnComparator()) { - if (anyStringEq_4 == "MISSING") { - return { state: import_util_waiter.WaiterState.FAILURE, reason }; + catch (e) { } + try { + const returnComparator = () => { + const flat_1 = [].concat(...result.failures); + const projection_3 = flat_1.map((element_2) => { + return element_2.reason; + }); + return projection_3; + }; + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "MISSING") { + return { state: utilWaiter.WaiterState.FAILURE, reason }; + } + } } - } - } catch (e) { + catch (e) { } + try { + const returnComparator = () => { + const flat_1 = [].concat(...result.tasks); + const projection_3 = flat_1.map((element_2) => { + return element_2.lastStatus; + }); + return projection_3; + }; + let allStringEq_5 = returnComparator().length > 0; + for (const element_4 of returnComparator()) { + allStringEq_5 = allStringEq_5 && element_4 == "RUNNING"; + } + if (allStringEq_5) { + return { state: utilWaiter.WaiterState.SUCCESS, reason }; + } + } + catch (e) { } } - try { - const returnComparator = /* @__PURE__ */ __name(() => { - const flat_1 = [].concat(...result.tasks); - const projection_3 = flat_1.map((element_2) => { - return element_2.lastStatus; - }); - return projection_3; - }, "returnComparator"); - let allStringEq_5 = returnComparator().length > 0; - for (const element_4 of returnComparator()) { - allStringEq_5 = allStringEq_5 && element_4 == "RUNNING"; - } - if (allStringEq_5) { - return { state: import_util_waiter.WaiterState.SUCCESS, reason }; - } - } catch (e) { + catch (exception) { + reason = exception; } - } catch (exception) { - reason = exception; - } - return { state: import_util_waiter.WaiterState.RETRY, reason }; -}, "checkState"); -var waitForTasksRunning = /* @__PURE__ */ __name(async (params, input) => { - const serviceDefaults = { minDelay: 6, maxDelay: 120 }; - return (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState3); -}, "waitForTasksRunning"); -var waitUntilTasksRunning = /* @__PURE__ */ __name(async (params, input) => { - const serviceDefaults = { minDelay: 6, maxDelay: 120 }; - const result = await (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState3); - return (0, import_util_waiter.checkExceptions)(result); -}, "waitUntilTasksRunning"); - -// src/waiters/waitForTasksStopped.ts - -var checkState4 = /* @__PURE__ */ __name(async (client, input) => { - let reason; - try { - const result = await client.send(new DescribeTasksCommand(input)); - reason = result; + return { state: utilWaiter.WaiterState.RETRY, reason }; +}; +const waitForTasksRunning = async (params, input) => { + const serviceDefaults = { minDelay: 6, maxDelay: 120 }; + return utilWaiter.createWaiter({ ...serviceDefaults, ...params }, input, checkState$1); +}; +const waitUntilTasksRunning = async (params, input) => { + const serviceDefaults = { minDelay: 6, maxDelay: 120 }; + const result = await utilWaiter.createWaiter({ ...serviceDefaults, ...params }, input, checkState$1); + return utilWaiter.checkExceptions(result); +}; + +const checkState = async (client, input) => { + let reason; try { - const returnComparator = /* @__PURE__ */ __name(() => { - const flat_1 = [].concat(...result.tasks); - const projection_3 = flat_1.map((element_2) => { - return element_2.lastStatus; - }); - return projection_3; - }, "returnComparator"); - let allStringEq_5 = returnComparator().length > 0; - for (const element_4 of returnComparator()) { - allStringEq_5 = allStringEq_5 && element_4 == "STOPPED"; - } - if (allStringEq_5) { - return { state: import_util_waiter.WaiterState.SUCCESS, reason }; - } - } catch (e) { + const result = await client.send(new DescribeTasksCommand(input)); + reason = result; + try { + const returnComparator = () => { + const flat_1 = [].concat(...result.tasks); + const projection_3 = flat_1.map((element_2) => { + return element_2.lastStatus; + }); + return projection_3; + }; + let allStringEq_5 = returnComparator().length > 0; + for (const element_4 of returnComparator()) { + allStringEq_5 = allStringEq_5 && element_4 == "STOPPED"; + } + if (allStringEq_5) { + return { state: utilWaiter.WaiterState.SUCCESS, reason }; + } + } + catch (e) { } } - } catch (exception) { - reason = exception; - } - return { state: import_util_waiter.WaiterState.RETRY, reason }; -}, "checkState"); -var waitForTasksStopped = /* @__PURE__ */ __name(async (params, input) => { - const serviceDefaults = { minDelay: 6, maxDelay: 120 }; - return (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState4); -}, "waitForTasksStopped"); -var waitUntilTasksStopped = /* @__PURE__ */ __name(async (params, input) => { - const serviceDefaults = { minDelay: 6, maxDelay: 120 }; - const result = await (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState4); - return (0, import_util_waiter.checkExceptions)(result); -}, "waitUntilTasksStopped"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); + catch (exception) { + reason = exception; + } + return { state: utilWaiter.WaiterState.RETRY, reason }; +}; +const waitForTasksStopped = async (params, input) => { + const serviceDefaults = { minDelay: 6, maxDelay: 120 }; + return utilWaiter.createWaiter({ ...serviceDefaults, ...params }, input, checkState); +}; +const waitUntilTasksStopped = async (params, input) => { + const serviceDefaults = { minDelay: 6, maxDelay: 120 }; + const result = await utilWaiter.createWaiter({ ...serviceDefaults, ...params }, input, checkState); + return utilWaiter.checkExceptions(result); +}; +Object.defineProperty(exports, "$Command", ({ + enumerable: true, + get: function () { return smithyClient.Command; } +})); +Object.defineProperty(exports, "__Client", ({ + enumerable: true, + get: function () { return smithyClient.Client; } +})); +exports.AcceleratorManufacturer = AcceleratorManufacturer; +exports.AcceleratorName = AcceleratorName; +exports.AcceleratorType = AcceleratorType; +exports.AccessDeniedException = AccessDeniedException; +exports.AgentUpdateStatus = AgentUpdateStatus; +exports.ApplicationProtocol = ApplicationProtocol; +exports.AssignPublicIp = AssignPublicIp; +exports.AttributeLimitExceededException = AttributeLimitExceededException; +exports.AvailabilityZoneRebalancing = AvailabilityZoneRebalancing; +exports.BareMetal = BareMetal; +exports.BlockedException = BlockedException; +exports.BurstablePerformance = BurstablePerformance; +exports.CPUArchitecture = CPUArchitecture; +exports.CapacityProviderField = CapacityProviderField; +exports.CapacityProviderStatus = CapacityProviderStatus; +exports.CapacityProviderType = CapacityProviderType; +exports.CapacityProviderUpdateStatus = CapacityProviderUpdateStatus; +exports.ClientException = ClientException; +exports.ClusterContainsCapacityProviderException = ClusterContainsCapacityProviderException; +exports.ClusterContainsContainerInstancesException = ClusterContainsContainerInstancesException; +exports.ClusterContainsServicesException = ClusterContainsServicesException; +exports.ClusterContainsTasksException = ClusterContainsTasksException; +exports.ClusterField = ClusterField; +exports.ClusterNotFoundException = ClusterNotFoundException; +exports.ClusterSettingName = ClusterSettingName; +exports.Compatibility = Compatibility; +exports.ConflictException = ConflictException; +exports.Connectivity = Connectivity; +exports.ContainerCondition = ContainerCondition; +exports.ContainerInstanceField = ContainerInstanceField; +exports.ContainerInstanceStatus = ContainerInstanceStatus; +exports.CpuManufacturer = CpuManufacturer; +exports.CreateCapacityProviderCommand = CreateCapacityProviderCommand; +exports.CreateClusterCommand = CreateClusterCommand; +exports.CreateServiceCommand = CreateServiceCommand; +exports.CreateTaskSetCommand = CreateTaskSetCommand; +exports.DeleteAccountSettingCommand = DeleteAccountSettingCommand; +exports.DeleteAttributesCommand = DeleteAttributesCommand; +exports.DeleteCapacityProviderCommand = DeleteCapacityProviderCommand; +exports.DeleteClusterCommand = DeleteClusterCommand; +exports.DeleteServiceCommand = DeleteServiceCommand; +exports.DeleteTaskDefinitionsCommand = DeleteTaskDefinitionsCommand; +exports.DeleteTaskSetCommand = DeleteTaskSetCommand; +exports.DeploymentControllerType = DeploymentControllerType; +exports.DeploymentLifecycleHookStage = DeploymentLifecycleHookStage; +exports.DeploymentRolloutState = DeploymentRolloutState; +exports.DeploymentStrategy = DeploymentStrategy; +exports.DeregisterContainerInstanceCommand = DeregisterContainerInstanceCommand; +exports.DeregisterTaskDefinitionCommand = DeregisterTaskDefinitionCommand; +exports.DescribeCapacityProvidersCommand = DescribeCapacityProvidersCommand; +exports.DescribeClustersCommand = DescribeClustersCommand; +exports.DescribeContainerInstancesCommand = DescribeContainerInstancesCommand; +exports.DescribeServiceDeploymentsCommand = DescribeServiceDeploymentsCommand; +exports.DescribeServiceRevisionsCommand = DescribeServiceRevisionsCommand; +exports.DescribeServicesCommand = DescribeServicesCommand; +exports.DescribeTaskDefinitionCommand = DescribeTaskDefinitionCommand; +exports.DescribeTaskSetsCommand = DescribeTaskSetsCommand; +exports.DescribeTasksCommand = DescribeTasksCommand; +exports.DesiredStatus = DesiredStatus; +exports.DeviceCgroupPermission = DeviceCgroupPermission; +exports.DiscoverPollEndpointCommand = DiscoverPollEndpointCommand; +exports.EBSResourceType = EBSResourceType; +exports.ECS = ECS; +exports.ECSClient = ECSClient; +exports.ECSServiceException = ECSServiceException; +exports.EFSAuthorizationConfigIAM = EFSAuthorizationConfigIAM; +exports.EFSTransitEncryption = EFSTransitEncryption; +exports.EnvironmentFileType = EnvironmentFileType; +exports.ExecuteCommandCommand = ExecuteCommandCommand; +exports.ExecuteCommandLogging = ExecuteCommandLogging; +exports.ExecuteCommandResponseFilterSensitiveLog = ExecuteCommandResponseFilterSensitiveLog; +exports.FirelensConfigurationType = FirelensConfigurationType; +exports.GetTaskProtectionCommand = GetTaskProtectionCommand; +exports.HealthStatus = HealthStatus; +exports.InstanceGeneration = InstanceGeneration; +exports.InstanceHealthCheckState = InstanceHealthCheckState; +exports.InstanceHealthCheckType = InstanceHealthCheckType; +exports.InvalidParameterException = InvalidParameterException; +exports.IpcMode = IpcMode; +exports.LaunchType = LaunchType; +exports.LimitExceededException = LimitExceededException; +exports.ListAccountSettingsCommand = ListAccountSettingsCommand; +exports.ListAttributesCommand = ListAttributesCommand; +exports.ListClustersCommand = ListClustersCommand; +exports.ListContainerInstancesCommand = ListContainerInstancesCommand; +exports.ListServiceDeploymentsCommand = ListServiceDeploymentsCommand; +exports.ListServicesByNamespaceCommand = ListServicesByNamespaceCommand; +exports.ListServicesCommand = ListServicesCommand; +exports.ListTagsForResourceCommand = ListTagsForResourceCommand; +exports.ListTaskDefinitionFamiliesCommand = ListTaskDefinitionFamiliesCommand; +exports.ListTaskDefinitionsCommand = ListTaskDefinitionsCommand; +exports.ListTasksCommand = ListTasksCommand; +exports.LocalStorage = LocalStorage; +exports.LocalStorageType = LocalStorageType; +exports.LogDriver = LogDriver; +exports.ManagedAgentName = ManagedAgentName; +exports.ManagedDraining = ManagedDraining; +exports.ManagedInstancesMonitoringOptions = ManagedInstancesMonitoringOptions; +exports.ManagedScalingStatus = ManagedScalingStatus; +exports.ManagedTerminationProtection = ManagedTerminationProtection; +exports.MissingVersionException = MissingVersionException; +exports.NamespaceNotFoundException = NamespaceNotFoundException; +exports.NetworkMode = NetworkMode; +exports.NoUpdateAvailableException = NoUpdateAvailableException; +exports.OSFamily = OSFamily; +exports.PidMode = PidMode; +exports.PlacementConstraintType = PlacementConstraintType; +exports.PlacementStrategyType = PlacementStrategyType; +exports.PlatformDeviceType = PlatformDeviceType; +exports.PlatformTaskDefinitionIncompatibilityException = PlatformTaskDefinitionIncompatibilityException; +exports.PlatformUnknownException = PlatformUnknownException; +exports.PropagateMITags = PropagateMITags; +exports.PropagateTags = PropagateTags; +exports.ProxyConfigurationType = ProxyConfigurationType; +exports.PutAccountSettingCommand = PutAccountSettingCommand; +exports.PutAccountSettingDefaultCommand = PutAccountSettingDefaultCommand; +exports.PutAttributesCommand = PutAttributesCommand; +exports.PutClusterCapacityProvidersCommand = PutClusterCapacityProvidersCommand; +exports.RegisterContainerInstanceCommand = RegisterContainerInstanceCommand; +exports.RegisterTaskDefinitionCommand = RegisterTaskDefinitionCommand; +exports.ResourceInUseException = ResourceInUseException; +exports.ResourceNotFoundException = ResourceNotFoundException; +exports.ResourceType = ResourceType; +exports.RunTaskCommand = RunTaskCommand; +exports.ScaleUnit = ScaleUnit; +exports.SchedulingStrategy = SchedulingStrategy; +exports.Scope = Scope; +exports.ServerException = ServerException; +exports.ServiceConnectAccessLoggingFormat = ServiceConnectAccessLoggingFormat; +exports.ServiceConnectIncludeQueryParameters = ServiceConnectIncludeQueryParameters; +exports.ServiceDeploymentLifecycleStage = ServiceDeploymentLifecycleStage; +exports.ServiceDeploymentNotFoundException = ServiceDeploymentNotFoundException; +exports.ServiceDeploymentRollbackMonitorsStatus = ServiceDeploymentRollbackMonitorsStatus; +exports.ServiceDeploymentStatus = ServiceDeploymentStatus; +exports.ServiceField = ServiceField; +exports.ServiceNotActiveException = ServiceNotActiveException; +exports.ServiceNotFoundException = ServiceNotFoundException; +exports.SessionFilterSensitiveLog = SessionFilterSensitiveLog; +exports.SettingName = SettingName; +exports.SettingType = SettingType; +exports.SortOrder = SortOrder; +exports.StabilityStatus = StabilityStatus; +exports.StartTaskCommand = StartTaskCommand; +exports.StopServiceDeploymentCommand = StopServiceDeploymentCommand; +exports.StopServiceDeploymentStopType = StopServiceDeploymentStopType; +exports.StopTaskCommand = StopTaskCommand; +exports.SubmitAttachmentStateChangesCommand = SubmitAttachmentStateChangesCommand; +exports.SubmitContainerStateChangeCommand = SubmitContainerStateChangeCommand; +exports.SubmitTaskStateChangeCommand = SubmitTaskStateChangeCommand; +exports.TagResourceCommand = TagResourceCommand; +exports.TargetNotConnectedException = TargetNotConnectedException; +exports.TargetNotFoundException = TargetNotFoundException; +exports.TargetType = TargetType; +exports.TaskDefinitionFamilyStatus = TaskDefinitionFamilyStatus; +exports.TaskDefinitionField = TaskDefinitionField; +exports.TaskDefinitionPlacementConstraintType = TaskDefinitionPlacementConstraintType; +exports.TaskDefinitionStatus = TaskDefinitionStatus; +exports.TaskField = TaskField; +exports.TaskFilesystemType = TaskFilesystemType; +exports.TaskSetField = TaskSetField; +exports.TaskSetNotFoundException = TaskSetNotFoundException; +exports.TaskStopCode = TaskStopCode; +exports.TransportProtocol = TransportProtocol; +exports.UlimitName = UlimitName; +exports.UnsupportedFeatureException = UnsupportedFeatureException; +exports.UntagResourceCommand = UntagResourceCommand; +exports.UpdateCapacityProviderCommand = UpdateCapacityProviderCommand; +exports.UpdateClusterCommand = UpdateClusterCommand; +exports.UpdateClusterSettingsCommand = UpdateClusterSettingsCommand; +exports.UpdateContainerAgentCommand = UpdateContainerAgentCommand; +exports.UpdateContainerInstancesStateCommand = UpdateContainerInstancesStateCommand; +exports.UpdateInProgressException = UpdateInProgressException; +exports.UpdateServiceCommand = UpdateServiceCommand; +exports.UpdateServicePrimaryTaskSetCommand = UpdateServicePrimaryTaskSetCommand; +exports.UpdateTaskProtectionCommand = UpdateTaskProtectionCommand; +exports.UpdateTaskSetCommand = UpdateTaskSetCommand; +exports.VersionConsistency = VersionConsistency; +exports.paginateListAccountSettings = paginateListAccountSettings; +exports.paginateListAttributes = paginateListAttributes; +exports.paginateListClusters = paginateListClusters; +exports.paginateListContainerInstances = paginateListContainerInstances; +exports.paginateListServices = paginateListServices; +exports.paginateListServicesByNamespace = paginateListServicesByNamespace; +exports.paginateListTaskDefinitionFamilies = paginateListTaskDefinitionFamilies; +exports.paginateListTaskDefinitions = paginateListTaskDefinitions; +exports.paginateListTasks = paginateListTasks; +exports.waitForServicesInactive = waitForServicesInactive; +exports.waitForServicesStable = waitForServicesStable; +exports.waitForTasksRunning = waitForTasksRunning; +exports.waitForTasksStopped = waitForTasksStopped; +exports.waitUntilServicesInactive = waitUntilServicesInactive; +exports.waitUntilServicesStable = waitUntilServicesStable; +exports.waitUntilTasksRunning = waitUntilTasksRunning; +exports.waitUntilTasksStopped = waitUntilTasksStopped; /***/ }), @@ -8480,16381 +8738,9607 @@ exports.getRuntimeConfig = getRuntimeConfig; /***/ }), -/***/ 2041: +/***/ 8704: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveHttpAuthSchemeConfig = exports.defaultSSOHttpAuthSchemeProvider = exports.defaultSSOHttpAuthSchemeParametersProvider = void 0; -const core_1 = __nccwpck_require__(8704); -const util_middleware_1 = __nccwpck_require__(6324); -const defaultSSOHttpAuthSchemeParametersProvider = async (config, context, input) => { - return { - operation: (0, util_middleware_1.getSmithyContext)(context).operation, - region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) || - (() => { - throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); - })(), - }; + +var protocolHttp = __nccwpck_require__(2356); +var core = __nccwpck_require__(402); +var propertyProvider = __nccwpck_require__(1238); +var client = __nccwpck_require__(5152); +var signatureV4 = __nccwpck_require__(5118); +var cbor = __nccwpck_require__(4645); +var schema = __nccwpck_require__(6890); +var protocols = __nccwpck_require__(3422); +var serde = __nccwpck_require__(2430); +var utilBase64 = __nccwpck_require__(8385); +var smithyClient = __nccwpck_require__(1411); +var utilUtf8 = __nccwpck_require__(1577); +var xmlBuilder = __nccwpck_require__(4274); + +const state = { + warningEmitted: false, +}; +const emitWarningIfUnsupportedVersion = (version) => { + if (version && !state.warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 18) { + state.warningEmitted = true; + process.emitWarning(`NodeDeprecationWarning: The AWS SDK for JavaScript (v3) will +no longer support Node.js 16.x on January 6, 2025. + +To continue receiving updates to AWS services, bug fixes, and security +updates please upgrade to a supported Node.js LTS version. + +More information can be found at: https://a.co/74kJMmI`); + } }; -exports.defaultSSOHttpAuthSchemeParametersProvider = defaultSSOHttpAuthSchemeParametersProvider; -function createAwsAuthSigv4HttpAuthOption(authParameters) { - return { - schemeId: "aws.auth#sigv4", - signingProperties: { - name: "awsssoportal", - region: authParameters.region, - }, - propertiesExtractor: (config, context) => ({ - signingProperties: { - config, - context, - }, - }), - }; -} -function createSmithyApiNoAuthHttpAuthOption(authParameters) { - return { - schemeId: "smithy.api#noAuth", - }; + +function setCredentialFeature(credentials, feature, value) { + if (!credentials.$source) { + credentials.$source = {}; + } + credentials.$source[feature] = value; + return credentials; } -const defaultSSOHttpAuthSchemeProvider = (authParameters) => { - const options = []; - switch (authParameters.operation) { - case "GetRoleCredentials": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; - } - case "ListAccountRoles": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; - } - case "ListAccounts": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; - } - case "Logout": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; - } - default: { - options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); - } + +function setFeature(context, feature, value) { + if (!context.__aws_sdk_context) { + context.__aws_sdk_context = { + features: {}, + }; } - return options; -}; -exports.defaultSSOHttpAuthSchemeProvider = defaultSSOHttpAuthSchemeProvider; -const resolveHttpAuthSchemeConfig = (config) => { - const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); - return Object.assign(config_0, { - authSchemePreference: (0, util_middleware_1.normalizeProvider)(config.authSchemePreference ?? []), - }); -}; -exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; + else if (!context.__aws_sdk_context.features) { + context.__aws_sdk_context.features = {}; + } + context.__aws_sdk_context.features[feature] = value; +} +function setTokenFeature(token, feature, value) { + if (!token.$source) { + token.$source = {}; + } + token.$source[feature] = value; + return token; +} -/***/ }), +const getDateHeader = (response) => protocolHttp.HttpResponse.isInstance(response) ? response.headers?.date ?? response.headers?.Date : undefined; -/***/ 3903: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +const getSkewCorrectedDate = (systemClockOffset) => new Date(Date.now() + systemClockOffset); -"use strict"; +const isClockSkewed = (clockTime, systemClockOffset) => Math.abs(getSkewCorrectedDate(systemClockOffset).getTime() - clockTime) >= 300000; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultEndpointResolver = void 0; -const util_endpoints_1 = __nccwpck_require__(3068); -const util_endpoints_2 = __nccwpck_require__(9674); -const ruleset_1 = __nccwpck_require__(1308); -const cache = new util_endpoints_2.EndpointCache({ - size: 50, - params: ["Endpoint", "Region", "UseDualStack", "UseFIPS"], -}); -const defaultEndpointResolver = (endpointParams, context = {}) => { - return cache.get(endpointParams, () => (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { - endpointParams: endpointParams, - logger: context.logger, - })); +const getUpdatedSystemClockOffset = (clockTime, currentSystemClockOffset) => { + const clockTimeInMs = Date.parse(clockTime); + if (isClockSkewed(clockTimeInMs, currentSystemClockOffset)) { + return clockTimeInMs - Date.now(); + } + return currentSystemClockOffset; }; -exports.defaultEndpointResolver = defaultEndpointResolver; -util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; - - -/***/ }), - -/***/ 1308: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ruleSet = void 0; -const u = "required", v = "fn", w = "argv", x = "ref"; -const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = "getAttr", i = { [u]: false, "type": "String" }, j = { [u]: true, "default": false, "type": "Boolean" }, k = { [x]: "Endpoint" }, l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }, m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }, n = {}, o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }, p = { [x]: g }, q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }, r = [l], s = [m], t = [{ [x]: "Region" }]; -const _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://portal.sso.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; -exports.ruleSet = _data; - - -/***/ }), - -/***/ 2054: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); +const throwSigningPropertyError = (name, property) => { + if (!property) { + throw new Error(`Property \`${name}\` is not resolved for AWS SDK SigV4Auth`); + } + return property; }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; +const validateSigningProperties = async (signingProperties) => { + const context = throwSigningPropertyError("context", signingProperties.context); + const config = throwSigningPropertyError("config", signingProperties.config); + const authScheme = context.endpointV2?.properties?.authSchemes?.[0]; + const signerFunction = throwSigningPropertyError("signer", config.signer); + const signer = await signerFunction(authScheme); + const signingRegion = signingProperties?.signingRegion; + const signingRegionSet = signingProperties?.signingRegionSet; + const signingName = signingProperties?.signingName; + return { + config, + signer, + signingRegion, + signingRegionSet, + signingName, + }; }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - GetRoleCredentialsCommand: () => GetRoleCredentialsCommand, - GetRoleCredentialsRequestFilterSensitiveLog: () => GetRoleCredentialsRequestFilterSensitiveLog, - GetRoleCredentialsResponseFilterSensitiveLog: () => GetRoleCredentialsResponseFilterSensitiveLog, - InvalidRequestException: () => InvalidRequestException, - ListAccountRolesCommand: () => ListAccountRolesCommand, - ListAccountRolesRequestFilterSensitiveLog: () => ListAccountRolesRequestFilterSensitiveLog, - ListAccountsCommand: () => ListAccountsCommand, - ListAccountsRequestFilterSensitiveLog: () => ListAccountsRequestFilterSensitiveLog, - LogoutCommand: () => LogoutCommand, - LogoutRequestFilterSensitiveLog: () => LogoutRequestFilterSensitiveLog, - ResourceNotFoundException: () => ResourceNotFoundException, - RoleCredentialsFilterSensitiveLog: () => RoleCredentialsFilterSensitiveLog, - SSO: () => SSO, - SSOClient: () => SSOClient, - SSOServiceException: () => SSOServiceException, - TooManyRequestsException: () => TooManyRequestsException, - UnauthorizedException: () => UnauthorizedException, - __Client: () => import_smithy_client.Client, - paginateListAccountRoles: () => paginateListAccountRoles, - paginateListAccounts: () => paginateListAccounts -}); -module.exports = __toCommonJS(index_exports); - -// src/SSOClient.ts -var import_middleware_host_header = __nccwpck_require__(2590); -var import_middleware_logger = __nccwpck_require__(5242); -var import_middleware_recursion_detection = __nccwpck_require__(1568); -var import_middleware_user_agent = __nccwpck_require__(2959); -var import_config_resolver = __nccwpck_require__(9316); -var import_core = __nccwpck_require__(402); -var import_middleware_content_length = __nccwpck_require__(7212); -var import_middleware_endpoint = __nccwpck_require__(99); -var import_middleware_retry = __nccwpck_require__(9618); - -var import_httpAuthSchemeProvider = __nccwpck_require__(2041); - -// src/endpoint/EndpointParameters.ts -var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { - return Object.assign(options, { - useDualstackEndpoint: options.useDualstackEndpoint ?? false, - useFipsEndpoint: options.useFipsEndpoint ?? false, - defaultSigningName: "awsssoportal" - }); -}, "resolveClientEndpointParameters"); -var commonParams = { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } -}; - -// src/SSOClient.ts -var import_runtimeConfig = __nccwpck_require__(2696); - -// src/runtimeExtensions.ts -var import_region_config_resolver = __nccwpck_require__(6463); -var import_protocol_http = __nccwpck_require__(2356); -var import_smithy_client = __nccwpck_require__(1411); - -// src/auth/httpAuthExtensionConfiguration.ts -var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; - let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; - let _credentials = runtimeConfig.credentials; - return { - setHttpAuthScheme(httpAuthScheme) { - const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); - if (index === -1) { - _httpAuthSchemes.push(httpAuthScheme); - } else { - _httpAuthSchemes.splice(index, 1, httpAuthScheme); - } - }, - httpAuthSchemes() { - return _httpAuthSchemes; - }, - setHttpAuthSchemeProvider(httpAuthSchemeProvider) { - _httpAuthSchemeProvider = httpAuthSchemeProvider; - }, - httpAuthSchemeProvider() { - return _httpAuthSchemeProvider; - }, - setCredentials(credentials) { - _credentials = credentials; - }, - credentials() { - return _credentials; +class AwsSdkSigV4Signer { + async sign(httpRequest, identity, signingProperties) { + if (!protocolHttp.HttpRequest.isInstance(httpRequest)) { + throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); + } + const validatedProps = await validateSigningProperties(signingProperties); + const { config, signer } = validatedProps; + let { signingRegion, signingName } = validatedProps; + const handlerExecutionContext = signingProperties.context; + if (handlerExecutionContext?.authSchemes?.length ?? 0 > 1) { + const [first, second] = handlerExecutionContext.authSchemes; + if (first?.name === "sigv4a" && second?.name === "sigv4") { + signingRegion = second?.signingRegion ?? signingRegion; + signingName = second?.signingName ?? signingName; + } + } + const signedRequest = await signer.sign(httpRequest, { + signingDate: getSkewCorrectedDate(config.systemClockOffset), + signingRegion: signingRegion, + signingService: signingName, + }); + return signedRequest; + } + errorHandler(signingProperties) { + return (error) => { + const serverTime = error.ServerTime ?? getDateHeader(error.$response); + if (serverTime) { + const config = throwSigningPropertyError("config", signingProperties.config); + const initialSystemClockOffset = config.systemClockOffset; + config.systemClockOffset = getUpdatedSystemClockOffset(serverTime, config.systemClockOffset); + const clockSkewCorrected = config.systemClockOffset !== initialSystemClockOffset; + if (clockSkewCorrected && error.$metadata) { + error.$metadata.clockSkewCorrected = true; + } + } + throw error; + }; } - }; -}, "getHttpAuthExtensionConfiguration"); -var resolveHttpAuthRuntimeConfig = /* @__PURE__ */ __name((config) => { - return { - httpAuthSchemes: config.httpAuthSchemes(), - httpAuthSchemeProvider: config.httpAuthSchemeProvider(), - credentials: config.credentials() - }; -}, "resolveHttpAuthRuntimeConfig"); - -// src/runtimeExtensions.ts -var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { - const extensionConfiguration = Object.assign( - (0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig), - (0, import_smithy_client.getDefaultExtensionConfiguration)(runtimeConfig), - (0, import_protocol_http.getHttpHandlerExtensionConfiguration)(runtimeConfig), - getHttpAuthExtensionConfiguration(runtimeConfig) - ); - extensions.forEach((extension) => extension.configure(extensionConfiguration)); - return Object.assign( - runtimeConfig, - (0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), - (0, import_smithy_client.resolveDefaultRuntimeConfig)(extensionConfiguration), - (0, import_protocol_http.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), - resolveHttpAuthRuntimeConfig(extensionConfiguration) - ); -}, "resolveRuntimeExtensions"); - -// src/SSOClient.ts -var SSOClient = class extends import_smithy_client.Client { - static { - __name(this, "SSOClient"); - } - /** - * The resolved configuration of SSOClient class. This is resolved and normalized from the {@link SSOClientConfig | constructor configuration interface}. - */ - config; - constructor(...[configuration]) { - const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); - super(_config_0); - this.initConfig = _config_0; - const _config_1 = resolveClientEndpointParameters(_config_0); - const _config_2 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_1); - const _config_3 = (0, import_middleware_retry.resolveRetryConfig)(_config_2); - const _config_4 = (0, import_config_resolver.resolveRegionConfig)(_config_3); - const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, import_middleware_endpoint.resolveEndpointConfig)(_config_5); - const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); - const _config_8 = resolveRuntimeExtensions(_config_7, configuration?.extensions || []); - this.config = _config_8; - this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_retry.getRetryPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_recursion_detection.getRecursionDetectionPlugin)(this.config)); - this.middlewareStack.use( - (0, import_core.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { - httpAuthSchemeParametersProvider: import_httpAuthSchemeProvider.defaultSSOHttpAuthSchemeParametersProvider, - identityProviderConfigProvider: /* @__PURE__ */ __name(async (config) => new import_core.DefaultIdentityProviderConfig({ - "aws.auth#sigv4": config.credentials - }), "identityProviderConfigProvider") - }) - ); - this.middlewareStack.use((0, import_core.getHttpSigningPlugin)(this.config)); - } - /** - * Destroy underlying resources, like sockets. It's usually not necessary to do this. - * However in Node.js, it's best to explicitly shut down the client's agent when it is no longer needed. - * Otherwise, sockets might stay open for quite a long time before the server terminates them. - */ - destroy() { - super.destroy(); - } -}; - -// src/SSO.ts - - -// src/commands/GetRoleCredentialsCommand.ts - -var import_middleware_serde = __nccwpck_require__(3255); - + successHandler(httpResponse, signingProperties) { + const dateHeader = getDateHeader(httpResponse); + if (dateHeader) { + const config = throwSigningPropertyError("config", signingProperties.config); + config.systemClockOffset = getUpdatedSystemClockOffset(dateHeader, config.systemClockOffset); + } + } +} +const AWSSDKSigV4Signer = AwsSdkSigV4Signer; -// src/models/models_0.ts +class AwsSdkSigV4ASigner extends AwsSdkSigV4Signer { + async sign(httpRequest, identity, signingProperties) { + if (!protocolHttp.HttpRequest.isInstance(httpRequest)) { + throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); + } + const { config, signer, signingRegion, signingRegionSet, signingName } = await validateSigningProperties(signingProperties); + const configResolvedSigningRegionSet = await config.sigv4aSigningRegionSet?.(); + const multiRegionOverride = (configResolvedSigningRegionSet ?? + signingRegionSet ?? [signingRegion]).join(","); + const signedRequest = await signer.sign(httpRequest, { + signingDate: getSkewCorrectedDate(config.systemClockOffset), + signingRegion: multiRegionOverride, + signingService: signingName, + }); + return signedRequest; + } +} +const getArrayForCommaSeparatedString = (str) => typeof str === "string" && str.length > 0 ? str.split(",").map((item) => item.trim()) : []; -// src/models/SSOServiceException.ts +const getBearerTokenEnvKey = (signingName) => `AWS_BEARER_TOKEN_${signingName.replace(/[\s-]/g, "_").toUpperCase()}`; -var SSOServiceException = class _SSOServiceException extends import_smithy_client.ServiceException { - static { - __name(this, "SSOServiceException"); - } - /** - * @internal - */ - constructor(options) { - super(options); - Object.setPrototypeOf(this, _SSOServiceException.prototype); - } +const NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY = "AWS_AUTH_SCHEME_PREFERENCE"; +const NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY = "auth_scheme_preference"; +const NODE_AUTH_SCHEME_PREFERENCE_OPTIONS = { + environmentVariableSelector: (env, options) => { + if (options?.signingName) { + const bearerTokenKey = getBearerTokenEnvKey(options.signingName); + if (bearerTokenKey in env) + return ["httpBearerAuth"]; + } + if (!(NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY in env)) + return undefined; + return getArrayForCommaSeparatedString(env[NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY]); + }, + configFileSelector: (profile) => { + if (!(NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY in profile)) + return undefined; + return getArrayForCommaSeparatedString(profile[NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY]); + }, + default: [], }; -// src/models/models_0.ts -var InvalidRequestException = class _InvalidRequestException extends SSOServiceException { - static { - __name(this, "InvalidRequestException"); - } - name = "InvalidRequestException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "InvalidRequestException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _InvalidRequestException.prototype); - } +const resolveAwsSdkSigV4AConfig = (config) => { + config.sigv4aSigningRegionSet = core.normalizeProvider(config.sigv4aSigningRegionSet); + return config; }; -var ResourceNotFoundException = class _ResourceNotFoundException extends SSOServiceException { - static { - __name(this, "ResourceNotFoundException"); - } - name = "ResourceNotFoundException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ResourceNotFoundException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ResourceNotFoundException.prototype); - } +const NODE_SIGV4A_CONFIG_OPTIONS = { + environmentVariableSelector(env) { + if (env.AWS_SIGV4A_SIGNING_REGION_SET) { + return env.AWS_SIGV4A_SIGNING_REGION_SET.split(",").map((_) => _.trim()); + } + throw new propertyProvider.ProviderError("AWS_SIGV4A_SIGNING_REGION_SET not set in env.", { + tryNextLink: true, + }); + }, + configFileSelector(profile) { + if (profile.sigv4a_signing_region_set) { + return (profile.sigv4a_signing_region_set ?? "").split(",").map((_) => _.trim()); + } + throw new propertyProvider.ProviderError("sigv4a_signing_region_set not set in profile.", { + tryNextLink: true, + }); + }, + default: undefined, }; -var TooManyRequestsException = class _TooManyRequestsException extends SSOServiceException { - static { - __name(this, "TooManyRequestsException"); - } - name = "TooManyRequestsException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "TooManyRequestsException", - $fault: "client", - ...opts + +const resolveAwsSdkSigV4Config = (config) => { + let inputCredentials = config.credentials; + let isUserSupplied = !!config.credentials; + let resolvedCredentials = undefined; + Object.defineProperty(config, "credentials", { + set(credentials) { + if (credentials && credentials !== inputCredentials && credentials !== resolvedCredentials) { + isUserSupplied = true; + } + inputCredentials = credentials; + const memoizedProvider = normalizeCredentialProvider(config, { + credentials: inputCredentials, + credentialDefaultProvider: config.credentialDefaultProvider, + }); + const boundProvider = bindCallerConfig(config, memoizedProvider); + if (isUserSupplied && !boundProvider.attributed) { + resolvedCredentials = async (options) => boundProvider(options).then((creds) => client.setCredentialFeature(creds, "CREDENTIALS_CODE", "e")); + resolvedCredentials.memoized = boundProvider.memoized; + resolvedCredentials.configBound = boundProvider.configBound; + resolvedCredentials.attributed = true; + } + else { + resolvedCredentials = boundProvider; + } + }, + get() { + return resolvedCredentials; + }, + enumerable: true, + configurable: true, }); - Object.setPrototypeOf(this, _TooManyRequestsException.prototype); - } -}; -var UnauthorizedException = class _UnauthorizedException extends SSOServiceException { - static { - __name(this, "UnauthorizedException"); - } - name = "UnauthorizedException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "UnauthorizedException", - $fault: "client", - ...opts + config.credentials = inputCredentials; + const { signingEscapePath = true, systemClockOffset = config.systemClockOffset || 0, sha256, } = config; + let signer; + if (config.signer) { + signer = core.normalizeProvider(config.signer); + } + else if (config.regionInfoProvider) { + signer = () => core.normalizeProvider(config.region)() + .then(async (region) => [ + (await config.regionInfoProvider(region, { + useFipsEndpoint: await config.useFipsEndpoint(), + useDualstackEndpoint: await config.useDualstackEndpoint(), + })) || {}, + region, + ]) + .then(([regionInfo, region]) => { + const { signingRegion, signingService } = regionInfo; + config.signingRegion = config.signingRegion || signingRegion || region; + config.signingName = config.signingName || signingService || config.serviceId; + const params = { + ...config, + credentials: config.credentials, + region: config.signingRegion, + service: config.signingName, + sha256, + uriEscapePath: signingEscapePath, + }; + const SignerCtor = config.signerConstructor || signatureV4.SignatureV4; + return new SignerCtor(params); + }); + } + else { + signer = async (authScheme) => { + authScheme = Object.assign({}, { + name: "sigv4", + signingName: config.signingName || config.defaultSigningName, + signingRegion: await core.normalizeProvider(config.region)(), + properties: {}, + }, authScheme); + const signingRegion = authScheme.signingRegion; + const signingService = authScheme.signingName; + config.signingRegion = config.signingRegion || signingRegion; + config.signingName = config.signingName || signingService || config.serviceId; + const params = { + ...config, + credentials: config.credentials, + region: config.signingRegion, + service: config.signingName, + sha256, + uriEscapePath: signingEscapePath, + }; + const SignerCtor = config.signerConstructor || signatureV4.SignatureV4; + return new SignerCtor(params); + }; + } + const resolvedConfig = Object.assign(config, { + systemClockOffset, + signingEscapePath, + signer, }); - Object.setPrototypeOf(this, _UnauthorizedException.prototype); - } -}; -var GetRoleCredentialsRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING } -}), "GetRoleCredentialsRequestFilterSensitiveLog"); -var RoleCredentialsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.secretAccessKey && { secretAccessKey: import_smithy_client.SENSITIVE_STRING }, - ...obj.sessionToken && { sessionToken: import_smithy_client.SENSITIVE_STRING } -}), "RoleCredentialsFilterSensitiveLog"); -var GetRoleCredentialsResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.roleCredentials && { roleCredentials: RoleCredentialsFilterSensitiveLog(obj.roleCredentials) } -}), "GetRoleCredentialsResponseFilterSensitiveLog"); -var ListAccountRolesRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING } -}), "ListAccountRolesRequestFilterSensitiveLog"); -var ListAccountsRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING } -}), "ListAccountsRequestFilterSensitiveLog"); -var LogoutRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING } -}), "LogoutRequestFilterSensitiveLog"); - -// src/protocols/Aws_restJson1.ts -var import_core2 = __nccwpck_require__(8704); - - -var se_GetRoleCredentialsCommand = /* @__PURE__ */ __name(async (input, context) => { - const b = (0, import_core.requestBuilder)(input, context); - const headers = (0, import_smithy_client.map)({}, import_smithy_client.isSerializableHeaderValue, { - [_xasbt]: input[_aT] - }); - b.bp("/federation/credentials"); - const query = (0, import_smithy_client.map)({ - [_rn]: [, (0, import_smithy_client.expectNonNull)(input[_rN], `roleName`)], - [_ai]: [, (0, import_smithy_client.expectNonNull)(input[_aI], `accountId`)] - }); - let body; - b.m("GET").h(headers).q(query).b(body); - return b.build(); -}, "se_GetRoleCredentialsCommand"); -var se_ListAccountRolesCommand = /* @__PURE__ */ __name(async (input, context) => { - const b = (0, import_core.requestBuilder)(input, context); - const headers = (0, import_smithy_client.map)({}, import_smithy_client.isSerializableHeaderValue, { - [_xasbt]: input[_aT] - }); - b.bp("/assignment/roles"); - const query = (0, import_smithy_client.map)({ - [_nt]: [, input[_nT]], - [_mr]: [() => input.maxResults !== void 0, () => input[_mR].toString()], - [_ai]: [, (0, import_smithy_client.expectNonNull)(input[_aI], `accountId`)] - }); - let body; - b.m("GET").h(headers).q(query).b(body); - return b.build(); -}, "se_ListAccountRolesCommand"); -var se_ListAccountsCommand = /* @__PURE__ */ __name(async (input, context) => { - const b = (0, import_core.requestBuilder)(input, context); - const headers = (0, import_smithy_client.map)({}, import_smithy_client.isSerializableHeaderValue, { - [_xasbt]: input[_aT] - }); - b.bp("/assignment/accounts"); - const query = (0, import_smithy_client.map)({ - [_nt]: [, input[_nT]], - [_mr]: [() => input.maxResults !== void 0, () => input[_mR].toString()] - }); - let body; - b.m("GET").h(headers).q(query).b(body); - return b.build(); -}, "se_ListAccountsCommand"); -var se_LogoutCommand = /* @__PURE__ */ __name(async (input, context) => { - const b = (0, import_core.requestBuilder)(input, context); - const headers = (0, import_smithy_client.map)({}, import_smithy_client.isSerializableHeaderValue, { - [_xasbt]: input[_aT] - }); - b.bp("/logout"); - let body; - b.m("POST").h(headers).b(body); - return b.build(); -}, "se_LogoutCommand"); -var de_GetRoleCredentialsCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_CommandError(output, context); - } - const contents = (0, import_smithy_client.map)({ - $metadata: deserializeMetadata(output) - }); - const data = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client.take)(data, { - roleCredentials: import_smithy_client._json - }); - Object.assign(contents, doc); - return contents; -}, "de_GetRoleCredentialsCommand"); -var de_ListAccountRolesCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_CommandError(output, context); - } - const contents = (0, import_smithy_client.map)({ - $metadata: deserializeMetadata(output) - }); - const data = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client.take)(data, { - nextToken: import_smithy_client.expectString, - roleList: import_smithy_client._json - }); - Object.assign(contents, doc); - return contents; -}, "de_ListAccountRolesCommand"); -var de_ListAccountsCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_CommandError(output, context); - } - const contents = (0, import_smithy_client.map)({ - $metadata: deserializeMetadata(output) - }); - const data = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client.take)(data, { - accountList: import_smithy_client._json, - nextToken: import_smithy_client.expectString - }); - Object.assign(contents, doc); - return contents; -}, "de_ListAccountsCommand"); -var de_LogoutCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_CommandError(output, context); - } - const contents = (0, import_smithy_client.map)({ - $metadata: deserializeMetadata(output) - }); - await (0, import_smithy_client.collectBody)(output.body, context); - return contents; -}, "de_LogoutCommand"); -var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { - const parsedOutput = { - ...output, - body: await (0, import_core2.parseJsonErrorBody)(output.body, context) - }; - const errorCode = (0, import_core2.loadRestJsonErrorCode)(output, parsedOutput.body); - switch (errorCode) { - case "InvalidRequestException": - case "com.amazonaws.sso#InvalidRequestException": - throw await de_InvalidRequestExceptionRes(parsedOutput, context); - case "ResourceNotFoundException": - case "com.amazonaws.sso#ResourceNotFoundException": - throw await de_ResourceNotFoundExceptionRes(parsedOutput, context); - case "TooManyRequestsException": - case "com.amazonaws.sso#TooManyRequestsException": - throw await de_TooManyRequestsExceptionRes(parsedOutput, context); - case "UnauthorizedException": - case "com.amazonaws.sso#UnauthorizedException": - throw await de_UnauthorizedExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode - }); - } -}, "de_CommandError"); -var throwDefaultError = (0, import_smithy_client.withBaseException)(SSOServiceException); -var de_InvalidRequestExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client.take)(data, { - message: import_smithy_client.expectString - }); - Object.assign(contents, doc); - const exception = new InvalidRequestException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); -}, "de_InvalidRequestExceptionRes"); -var de_ResourceNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client.take)(data, { - message: import_smithy_client.expectString - }); - Object.assign(contents, doc); - const exception = new ResourceNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); -}, "de_ResourceNotFoundExceptionRes"); -var de_TooManyRequestsExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client.take)(data, { - message: import_smithy_client.expectString - }); - Object.assign(contents, doc); - const exception = new TooManyRequestsException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); -}, "de_TooManyRequestsExceptionRes"); -var de_UnauthorizedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client.take)(data, { - message: import_smithy_client.expectString - }); - Object.assign(contents, doc); - const exception = new UnauthorizedException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); -}, "de_UnauthorizedExceptionRes"); -var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"] -}), "deserializeMetadata"); -var _aI = "accountId"; -var _aT = "accessToken"; -var _ai = "account_id"; -var _mR = "maxResults"; -var _mr = "max_result"; -var _nT = "nextToken"; -var _nt = "next_token"; -var _rN = "roleName"; -var _rn = "role_name"; -var _xasbt = "x-amz-sso_bearer_token"; - -// src/commands/GetRoleCredentialsCommand.ts -var GetRoleCredentialsCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("SWBPortalService", "GetRoleCredentials", {}).n("SSOClient", "GetRoleCredentialsCommand").f(GetRoleCredentialsRequestFilterSensitiveLog, GetRoleCredentialsResponseFilterSensitiveLog).ser(se_GetRoleCredentialsCommand).de(de_GetRoleCredentialsCommand).build() { - static { - __name(this, "GetRoleCredentialsCommand"); - } + return resolvedConfig; }; +const resolveAWSSDKSigV4Config = resolveAwsSdkSigV4Config; +function normalizeCredentialProvider(config, { credentials, credentialDefaultProvider, }) { + let credentialsProvider; + if (credentials) { + if (!credentials?.memoized) { + credentialsProvider = core.memoizeIdentityProvider(credentials, core.isIdentityExpired, core.doesIdentityRequireRefresh); + } + else { + credentialsProvider = credentials; + } + } + else { + if (credentialDefaultProvider) { + credentialsProvider = core.normalizeProvider(credentialDefaultProvider(Object.assign({}, config, { + parentClientConfig: config, + }))); + } + else { + credentialsProvider = async () => { + throw new Error("@aws-sdk/core::resolveAwsSdkSigV4Config - `credentials` not provided and no credentialDefaultProvider was configured."); + }; + } + } + credentialsProvider.memoized = true; + return credentialsProvider; +} +function bindCallerConfig(config, credentialsProvider) { + if (credentialsProvider.configBound) { + return credentialsProvider; + } + const fn = async (options) => credentialsProvider({ ...options, callerClientConfig: config }); + fn.memoized = credentialsProvider.memoized; + fn.configBound = true; + return fn; +} -// src/commands/ListAccountRolesCommand.ts - +class ProtocolLib { + resolveRestContentType(defaultContentType, inputSchema) { + const members = inputSchema.getMemberSchemas(); + const httpPayloadMember = Object.values(members).find((m) => { + return !!m.getMergedTraits().httpPayload; + }); + if (httpPayloadMember) { + const mediaType = httpPayloadMember.getMergedTraits().mediaType; + if (mediaType) { + return mediaType; + } + else if (httpPayloadMember.isStringSchema()) { + return "text/plain"; + } + else if (httpPayloadMember.isBlobSchema()) { + return "application/octet-stream"; + } + else { + return defaultContentType; + } + } + else if (!inputSchema.isUnitSchema()) { + const hasBody = Object.values(members).find((m) => { + const { httpQuery, httpQueryParams, httpHeader, httpLabel, httpPrefixHeaders } = m.getMergedTraits(); + const noPrefixHeaders = httpPrefixHeaders === void 0; + return !httpQuery && !httpQueryParams && !httpHeader && !httpLabel && noPrefixHeaders; + }); + if (hasBody) { + return defaultContentType; + } + } + } + async getErrorSchemaOrThrowBaseException(errorIdentifier, defaultNamespace, response, dataObject, metadata, getErrorSchema) { + let namespace = defaultNamespace; + let errorName = errorIdentifier; + if (errorIdentifier.includes("#")) { + [namespace, errorName] = errorIdentifier.split("#"); + } + const errorMetadata = { + $metadata: metadata, + $response: response, + $fault: response.statusCode < 500 ? "client" : "server", + }; + const registry = schema.TypeRegistry.for(namespace); + try { + const errorSchema = getErrorSchema?.(registry, errorName) ?? registry.getSchema(errorIdentifier); + return { errorSchema, errorMetadata }; + } + catch (e) { + dataObject.message = dataObject.message ?? dataObject.Message ?? "UnknownError"; + const synthetic = schema.TypeRegistry.for("smithy.ts.sdk.synthetic." + namespace); + const baseExceptionSchema = synthetic.getBaseException(); + if (baseExceptionSchema) { + const ErrorCtor = synthetic.getErrorCtor(baseExceptionSchema) ?? Error; + throw Object.assign(new ErrorCtor({ name: errorName }), errorMetadata, dataObject); + } + throw Object.assign(new Error(errorName), errorMetadata, dataObject); + } + } + setQueryCompatError(output, response) { + const queryErrorHeader = response.headers?.["x-amzn-query-error"]; + if (output !== undefined && queryErrorHeader != null) { + const [Code, Type] = queryErrorHeader.split(";"); + const entries = Object.entries(output); + const Error = { + Code, + Type, + }; + Object.assign(output, Error); + for (const [k, v] of entries) { + Error[k] = v; + } + delete Error.__type; + output.Error = Error; + } + } + queryCompatOutput(queryCompatErrorData, errorData) { + if (queryCompatErrorData.Error) { + errorData.Error = queryCompatErrorData.Error; + } + if (queryCompatErrorData.Type) { + errorData.Type = queryCompatErrorData.Type; + } + if (queryCompatErrorData.Code) { + errorData.Code = queryCompatErrorData.Code; + } + } +} +class AwsSmithyRpcV2CborProtocol extends cbor.SmithyRpcV2CborProtocol { + awsQueryCompatible; + mixin = new ProtocolLib(); + constructor({ defaultNamespace, awsQueryCompatible, }) { + super({ defaultNamespace }); + this.awsQueryCompatible = !!awsQueryCompatible; + } + async serializeRequest(operationSchema, input, context) { + const request = await super.serializeRequest(operationSchema, input, context); + if (this.awsQueryCompatible) { + request.headers["x-amzn-query-mode"] = "true"; + } + return request; + } + async handleError(operationSchema, context, response, dataObject, metadata) { + if (this.awsQueryCompatible) { + this.mixin.setQueryCompatError(dataObject, response); + } + const errorName = cbor.loadSmithyRpcV2CborErrorCode(response, dataObject) ?? "Unknown"; + const { errorSchema, errorMetadata } = await this.mixin.getErrorSchemaOrThrowBaseException(errorName, this.options.defaultNamespace, response, dataObject, metadata); + const ns = schema.NormalizedSchema.of(errorSchema); + const message = dataObject.message ?? dataObject.Message ?? "Unknown"; + const ErrorCtor = schema.TypeRegistry.for(errorSchema[1]).getErrorCtor(errorSchema) ?? Error; + const exception = new ErrorCtor(message); + const output = {}; + for (const [name, member] of ns.structIterator()) { + output[name] = this.deserializer.readValue(member, dataObject[name]); + } + if (this.awsQueryCompatible) { + this.mixin.queryCompatOutput(dataObject, output); + } + throw Object.assign(exception, errorMetadata, { + $fault: ns.getMergedTraits().error, + message, + }, output); + } +} -var ListAccountRolesCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("SWBPortalService", "ListAccountRoles", {}).n("SSOClient", "ListAccountRolesCommand").f(ListAccountRolesRequestFilterSensitiveLog, void 0).ser(se_ListAccountRolesCommand).de(de_ListAccountRolesCommand).build() { - static { - __name(this, "ListAccountRolesCommand"); - } +const _toStr = (val) => { + if (val == null) { + return val; + } + if (typeof val === "number" || typeof val === "bigint") { + const warning = new Error(`Received number ${val} where a string was expected.`); + warning.name = "Warning"; + console.warn(warning); + return String(val); + } + if (typeof val === "boolean") { + const warning = new Error(`Received boolean ${val} where a string was expected.`); + warning.name = "Warning"; + console.warn(warning); + return String(val); + } + return val; }; - -// src/commands/ListAccountsCommand.ts - - - -var ListAccountsCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("SWBPortalService", "ListAccounts", {}).n("SSOClient", "ListAccountsCommand").f(ListAccountsRequestFilterSensitiveLog, void 0).ser(se_ListAccountsCommand).de(de_ListAccountsCommand).build() { - static { - __name(this, "ListAccountsCommand"); - } +const _toBool = (val) => { + if (val == null) { + return val; + } + if (typeof val === "string") { + const lowercase = val.toLowerCase(); + if (val !== "" && lowercase !== "false" && lowercase !== "true") { + const warning = new Error(`Received string "${val}" where a boolean was expected.`); + warning.name = "Warning"; + console.warn(warning); + } + return val !== "" && lowercase !== "false"; + } + return val; +}; +const _toNum = (val) => { + if (val == null) { + return val; + } + if (typeof val === "string") { + const num = Number(val); + if (num.toString() !== val) { + const warning = new Error(`Received string "${val}" where a number was expected.`); + warning.name = "Warning"; + console.warn(warning); + return val; + } + return num; + } + return val; }; -// src/commands/LogoutCommand.ts - +class SerdeContextConfig { + serdeContext; + setSerdeContext(serdeContext) { + this.serdeContext = serdeContext; + } +} +function jsonReviver(key, value, context) { + if (context?.source) { + const numericString = context.source; + if (typeof value === "number") { + if (value > Number.MAX_SAFE_INTEGER || value < Number.MIN_SAFE_INTEGER || numericString !== String(value)) { + const isFractional = numericString.includes("."); + if (isFractional) { + return new serde.NumericValue(numericString, "bigDecimal"); + } + else { + return BigInt(numericString); + } + } + } + } + return value; +} -var LogoutCommand = class extends import_smithy_client.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("SWBPortalService", "Logout", {}).n("SSOClient", "LogoutCommand").f(LogoutRequestFilterSensitiveLog, void 0).ser(se_LogoutCommand).de(de_LogoutCommand).build() { - static { - __name(this, "LogoutCommand"); - } -}; +const collectBodyString = (streamBody, context) => smithyClient.collectBody(streamBody, context).then((body) => (context?.utf8Encoder ?? utilUtf8.toUtf8)(body)); -// src/SSO.ts -var commands = { - GetRoleCredentialsCommand, - ListAccountRolesCommand, - ListAccountsCommand, - LogoutCommand +const parseJsonBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + try { + return JSON.parse(encoded); + } + catch (e) { + if (e?.name === "SyntaxError") { + Object.defineProperty(e, "$responseBodyText", { + value: encoded, + }); + } + throw e; + } + } + return {}; +}); +const parseJsonErrorBody = async (errorBody, context) => { + const value = await parseJsonBody(errorBody, context); + value.message = value.message ?? value.Message; + return value; }; -var SSO = class extends SSOClient { - static { - __name(this, "SSO"); - } +const loadRestJsonErrorCode = (output, data) => { + const findKey = (object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase()); + const sanitizeErrorCode = (rawValue) => { + let cleanValue = rawValue; + if (typeof cleanValue === "number") { + cleanValue = cleanValue.toString(); + } + if (cleanValue.indexOf(",") >= 0) { + cleanValue = cleanValue.split(",")[0]; + } + if (cleanValue.indexOf(":") >= 0) { + cleanValue = cleanValue.split(":")[0]; + } + if (cleanValue.indexOf("#") >= 0) { + cleanValue = cleanValue.split("#")[1]; + } + return cleanValue; + }; + const headerKey = findKey(output.headers, "x-amzn-errortype"); + if (headerKey !== undefined) { + return sanitizeErrorCode(output.headers[headerKey]); + } + if (data && typeof data === "object") { + const codeKey = findKey(data, "code"); + if (codeKey && data[codeKey] !== undefined) { + return sanitizeErrorCode(data[codeKey]); + } + if (data["__type"] !== undefined) { + return sanitizeErrorCode(data["__type"]); + } + } }; -(0, import_smithy_client.createAggregatedClient)(commands, SSO); - -// src/pagination/ListAccountRolesPaginator.ts -var paginateListAccountRoles = (0, import_core.createPaginator)(SSOClient, ListAccountRolesCommand, "nextToken", "nextToken", "maxResults"); - -// src/pagination/ListAccountsPaginator.ts +class JsonShapeDeserializer extends SerdeContextConfig { + settings; + constructor(settings) { + super(); + this.settings = settings; + } + async read(schema, data) { + return this._read(schema, typeof data === "string" ? JSON.parse(data, jsonReviver) : await parseJsonBody(data, this.serdeContext)); + } + readObject(schema, data) { + return this._read(schema, data); + } + _read(schema$1, value) { + const isObject = value !== null && typeof value === "object"; + const ns = schema.NormalizedSchema.of(schema$1); + if (ns.isListSchema() && Array.isArray(value)) { + const listMember = ns.getValueSchema(); + const out = []; + const sparse = !!ns.getMergedTraits().sparse; + for (const item of value) { + if (sparse || item != null) { + out.push(this._read(listMember, item)); + } + } + return out; + } + else if (ns.isMapSchema() && isObject) { + const mapMember = ns.getValueSchema(); + const out = {}; + const sparse = !!ns.getMergedTraits().sparse; + for (const [_k, _v] of Object.entries(value)) { + if (sparse || _v != null) { + out[_k] = this._read(mapMember, _v); + } + } + return out; + } + else if (ns.isStructSchema() && isObject) { + const out = {}; + for (const [memberName, memberSchema] of ns.structIterator()) { + const fromKey = this.settings.jsonName ? memberSchema.getMergedTraits().jsonName ?? memberName : memberName; + const deserializedValue = this._read(memberSchema, value[fromKey]); + if (deserializedValue != null) { + out[memberName] = deserializedValue; + } + } + return out; + } + if (ns.isBlobSchema() && typeof value === "string") { + return utilBase64.fromBase64(value); + } + const mediaType = ns.getMergedTraits().mediaType; + if (ns.isStringSchema() && typeof value === "string" && mediaType) { + const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); + if (isJson) { + return serde.LazyJsonString.from(value); + } + } + if (ns.isTimestampSchema() && value != null) { + const format = protocols.determineTimestampFormat(ns, this.settings); + switch (format) { + case 5: + return serde.parseRfc3339DateTimeWithOffset(value); + case 6: + return serde.parseRfc7231DateTime(value); + case 7: + return serde.parseEpochTimestamp(value); + default: + console.warn("Missing timestamp format, parsing value with Date constructor:", value); + return new Date(value); + } + } + if (ns.isBigIntegerSchema() && (typeof value === "number" || typeof value === "string")) { + return BigInt(value); + } + if (ns.isBigDecimalSchema() && value != undefined) { + if (value instanceof serde.NumericValue) { + return value; + } + const untyped = value; + if (untyped.type === "bigDecimal" && "string" in untyped) { + return new serde.NumericValue(untyped.string, untyped.type); + } + return new serde.NumericValue(String(value), "bigDecimal"); + } + if (ns.isNumericSchema() && typeof value === "string") { + switch (value) { + case "Infinity": + return Infinity; + case "-Infinity": + return -Infinity; + case "NaN": + return NaN; + } + } + if (ns.isDocumentSchema()) { + if (isObject) { + const out = Array.isArray(value) ? [] : {}; + for (const [k, v] of Object.entries(value)) { + if (v instanceof serde.NumericValue) { + out[k] = v; + } + else { + out[k] = this._read(ns, v); + } + } + return out; + } + else { + return structuredClone(value); + } + } + return value; + } +} -var paginateListAccounts = (0, import_core.createPaginator)(SSOClient, ListAccountsCommand, "nextToken", "nextToken", "maxResults"); -// Annotate the CommonJS export names for ESM import in node: +const NUMERIC_CONTROL_CHAR = String.fromCharCode(925); +class JsonReplacer { + values = new Map(); + counter = 0; + stage = 0; + createReplacer() { + if (this.stage === 1) { + throw new Error("@aws-sdk/core/protocols - JsonReplacer already created."); + } + if (this.stage === 2) { + throw new Error("@aws-sdk/core/protocols - JsonReplacer exhausted."); + } + this.stage = 1; + return (key, value) => { + if (value instanceof serde.NumericValue) { + const v = `${NUMERIC_CONTROL_CHAR + "nv" + this.counter++}_` + value.string; + this.values.set(`"${v}"`, value.string); + return v; + } + if (typeof value === "bigint") { + const s = value.toString(); + const v = `${NUMERIC_CONTROL_CHAR + "b" + this.counter++}_` + s; + this.values.set(`"${v}"`, s); + return v; + } + return value; + }; + } + replaceInJson(json) { + if (this.stage === 0) { + throw new Error("@aws-sdk/core/protocols - JsonReplacer not created yet."); + } + if (this.stage === 2) { + throw new Error("@aws-sdk/core/protocols - JsonReplacer exhausted."); + } + this.stage = 2; + if (this.counter === 0) { + return json; + } + for (const [key, value] of this.values) { + json = json.replace(key, value); + } + return json; + } +} -0 && (0); +class JsonShapeSerializer extends SerdeContextConfig { + settings; + buffer; + rootSchema; + constructor(settings) { + super(); + this.settings = settings; + } + write(schema$1, value) { + this.rootSchema = schema.NormalizedSchema.of(schema$1); + this.buffer = this._write(this.rootSchema, value); + } + writeDiscriminatedDocument(schema$1, value) { + this.write(schema$1, value); + if (typeof this.buffer === "object") { + this.buffer.__type = schema.NormalizedSchema.of(schema$1).getName(true); + } + } + flush() { + const { rootSchema } = this; + this.rootSchema = undefined; + if (rootSchema?.isStructSchema() || rootSchema?.isDocumentSchema()) { + const replacer = new JsonReplacer(); + return replacer.replaceInJson(JSON.stringify(this.buffer, replacer.createReplacer(), 0)); + } + return this.buffer; + } + _write(schema$1, value, container) { + const isObject = value !== null && typeof value === "object"; + const ns = schema.NormalizedSchema.of(schema$1); + if (ns.isListSchema() && Array.isArray(value)) { + const listMember = ns.getValueSchema(); + const out = []; + const sparse = !!ns.getMergedTraits().sparse; + for (const item of value) { + if (sparse || item != null) { + out.push(this._write(listMember, item)); + } + } + return out; + } + else if (ns.isMapSchema() && isObject) { + const mapMember = ns.getValueSchema(); + const out = {}; + const sparse = !!ns.getMergedTraits().sparse; + for (const [_k, _v] of Object.entries(value)) { + if (sparse || _v != null) { + out[_k] = this._write(mapMember, _v); + } + } + return out; + } + else if (ns.isStructSchema() && isObject) { + const out = {}; + for (const [memberName, memberSchema] of ns.structIterator()) { + const targetKey = this.settings.jsonName ? memberSchema.getMergedTraits().jsonName ?? memberName : memberName; + const serializableValue = this._write(memberSchema, value[memberName], ns); + if (serializableValue !== undefined) { + out[targetKey] = serializableValue; + } + } + return out; + } + if (value === null && container?.isStructSchema()) { + return void 0; + } + if ((ns.isBlobSchema() && (value instanceof Uint8Array || typeof value === "string")) || + (ns.isDocumentSchema() && value instanceof Uint8Array)) { + if (ns === this.rootSchema) { + return value; + } + if (!this.serdeContext?.base64Encoder) { + return utilBase64.toBase64(value); + } + return this.serdeContext?.base64Encoder(value); + } + if ((ns.isTimestampSchema() || ns.isDocumentSchema()) && value instanceof Date) { + const format = protocols.determineTimestampFormat(ns, this.settings); + switch (format) { + case 5: + return value.toISOString().replace(".000Z", "Z"); + case 6: + return serde.dateToUtcString(value); + case 7: + return value.getTime() / 1000; + default: + console.warn("Missing timestamp format, using epoch seconds", value); + return value.getTime() / 1000; + } + } + if (ns.isNumericSchema() && typeof value === "number") { + if (Math.abs(value) === Infinity || isNaN(value)) { + return String(value); + } + } + if (ns.isStringSchema()) { + if (typeof value === "undefined" && ns.isIdempotencyToken()) { + return serde.generateIdempotencyToken(); + } + const mediaType = ns.getMergedTraits().mediaType; + if (value != null && mediaType) { + const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); + if (isJson) { + return serde.LazyJsonString.from(value); + } + } + } + if (ns.isDocumentSchema()) { + if (isObject) { + const out = Array.isArray(value) ? [] : {}; + for (const [k, v] of Object.entries(value)) { + if (v instanceof serde.NumericValue) { + out[k] = v; + } + else { + out[k] = this._write(ns, v); + } + } + return out; + } + else { + return structuredClone(value); + } + } + return value; + } +} +class JsonCodec extends SerdeContextConfig { + settings; + constructor(settings) { + super(); + this.settings = settings; + } + createSerializer() { + const serializer = new JsonShapeSerializer(this.settings); + serializer.setSerdeContext(this.serdeContext); + return serializer; + } + createDeserializer() { + const deserializer = new JsonShapeDeserializer(this.settings); + deserializer.setSerdeContext(this.serdeContext); + return deserializer; + } +} + +class AwsJsonRpcProtocol extends protocols.RpcProtocol { + serializer; + deserializer; + serviceTarget; + codec; + mixin = new ProtocolLib(); + awsQueryCompatible; + constructor({ defaultNamespace, serviceTarget, awsQueryCompatible, }) { + super({ + defaultNamespace, + }); + this.serviceTarget = serviceTarget; + this.codec = new JsonCodec({ + timestampFormat: { + useTrait: true, + default: 7, + }, + jsonName: false, + }); + this.serializer = this.codec.createSerializer(); + this.deserializer = this.codec.createDeserializer(); + this.awsQueryCompatible = !!awsQueryCompatible; + } + async serializeRequest(operationSchema, input, context) { + const request = await super.serializeRequest(operationSchema, input, context); + if (!request.path.endsWith("/")) { + request.path += "/"; + } + Object.assign(request.headers, { + "content-type": `application/x-amz-json-${this.getJsonRpcVersion()}`, + "x-amz-target": `${this.serviceTarget}.${operationSchema.name}`, + }); + if (this.awsQueryCompatible) { + request.headers["x-amzn-query-mode"] = "true"; + } + if (schema.deref(operationSchema.input) === "unit" || !request.body) { + request.body = "{}"; + } + return request; + } + getPayloadCodec() { + return this.codec; + } + async handleError(operationSchema, context, response, dataObject, metadata) { + if (this.awsQueryCompatible) { + this.mixin.setQueryCompatError(dataObject, response); + } + const errorIdentifier = loadRestJsonErrorCode(response, dataObject) ?? "Unknown"; + const { errorSchema, errorMetadata } = await this.mixin.getErrorSchemaOrThrowBaseException(errorIdentifier, this.options.defaultNamespace, response, dataObject, metadata); + const ns = schema.NormalizedSchema.of(errorSchema); + const message = dataObject.message ?? dataObject.Message ?? "Unknown"; + const ErrorCtor = schema.TypeRegistry.for(errorSchema[1]).getErrorCtor(errorSchema) ?? Error; + const exception = new ErrorCtor(message); + const output = {}; + for (const [name, member] of ns.structIterator()) { + const target = member.getMergedTraits().jsonName ?? name; + output[name] = this.codec.createDeserializer().readObject(member, dataObject[target]); + } + if (this.awsQueryCompatible) { + this.mixin.queryCompatOutput(dataObject, output); + } + throw Object.assign(exception, errorMetadata, { + $fault: ns.getMergedTraits().error, + message, + }, output); + } +} +class AwsJson1_0Protocol extends AwsJsonRpcProtocol { + constructor({ defaultNamespace, serviceTarget, awsQueryCompatible, }) { + super({ + defaultNamespace, + serviceTarget, + awsQueryCompatible, + }); + } + getShapeId() { + return "aws.protocols#awsJson1_0"; + } + getJsonRpcVersion() { + return "1.0"; + } + getDefaultContentType() { + return "application/x-amz-json-1.0"; + } +} -/***/ }), +class AwsJson1_1Protocol extends AwsJsonRpcProtocol { + constructor({ defaultNamespace, serviceTarget, awsQueryCompatible, }) { + super({ + defaultNamespace, + serviceTarget, + awsQueryCompatible, + }); + } + getShapeId() { + return "aws.protocols#awsJson1_1"; + } + getJsonRpcVersion() { + return "1.1"; + } + getDefaultContentType() { + return "application/x-amz-json-1.1"; + } +} -/***/ 2696: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +class AwsRestJsonProtocol extends protocols.HttpBindingProtocol { + serializer; + deserializer; + codec; + mixin = new ProtocolLib(); + constructor({ defaultNamespace }) { + super({ + defaultNamespace, + }); + const settings = { + timestampFormat: { + useTrait: true, + default: 7, + }, + httpBindings: true, + jsonName: true, + }; + this.codec = new JsonCodec(settings); + this.serializer = new protocols.HttpInterceptingShapeSerializer(this.codec.createSerializer(), settings); + this.deserializer = new protocols.HttpInterceptingShapeDeserializer(this.codec.createDeserializer(), settings); + } + getShapeId() { + return "aws.protocols#restJson1"; + } + getPayloadCodec() { + return this.codec; + } + setSerdeContext(serdeContext) { + this.codec.setSerdeContext(serdeContext); + super.setSerdeContext(serdeContext); + } + async serializeRequest(operationSchema, input, context) { + const request = await super.serializeRequest(operationSchema, input, context); + const inputSchema = schema.NormalizedSchema.of(operationSchema.input); + if (!request.headers["content-type"]) { + const contentType = this.mixin.resolveRestContentType(this.getDefaultContentType(), inputSchema); + if (contentType) { + request.headers["content-type"] = contentType; + } + } + if (request.headers["content-type"] && !request.body) { + request.body = "{}"; + } + return request; + } + async handleError(operationSchema, context, response, dataObject, metadata) { + const errorIdentifier = loadRestJsonErrorCode(response, dataObject) ?? "Unknown"; + const { errorSchema, errorMetadata } = await this.mixin.getErrorSchemaOrThrowBaseException(errorIdentifier, this.options.defaultNamespace, response, dataObject, metadata); + const ns = schema.NormalizedSchema.of(errorSchema); + const message = dataObject.message ?? dataObject.Message ?? "Unknown"; + const ErrorCtor = schema.TypeRegistry.for(errorSchema[1]).getErrorCtor(errorSchema) ?? Error; + const exception = new ErrorCtor(message); + await this.deserializeHttpMessage(errorSchema, context, response, dataObject); + const output = {}; + for (const [name, member] of ns.structIterator()) { + const target = member.getMergedTraits().jsonName ?? name; + output[name] = this.codec.createDeserializer().readObject(member, dataObject[target]); + } + throw Object.assign(exception, errorMetadata, { + $fault: ns.getMergedTraits().error, + message, + }, output); + } + getDefaultContentType() { + return "application/json"; + } +} -"use strict"; +const awsExpectUnion = (value) => { + if (value == null) { + return undefined; + } + if (typeof value === "object" && "__type" in value) { + delete value.__type; + } + return smithyClient.expectUnion(value); +}; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const tslib_1 = __nccwpck_require__(1860); -const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(5188)); -const core_1 = __nccwpck_require__(8704); -const util_user_agent_node_1 = __nccwpck_require__(1656); -const config_resolver_1 = __nccwpck_require__(9316); -const hash_node_1 = __nccwpck_require__(5092); -const middleware_retry_1 = __nccwpck_require__(9618); -const node_config_provider_1 = __nccwpck_require__(5704); -const node_http_handler_1 = __nccwpck_require__(1279); -const util_body_length_node_1 = __nccwpck_require__(3638); -const util_retry_1 = __nccwpck_require__(5518); -const runtimeConfig_shared_1 = __nccwpck_require__(8073); -const smithy_client_1 = __nccwpck_require__(1411); -const util_defaults_mode_node_1 = __nccwpck_require__(5435); -const smithy_client_2 = __nccwpck_require__(1411); -const getRuntimeConfig = (config) => { - (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); - const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); - const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); - const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); - (0, core_1.emitWarningIfUnsupportedVersion)(process.version); - const loaderConfig = { - profile: config?.profile, - logger: clientSharedValues.logger, - }; - return { - ...clientSharedValues, - ...config, - runtime: "node", - defaultsMode, - authSchemePreference: config?.authSchemePreference ?? (0, node_config_provider_1.loadConfig)(core_1.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, loaderConfig), - bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, - defaultUserAgentProvider: config?.defaultUserAgentProvider ?? - (0, util_user_agent_node_1.createDefaultUserAgentProvider)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), - maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS, config), - region: config?.region ?? - (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, { ...config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS, ...loaderConfig }), - requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), - retryMode: config?.retryMode ?? - (0, node_config_provider_1.loadConfig)({ - ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, - default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, - }, config), - sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), - streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, - useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, loaderConfig), - useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, loaderConfig), - userAgentAppId: config?.userAgentAppId ?? (0, node_config_provider_1.loadConfig)(util_user_agent_node_1.NODE_APP_ID_CONFIG_OPTIONS, loaderConfig), - }; -}; -exports.getRuntimeConfig = getRuntimeConfig; - - -/***/ }), - -/***/ 8073: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +class XmlShapeDeserializer extends SerdeContextConfig { + settings; + stringDeserializer; + constructor(settings) { + super(); + this.settings = settings; + this.stringDeserializer = new protocols.FromStringShapeDeserializer(settings); + } + setSerdeContext(serdeContext) { + this.serdeContext = serdeContext; + this.stringDeserializer.setSerdeContext(serdeContext); + } + read(schema$1, bytes, key) { + const ns = schema.NormalizedSchema.of(schema$1); + const memberSchemas = ns.getMemberSchemas(); + const isEventPayload = ns.isStructSchema() && + ns.isMemberSchema() && + !!Object.values(memberSchemas).find((memberNs) => { + return !!memberNs.getMemberTraits().eventPayload; + }); + if (isEventPayload) { + const output = {}; + const memberName = Object.keys(memberSchemas)[0]; + const eventMemberSchema = memberSchemas[memberName]; + if (eventMemberSchema.isBlobSchema()) { + output[memberName] = bytes; + } + else { + output[memberName] = this.read(memberSchemas[memberName], bytes); + } + return output; + } + const xmlString = (this.serdeContext?.utf8Encoder ?? utilUtf8.toUtf8)(bytes); + const parsedObject = this.parseXml(xmlString); + return this.readSchema(schema$1, key ? parsedObject[key] : parsedObject); + } + readSchema(_schema, value) { + const ns = schema.NormalizedSchema.of(_schema); + if (ns.isUnitSchema()) { + return; + } + const traits = ns.getMergedTraits(); + if (ns.isListSchema() && !Array.isArray(value)) { + return this.readSchema(ns, [value]); + } + if (value == null) { + return value; + } + if (typeof value === "object") { + const sparse = !!traits.sparse; + const flat = !!traits.xmlFlattened; + if (ns.isListSchema()) { + const listValue = ns.getValueSchema(); + const buffer = []; + const sourceKey = listValue.getMergedTraits().xmlName ?? "member"; + const source = flat ? value : (value[0] ?? value)[sourceKey]; + const sourceArray = Array.isArray(source) ? source : [source]; + for (const v of sourceArray) { + if (v != null || sparse) { + buffer.push(this.readSchema(listValue, v)); + } + } + return buffer; + } + const buffer = {}; + if (ns.isMapSchema()) { + const keyNs = ns.getKeySchema(); + const memberNs = ns.getValueSchema(); + let entries; + if (flat) { + entries = Array.isArray(value) ? value : [value]; + } + else { + entries = Array.isArray(value.entry) ? value.entry : [value.entry]; + } + const keyProperty = keyNs.getMergedTraits().xmlName ?? "key"; + const valueProperty = memberNs.getMergedTraits().xmlName ?? "value"; + for (const entry of entries) { + const key = entry[keyProperty]; + const value = entry[valueProperty]; + if (value != null || sparse) { + buffer[key] = this.readSchema(memberNs, value); + } + } + return buffer; + } + if (ns.isStructSchema()) { + for (const [memberName, memberSchema] of ns.structIterator()) { + const memberTraits = memberSchema.getMergedTraits(); + const xmlObjectKey = !memberTraits.httpPayload + ? memberSchema.getMemberTraits().xmlName ?? memberName + : memberTraits.xmlName ?? memberSchema.getName(); + if (value[xmlObjectKey] != null) { + buffer[memberName] = this.readSchema(memberSchema, value[xmlObjectKey]); + } + } + return buffer; + } + if (ns.isDocumentSchema()) { + return value; + } + throw new Error(`@aws-sdk/core/protocols - xml deserializer unhandled schema type for ${ns.getName(true)}`); + } + if (ns.isListSchema()) { + return []; + } + if (ns.isMapSchema() || ns.isStructSchema()) { + return {}; + } + return this.stringDeserializer.read(ns, value); + } + parseXml(xml) { + if (xml.length) { + let parsedObj; + try { + parsedObj = xmlBuilder.parseXML(xml); + } + catch (e) { + if (e && typeof e === "object") { + Object.defineProperty(e, "$responseBodyText", { + value: xml, + }); + } + throw e; + } + const textNodeName = "#text"; + const key = Object.keys(parsedObj)[0]; + const parsedObjToReturn = parsedObj[key]; + if (parsedObjToReturn[textNodeName]) { + parsedObjToReturn[key] = parsedObjToReturn[textNodeName]; + delete parsedObjToReturn[textNodeName]; + } + return smithyClient.getValueFromTextNode(parsedObjToReturn); + } + return {}; + } +} -"use strict"; +class QueryShapeSerializer extends SerdeContextConfig { + settings; + buffer; + constructor(settings) { + super(); + this.settings = settings; + } + write(schema$1, value, prefix = "") { + if (this.buffer === undefined) { + this.buffer = ""; + } + const ns = schema.NormalizedSchema.of(schema$1); + if (prefix && !prefix.endsWith(".")) { + prefix += "."; + } + if (ns.isBlobSchema()) { + if (typeof value === "string" || value instanceof Uint8Array) { + this.writeKey(prefix); + this.writeValue((this.serdeContext?.base64Encoder ?? utilBase64.toBase64)(value)); + } + } + else if (ns.isBooleanSchema() || ns.isNumericSchema() || ns.isStringSchema()) { + if (value != null) { + this.writeKey(prefix); + this.writeValue(String(value)); + } + else if (ns.isIdempotencyToken()) { + this.writeKey(prefix); + this.writeValue(serde.generateIdempotencyToken()); + } + } + else if (ns.isBigIntegerSchema()) { + if (value != null) { + this.writeKey(prefix); + this.writeValue(String(value)); + } + } + else if (ns.isBigDecimalSchema()) { + if (value != null) { + this.writeKey(prefix); + this.writeValue(value instanceof serde.NumericValue ? value.string : String(value)); + } + } + else if (ns.isTimestampSchema()) { + if (value instanceof Date) { + this.writeKey(prefix); + const format = protocols.determineTimestampFormat(ns, this.settings); + switch (format) { + case 5: + this.writeValue(value.toISOString().replace(".000Z", "Z")); + break; + case 6: + this.writeValue(smithyClient.dateToUtcString(value)); + break; + case 7: + this.writeValue(String(value.getTime() / 1000)); + break; + } + } + } + else if (ns.isDocumentSchema()) { + throw new Error(`@aws-sdk/core/protocols - QuerySerializer unsupported document type ${ns.getName(true)}`); + } + else if (ns.isListSchema()) { + if (Array.isArray(value)) { + if (value.length === 0) { + if (this.settings.serializeEmptyLists) { + this.writeKey(prefix); + this.writeValue(""); + } + } + else { + const member = ns.getValueSchema(); + const flat = this.settings.flattenLists || ns.getMergedTraits().xmlFlattened; + let i = 1; + for (const item of value) { + if (item == null) { + continue; + } + const suffix = this.getKey("member", member.getMergedTraits().xmlName); + const key = flat ? `${prefix}${i}` : `${prefix}${suffix}.${i}`; + this.write(member, item, key); + ++i; + } + } + } + } + else if (ns.isMapSchema()) { + if (value && typeof value === "object") { + const keySchema = ns.getKeySchema(); + const memberSchema = ns.getValueSchema(); + const flat = ns.getMergedTraits().xmlFlattened; + let i = 1; + for (const [k, v] of Object.entries(value)) { + if (v == null) { + continue; + } + const keySuffix = this.getKey("key", keySchema.getMergedTraits().xmlName); + const key = flat ? `${prefix}${i}.${keySuffix}` : `${prefix}entry.${i}.${keySuffix}`; + const valueSuffix = this.getKey("value", memberSchema.getMergedTraits().xmlName); + const valueKey = flat ? `${prefix}${i}.${valueSuffix}` : `${prefix}entry.${i}.${valueSuffix}`; + this.write(keySchema, k, key); + this.write(memberSchema, v, valueKey); + ++i; + } + } + } + else if (ns.isStructSchema()) { + if (value && typeof value === "object") { + for (const [memberName, member] of ns.structIterator()) { + if (value[memberName] == null && !member.isIdempotencyToken()) { + continue; + } + const suffix = this.getKey(memberName, member.getMergedTraits().xmlName); + const key = `${prefix}${suffix}`; + this.write(member, value[memberName], key); + } + } + } + else if (ns.isUnitSchema()) ; + else { + throw new Error(`@aws-sdk/core/protocols - QuerySerializer unrecognized schema type ${ns.getName(true)}`); + } + } + flush() { + if (this.buffer === undefined) { + throw new Error("@aws-sdk/core/protocols - QuerySerializer cannot flush with nothing written to buffer."); + } + const str = this.buffer; + delete this.buffer; + return str; + } + getKey(memberName, xmlName) { + const key = xmlName ?? memberName; + if (this.settings.capitalizeKeys) { + return key[0].toUpperCase() + key.slice(1); + } + return key; + } + writeKey(key) { + if (key.endsWith(".")) { + key = key.slice(0, key.length - 1); + } + this.buffer += `&${protocols.extendedEncodeURIComponent(key)}=`; + } + writeValue(value) { + this.buffer += protocols.extendedEncodeURIComponent(value); + } +} -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const core_1 = __nccwpck_require__(8704); -const core_2 = __nccwpck_require__(402); -const smithy_client_1 = __nccwpck_require__(1411); -const url_parser_1 = __nccwpck_require__(4494); -const util_base64_1 = __nccwpck_require__(8385); -const util_utf8_1 = __nccwpck_require__(1577); -const httpAuthSchemeProvider_1 = __nccwpck_require__(2041); -const endpointResolver_1 = __nccwpck_require__(3903); -const getRuntimeConfig = (config) => { - return { - apiVersion: "2019-06-10", - base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, - base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, - disableHostPrefix: config?.disableHostPrefix ?? false, - endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, - extensions: config?.extensions ?? [], - httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSSOHttpAuthSchemeProvider, - httpAuthSchemes: config?.httpAuthSchemes ?? [ - { - schemeId: "aws.auth#sigv4", - identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), - signer: new core_1.AwsSdkSigV4Signer(), - }, - { - schemeId: "smithy.api#noAuth", - identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), - signer: new core_2.NoAuthSigner(), +class AwsQueryProtocol extends protocols.RpcProtocol { + options; + serializer; + deserializer; + mixin = new ProtocolLib(); + constructor(options) { + super({ + defaultNamespace: options.defaultNamespace, + }); + this.options = options; + const settings = { + timestampFormat: { + useTrait: true, + default: 5, }, - ], - logger: config?.logger ?? new smithy_client_1.NoOpLogger(), - serviceId: config?.serviceId ?? "SSO", - urlParser: config?.urlParser ?? url_parser_1.parseUrl, - utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, - utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, - }; -}; -exports.getRuntimeConfig = getRuntimeConfig; - + httpBindings: false, + xmlNamespace: options.xmlNamespace, + serviceNamespace: options.defaultNamespace, + serializeEmptyLists: true, + }; + this.serializer = new QueryShapeSerializer(settings); + this.deserializer = new XmlShapeDeserializer(settings); + } + getShapeId() { + return "aws.protocols#awsQuery"; + } + setSerdeContext(serdeContext) { + this.serializer.setSerdeContext(serdeContext); + this.deserializer.setSerdeContext(serdeContext); + } + getPayloadCodec() { + throw new Error("AWSQuery protocol has no payload codec."); + } + async serializeRequest(operationSchema, input, context) { + const request = await super.serializeRequest(operationSchema, input, context); + if (!request.path.endsWith("/")) { + request.path += "/"; + } + Object.assign(request.headers, { + "content-type": `application/x-www-form-urlencoded`, + }); + if (schema.deref(operationSchema.input) === "unit" || !request.body) { + request.body = ""; + } + const action = operationSchema.name.split("#")[1] ?? operationSchema.name; + request.body = `Action=${action}&Version=${this.options.version}` + request.body; + if (request.body.endsWith("&")) { + request.body = request.body.slice(-1); + } + return request; + } + async deserializeResponse(operationSchema, context, response) { + const deserializer = this.deserializer; + const ns = schema.NormalizedSchema.of(operationSchema.output); + const dataObject = {}; + if (response.statusCode >= 300) { + const bytes = await protocols.collectBody(response.body, context); + if (bytes.byteLength > 0) { + Object.assign(dataObject, await deserializer.read(15, bytes)); + } + await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); + } + for (const header in response.headers) { + const value = response.headers[header]; + delete response.headers[header]; + response.headers[header.toLowerCase()] = value; + } + const shortName = operationSchema.name.split("#")[1] ?? operationSchema.name; + const awsQueryResultKey = ns.isStructSchema() && this.useNestedResult() ? shortName + "Result" : undefined; + const bytes = await protocols.collectBody(response.body, context); + if (bytes.byteLength > 0) { + Object.assign(dataObject, await deserializer.read(ns, bytes, awsQueryResultKey)); + } + const output = { + $metadata: this.deserializeMetadata(response), + ...dataObject, + }; + return output; + } + useNestedResult() { + return true; + } + async handleError(operationSchema, context, response, dataObject, metadata) { + const errorIdentifier = this.loadQueryErrorCode(response, dataObject) ?? "Unknown"; + const errorData = this.loadQueryError(dataObject); + const message = this.loadQueryErrorMessage(dataObject); + errorData.message = message; + errorData.Error = { + Type: errorData.Type, + Code: errorData.Code, + Message: message, + }; + const { errorSchema, errorMetadata } = await this.mixin.getErrorSchemaOrThrowBaseException(errorIdentifier, this.options.defaultNamespace, response, errorData, metadata, (registry, errorName) => registry.find((schema$1) => schema.NormalizedSchema.of(schema$1).getMergedTraits().awsQueryError?.[0] === errorName)); + const ns = schema.NormalizedSchema.of(errorSchema); + const ErrorCtor = schema.TypeRegistry.for(errorSchema[1]).getErrorCtor(errorSchema) ?? Error; + const exception = new ErrorCtor(message); + const output = { + Error: errorData.Error, + }; + for (const [name, member] of ns.structIterator()) { + const target = member.getMergedTraits().xmlName ?? name; + const value = errorData[target] ?? dataObject[target]; + output[name] = this.deserializer.readSchema(member, value); + } + throw Object.assign(exception, errorMetadata, { + $fault: ns.getMergedTraits().error, + message, + }, output); + } + loadQueryErrorCode(output, data) { + const code = (data.Errors?.[0]?.Error ?? data.Errors?.Error ?? data.Error)?.Code; + if (code !== undefined) { + return code; + } + if (output.statusCode == 404) { + return "NotFound"; + } + } + loadQueryError(data) { + return data.Errors?.[0]?.Error ?? data.Errors?.Error ?? data.Error; + } + loadQueryErrorMessage(data) { + const errorData = this.loadQueryError(data); + return errorData?.message ?? errorData?.Message ?? data.message ?? data.Message ?? "Unknown"; + } + getDefaultContentType() { + return "application/x-www-form-urlencoded"; + } +} -/***/ }), +class AwsEc2QueryProtocol extends AwsQueryProtocol { + options; + constructor(options) { + super(options); + this.options = options; + const ec2Settings = { + capitalizeKeys: true, + flattenLists: true, + serializeEmptyLists: false, + }; + Object.assign(this.serializer.settings, ec2Settings); + } + useNestedResult() { + return false; + } +} -/***/ 8704: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +const parseXmlBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + let parsedObj; + try { + parsedObj = xmlBuilder.parseXML(encoded); + } + catch (e) { + if (e && typeof e === "object") { + Object.defineProperty(e, "$responseBodyText", { + value: encoded, + }); + } + throw e; + } + const textNodeName = "#text"; + const key = Object.keys(parsedObj)[0]; + const parsedObjToReturn = parsedObj[key]; + if (parsedObjToReturn[textNodeName]) { + parsedObjToReturn[key] = parsedObjToReturn[textNodeName]; + delete parsedObjToReturn[textNodeName]; + } + return smithyClient.getValueFromTextNode(parsedObjToReturn); + } + return {}; +}); +const parseXmlErrorBody = async (errorBody, context) => { + const value = await parseXmlBody(errorBody, context); + if (value.Error) { + value.Error.message = value.Error.message ?? value.Error.Message; + } + return value; +}; +const loadRestXmlErrorCode = (output, data) => { + if (data?.Error?.Code !== undefined) { + return data.Error.Code; + } + if (data?.Code !== undefined) { + return data.Code; + } + if (output.statusCode == 404) { + return "NotFound"; + } +}; -"use strict"; +class XmlShapeSerializer extends SerdeContextConfig { + settings; + stringBuffer; + byteBuffer; + buffer; + constructor(settings) { + super(); + this.settings = settings; + } + write(schema$1, value) { + const ns = schema.NormalizedSchema.of(schema$1); + if (ns.isStringSchema() && typeof value === "string") { + this.stringBuffer = value; + } + else if (ns.isBlobSchema()) { + this.byteBuffer = + "byteLength" in value + ? value + : (this.serdeContext?.base64Decoder ?? utilBase64.fromBase64)(value); + } + else { + this.buffer = this.writeStruct(ns, value, undefined); + const traits = ns.getMergedTraits(); + if (traits.httpPayload && !traits.xmlName) { + this.buffer.withName(ns.getName()); + } + } + } + flush() { + if (this.byteBuffer !== undefined) { + const bytes = this.byteBuffer; + delete this.byteBuffer; + return bytes; + } + if (this.stringBuffer !== undefined) { + const str = this.stringBuffer; + delete this.stringBuffer; + return str; + } + const buffer = this.buffer; + if (this.settings.xmlNamespace) { + if (!buffer?.attributes?.["xmlns"]) { + buffer.addAttribute("xmlns", this.settings.xmlNamespace); + } + } + delete this.buffer; + return buffer.toString(); + } + writeStruct(ns, value, parentXmlns) { + const traits = ns.getMergedTraits(); + const name = ns.isMemberSchema() && !traits.httpPayload + ? ns.getMemberTraits().xmlName ?? ns.getMemberName() + : traits.xmlName ?? ns.getName(); + if (!name || !ns.isStructSchema()) { + throw new Error(`@aws-sdk/core/protocols - xml serializer, cannot write struct with empty name or non-struct, schema=${ns.getName(true)}.`); + } + const structXmlNode = xmlBuilder.XmlNode.of(name); + const [xmlnsAttr, xmlns] = this.getXmlnsAttribute(ns, parentXmlns); + for (const [memberName, memberSchema] of ns.structIterator()) { + const val = value[memberName]; + if (val != null || memberSchema.isIdempotencyToken()) { + if (memberSchema.getMergedTraits().xmlAttribute) { + structXmlNode.addAttribute(memberSchema.getMergedTraits().xmlName ?? memberName, this.writeSimple(memberSchema, val)); + continue; + } + if (memberSchema.isListSchema()) { + this.writeList(memberSchema, val, structXmlNode, xmlns); + } + else if (memberSchema.isMapSchema()) { + this.writeMap(memberSchema, val, structXmlNode, xmlns); + } + else if (memberSchema.isStructSchema()) { + structXmlNode.addChildNode(this.writeStruct(memberSchema, val, xmlns)); + } + else { + const memberNode = xmlBuilder.XmlNode.of(memberSchema.getMergedTraits().xmlName ?? memberSchema.getMemberName()); + this.writeSimpleInto(memberSchema, val, memberNode, xmlns); + structXmlNode.addChildNode(memberNode); + } + } + } + if (xmlns) { + structXmlNode.addAttribute(xmlnsAttr, xmlns); + } + return structXmlNode; + } + writeList(listMember, array, container, parentXmlns) { + if (!listMember.isMemberSchema()) { + throw new Error(`@aws-sdk/core/protocols - xml serializer, cannot write non-member list: ${listMember.getName(true)}`); + } + const listTraits = listMember.getMergedTraits(); + const listValueSchema = listMember.getValueSchema(); + const listValueTraits = listValueSchema.getMergedTraits(); + const sparse = !!listValueTraits.sparse; + const flat = !!listTraits.xmlFlattened; + const [xmlnsAttr, xmlns] = this.getXmlnsAttribute(listMember, parentXmlns); + const writeItem = (container, value) => { + if (listValueSchema.isListSchema()) { + this.writeList(listValueSchema, Array.isArray(value) ? value : [value], container, xmlns); + } + else if (listValueSchema.isMapSchema()) { + this.writeMap(listValueSchema, value, container, xmlns); + } + else if (listValueSchema.isStructSchema()) { + const struct = this.writeStruct(listValueSchema, value, xmlns); + container.addChildNode(struct.withName(flat ? listTraits.xmlName ?? listMember.getMemberName() : listValueTraits.xmlName ?? "member")); + } + else { + const listItemNode = xmlBuilder.XmlNode.of(flat ? listTraits.xmlName ?? listMember.getMemberName() : listValueTraits.xmlName ?? "member"); + this.writeSimpleInto(listValueSchema, value, listItemNode, xmlns); + container.addChildNode(listItemNode); + } + }; + if (flat) { + for (const value of array) { + if (sparse || value != null) { + writeItem(container, value); + } + } + } + else { + const listNode = xmlBuilder.XmlNode.of(listTraits.xmlName ?? listMember.getMemberName()); + if (xmlns) { + listNode.addAttribute(xmlnsAttr, xmlns); + } + for (const value of array) { + if (sparse || value != null) { + writeItem(listNode, value); + } + } + container.addChildNode(listNode); + } + } + writeMap(mapMember, map, container, parentXmlns, containerIsMap = false) { + if (!mapMember.isMemberSchema()) { + throw new Error(`@aws-sdk/core/protocols - xml serializer, cannot write non-member map: ${mapMember.getName(true)}`); + } + const mapTraits = mapMember.getMergedTraits(); + const mapKeySchema = mapMember.getKeySchema(); + const mapKeyTraits = mapKeySchema.getMergedTraits(); + const keyTag = mapKeyTraits.xmlName ?? "key"; + const mapValueSchema = mapMember.getValueSchema(); + const mapValueTraits = mapValueSchema.getMergedTraits(); + const valueTag = mapValueTraits.xmlName ?? "value"; + const sparse = !!mapValueTraits.sparse; + const flat = !!mapTraits.xmlFlattened; + const [xmlnsAttr, xmlns] = this.getXmlnsAttribute(mapMember, parentXmlns); + const addKeyValue = (entry, key, val) => { + const keyNode = xmlBuilder.XmlNode.of(keyTag, key); + const [keyXmlnsAttr, keyXmlns] = this.getXmlnsAttribute(mapKeySchema, xmlns); + if (keyXmlns) { + keyNode.addAttribute(keyXmlnsAttr, keyXmlns); + } + entry.addChildNode(keyNode); + let valueNode = xmlBuilder.XmlNode.of(valueTag); + if (mapValueSchema.isListSchema()) { + this.writeList(mapValueSchema, val, valueNode, xmlns); + } + else if (mapValueSchema.isMapSchema()) { + this.writeMap(mapValueSchema, val, valueNode, xmlns, true); + } + else if (mapValueSchema.isStructSchema()) { + valueNode = this.writeStruct(mapValueSchema, val, xmlns); + } + else { + this.writeSimpleInto(mapValueSchema, val, valueNode, xmlns); + } + entry.addChildNode(valueNode); + }; + if (flat) { + for (const [key, val] of Object.entries(map)) { + if (sparse || val != null) { + const entry = xmlBuilder.XmlNode.of(mapTraits.xmlName ?? mapMember.getMemberName()); + addKeyValue(entry, key, val); + container.addChildNode(entry); + } + } + } + else { + let mapNode; + if (!containerIsMap) { + mapNode = xmlBuilder.XmlNode.of(mapTraits.xmlName ?? mapMember.getMemberName()); + if (xmlns) { + mapNode.addAttribute(xmlnsAttr, xmlns); + } + container.addChildNode(mapNode); + } + for (const [key, val] of Object.entries(map)) { + if (sparse || val != null) { + const entry = xmlBuilder.XmlNode.of("entry"); + addKeyValue(entry, key, val); + (containerIsMap ? container : mapNode).addChildNode(entry); + } + } + } + } + writeSimple(_schema, value) { + if (null === value) { + throw new Error("@aws-sdk/core/protocols - (XML serializer) cannot write null value."); + } + const ns = schema.NormalizedSchema.of(_schema); + let nodeContents = null; + if (value && typeof value === "object") { + if (ns.isBlobSchema()) { + nodeContents = (this.serdeContext?.base64Encoder ?? utilBase64.toBase64)(value); + } + else if (ns.isTimestampSchema() && value instanceof Date) { + const format = protocols.determineTimestampFormat(ns, this.settings); + switch (format) { + case 5: + nodeContents = value.toISOString().replace(".000Z", "Z"); + break; + case 6: + nodeContents = smithyClient.dateToUtcString(value); + break; + case 7: + nodeContents = String(value.getTime() / 1000); + break; + default: + console.warn("Missing timestamp format, using http date", value); + nodeContents = smithyClient.dateToUtcString(value); + break; + } + } + else if (ns.isBigDecimalSchema() && value) { + if (value instanceof serde.NumericValue) { + return value.string; + } + return String(value); + } + else if (ns.isMapSchema() || ns.isListSchema()) { + throw new Error("@aws-sdk/core/protocols - xml serializer, cannot call _write() on List/Map schema, call writeList or writeMap() instead."); + } + else { + throw new Error(`@aws-sdk/core/protocols - xml serializer, unhandled schema type for object value and schema: ${ns.getName(true)}`); + } + } + if (ns.isBooleanSchema() || ns.isNumericSchema() || ns.isBigIntegerSchema() || ns.isBigDecimalSchema()) { + nodeContents = String(value); + } + if (ns.isStringSchema()) { + if (value === undefined && ns.isIdempotencyToken()) { + nodeContents = serde.generateIdempotencyToken(); + } + else { + nodeContents = String(value); + } + } + if (nodeContents === null) { + throw new Error(`Unhandled schema-value pair ${ns.getName(true)}=${value}`); + } + return nodeContents; + } + writeSimpleInto(_schema, value, into, parentXmlns) { + const nodeContents = this.writeSimple(_schema, value); + const ns = schema.NormalizedSchema.of(_schema); + const content = new xmlBuilder.XmlText(nodeContents); + const [xmlnsAttr, xmlns] = this.getXmlnsAttribute(ns, parentXmlns); + if (xmlns) { + into.addAttribute(xmlnsAttr, xmlns); + } + into.addChildNode(content); + } + getXmlnsAttribute(ns, parentXmlns) { + const traits = ns.getMergedTraits(); + const [prefix, xmlns] = traits.xmlNamespace ?? []; + if (xmlns && xmlns !== parentXmlns) { + return [prefix ? `xmlns:${prefix}` : "xmlns", xmlns]; + } + return [void 0, void 0]; + } +} -Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(1860); -tslib_1.__exportStar(__nccwpck_require__(5152), exports); -tslib_1.__exportStar(__nccwpck_require__(7523), exports); -tslib_1.__exportStar(__nccwpck_require__(7288), exports); +class XmlCodec extends SerdeContextConfig { + settings; + constructor(settings) { + super(); + this.settings = settings; + } + createSerializer() { + const serializer = new XmlShapeSerializer(this.settings); + serializer.setSerdeContext(this.serdeContext); + return serializer; + } + createDeserializer() { + const deserializer = new XmlShapeDeserializer(this.settings); + deserializer.setSerdeContext(this.serdeContext); + return deserializer; + } +} + +class AwsRestXmlProtocol extends protocols.HttpBindingProtocol { + codec; + serializer; + deserializer; + mixin = new ProtocolLib(); + constructor(options) { + super(options); + const settings = { + timestampFormat: { + useTrait: true, + default: 5, + }, + httpBindings: true, + xmlNamespace: options.xmlNamespace, + serviceNamespace: options.defaultNamespace, + }; + this.codec = new XmlCodec(settings); + this.serializer = new protocols.HttpInterceptingShapeSerializer(this.codec.createSerializer(), settings); + this.deserializer = new protocols.HttpInterceptingShapeDeserializer(this.codec.createDeserializer(), settings); + } + getPayloadCodec() { + return this.codec; + } + getShapeId() { + return "aws.protocols#restXml"; + } + async serializeRequest(operationSchema, input, context) { + const request = await super.serializeRequest(operationSchema, input, context); + const inputSchema = schema.NormalizedSchema.of(operationSchema.input); + if (!request.headers["content-type"]) { + const contentType = this.mixin.resolveRestContentType(this.getDefaultContentType(), inputSchema); + if (contentType) { + request.headers["content-type"] = contentType; + } + } + if (request.headers["content-type"] === this.getDefaultContentType()) { + if (typeof request.body === "string") { + request.body = '' + request.body; + } + } + return request; + } + async deserializeResponse(operationSchema, context, response) { + return super.deserializeResponse(operationSchema, context, response); + } + async handleError(operationSchema, context, response, dataObject, metadata) { + const errorIdentifier = loadRestXmlErrorCode(response, dataObject) ?? "Unknown"; + const { errorSchema, errorMetadata } = await this.mixin.getErrorSchemaOrThrowBaseException(errorIdentifier, this.options.defaultNamespace, response, dataObject, metadata); + const ns = schema.NormalizedSchema.of(errorSchema); + const message = dataObject.Error?.message ?? dataObject.Error?.Message ?? dataObject.message ?? dataObject.Message ?? "Unknown"; + const ErrorCtor = schema.TypeRegistry.for(errorSchema[1]).getErrorCtor(errorSchema) ?? Error; + const exception = new ErrorCtor(message); + await this.deserializeHttpMessage(errorSchema, context, response, dataObject); + const output = {}; + for (const [name, member] of ns.structIterator()) { + const target = member.getMergedTraits().xmlName ?? name; + const value = dataObject.Error?.[target] ?? dataObject[target]; + output[name] = this.codec.createDeserializer().readSchema(member, value); + } + throw Object.assign(exception, errorMetadata, { + $fault: ns.getMergedTraits().error, + message, + }, output); + } + getDefaultContentType() { + return "application/xml"; + } +} + +exports.AWSSDKSigV4Signer = AWSSDKSigV4Signer; +exports.AwsEc2QueryProtocol = AwsEc2QueryProtocol; +exports.AwsJson1_0Protocol = AwsJson1_0Protocol; +exports.AwsJson1_1Protocol = AwsJson1_1Protocol; +exports.AwsJsonRpcProtocol = AwsJsonRpcProtocol; +exports.AwsQueryProtocol = AwsQueryProtocol; +exports.AwsRestJsonProtocol = AwsRestJsonProtocol; +exports.AwsRestXmlProtocol = AwsRestXmlProtocol; +exports.AwsSdkSigV4ASigner = AwsSdkSigV4ASigner; +exports.AwsSdkSigV4Signer = AwsSdkSigV4Signer; +exports.AwsSmithyRpcV2CborProtocol = AwsSmithyRpcV2CborProtocol; +exports.JsonCodec = JsonCodec; +exports.JsonShapeDeserializer = JsonShapeDeserializer; +exports.JsonShapeSerializer = JsonShapeSerializer; +exports.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS = NODE_AUTH_SCHEME_PREFERENCE_OPTIONS; +exports.NODE_SIGV4A_CONFIG_OPTIONS = NODE_SIGV4A_CONFIG_OPTIONS; +exports.XmlCodec = XmlCodec; +exports.XmlShapeDeserializer = XmlShapeDeserializer; +exports.XmlShapeSerializer = XmlShapeSerializer; +exports._toBool = _toBool; +exports._toNum = _toNum; +exports._toStr = _toStr; +exports.awsExpectUnion = awsExpectUnion; +exports.emitWarningIfUnsupportedVersion = emitWarningIfUnsupportedVersion; +exports.getBearerTokenEnvKey = getBearerTokenEnvKey; +exports.loadRestJsonErrorCode = loadRestJsonErrorCode; +exports.loadRestXmlErrorCode = loadRestXmlErrorCode; +exports.parseJsonBody = parseJsonBody; +exports.parseJsonErrorBody = parseJsonErrorBody; +exports.parseXmlBody = parseXmlBody; +exports.parseXmlErrorBody = parseXmlErrorBody; +exports.resolveAWSSDKSigV4Config = resolveAWSSDKSigV4Config; +exports.resolveAwsSdkSigV4AConfig = resolveAwsSdkSigV4AConfig; +exports.resolveAwsSdkSigV4Config = resolveAwsSdkSigV4Config; +exports.setCredentialFeature = setCredentialFeature; +exports.setFeature = setFeature; +exports.setTokenFeature = setTokenFeature; +exports.state = state; +exports.validateSigningProperties = validateSigningProperties; /***/ }), /***/ 5152: -/***/ ((module) => { +/***/ ((__unused_webpack_module, exports) => { "use strict"; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/submodules/client/index.ts -var index_exports = {}; -__export(index_exports, { - emitWarningIfUnsupportedVersion: () => emitWarningIfUnsupportedVersion, - setCredentialFeature: () => setCredentialFeature, - setFeature: () => setFeature, - setTokenFeature: () => setTokenFeature, - state: () => state -}); -module.exports = __toCommonJS(index_exports); -// src/submodules/client/emitWarningIfUnsupportedVersion.ts -var state = { - warningEmitted: false +const state = { + warningEmitted: false, }; -var emitWarningIfUnsupportedVersion = /* @__PURE__ */ __name((version) => { - if (version && !state.warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 18) { - state.warningEmitted = true; - process.emitWarning( - `NodeDeprecationWarning: The AWS SDK for JavaScript (v3) will +const emitWarningIfUnsupportedVersion = (version) => { + if (version && !state.warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 18) { + state.warningEmitted = true; + process.emitWarning(`NodeDeprecationWarning: The AWS SDK for JavaScript (v3) will no longer support Node.js 16.x on January 6, 2025. To continue receiving updates to AWS services, bug fixes, and security updates please upgrade to a supported Node.js LTS version. -More information can be found at: https://a.co/74kJMmI` - ); - } -}, "emitWarningIfUnsupportedVersion"); +More information can be found at: https://a.co/74kJMmI`); + } +}; -// src/submodules/client/setCredentialFeature.ts function setCredentialFeature(credentials, feature, value) { - if (!credentials.$source) { - credentials.$source = {}; - } - credentials.$source[feature] = value; - return credentials; + if (!credentials.$source) { + credentials.$source = {}; + } + credentials.$source[feature] = value; + return credentials; } -__name(setCredentialFeature, "setCredentialFeature"); -// src/submodules/client/setFeature.ts function setFeature(context, feature, value) { - if (!context.__aws_sdk_context) { - context.__aws_sdk_context = { - features: {} - }; - } else if (!context.__aws_sdk_context.features) { - context.__aws_sdk_context.features = {}; - } - context.__aws_sdk_context.features[feature] = value; + if (!context.__aws_sdk_context) { + context.__aws_sdk_context = { + features: {}, + }; + } + else if (!context.__aws_sdk_context.features) { + context.__aws_sdk_context.features = {}; + } + context.__aws_sdk_context.features[feature] = value; } -__name(setFeature, "setFeature"); -// src/submodules/client/setTokenFeature.ts function setTokenFeature(token, feature, value) { - if (!token.$source) { - token.$source = {}; - } - token.$source[feature] = value; - return token; + if (!token.$source) { + token.$source = {}; + } + token.$source[feature] = value; + return token; } -__name(setTokenFeature, "setTokenFeature"); -// Annotate the CommonJS export names for ESM import in node: -0 && (0); + +exports.emitWarningIfUnsupportedVersion = emitWarningIfUnsupportedVersion; +exports.setCredentialFeature = setCredentialFeature; +exports.setFeature = setFeature; +exports.setTokenFeature = setTokenFeature; +exports.state = state; /***/ }), -/***/ 7523: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 5606: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; + +var client = __nccwpck_require__(5152); +var propertyProvider = __nccwpck_require__(1238); + +const ENV_KEY = "AWS_ACCESS_KEY_ID"; +const ENV_SECRET = "AWS_SECRET_ACCESS_KEY"; +const ENV_SESSION = "AWS_SESSION_TOKEN"; +const ENV_EXPIRATION = "AWS_CREDENTIAL_EXPIRATION"; +const ENV_CREDENTIAL_SCOPE = "AWS_CREDENTIAL_SCOPE"; +const ENV_ACCOUNT_ID = "AWS_ACCOUNT_ID"; +const fromEnv = (init) => async () => { + init?.logger?.debug("@aws-sdk/credential-provider-env - fromEnv"); + const accessKeyId = process.env[ENV_KEY]; + const secretAccessKey = process.env[ENV_SECRET]; + const sessionToken = process.env[ENV_SESSION]; + const expiry = process.env[ENV_EXPIRATION]; + const credentialScope = process.env[ENV_CREDENTIAL_SCOPE]; + const accountId = process.env[ENV_ACCOUNT_ID]; + if (accessKeyId && secretAccessKey) { + const credentials = { + accessKeyId, + secretAccessKey, + ...(sessionToken && { sessionToken }), + ...(expiry && { expiration: new Date(expiry) }), + ...(credentialScope && { credentialScope }), + ...(accountId && { accountId }), + }; + client.setCredentialFeature(credentials, "CREDENTIALS_ENV_VARS", "g"); + return credentials; + } + throw new propertyProvider.CredentialsProviderError("Unable to find environment variable credentials.", { logger: init?.logger }); }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/submodules/httpAuthSchemes/index.ts -var index_exports = {}; -__export(index_exports, { - AWSSDKSigV4Signer: () => AWSSDKSigV4Signer, - AwsSdkSigV4ASigner: () => AwsSdkSigV4ASigner, - AwsSdkSigV4Signer: () => AwsSdkSigV4Signer, - NODE_AUTH_SCHEME_PREFERENCE_OPTIONS: () => NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, - NODE_SIGV4A_CONFIG_OPTIONS: () => NODE_SIGV4A_CONFIG_OPTIONS, - getBearerTokenEnvKey: () => getBearerTokenEnvKey, - resolveAWSSDKSigV4Config: () => resolveAWSSDKSigV4Config, - resolveAwsSdkSigV4AConfig: () => resolveAwsSdkSigV4AConfig, - resolveAwsSdkSigV4Config: () => resolveAwsSdkSigV4Config, - validateSigningProperties: () => validateSigningProperties -}); -module.exports = __toCommonJS(index_exports); +exports.ENV_ACCOUNT_ID = ENV_ACCOUNT_ID; +exports.ENV_CREDENTIAL_SCOPE = ENV_CREDENTIAL_SCOPE; +exports.ENV_EXPIRATION = ENV_EXPIRATION; +exports.ENV_KEY = ENV_KEY; +exports.ENV_SECRET = ENV_SECRET; +exports.ENV_SESSION = ENV_SESSION; +exports.fromEnv = fromEnv; -// src/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4Signer.ts -var import_protocol_http2 = __nccwpck_require__(2356); -// src/submodules/httpAuthSchemes/utils/getDateHeader.ts -var import_protocol_http = __nccwpck_require__(2356); -var getDateHeader = /* @__PURE__ */ __name((response) => import_protocol_http.HttpResponse.isInstance(response) ? response.headers?.date ?? response.headers?.Date : void 0, "getDateHeader"); +/***/ }), + +/***/ 5861: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -// src/submodules/httpAuthSchemes/utils/getSkewCorrectedDate.ts -var getSkewCorrectedDate = /* @__PURE__ */ __name((systemClockOffset) => new Date(Date.now() + systemClockOffset), "getSkewCorrectedDate"); +"use strict"; -// src/submodules/httpAuthSchemes/utils/isClockSkewed.ts -var isClockSkewed = /* @__PURE__ */ __name((clockTime, systemClockOffset) => Math.abs(getSkewCorrectedDate(systemClockOffset).getTime() - clockTime) >= 3e5, "isClockSkewed"); -// src/submodules/httpAuthSchemes/utils/getUpdatedSystemClockOffset.ts -var getUpdatedSystemClockOffset = /* @__PURE__ */ __name((clockTime, currentSystemClockOffset) => { - const clockTimeInMs = Date.parse(clockTime); - if (isClockSkewed(clockTimeInMs, currentSystemClockOffset)) { - return clockTimeInMs - Date.now(); - } - return currentSystemClockOffset; -}, "getUpdatedSystemClockOffset"); +var credentialProviderEnv = __nccwpck_require__(5606); +var propertyProvider = __nccwpck_require__(1238); +var sharedIniFileLoader = __nccwpck_require__(4964); -// src/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4Signer.ts -var throwSigningPropertyError = /* @__PURE__ */ __name((name, property) => { - if (!property) { - throw new Error(`Property \`${name}\` is not resolved for AWS SDK SigV4Auth`); - } - return property; -}, "throwSigningPropertyError"); -var validateSigningProperties = /* @__PURE__ */ __name(async (signingProperties) => { - const context = throwSigningPropertyError( - "context", - signingProperties.context - ); - const config = throwSigningPropertyError("config", signingProperties.config); - const authScheme = context.endpointV2?.properties?.authSchemes?.[0]; - const signerFunction = throwSigningPropertyError( - "signer", - config.signer - ); - const signer = await signerFunction(authScheme); - const signingRegion = signingProperties?.signingRegion; - const signingRegionSet = signingProperties?.signingRegionSet; - const signingName = signingProperties?.signingName; - return { - config, - signer, - signingRegion, - signingRegionSet, - signingName - }; -}, "validateSigningProperties"); -var AwsSdkSigV4Signer = class { - static { - __name(this, "AwsSdkSigV4Signer"); - } - async sign(httpRequest, identity, signingProperties) { - if (!import_protocol_http2.HttpRequest.isInstance(httpRequest)) { - throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); - } - const validatedProps = await validateSigningProperties(signingProperties); - const { config, signer } = validatedProps; - let { signingRegion, signingName } = validatedProps; - const handlerExecutionContext = signingProperties.context; - if (handlerExecutionContext?.authSchemes?.length ?? 0 > 1) { - const [first, second] = handlerExecutionContext.authSchemes; - if (first?.name === "sigv4a" && second?.name === "sigv4") { - signingRegion = second?.signingRegion ?? signingRegion; - signingName = second?.signingName ?? signingName; - } - } - const signedRequest = await signer.sign(httpRequest, { - signingDate: getSkewCorrectedDate(config.systemClockOffset), - signingRegion, - signingService: signingName - }); - return signedRequest; - } - errorHandler(signingProperties) { - return (error) => { - const serverTime = error.ServerTime ?? getDateHeader(error.$response); - if (serverTime) { - const config = throwSigningPropertyError("config", signingProperties.config); - const initialSystemClockOffset = config.systemClockOffset; - config.systemClockOffset = getUpdatedSystemClockOffset(serverTime, config.systemClockOffset); - const clockSkewCorrected = config.systemClockOffset !== initialSystemClockOffset; - if (clockSkewCorrected && error.$metadata) { - error.$metadata.clockSkewCorrected = true; - } - } - throw error; - }; - } - successHandler(httpResponse, signingProperties) { - const dateHeader = getDateHeader(httpResponse); - if (dateHeader) { - const config = throwSigningPropertyError("config", signingProperties.config); - config.systemClockOffset = getUpdatedSystemClockOffset(dateHeader, config.systemClockOffset); +const ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; +const remoteProvider = async (init) => { + const { ENV_CMDS_FULL_URI, ENV_CMDS_RELATIVE_URI, fromContainerMetadata, fromInstanceMetadata } = await __nccwpck_require__.e(/* import() */ 566).then(__nccwpck_require__.t.bind(__nccwpck_require__, 566, 19)); + if (process.env[ENV_CMDS_RELATIVE_URI] || process.env[ENV_CMDS_FULL_URI]) { + init.logger?.debug("@aws-sdk/credential-provider-node - remoteProvider::fromHttp/fromContainerMetadata"); + const { fromHttp } = await __nccwpck_require__.e(/* import() */ 605).then(__nccwpck_require__.bind(__nccwpck_require__, 8605)); + return propertyProvider.chain(fromHttp(init), fromContainerMetadata(init)); } - } + if (process.env[ENV_IMDS_DISABLED] && process.env[ENV_IMDS_DISABLED] !== "false") { + return async () => { + throw new propertyProvider.CredentialsProviderError("EC2 Instance Metadata Service access disabled", { logger: init.logger }); + }; + } + init.logger?.debug("@aws-sdk/credential-provider-node - remoteProvider::fromInstanceMetadata"); + return fromInstanceMetadata(init); }; -var AWSSDKSigV4Signer = AwsSdkSigV4Signer; -// src/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4ASigner.ts -var import_protocol_http3 = __nccwpck_require__(2356); -var AwsSdkSigV4ASigner = class extends AwsSdkSigV4Signer { - static { - __name(this, "AwsSdkSigV4ASigner"); - } - async sign(httpRequest, identity, signingProperties) { - if (!import_protocol_http3.HttpRequest.isInstance(httpRequest)) { - throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); +function memoizeChain(providers, treatAsExpired) { + const chain = internalCreateChain(providers); + let activeLock; + let passiveLock; + let credentials; + const provider = async (options) => { + if (options?.forceRefresh) { + return await chain(options); + } + if (credentials?.expiration) { + if (credentials?.expiration?.getTime() < Date.now()) { + credentials = undefined; + } + } + if (activeLock) { + await activeLock; + } + else if (!credentials || treatAsExpired?.(credentials)) { + if (credentials) { + if (!passiveLock) { + passiveLock = chain(options).then((c) => { + credentials = c; + passiveLock = undefined; + }); + } + } + else { + activeLock = chain(options).then((c) => { + credentials = c; + activeLock = undefined; + }); + return provider(options); + } + } + return credentials; + }; + return provider; +} +const internalCreateChain = (providers) => async (awsIdentityProperties) => { + let lastProviderError; + for (const provider of providers) { + try { + return await provider(awsIdentityProperties); + } + catch (err) { + lastProviderError = err; + if (err?.tryNextLink) { + continue; + } + throw err; + } } - const { config, signer, signingRegion, signingRegionSet, signingName } = await validateSigningProperties( - signingProperties - ); - const configResolvedSigningRegionSet = await config.sigv4aSigningRegionSet?.(); - const multiRegionOverride = (configResolvedSigningRegionSet ?? signingRegionSet ?? [signingRegion]).join(","); - const signedRequest = await signer.sign(httpRequest, { - signingDate: getSkewCorrectedDate(config.systemClockOffset), - signingRegion: multiRegionOverride, - signingService: signingName - }); - return signedRequest; - } + throw lastProviderError; }; -// src/submodules/httpAuthSchemes/utils/getArrayForCommaSeparatedString.ts -var getArrayForCommaSeparatedString = /* @__PURE__ */ __name((str) => typeof str === "string" && str.length > 0 ? str.split(",").map((item) => item.trim()) : [], "getArrayForCommaSeparatedString"); - -// src/submodules/httpAuthSchemes/utils/getBearerTokenEnvKey.ts -var getBearerTokenEnvKey = /* @__PURE__ */ __name((signingName) => `AWS_BEARER_TOKEN_${signingName.replace(/[\s-]/g, "_").toUpperCase()}`, "getBearerTokenEnvKey"); - -// src/submodules/httpAuthSchemes/aws_sdk/NODE_AUTH_SCHEME_PREFERENCE_OPTIONS.ts -var NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY = "AWS_AUTH_SCHEME_PREFERENCE"; -var NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY = "auth_scheme_preference"; -var NODE_AUTH_SCHEME_PREFERENCE_OPTIONS = { - /** - * Retrieves auth scheme preference from environment variables - * @param env - Node process environment object - * @returns Array of auth scheme strings if preference is set, undefined otherwise - */ - environmentVariableSelector: /* @__PURE__ */ __name((env, options) => { - if (options?.signingName) { - const bearerTokenKey = getBearerTokenEnvKey(options.signingName); - if (bearerTokenKey in env) return ["httpBearerAuth"]; - } - if (!(NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY in env)) return void 0; - return getArrayForCommaSeparatedString(env[NODE_AUTH_SCHEME_PREFERENCE_ENV_KEY]); - }, "environmentVariableSelector"), - /** - * Retrieves auth scheme preference from config file - * @param profile - Config profile object - * @returns Array of auth scheme strings if preference is set, undefined otherwise - */ - configFileSelector: /* @__PURE__ */ __name((profile) => { - if (!(NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY in profile)) return void 0; - return getArrayForCommaSeparatedString(profile[NODE_AUTH_SCHEME_PREFERENCE_CONFIG_KEY]); - }, "configFileSelector"), - /** - * Default auth scheme preference if not specified in environment or config - */ - default: [] -}; - -// src/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4AConfig.ts -var import_core = __nccwpck_require__(402); -var import_property_provider = __nccwpck_require__(1238); -var resolveAwsSdkSigV4AConfig = /* @__PURE__ */ __name((config) => { - config.sigv4aSigningRegionSet = (0, import_core.normalizeProvider)(config.sigv4aSigningRegionSet); - return config; -}, "resolveAwsSdkSigV4AConfig"); -var NODE_SIGV4A_CONFIG_OPTIONS = { - environmentVariableSelector(env) { - if (env.AWS_SIGV4A_SIGNING_REGION_SET) { - return env.AWS_SIGV4A_SIGNING_REGION_SET.split(",").map((_) => _.trim()); - } - throw new import_property_provider.ProviderError("AWS_SIGV4A_SIGNING_REGION_SET not set in env.", { - tryNextLink: true - }); - }, - configFileSelector(profile) { - if (profile.sigv4a_signing_region_set) { - return (profile.sigv4a_signing_region_set ?? "").split(",").map((_) => _.trim()); - } - throw new import_property_provider.ProviderError("sigv4a_signing_region_set not set in profile.", { - tryNextLink: true - }); - }, - default: void 0 -}; - -// src/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4Config.ts -var import_client = __nccwpck_require__(5152); -var import_core2 = __nccwpck_require__(402); -var import_signature_v4 = __nccwpck_require__(5118); -var resolveAwsSdkSigV4Config = /* @__PURE__ */ __name((config) => { - let inputCredentials = config.credentials; - let isUserSupplied = !!config.credentials; - let resolvedCredentials = void 0; - Object.defineProperty(config, "credentials", { - set(credentials) { - if (credentials && credentials !== inputCredentials && credentials !== resolvedCredentials) { - isUserSupplied = true; - } - inputCredentials = credentials; - const memoizedProvider = normalizeCredentialProvider(config, { - credentials: inputCredentials, - credentialDefaultProvider: config.credentialDefaultProvider - }); - const boundProvider = bindCallerConfig(config, memoizedProvider); - if (isUserSupplied && !boundProvider.attributed) { - resolvedCredentials = /* @__PURE__ */ __name(async (options) => boundProvider(options).then( - (creds) => (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_CODE", "e") - ), "resolvedCredentials"); - resolvedCredentials.memoized = boundProvider.memoized; - resolvedCredentials.configBound = boundProvider.configBound; - resolvedCredentials.attributed = true; - } else { - resolvedCredentials = boundProvider; - } +let multipleCredentialSourceWarningEmitted = false; +const defaultProvider = (init = {}) => memoizeChain([ + async () => { + const profile = init.profile ?? process.env[sharedIniFileLoader.ENV_PROFILE]; + if (profile) { + const envStaticCredentialsAreSet = process.env[credentialProviderEnv.ENV_KEY] && process.env[credentialProviderEnv.ENV_SECRET]; + if (envStaticCredentialsAreSet) { + if (!multipleCredentialSourceWarningEmitted) { + const warnFn = init.logger?.warn && init.logger?.constructor?.name !== "NoOpLogger" + ? init.logger.warn.bind(init.logger) + : console.warn; + warnFn(`@aws-sdk/credential-provider-node - defaultProvider::fromEnv WARNING: + Multiple credential sources detected: + Both AWS_PROFILE and the pair AWS_ACCESS_KEY_ID/AWS_SECRET_ACCESS_KEY static credentials are set. + This SDK will proceed with the AWS_PROFILE value. + + However, a future version may change this behavior to prefer the ENV static credentials. + Please ensure that your environment only sets either the AWS_PROFILE or the + AWS_ACCESS_KEY_ID/AWS_SECRET_ACCESS_KEY pair. +`); + multipleCredentialSourceWarningEmitted = true; + } + } + throw new propertyProvider.CredentialsProviderError("AWS_PROFILE is set, skipping fromEnv provider.", { + logger: init.logger, + tryNextLink: true, + }); + } + init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromEnv"); + return credentialProviderEnv.fromEnv(init)(); }, - get() { - return resolvedCredentials; + async (awsIdentityProperties) => { + init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromSSO"); + const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoSession } = init; + if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) { + throw new propertyProvider.CredentialsProviderError("Skipping SSO provider in default chain (inputs do not include SSO fields).", { logger: init.logger }); + } + const { fromSSO } = await __nccwpck_require__.e(/* import() */ 998).then(__nccwpck_require__.t.bind(__nccwpck_require__, 998, 19)); + return fromSSO(init)(awsIdentityProperties); }, - enumerable: true, - configurable: true - }); - config.credentials = inputCredentials; - const { - // Default for signingEscapePath - signingEscapePath = true, - // Default for systemClockOffset - systemClockOffset = config.systemClockOffset || 0, - // No default for sha256 since it is platform dependent - sha256 - } = config; - let signer; - if (config.signer) { - signer = (0, import_core2.normalizeProvider)(config.signer); - } else if (config.regionInfoProvider) { - signer = /* @__PURE__ */ __name(() => (0, import_core2.normalizeProvider)(config.region)().then( - async (region) => [ - await config.regionInfoProvider(region, { - useFipsEndpoint: await config.useFipsEndpoint(), - useDualstackEndpoint: await config.useDualstackEndpoint() - }) || {}, - region - ] - ).then(([regionInfo, region]) => { - const { signingRegion, signingService } = regionInfo; - config.signingRegion = config.signingRegion || signingRegion || region; - config.signingName = config.signingName || signingService || config.serviceId; - const params = { - ...config, - credentials: config.credentials, - region: config.signingRegion, - service: config.signingName, - sha256, - uriEscapePath: signingEscapePath - }; - const SignerCtor = config.signerConstructor || import_signature_v4.SignatureV4; - return new SignerCtor(params); - }), "signer"); - } else { - signer = /* @__PURE__ */ __name(async (authScheme) => { - authScheme = Object.assign( - {}, - { - name: "sigv4", - signingName: config.signingName || config.defaultSigningName, - signingRegion: await (0, import_core2.normalizeProvider)(config.region)(), - properties: {} - }, - authScheme - ); - const signingRegion = authScheme.signingRegion; - const signingService = authScheme.signingName; - config.signingRegion = config.signingRegion || signingRegion; - config.signingName = config.signingName || signingService || config.serviceId; - const params = { - ...config, - credentials: config.credentials, - region: config.signingRegion, - service: config.signingName, - sha256, - uriEscapePath: signingEscapePath - }; - const SignerCtor = config.signerConstructor || import_signature_v4.SignatureV4; - return new SignerCtor(params); - }, "signer"); - } - const resolvedConfig = Object.assign(config, { - systemClockOffset, - signingEscapePath, - signer - }); - return resolvedConfig; -}, "resolveAwsSdkSigV4Config"); -var resolveAWSSDKSigV4Config = resolveAwsSdkSigV4Config; -function normalizeCredentialProvider(config, { - credentials, - credentialDefaultProvider -}) { - let credentialsProvider; - if (credentials) { - if (!credentials?.memoized) { - credentialsProvider = (0, import_core2.memoizeIdentityProvider)(credentials, import_core2.isIdentityExpired, import_core2.doesIdentityRequireRefresh); - } else { - credentialsProvider = credentials; - } - } else { - if (credentialDefaultProvider) { - credentialsProvider = (0, import_core2.normalizeProvider)( - credentialDefaultProvider( - Object.assign({}, config, { - parentClientConfig: config - }) - ) - ); - } else { - credentialsProvider = /* @__PURE__ */ __name(async () => { - throw new Error( - "@aws-sdk/core::resolveAwsSdkSigV4Config - `credentials` not provided and no credentialDefaultProvider was configured." - ); - }, "credentialsProvider"); - } - } - credentialsProvider.memoized = true; - return credentialsProvider; -} -__name(normalizeCredentialProvider, "normalizeCredentialProvider"); -function bindCallerConfig(config, credentialsProvider) { - if (credentialsProvider.configBound) { - return credentialsProvider; - } - const fn = /* @__PURE__ */ __name(async (options) => credentialsProvider({ ...options, callerClientConfig: config }), "fn"); - fn.memoized = credentialsProvider.memoized; - fn.configBound = true; - return fn; -} -__name(bindCallerConfig, "bindCallerConfig"); -// Annotate the CommonJS export names for ESM import in node: -0 && (0); + async (awsIdentityProperties) => { + init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromIni"); + const { fromIni } = await __nccwpck_require__.e(/* import() */ 869).then(__nccwpck_require__.t.bind(__nccwpck_require__, 5869, 19)); + return fromIni(init)(awsIdentityProperties); + }, + async (awsIdentityProperties) => { + init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromProcess"); + const { fromProcess } = await __nccwpck_require__.e(/* import() */ 360).then(__nccwpck_require__.t.bind(__nccwpck_require__, 5360, 19)); + return fromProcess(init)(awsIdentityProperties); + }, + async (awsIdentityProperties) => { + init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromTokenFile"); + const { fromTokenFile } = await Promise.all(/* import() */[__nccwpck_require__.e(136), __nccwpck_require__.e(956)]).then(__nccwpck_require__.t.bind(__nccwpck_require__, 9956, 23)); + return fromTokenFile(init)(awsIdentityProperties); + }, + async () => { + init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::remoteProvider"); + return (await remoteProvider(init))(); + }, + async () => { + throw new propertyProvider.CredentialsProviderError("Could not load credentials from any providers", { + tryNextLink: false, + logger: init.logger, + }); + }, +], credentialsTreatedAsExpired); +const credentialsWillNeedRefresh = (credentials) => credentials?.expiration !== undefined; +const credentialsTreatedAsExpired = (credentials) => credentials?.expiration !== undefined && credentials.expiration.getTime() - Date.now() < 300000; + +exports.credentialsTreatedAsExpired = credentialsTreatedAsExpired; +exports.credentialsWillNeedRefresh = credentialsWillNeedRefresh; +exports.defaultProvider = defaultProvider; /***/ }), -/***/ 7288: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 2590: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); + +var protocolHttp = __nccwpck_require__(2356); + +function resolveHostHeaderConfig(input) { + return input; +} +const hostHeaderMiddleware = (options) => (next) => async (args) => { + if (!protocolHttp.HttpRequest.isInstance(args.request)) + return next(args); + const { request } = args; + const { handlerProtocol = "" } = options.requestHandler.metadata || {}; + if (handlerProtocol.indexOf("h2") >= 0 && !request.headers[":authority"]) { + delete request.headers["host"]; + request.headers[":authority"] = request.hostname + (request.port ? ":" + request.port : ""); + } + else if (!request.headers["host"]) { + let host = request.hostname; + if (request.port != null) + host += `:${request.port}`; + request.headers["host"] = host; + } + return next(args); }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; +const hostHeaderMiddlewareOptions = { + name: "hostHeaderMiddleware", + step: "build", + priority: "low", + tags: ["HOST"], + override: true, }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/submodules/protocols/index.ts -var index_exports = {}; -__export(index_exports, { - AwsEc2QueryProtocol: () => AwsEc2QueryProtocol, - AwsJson1_0Protocol: () => AwsJson1_0Protocol, - AwsJson1_1Protocol: () => AwsJson1_1Protocol, - AwsJsonRpcProtocol: () => AwsJsonRpcProtocol, - AwsQueryProtocol: () => AwsQueryProtocol, - AwsRestJsonProtocol: () => AwsRestJsonProtocol, - AwsRestXmlProtocol: () => AwsRestXmlProtocol, - AwsSmithyRpcV2CborProtocol: () => AwsSmithyRpcV2CborProtocol, - JsonCodec: () => JsonCodec, - JsonShapeDeserializer: () => JsonShapeDeserializer, - JsonShapeSerializer: () => JsonShapeSerializer, - XmlCodec: () => XmlCodec, - XmlShapeDeserializer: () => XmlShapeDeserializer, - XmlShapeSerializer: () => XmlShapeSerializer, - _toBool: () => _toBool, - _toNum: () => _toNum, - _toStr: () => _toStr, - awsExpectUnion: () => awsExpectUnion, - loadRestJsonErrorCode: () => loadRestJsonErrorCode, - loadRestXmlErrorCode: () => loadRestXmlErrorCode, - parseJsonBody: () => parseJsonBody, - parseJsonErrorBody: () => parseJsonErrorBody, - parseXmlBody: () => parseXmlBody, - parseXmlErrorBody: () => parseXmlErrorBody +const getHostHeaderPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add(hostHeaderMiddleware(options), hostHeaderMiddlewareOptions); + }, }); -module.exports = __toCommonJS(index_exports); -// src/submodules/protocols/cbor/AwsSmithyRpcV2CborProtocol.ts -var import_cbor = __nccwpck_require__(4645); -var import_schema2 = __nccwpck_require__(6890); +exports.getHostHeaderPlugin = getHostHeaderPlugin; +exports.hostHeaderMiddleware = hostHeaderMiddleware; +exports.hostHeaderMiddlewareOptions = hostHeaderMiddlewareOptions; +exports.resolveHostHeaderConfig = resolveHostHeaderConfig; -// src/submodules/protocols/ProtocolLib.ts -var import_schema = __nccwpck_require__(6890); -var import_util_body_length_browser = __nccwpck_require__(2098); -var ProtocolLib = class { - static { - __name(this, "ProtocolLib"); - } - /** - * @param body - to be inspected. - * @param serdeContext - this is a subset type but in practice is the client.config having a property called bodyLengthChecker. - * - * @returns content-length value for the body if possible. - * @throws Error and should be caught and handled if not possible to determine length. - */ - calculateContentLength(body, serdeContext) { - const bodyLengthCalculator = serdeContext?.bodyLengthChecker ?? import_util_body_length_browser.calculateBodyLength; - return String(bodyLengthCalculator(body)); - } - /** - * This is only for REST protocols. - * - * @param defaultContentType - of the protocol. - * @param inputSchema - schema for which to determine content type. - * - * @returns content-type header value or undefined when not applicable. - */ - resolveRestContentType(defaultContentType, inputSchema) { - const members = inputSchema.getMemberSchemas(); - const httpPayloadMember = Object.values(members).find((m) => { - return !!m.getMergedTraits().httpPayload; - }); - if (httpPayloadMember) { - const mediaType = httpPayloadMember.getMergedTraits().mediaType; - if (mediaType) { - return mediaType; - } else if (httpPayloadMember.isStringSchema()) { - return "text/plain"; - } else if (httpPayloadMember.isBlobSchema()) { - return "application/octet-stream"; - } else { - return defaultContentType; - } - } else if (!inputSchema.isUnitSchema()) { - const hasBody = Object.values(members).find((m) => { - const { httpQuery, httpQueryParams, httpHeader, httpLabel, httpPrefixHeaders } = m.getMergedTraits(); - const noPrefixHeaders = httpPrefixHeaders === void 0; - return !httpQuery && !httpQueryParams && !httpHeader && !httpLabel && noPrefixHeaders; - }); - if (hasBody) { - return defaultContentType; - } - } - } - /** - * Shared code for finding error schema or throwing an unmodeled base error. - * @returns error schema and error metadata. - * - * @throws ServiceBaseException or generic Error if no error schema could be found. - */ - async getErrorSchemaOrThrowBaseException(errorIdentifier, defaultNamespace, response, dataObject, metadata, getErrorSchema) { - let namespace = defaultNamespace; - let errorName = errorIdentifier; - if (errorIdentifier.includes("#")) { - [namespace, errorName] = errorIdentifier.split("#"); - } - const errorMetadata = { - $metadata: metadata, - $response: response, - $fault: response.statusCode < 500 ? "client" : "server" - }; - const registry = import_schema.TypeRegistry.for(namespace); + +/***/ }), + +/***/ 5242: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + + +const loggerMiddleware = () => (next, context) => async (args) => { try { - const errorSchema = getErrorSchema?.(registry, errorName) ?? registry.getSchema(errorIdentifier); - return { errorSchema, errorMetadata }; - } catch (e) { - if (dataObject.Message) { - dataObject.message = dataObject.Message; - } - const baseExceptionSchema = import_schema.TypeRegistry.for("smithy.ts.sdk.synthetic." + namespace).getBaseException(); - if (baseExceptionSchema) { - const ErrorCtor = baseExceptionSchema.ctor; - throw Object.assign(new ErrorCtor({ name: errorName }), errorMetadata, dataObject); - } - throw Object.assign(new Error(errorName), errorMetadata, dataObject); - } - } - /** - * Reads the x-amzn-query-error header for awsQuery compatibility. - * - * @param output - values that will be assigned to an error object. - * @param response - from which to read awsQueryError headers. - */ - setQueryCompatError(output, response) { - const queryErrorHeader = response.headers?.["x-amzn-query-error"]; - if (output !== void 0 && queryErrorHeader != null) { - const [Code, Type] = queryErrorHeader.split(";"); - const entries = Object.entries(output); - const Error2 = { - Code, - Type - }; - Object.assign(output, Error2); - for (const [k, v] of entries) { - Error2[k] = v; - } - delete Error2.__type; - output.Error = Error2; - } - } - /** - * Assigns Error, Type, Code from the awsQuery error object to the output error object. - * @param queryCompatErrorData - query compat error object. - * @param errorData - canonical error object returned to the caller. - */ - queryCompatOutput(queryCompatErrorData, errorData) { - if (queryCompatErrorData.Error) { - errorData.Error = queryCompatErrorData.Error; - } - if (queryCompatErrorData.Type) { - errorData.Type = queryCompatErrorData.Type; - } - if (queryCompatErrorData.Code) { - errorData.Code = queryCompatErrorData.Code; + const response = await next(args); + const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; + const { overrideInputFilterSensitiveLog, overrideOutputFilterSensitiveLog } = dynamoDbDocumentClientOptions; + const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog; + const outputFilterSensitiveLog = overrideOutputFilterSensitiveLog ?? context.outputFilterSensitiveLog; + const { $metadata, ...outputWithoutMetadata } = response.output; + logger?.info?.({ + clientName, + commandName, + input: inputFilterSensitiveLog(args.input), + output: outputFilterSensitiveLog(outputWithoutMetadata), + metadata: $metadata, + }); + return response; + } + catch (error) { + const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; + const { overrideInputFilterSensitiveLog } = dynamoDbDocumentClientOptions; + const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog; + logger?.error?.({ + clientName, + commandName, + input: inputFilterSensitiveLog(args.input), + error, + metadata: error.$metadata, + }); + throw error; } - } }; - -// src/submodules/protocols/cbor/AwsSmithyRpcV2CborProtocol.ts -var AwsSmithyRpcV2CborProtocol = class extends import_cbor.SmithyRpcV2CborProtocol { - static { - __name(this, "AwsSmithyRpcV2CborProtocol"); - } - awsQueryCompatible; - mixin = new ProtocolLib(); - constructor({ - defaultNamespace, - awsQueryCompatible - }) { - super({ defaultNamespace }); - this.awsQueryCompatible = !!awsQueryCompatible; - } - /** - * @override - */ - async serializeRequest(operationSchema, input, context) { - const request = await super.serializeRequest(operationSchema, input, context); - if (this.awsQueryCompatible) { - request.headers["x-amzn-query-mode"] = "true"; - } - return request; - } - /** - * @override - */ - async handleError(operationSchema, context, response, dataObject, metadata) { - if (this.awsQueryCompatible) { - this.mixin.setQueryCompatError(dataObject, response); - } - const errorName = (0, import_cbor.loadSmithyRpcV2CborErrorCode)(response, dataObject) ?? "Unknown"; - const { errorSchema, errorMetadata } = await this.mixin.getErrorSchemaOrThrowBaseException( - errorName, - this.options.defaultNamespace, - response, - dataObject, - metadata - ); - const ns = import_schema2.NormalizedSchema.of(errorSchema); - const message = dataObject.message ?? dataObject.Message ?? "Unknown"; - const exception = new errorSchema.ctor(message); - const output = {}; - for (const [name, member] of ns.structIterator()) { - output[name] = this.deserializer.readValue(member, dataObject[name]); - } - if (this.awsQueryCompatible) { - this.mixin.queryCompatOutput(dataObject, output); - } - throw Object.assign( - exception, - errorMetadata, - { - $fault: ns.getMergedTraits().error, - message - }, - output - ); - } +const loggerMiddlewareOptions = { + name: "loggerMiddleware", + tags: ["LOGGER"], + step: "initialize", + override: true, }; +const getLoggerPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add(loggerMiddleware(), loggerMiddlewareOptions); + }, +}); -// src/submodules/protocols/coercing-serializers.ts -var _toStr = /* @__PURE__ */ __name((val) => { - if (val == null) { - return val; - } - if (typeof val === "number" || typeof val === "bigint") { - const warning = new Error(`Received number ${val} where a string was expected.`); - warning.name = "Warning"; - console.warn(warning); - return String(val); - } - if (typeof val === "boolean") { - const warning = new Error(`Received boolean ${val} where a string was expected.`); - warning.name = "Warning"; - console.warn(warning); - return String(val); - } - return val; -}, "_toStr"); -var _toBool = /* @__PURE__ */ __name((val) => { - if (val == null) { - return val; - } - if (typeof val === "number") { - } - if (typeof val === "string") { - const lowercase = val.toLowerCase(); - if (val !== "" && lowercase !== "false" && lowercase !== "true") { - const warning = new Error(`Received string "${val}" where a boolean was expected.`); - warning.name = "Warning"; - console.warn(warning); - } - return val !== "" && lowercase !== "false"; - } - return val; -}, "_toBool"); -var _toNum = /* @__PURE__ */ __name((val) => { - if (val == null) { - return val; - } - if (typeof val === "boolean") { - } - if (typeof val === "string") { - const num = Number(val); - if (num.toString() !== val) { - const warning = new Error(`Received string "${val}" where a number was expected.`); - warning.name = "Warning"; - console.warn(warning); - return val; - } - return num; - } - return val; -}, "_toNum"); +exports.getLoggerPlugin = getLoggerPlugin; +exports.loggerMiddleware = loggerMiddleware; +exports.loggerMiddlewareOptions = loggerMiddlewareOptions; -// src/submodules/protocols/json/AwsJsonRpcProtocol.ts -var import_protocols3 = __nccwpck_require__(3422); -var import_schema5 = __nccwpck_require__(6890); -// src/submodules/protocols/ConfigurableSerdeContext.ts -var SerdeContextConfig = class { - static { - __name(this, "SerdeContextConfig"); - } - serdeContext; - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - } +/***/ }), + +/***/ 1568: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +var recursionDetectionMiddleware = __nccwpck_require__(2521); + +const recursionDetectionMiddlewareOptions = { + step: "build", + tags: ["RECURSION_DETECTION"], + name: "recursionDetectionMiddleware", + override: true, + priority: "low", }; -// src/submodules/protocols/json/JsonShapeDeserializer.ts -var import_protocols = __nccwpck_require__(3422); -var import_schema3 = __nccwpck_require__(6890); -var import_serde2 = __nccwpck_require__(2430); -var import_util_base64 = __nccwpck_require__(8385); +const getRecursionDetectionPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add(recursionDetectionMiddleware.recursionDetectionMiddleware(), recursionDetectionMiddlewareOptions); + }, +}); -// src/submodules/protocols/json/jsonReviver.ts -var import_serde = __nccwpck_require__(2430); -function jsonReviver(key, value, context) { - if (context?.source) { - const numericString = context.source; - if (typeof value === "number") { - if (value > Number.MAX_SAFE_INTEGER || value < Number.MIN_SAFE_INTEGER || numericString !== String(value)) { - const isFractional = numericString.includes("."); - if (isFractional) { - return new import_serde.NumericValue(numericString, "bigDecimal"); - } else { - return BigInt(numericString); - } - } - } - } - return value; -} -__name(jsonReviver, "jsonReviver"); +exports.getRecursionDetectionPlugin = getRecursionDetectionPlugin; +Object.keys(recursionDetectionMiddleware).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return recursionDetectionMiddleware[k]; } + }); +}); -// src/submodules/protocols/common.ts -var import_smithy_client = __nccwpck_require__(1411); -var import_util_utf8 = __nccwpck_require__(1577); -var collectBodyString = /* @__PURE__ */ __name((streamBody, context) => (0, import_smithy_client.collectBody)(streamBody, context).then((body) => (context?.utf8Encoder ?? import_util_utf8.toUtf8)(body)), "collectBodyString"); -// src/submodules/protocols/json/parseJsonBody.ts -var parseJsonBody = /* @__PURE__ */ __name((streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { - if (encoded.length) { - try { - return JSON.parse(encoded); - } catch (e) { - if (e?.name === "SyntaxError") { - Object.defineProperty(e, "$responseBodyText", { - value: encoded - }); - } - throw e; +/***/ }), + +/***/ 2521: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.recursionDetectionMiddleware = void 0; +const lambda_invoke_store_1 = __nccwpck_require__(9320); +const protocol_http_1 = __nccwpck_require__(2356); +const TRACE_ID_HEADER_NAME = "X-Amzn-Trace-Id"; +const ENV_LAMBDA_FUNCTION_NAME = "AWS_LAMBDA_FUNCTION_NAME"; +const ENV_TRACE_ID = "_X_AMZN_TRACE_ID"; +const recursionDetectionMiddleware = () => (next) => async (args) => { + const { request } = args; + if (!protocol_http_1.HttpRequest.isInstance(request)) { + return next(args); } - } - return {}; -}), "parseJsonBody"); -var parseJsonErrorBody = /* @__PURE__ */ __name(async (errorBody, context) => { - const value = await parseJsonBody(errorBody, context); - value.message = value.message ?? value.Message; - return value; -}, "parseJsonErrorBody"); -var loadRestJsonErrorCode = /* @__PURE__ */ __name((output, data) => { - const findKey = /* @__PURE__ */ __name((object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase()), "findKey"); - const sanitizeErrorCode = /* @__PURE__ */ __name((rawValue) => { - let cleanValue = rawValue; - if (typeof cleanValue === "number") { - cleanValue = cleanValue.toString(); + const traceIdHeader = Object.keys(request.headers ?? {}).find((h) => h.toLowerCase() === TRACE_ID_HEADER_NAME.toLowerCase()) ?? + TRACE_ID_HEADER_NAME; + if (request.headers.hasOwnProperty(traceIdHeader)) { + return next(args); } - if (cleanValue.indexOf(",") >= 0) { - cleanValue = cleanValue.split(",")[0]; + const functionName = process.env[ENV_LAMBDA_FUNCTION_NAME]; + const traceIdFromEnv = process.env[ENV_TRACE_ID]; + const traceIdFromInvokeStore = lambda_invoke_store_1.InvokeStore.getXRayTraceId(); + const traceId = traceIdFromInvokeStore ?? traceIdFromEnv; + const nonEmptyString = (str) => typeof str === "string" && str.length > 0; + if (nonEmptyString(functionName) && nonEmptyString(traceId)) { + request.headers[TRACE_ID_HEADER_NAME] = traceId; } - if (cleanValue.indexOf(":") >= 0) { - cleanValue = cleanValue.split(":")[0]; + return next({ + ...args, + request, + }); +}; +exports.recursionDetectionMiddleware = recursionDetectionMiddleware; + + +/***/ }), + +/***/ 2959: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +var core = __nccwpck_require__(402); +var utilEndpoints = __nccwpck_require__(3068); +var protocolHttp = __nccwpck_require__(2356); +var core$1 = __nccwpck_require__(8704); + +const DEFAULT_UA_APP_ID = undefined; +function isValidUserAgentAppId(appId) { + if (appId === undefined) { + return true; } - if (cleanValue.indexOf("#") >= 0) { - cleanValue = cleanValue.split("#")[1]; + return typeof appId === "string" && appId.length <= 50; +} +function resolveUserAgentConfig(input) { + const normalizedAppIdProvider = core.normalizeProvider(input.userAgentAppId ?? DEFAULT_UA_APP_ID); + const { customUserAgent } = input; + return Object.assign(input, { + customUserAgent: typeof customUserAgent === "string" ? [[customUserAgent]] : customUserAgent, + userAgentAppId: async () => { + const appId = await normalizedAppIdProvider(); + if (!isValidUserAgentAppId(appId)) { + const logger = input.logger?.constructor?.name === "NoOpLogger" || !input.logger ? console : input.logger; + if (typeof appId !== "string") { + logger?.warn("userAgentAppId must be a string or undefined."); + } + else if (appId.length > 50) { + logger?.warn("The provided userAgentAppId exceeds the maximum length of 50 characters."); + } + } + return appId; + }, + }); +} + +const ACCOUNT_ID_ENDPOINT_REGEX = /\d{12}\.ddb/; +async function checkFeatures(context, config, args) { + const request = args.request; + if (request?.headers?.["smithy-protocol"] === "rpc-v2-cbor") { + core$1.setFeature(context, "PROTOCOL_RPC_V2_CBOR", "M"); + } + if (typeof config.retryStrategy === "function") { + const retryStrategy = await config.retryStrategy(); + if (typeof retryStrategy.acquireInitialRetryToken === "function") { + if (retryStrategy.constructor?.name?.includes("Adaptive")) { + core$1.setFeature(context, "RETRY_MODE_ADAPTIVE", "F"); + } + else { + core$1.setFeature(context, "RETRY_MODE_STANDARD", "E"); + } + } + else { + core$1.setFeature(context, "RETRY_MODE_LEGACY", "D"); + } } - return cleanValue; - }, "sanitizeErrorCode"); - const headerKey = findKey(output.headers, "x-amzn-errortype"); - if (headerKey !== void 0) { - return sanitizeErrorCode(output.headers[headerKey]); - } - if (data && typeof data === "object") { - const codeKey = findKey(data, "code"); - if (codeKey && data[codeKey] !== void 0) { - return sanitizeErrorCode(data[codeKey]); + if (typeof config.accountIdEndpointMode === "function") { + const endpointV2 = context.endpointV2; + if (String(endpointV2?.url?.hostname).match(ACCOUNT_ID_ENDPOINT_REGEX)) { + core$1.setFeature(context, "ACCOUNT_ID_ENDPOINT", "O"); + } + switch (await config.accountIdEndpointMode?.()) { + case "disabled": + core$1.setFeature(context, "ACCOUNT_ID_MODE_DISABLED", "Q"); + break; + case "preferred": + core$1.setFeature(context, "ACCOUNT_ID_MODE_PREFERRED", "P"); + break; + case "required": + core$1.setFeature(context, "ACCOUNT_ID_MODE_REQUIRED", "R"); + break; + } } - if (data["__type"] !== void 0) { - return sanitizeErrorCode(data["__type"]); + const identity = context.__smithy_context?.selectedHttpAuthScheme?.identity; + if (identity?.$source) { + const credentials = identity; + if (credentials.accountId) { + core$1.setFeature(context, "RESOLVED_ACCOUNT_ID", "T"); + } + for (const [key, value] of Object.entries(credentials.$source ?? {})) { + core$1.setFeature(context, key, value); + } } - } -}, "loadRestJsonErrorCode"); +} -// src/submodules/protocols/json/JsonShapeDeserializer.ts -var JsonShapeDeserializer = class extends SerdeContextConfig { - constructor(settings) { - super(); - this.settings = settings; - } - static { - __name(this, "JsonShapeDeserializer"); - } - async read(schema, data) { - return this._read( - schema, - typeof data === "string" ? JSON.parse(data, jsonReviver) : await parseJsonBody(data, this.serdeContext) - ); - } - readObject(schema, data) { - return this._read(schema, data); - } - _read(schema, value) { - const isObject = value !== null && typeof value === "object"; - const ns = import_schema3.NormalizedSchema.of(schema); - if (ns.isListSchema() && Array.isArray(value)) { - const listMember = ns.getValueSchema(); - const out = []; - const sparse = !!ns.getMergedTraits().sparse; - for (const item of value) { - if (sparse || item != null) { - out.push(this._read(listMember, item)); - } - } - return out; - } else if (ns.isMapSchema() && isObject) { - const mapMember = ns.getValueSchema(); - const out = {}; - const sparse = !!ns.getMergedTraits().sparse; - for (const [_k, _v] of Object.entries(value)) { - if (sparse || _v != null) { - out[_k] = this._read(mapMember, _v); - } - } - return out; - } else if (ns.isStructSchema() && isObject) { - const out = {}; - for (const [memberName, memberSchema] of ns.structIterator()) { - const fromKey = this.settings.jsonName ? memberSchema.getMergedTraits().jsonName ?? memberName : memberName; - const deserializedValue = this._read(memberSchema, value[fromKey]); - if (deserializedValue != null) { - out[memberName] = deserializedValue; - } - } - return out; - } - if (ns.isBlobSchema() && typeof value === "string") { - return (0, import_util_base64.fromBase64)(value); - } - const mediaType = ns.getMergedTraits().mediaType; - if (ns.isStringSchema() && typeof value === "string" && mediaType) { - const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); - if (isJson) { - return import_serde2.LazyJsonString.from(value); - } - } - if (ns.isTimestampSchema() && value != null) { - const format = (0, import_protocols.determineTimestampFormat)(ns, this.settings); - switch (format) { - case import_schema3.SCHEMA.TIMESTAMP_DATE_TIME: - return (0, import_serde2.parseRfc3339DateTimeWithOffset)(value); - case import_schema3.SCHEMA.TIMESTAMP_HTTP_DATE: - return (0, import_serde2.parseRfc7231DateTime)(value); - case import_schema3.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - return (0, import_serde2.parseEpochTimestamp)(value); - default: - console.warn("Missing timestamp format, parsing value with Date constructor:", value); - return new Date(value); - } +const USER_AGENT = "user-agent"; +const X_AMZ_USER_AGENT = "x-amz-user-agent"; +const SPACE = " "; +const UA_NAME_SEPARATOR = "/"; +const UA_NAME_ESCAPE_REGEX = /[^!$%&'*+\-.^_`|~\w]/g; +const UA_VALUE_ESCAPE_REGEX = /[^!$%&'*+\-.^_`|~\w#]/g; +const UA_ESCAPE_CHAR = "-"; + +const BYTE_LIMIT = 1024; +function encodeFeatures(features) { + let buffer = ""; + for (const key in features) { + const val = features[key]; + if (buffer.length + val.length + 1 <= BYTE_LIMIT) { + if (buffer.length) { + buffer += "," + val; + } + else { + buffer += val; + } + continue; + } + break; } - if (ns.isBigIntegerSchema() && (typeof value === "number" || typeof value === "string")) { - return BigInt(value); + return buffer; +} + +const userAgentMiddleware = (options) => (next, context) => async (args) => { + const { request } = args; + if (!protocolHttp.HttpRequest.isInstance(request)) { + return next(args); } - if (ns.isBigDecimalSchema() && value != void 0) { - if (value instanceof import_serde2.NumericValue) { - return value; - } - const untyped = value; - if (untyped.type === "bigDecimal" && "string" in untyped) { - return new import_serde2.NumericValue(untyped.string, untyped.type); - } - return new import_serde2.NumericValue(String(value), "bigDecimal"); + const { headers } = request; + const userAgent = context?.userAgent?.map(escapeUserAgent) || []; + const defaultUserAgent = (await options.defaultUserAgentProvider()).map(escapeUserAgent); + await checkFeatures(context, options, args); + const awsContext = context; + defaultUserAgent.push(`m/${encodeFeatures(Object.assign({}, context.__smithy_context?.features, awsContext.__aws_sdk_context?.features))}`); + const customUserAgent = options?.customUserAgent?.map(escapeUserAgent) || []; + const appId = await options.userAgentAppId(); + if (appId) { + defaultUserAgent.push(escapeUserAgent([`app`, `${appId}`])); + } + const prefix = utilEndpoints.getUserAgentPrefix(); + const sdkUserAgentValue = (prefix ? [prefix] : []) + .concat([...defaultUserAgent, ...userAgent, ...customUserAgent]) + .join(SPACE); + const normalUAValue = [ + ...defaultUserAgent.filter((section) => section.startsWith("aws-sdk-")), + ...customUserAgent, + ].join(SPACE); + if (options.runtime !== "browser") { + if (normalUAValue) { + headers[X_AMZ_USER_AGENT] = headers[X_AMZ_USER_AGENT] + ? `${headers[USER_AGENT]} ${normalUAValue}` + : normalUAValue; + } + headers[USER_AGENT] = sdkUserAgentValue; } - if (ns.isNumericSchema() && typeof value === "string") { - switch (value) { - case "Infinity": - return Infinity; - case "-Infinity": - return -Infinity; - case "NaN": - return NaN; - } + else { + headers[X_AMZ_USER_AGENT] = sdkUserAgentValue; } - if (ns.isDocumentSchema()) { - if (isObject) { - const out = Array.isArray(value) ? [] : {}; - for (const [k, v] of Object.entries(value)) { - if (v instanceof import_serde2.NumericValue) { - out[k] = v; - } else { - out[k] = this._read(ns, v); - } + return next({ + ...args, + request, + }); +}; +const escapeUserAgent = (userAgentPair) => { + const name = userAgentPair[0] + .split(UA_NAME_SEPARATOR) + .map((part) => part.replace(UA_NAME_ESCAPE_REGEX, UA_ESCAPE_CHAR)) + .join(UA_NAME_SEPARATOR); + const version = userAgentPair[1]?.replace(UA_VALUE_ESCAPE_REGEX, UA_ESCAPE_CHAR); + const prefixSeparatorIndex = name.indexOf(UA_NAME_SEPARATOR); + const prefix = name.substring(0, prefixSeparatorIndex); + let uaName = name.substring(prefixSeparatorIndex + 1); + if (prefix === "api") { + uaName = uaName.toLowerCase(); + } + return [prefix, uaName, version] + .filter((item) => item && item.length > 0) + .reduce((acc, item, index) => { + switch (index) { + case 0: + return item; + case 1: + return `${acc}/${item}`; + default: + return `${acc}#${item}`; } - return out; - } else { - return structuredClone(value); - } - } - return value; - } + }, ""); }; +const getUserAgentMiddlewareOptions = { + name: "getUserAgentMiddleware", + step: "build", + priority: "low", + tags: ["SET_USER_AGENT", "USER_AGENT"], + override: true, +}; +const getUserAgentPlugin = (config) => ({ + applyToStack: (clientStack) => { + clientStack.add(userAgentMiddleware(config), getUserAgentMiddlewareOptions); + }, +}); -// src/submodules/protocols/json/JsonShapeSerializer.ts -var import_protocols2 = __nccwpck_require__(3422); -var import_schema4 = __nccwpck_require__(6890); -var import_serde4 = __nccwpck_require__(2430); -var import_util_base642 = __nccwpck_require__(8385); +exports.DEFAULT_UA_APP_ID = DEFAULT_UA_APP_ID; +exports.getUserAgentMiddlewareOptions = getUserAgentMiddlewareOptions; +exports.getUserAgentPlugin = getUserAgentPlugin; +exports.resolveUserAgentConfig = resolveUserAgentConfig; +exports.userAgentMiddleware = userAgentMiddleware; -// src/submodules/protocols/json/jsonReplacer.ts -var import_serde3 = __nccwpck_require__(2430); -var NUMERIC_CONTROL_CHAR = String.fromCharCode(925); -var JsonReplacer = class { - static { - __name(this, "JsonReplacer"); - } - /** - * Stores placeholder key to true serialized value lookup. - */ - values = /* @__PURE__ */ new Map(); - counter = 0; - stage = 0; - /** - * Creates a jsonReplacer function that reserves big integer and big decimal values - * for later replacement. - */ - createReplacer() { - if (this.stage === 1) { - throw new Error("@aws-sdk/core/protocols - JsonReplacer already created."); - } - if (this.stage === 2) { - throw new Error("@aws-sdk/core/protocols - JsonReplacer exhausted."); - } - this.stage = 1; - return (key, value) => { - if (value instanceof import_serde3.NumericValue) { - const v = `${NUMERIC_CONTROL_CHAR + "nv" + this.counter++}_` + value.string; - this.values.set(`"${v}"`, value.string); - return v; - } - if (typeof value === "bigint") { - const s = value.toString(); - const v = `${NUMERIC_CONTROL_CHAR + "b" + this.counter++}_` + s; - this.values.set(`"${v}"`, s); - return v; - } - return value; + +/***/ }), + +/***/ 6463: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +var configResolver = __nccwpck_require__(9316); +var stsRegionDefaultResolver = __nccwpck_require__(5779); + +const getAwsRegionExtensionConfiguration = (runtimeConfig) => { + return { + setRegion(region) { + runtimeConfig.region = region; + }, + region() { + return runtimeConfig.region; + }, + }; +}; +const resolveAwsRegionExtensionConfiguration = (awsRegionExtensionConfiguration) => { + return { + region: awsRegionExtensionConfiguration.region(), }; - } - /** - * Replaces placeholder keys with their true values. - */ - replaceInJson(json) { - if (this.stage === 0) { - throw new Error("@aws-sdk/core/protocols - JsonReplacer not created yet."); - } - if (this.stage === 2) { - throw new Error("@aws-sdk/core/protocols - JsonReplacer exhausted."); - } - this.stage = 2; - if (this.counter === 0) { - return json; - } - for (const [key, value] of this.values) { - json = json.replace(key, value); - } - return json; - } }; -// src/submodules/protocols/json/JsonShapeSerializer.ts -var JsonShapeSerializer = class extends SerdeContextConfig { - constructor(settings) { - super(); - this.settings = settings; - } - static { - __name(this, "JsonShapeSerializer"); - } - buffer; - rootSchema; - write(schema, value) { - this.rootSchema = import_schema4.NormalizedSchema.of(schema); - this.buffer = this._write(this.rootSchema, value); - } - /** - * @internal - */ - writeDiscriminatedDocument(schema, value) { - this.write(schema, value); - if (typeof this.buffer === "object") { - this.buffer.__type = import_schema4.NormalizedSchema.of(schema).getName(true); - } - } - flush() { - const { rootSchema } = this; - this.rootSchema = void 0; - if (rootSchema?.isStructSchema() || rootSchema?.isDocumentSchema()) { - const replacer = new JsonReplacer(); - return replacer.replaceInJson(JSON.stringify(this.buffer, replacer.createReplacer(), 0)); - } - return this.buffer; - } - _write(schema, value, container) { - const isObject = value !== null && typeof value === "object"; - const ns = import_schema4.NormalizedSchema.of(schema); - if (ns.isListSchema() && Array.isArray(value)) { - const listMember = ns.getValueSchema(); - const out = []; - const sparse = !!ns.getMergedTraits().sparse; - for (const item of value) { - if (sparse || item != null) { - out.push(this._write(listMember, item)); - } - } - return out; - } else if (ns.isMapSchema() && isObject) { - const mapMember = ns.getValueSchema(); - const out = {}; - const sparse = !!ns.getMergedTraits().sparse; - for (const [_k, _v] of Object.entries(value)) { - if (sparse || _v != null) { - out[_k] = this._write(mapMember, _v); - } - } - return out; - } else if (ns.isStructSchema() && isObject) { - const out = {}; - for (const [memberName, memberSchema] of ns.structIterator()) { - const targetKey = this.settings.jsonName ? memberSchema.getMergedTraits().jsonName ?? memberName : memberName; - const serializableValue = this._write(memberSchema, value[memberName], ns); - if (serializableValue !== void 0) { - out[targetKey] = serializableValue; - } - } - return out; - } - if (value === null && container?.isStructSchema()) { - return void 0; - } - if (ns.isBlobSchema() && (value instanceof Uint8Array || typeof value === "string") || ns.isDocumentSchema() && value instanceof Uint8Array) { - if (ns === this.rootSchema) { - return value; - } - if (!this.serdeContext?.base64Encoder) { - return (0, import_util_base642.toBase64)(value); - } - return this.serdeContext?.base64Encoder(value); +Object.defineProperty(exports, "NODE_REGION_CONFIG_FILE_OPTIONS", ({ + enumerable: true, + get: function () { return configResolver.NODE_REGION_CONFIG_FILE_OPTIONS; } +})); +Object.defineProperty(exports, "NODE_REGION_CONFIG_OPTIONS", ({ + enumerable: true, + get: function () { return configResolver.NODE_REGION_CONFIG_OPTIONS; } +})); +Object.defineProperty(exports, "REGION_ENV_NAME", ({ + enumerable: true, + get: function () { return configResolver.REGION_ENV_NAME; } +})); +Object.defineProperty(exports, "REGION_INI_NAME", ({ + enumerable: true, + get: function () { return configResolver.REGION_INI_NAME; } +})); +Object.defineProperty(exports, "resolveRegionConfig", ({ + enumerable: true, + get: function () { return configResolver.resolveRegionConfig; } +})); +exports.getAwsRegionExtensionConfiguration = getAwsRegionExtensionConfiguration; +exports.resolveAwsRegionExtensionConfiguration = resolveAwsRegionExtensionConfiguration; +Object.keys(stsRegionDefaultResolver).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return stsRegionDefaultResolver[k]; } + }); +}); + + +/***/ }), + +/***/ 5779: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.warning = void 0; +exports.stsRegionDefaultResolver = stsRegionDefaultResolver; +const config_resolver_1 = __nccwpck_require__(9316); +const node_config_provider_1 = __nccwpck_require__(5704); +function stsRegionDefaultResolver(loaderConfig = {}) { + return (0, node_config_provider_1.loadConfig)({ + ...config_resolver_1.NODE_REGION_CONFIG_OPTIONS, + async default() { + if (!exports.warning.silence) { + console.warn("@aws-sdk - WARN - default STS region of us-east-1 used. See @aws-sdk/credential-providers README and set a region explicitly."); + } + return "us-east-1"; + }, + }, { ...config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS, ...loaderConfig }); +} +exports.warning = { + silence: false, +}; + + +/***/ }), + +/***/ 3068: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +var utilEndpoints = __nccwpck_require__(9674); +var urlParser = __nccwpck_require__(4494); + +const isVirtualHostableS3Bucket = (value, allowSubDomains = false) => { + if (allowSubDomains) { + for (const label of value.split(".")) { + if (!isVirtualHostableS3Bucket(label)) { + return false; + } + } + return true; } - if ((ns.isTimestampSchema() || ns.isDocumentSchema()) && value instanceof Date) { - const format = (0, import_protocols2.determineTimestampFormat)(ns, this.settings); - switch (format) { - case import_schema4.SCHEMA.TIMESTAMP_DATE_TIME: - return value.toISOString().replace(".000Z", "Z"); - case import_schema4.SCHEMA.TIMESTAMP_HTTP_DATE: - return (0, import_serde4.dateToUtcString)(value); - case import_schema4.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - return value.getTime() / 1e3; - default: - console.warn("Missing timestamp format, using epoch seconds", value); - return value.getTime() / 1e3; - } + if (!utilEndpoints.isValidHostLabel(value)) { + return false; } - if (ns.isNumericSchema() && typeof value === "number") { - if (Math.abs(value) === Infinity || isNaN(value)) { - return String(value); - } + if (value.length < 3 || value.length > 63) { + return false; } - if (ns.isStringSchema()) { - if (typeof value === "undefined" && ns.isIdempotencyToken()) { - return (0, import_serde4.generateIdempotencyToken)(); - } - const mediaType = ns.getMergedTraits().mediaType; - if (typeof value === "string" && mediaType) { - const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); - if (isJson) { - return import_serde4.LazyJsonString.from(value); - } - } + if (value !== value.toLowerCase()) { + return false; } - if (ns.isDocumentSchema()) { - if (isObject) { - const out = Array.isArray(value) ? [] : {}; - for (const [k, v] of Object.entries(value)) { - if (v instanceof import_serde4.NumericValue) { - out[k] = v; - } else { - out[k] = this._write(ns, v); - } - } - return out; - } else { - return structuredClone(value); - } + if (utilEndpoints.isIpAddress(value)) { + return false; } - return value; - } + return true; }; -// src/submodules/protocols/json/JsonCodec.ts -var JsonCodec = class extends SerdeContextConfig { - constructor(settings) { - super(); - this.settings = settings; - } - static { - __name(this, "JsonCodec"); - } - createSerializer() { - const serializer = new JsonShapeSerializer(this.settings); - serializer.setSerdeContext(this.serdeContext); - return serializer; - } - createDeserializer() { - const deserializer = new JsonShapeDeserializer(this.settings); - deserializer.setSerdeContext(this.serdeContext); - return deserializer; - } +const ARN_DELIMITER = ":"; +const RESOURCE_DELIMITER = "/"; +const parseArn = (value) => { + const segments = value.split(ARN_DELIMITER); + if (segments.length < 6) + return null; + const [arn, partition, service, region, accountId, ...resourcePath] = segments; + if (arn !== "arn" || partition === "" || service === "" || resourcePath.join(ARN_DELIMITER) === "") + return null; + const resourceId = resourcePath.map((resource) => resource.split(RESOURCE_DELIMITER)).flat(); + return { + partition, + service, + region, + accountId, + resourceId, + }; }; -// src/submodules/protocols/json/AwsJsonRpcProtocol.ts -var AwsJsonRpcProtocol = class extends import_protocols3.RpcProtocol { - static { - __name(this, "AwsJsonRpcProtocol"); - } - serializer; - deserializer; - serviceTarget; - codec; - mixin = new ProtocolLib(); - awsQueryCompatible; - constructor({ - defaultNamespace, - serviceTarget, - awsQueryCompatible - }) { - super({ - defaultNamespace - }); - this.serviceTarget = serviceTarget; - this.codec = new JsonCodec({ - timestampFormat: { - useTrait: true, - default: import_schema5.SCHEMA.TIMESTAMP_EPOCH_SECONDS - }, - jsonName: false - }); - this.serializer = this.codec.createSerializer(); - this.deserializer = this.codec.createDeserializer(); - this.awsQueryCompatible = !!awsQueryCompatible; - } - async serializeRequest(operationSchema, input, context) { - const request = await super.serializeRequest(operationSchema, input, context); - if (!request.path.endsWith("/")) { - request.path += "/"; - } - Object.assign(request.headers, { - "content-type": `application/x-amz-json-${this.getJsonRpcVersion()}`, - "x-amz-target": `${this.serviceTarget}.${import_schema5.NormalizedSchema.of(operationSchema).getName()}` - }); - if (this.awsQueryCompatible) { - request.headers["x-amzn-query-mode"] = "true"; +var partitions = [ + { + id: "aws", + outputs: { + dnsSuffix: "amazonaws.com", + dualStackDnsSuffix: "api.aws", + implicitGlobalRegion: "us-east-1", + name: "aws", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^(us|eu|ap|sa|ca|me|af|il|mx)\\-\\w+\\-\\d+$", + regions: { + "af-south-1": { + description: "Africa (Cape Town)" + }, + "ap-east-1": { + description: "Asia Pacific (Hong Kong)" + }, + "ap-east-2": { + description: "Asia Pacific (Taipei)" + }, + "ap-northeast-1": { + description: "Asia Pacific (Tokyo)" + }, + "ap-northeast-2": { + description: "Asia Pacific (Seoul)" + }, + "ap-northeast-3": { + description: "Asia Pacific (Osaka)" + }, + "ap-south-1": { + description: "Asia Pacific (Mumbai)" + }, + "ap-south-2": { + description: "Asia Pacific (Hyderabad)" + }, + "ap-southeast-1": { + description: "Asia Pacific (Singapore)" + }, + "ap-southeast-2": { + description: "Asia Pacific (Sydney)" + }, + "ap-southeast-3": { + description: "Asia Pacific (Jakarta)" + }, + "ap-southeast-4": { + description: "Asia Pacific (Melbourne)" + }, + "ap-southeast-5": { + description: "Asia Pacific (Malaysia)" + }, + "ap-southeast-6": { + description: "Asia Pacific (New Zealand)" + }, + "ap-southeast-7": { + description: "Asia Pacific (Thailand)" + }, + "aws-global": { + description: "aws global region" + }, + "ca-central-1": { + description: "Canada (Central)" + }, + "ca-west-1": { + description: "Canada West (Calgary)" + }, + "eu-central-1": { + description: "Europe (Frankfurt)" + }, + "eu-central-2": { + description: "Europe (Zurich)" + }, + "eu-north-1": { + description: "Europe (Stockholm)" + }, + "eu-south-1": { + description: "Europe (Milan)" + }, + "eu-south-2": { + description: "Europe (Spain)" + }, + "eu-west-1": { + description: "Europe (Ireland)" + }, + "eu-west-2": { + description: "Europe (London)" + }, + "eu-west-3": { + description: "Europe (Paris)" + }, + "il-central-1": { + description: "Israel (Tel Aviv)" + }, + "me-central-1": { + description: "Middle East (UAE)" + }, + "me-south-1": { + description: "Middle East (Bahrain)" + }, + "mx-central-1": { + description: "Mexico (Central)" + }, + "sa-east-1": { + description: "South America (Sao Paulo)" + }, + "us-east-1": { + description: "US East (N. Virginia)" + }, + "us-east-2": { + description: "US East (Ohio)" + }, + "us-west-1": { + description: "US West (N. California)" + }, + "us-west-2": { + description: "US West (Oregon)" + } + } + }, + { + id: "aws-cn", + outputs: { + dnsSuffix: "amazonaws.com.cn", + dualStackDnsSuffix: "api.amazonwebservices.com.cn", + implicitGlobalRegion: "cn-northwest-1", + name: "aws-cn", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^cn\\-\\w+\\-\\d+$", + regions: { + "aws-cn-global": { + description: "aws-cn global region" + }, + "cn-north-1": { + description: "China (Beijing)" + }, + "cn-northwest-1": { + description: "China (Ningxia)" + } + } + }, + { + id: "aws-eusc", + outputs: { + dnsSuffix: "amazonaws.eu", + dualStackDnsSuffix: "api.amazonwebservices.eu", + implicitGlobalRegion: "eusc-de-east-1", + name: "aws-eusc", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^eusc\\-(de)\\-\\w+\\-\\d+$", + regions: { + "eusc-de-east-1": { + description: "EU (Germany)" + } + } + }, + { + id: "aws-iso", + outputs: { + dnsSuffix: "c2s.ic.gov", + dualStackDnsSuffix: "api.aws.ic.gov", + implicitGlobalRegion: "us-iso-east-1", + name: "aws-iso", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^us\\-iso\\-\\w+\\-\\d+$", + regions: { + "aws-iso-global": { + description: "aws-iso global region" + }, + "us-iso-east-1": { + description: "US ISO East" + }, + "us-iso-west-1": { + description: "US ISO WEST" + } + } + }, + { + id: "aws-iso-b", + outputs: { + dnsSuffix: "sc2s.sgov.gov", + dualStackDnsSuffix: "api.aws.scloud", + implicitGlobalRegion: "us-isob-east-1", + name: "aws-iso-b", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^us\\-isob\\-\\w+\\-\\d+$", + regions: { + "aws-iso-b-global": { + description: "aws-iso-b global region" + }, + "us-isob-east-1": { + description: "US ISOB East (Ohio)" + }, + "us-isob-west-1": { + description: "US ISOB West" + } + } + }, + { + id: "aws-iso-e", + outputs: { + dnsSuffix: "cloud.adc-e.uk", + dualStackDnsSuffix: "api.cloud-aws.adc-e.uk", + implicitGlobalRegion: "eu-isoe-west-1", + name: "aws-iso-e", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^eu\\-isoe\\-\\w+\\-\\d+$", + regions: { + "aws-iso-e-global": { + description: "aws-iso-e global region" + }, + "eu-isoe-west-1": { + description: "EU ISOE West" + } + } + }, + { + id: "aws-iso-f", + outputs: { + dnsSuffix: "csp.hci.ic.gov", + dualStackDnsSuffix: "api.aws.hci.ic.gov", + implicitGlobalRegion: "us-isof-south-1", + name: "aws-iso-f", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^us\\-isof\\-\\w+\\-\\d+$", + regions: { + "aws-iso-f-global": { + description: "aws-iso-f global region" + }, + "us-isof-east-1": { + description: "US ISOF EAST" + }, + "us-isof-south-1": { + description: "US ISOF SOUTH" + } + } + }, + { + id: "aws-us-gov", + outputs: { + dnsSuffix: "amazonaws.com", + dualStackDnsSuffix: "api.aws", + implicitGlobalRegion: "us-gov-west-1", + name: "aws-us-gov", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^us\\-gov\\-\\w+\\-\\d+$", + regions: { + "aws-us-gov-global": { + description: "aws-us-gov global region" + }, + "us-gov-east-1": { + description: "AWS GovCloud (US-East)" + }, + "us-gov-west-1": { + description: "AWS GovCloud (US-West)" + } + } + } +]; +var version = "1.1"; +var partitionsInfo = { + partitions: partitions, + version: version +}; + +let selectedPartitionsInfo = partitionsInfo; +let selectedUserAgentPrefix = ""; +const partition = (value) => { + const { partitions } = selectedPartitionsInfo; + for (const partition of partitions) { + const { regions, outputs } = partition; + for (const [region, regionData] of Object.entries(regions)) { + if (region === value) { + return { + ...outputs, + ...regionData, + }; + } + } } - if ((0, import_schema5.deref)(operationSchema.input) === "unit" || !request.body) { - request.body = "{}"; + for (const partition of partitions) { + const { regionRegex, outputs } = partition; + if (new RegExp(regionRegex).test(value)) { + return { + ...outputs, + }; + } } - try { - request.headers["content-length"] = this.mixin.calculateContentLength(request.body, this.serdeContext); - } catch (e) { + const DEFAULT_PARTITION = partitions.find((partition) => partition.id === "aws"); + if (!DEFAULT_PARTITION) { + throw new Error("Provided region was not found in the partition array or regex," + + " and default partition with id 'aws' doesn't exist."); } - return request; - } - getPayloadCodec() { - return this.codec; - } - async handleError(operationSchema, context, response, dataObject, metadata) { - if (this.awsQueryCompatible) { - this.mixin.setQueryCompatError(dataObject, response); + return { + ...DEFAULT_PARTITION.outputs, + }; +}; +const setPartitionInfo = (partitionsInfo, userAgentPrefix = "") => { + selectedPartitionsInfo = partitionsInfo; + selectedUserAgentPrefix = userAgentPrefix; +}; +const useDefaultPartitionInfo = () => { + setPartitionInfo(partitionsInfo, ""); +}; +const getUserAgentPrefix = () => selectedUserAgentPrefix; + +const awsEndpointFunctions = { + isVirtualHostableS3Bucket: isVirtualHostableS3Bucket, + parseArn: parseArn, + partition: partition, +}; +utilEndpoints.customEndpointFunctions.aws = awsEndpointFunctions; + +const resolveDefaultAwsRegionalEndpointsConfig = (input) => { + if (typeof input.endpointProvider !== "function") { + throw new Error("@aws-sdk/util-endpoint - endpointProvider and endpoint missing in config for this client."); + } + const { endpoint } = input; + if (endpoint === undefined) { + input.endpoint = async () => { + return toEndpointV1(input.endpointProvider({ + Region: typeof input.region === "function" ? await input.region() : input.region, + UseDualStack: typeof input.useDualstackEndpoint === "function" + ? await input.useDualstackEndpoint() + : input.useDualstackEndpoint, + UseFIPS: typeof input.useFipsEndpoint === "function" ? await input.useFipsEndpoint() : input.useFipsEndpoint, + Endpoint: undefined, + }, { logger: input.logger })); + }; } - const errorIdentifier = loadRestJsonErrorCode(response, dataObject) ?? "Unknown"; - const { errorSchema, errorMetadata } = await this.mixin.getErrorSchemaOrThrowBaseException( - errorIdentifier, - this.options.defaultNamespace, - response, - dataObject, - metadata - ); - const ns = import_schema5.NormalizedSchema.of(errorSchema); - const message = dataObject.message ?? dataObject.Message ?? "Unknown"; - const exception = new errorSchema.ctor(message); - const output = {}; - for (const [name, member] of ns.structIterator()) { - const target = member.getMergedTraits().jsonName ?? name; - output[name] = this.codec.createDeserializer().readObject(member, dataObject[target]); - } - if (this.awsQueryCompatible) { - this.mixin.queryCompatOutput(dataObject, output); - } - throw Object.assign( - exception, - errorMetadata, - { - $fault: ns.getMergedTraits().error, - message - }, - output - ); - } + return input; }; +const toEndpointV1 = (endpoint) => urlParser.parseUrl(endpoint.url); -// src/submodules/protocols/json/AwsJson1_0Protocol.ts -var AwsJson1_0Protocol = class extends AwsJsonRpcProtocol { - static { - __name(this, "AwsJson1_0Protocol"); - } - constructor({ - defaultNamespace, - serviceTarget, - awsQueryCompatible - }) { - super({ - defaultNamespace, - serviceTarget, - awsQueryCompatible - }); - } - getShapeId() { - return "aws.protocols#awsJson1_0"; - } - getJsonRpcVersion() { - return "1.0"; - } - /** - * @override - */ - getDefaultContentType() { - return "application/x-amz-json-1.0"; - } +Object.defineProperty(exports, "EndpointError", ({ + enumerable: true, + get: function () { return utilEndpoints.EndpointError; } +})); +Object.defineProperty(exports, "isIpAddress", ({ + enumerable: true, + get: function () { return utilEndpoints.isIpAddress; } +})); +Object.defineProperty(exports, "resolveEndpoint", ({ + enumerable: true, + get: function () { return utilEndpoints.resolveEndpoint; } +})); +exports.awsEndpointFunctions = awsEndpointFunctions; +exports.getUserAgentPrefix = getUserAgentPrefix; +exports.partition = partition; +exports.resolveDefaultAwsRegionalEndpointsConfig = resolveDefaultAwsRegionalEndpointsConfig; +exports.setPartitionInfo = setPartitionInfo; +exports.toEndpointV1 = toEndpointV1; +exports.useDefaultPartitionInfo = useDefaultPartitionInfo; + + +/***/ }), + +/***/ 1656: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +var os = __nccwpck_require__(857); +var process = __nccwpck_require__(932); +var middlewareUserAgent = __nccwpck_require__(2959); + +const crtAvailability = { + isCrtAvailable: false, }; -// src/submodules/protocols/json/AwsJson1_1Protocol.ts -var AwsJson1_1Protocol = class extends AwsJsonRpcProtocol { - static { - __name(this, "AwsJson1_1Protocol"); - } - constructor({ - defaultNamespace, - serviceTarget, - awsQueryCompatible - }) { - super({ - defaultNamespace, - serviceTarget, - awsQueryCompatible - }); - } - getShapeId() { - return "aws.protocols#awsJson1_1"; - } - getJsonRpcVersion() { - return "1.1"; - } - /** - * @override - */ - getDefaultContentType() { - return "application/x-amz-json-1.1"; - } +const isCrtAvailable = () => { + if (crtAvailability.isCrtAvailable) { + return ["md/crt-avail"]; + } + return null; }; -// src/submodules/protocols/json/AwsRestJsonProtocol.ts -var import_protocols4 = __nccwpck_require__(3422); -var import_schema6 = __nccwpck_require__(6890); -var AwsRestJsonProtocol = class extends import_protocols4.HttpBindingProtocol { - static { - __name(this, "AwsRestJsonProtocol"); - } - serializer; - deserializer; - codec; - mixin = new ProtocolLib(); - constructor({ defaultNamespace }) { - super({ - defaultNamespace - }); - const settings = { - timestampFormat: { - useTrait: true, - default: import_schema6.SCHEMA.TIMESTAMP_EPOCH_SECONDS - }, - httpBindings: true, - jsonName: true +const createDefaultUserAgentProvider = ({ serviceId, clientVersion }) => { + return async (config) => { + const sections = [ + ["aws-sdk-js", clientVersion], + ["ua", "2.1"], + [`os/${os.platform()}`, os.release()], + ["lang/js"], + ["md/nodejs", `${process.versions.node}`], + ]; + const crtAvailable = isCrtAvailable(); + if (crtAvailable) { + sections.push(crtAvailable); + } + if (serviceId) { + sections.push([`api/${serviceId}`, clientVersion]); + } + if (process.env.AWS_EXECUTION_ENV) { + sections.push([`exec-env/${process.env.AWS_EXECUTION_ENV}`]); + } + const appId = await config?.userAgentAppId?.(); + const resolvedUserAgent = appId ? [...sections, [`app/${appId}`]] : [...sections]; + return resolvedUserAgent; }; - this.codec = new JsonCodec(settings); - this.serializer = new import_protocols4.HttpInterceptingShapeSerializer(this.codec.createSerializer(), settings); - this.deserializer = new import_protocols4.HttpInterceptingShapeDeserializer(this.codec.createDeserializer(), settings); - } - getShapeId() { - return "aws.protocols#restJson1"; - } - getPayloadCodec() { - return this.codec; - } - setSerdeContext(serdeContext) { - this.codec.setSerdeContext(serdeContext); - super.setSerdeContext(serdeContext); - } - async serializeRequest(operationSchema, input, context) { - const request = await super.serializeRequest(operationSchema, input, context); - const inputSchema = import_schema6.NormalizedSchema.of(operationSchema.input); - if (!request.headers["content-type"]) { - const contentType = this.mixin.resolveRestContentType(this.getDefaultContentType(), inputSchema); - if (contentType) { - request.headers["content-type"] = contentType; - } - } - if (request.headers["content-type"] && !request.body) { - request.body = "{}"; - } - if (request.body) { - try { - request.headers["content-length"] = this.mixin.calculateContentLength(request.body, this.serdeContext); - } catch (e) { - } - } - return request; - } - async handleError(operationSchema, context, response, dataObject, metadata) { - const errorIdentifier = loadRestJsonErrorCode(response, dataObject) ?? "Unknown"; - const { errorSchema, errorMetadata } = await this.mixin.getErrorSchemaOrThrowBaseException( - errorIdentifier, - this.options.defaultNamespace, - response, - dataObject, - metadata - ); - const ns = import_schema6.NormalizedSchema.of(errorSchema); - const message = dataObject.message ?? dataObject.Message ?? "Unknown"; - const exception = new errorSchema.ctor(message); - await this.deserializeHttpMessage(errorSchema, context, response, dataObject); - const output = {}; - for (const [name, member] of ns.structIterator()) { - const target = member.getMergedTraits().jsonName ?? name; - output[name] = this.codec.createDeserializer().readObject(member, dataObject[target]); - } - throw Object.assign( - exception, - errorMetadata, - { - $fault: ns.getMergedTraits().error, - message - }, - output - ); - } - /** - * @override - */ - getDefaultContentType() { - return "application/json"; - } }; +const defaultUserAgent = createDefaultUserAgentProvider; -// src/submodules/protocols/json/awsExpectUnion.ts -var import_smithy_client2 = __nccwpck_require__(1411); -var awsExpectUnion = /* @__PURE__ */ __name((value) => { - if (value == null) { - return void 0; - } - if (typeof value === "object" && "__type" in value) { - delete value.__type; - } - return (0, import_smithy_client2.expectUnion)(value); -}, "awsExpectUnion"); +const UA_APP_ID_ENV_NAME = "AWS_SDK_UA_APP_ID"; +const UA_APP_ID_INI_NAME = "sdk_ua_app_id"; +const UA_APP_ID_INI_NAME_DEPRECATED = "sdk-ua-app-id"; +const NODE_APP_ID_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[UA_APP_ID_ENV_NAME], + configFileSelector: (profile) => profile[UA_APP_ID_INI_NAME] ?? profile[UA_APP_ID_INI_NAME_DEPRECATED], + default: middlewareUserAgent.DEFAULT_UA_APP_ID, +}; -// src/submodules/protocols/query/AwsQueryProtocol.ts -var import_protocols7 = __nccwpck_require__(3422); -var import_schema9 = __nccwpck_require__(6890); +exports.NODE_APP_ID_CONFIG_OPTIONS = NODE_APP_ID_CONFIG_OPTIONS; +exports.UA_APP_ID_ENV_NAME = UA_APP_ID_ENV_NAME; +exports.UA_APP_ID_INI_NAME = UA_APP_ID_INI_NAME; +exports.createDefaultUserAgentProvider = createDefaultUserAgentProvider; +exports.crtAvailability = crtAvailability; +exports.defaultUserAgent = defaultUserAgent; -// src/submodules/protocols/xml/XmlShapeDeserializer.ts -var import_protocols5 = __nccwpck_require__(3422); -var import_schema7 = __nccwpck_require__(6890); -var import_smithy_client3 = __nccwpck_require__(1411); -var import_util_utf82 = __nccwpck_require__(1577); -var import_fast_xml_parser = __nccwpck_require__(591); -var XmlShapeDeserializer = class extends SerdeContextConfig { - constructor(settings) { - super(); - this.settings = settings; - this.stringDeserializer = new import_protocols5.FromStringShapeDeserializer(settings); - } - static { - __name(this, "XmlShapeDeserializer"); - } - stringDeserializer; - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - this.stringDeserializer.setSerdeContext(serdeContext); - } - /** - * @param schema - describing the data. - * @param bytes - serialized data. - * @param key - used by AwsQuery to step one additional depth into the object before reading it. - */ - read(schema, bytes, key) { - const ns = import_schema7.NormalizedSchema.of(schema); - const memberSchemas = ns.getMemberSchemas(); - const isEventPayload = ns.isStructSchema() && ns.isMemberSchema() && !!Object.values(memberSchemas).find((memberNs) => { - return !!memberNs.getMemberTraits().eventPayload; - }); - if (isEventPayload) { - const output = {}; - const memberName = Object.keys(memberSchemas)[0]; - const eventMemberSchema = memberSchemas[memberName]; - if (eventMemberSchema.isBlobSchema()) { - output[memberName] = bytes; - } else { - output[memberName] = this.read(memberSchemas[memberName], bytes); - } - return output; - } - const xmlString = (this.serdeContext?.utf8Encoder ?? import_util_utf82.toUtf8)(bytes); - const parsedObject = this.parseXml(xmlString); - return this.readSchema(schema, key ? parsedObject[key] : parsedObject); - } - readSchema(_schema, value) { - const ns = import_schema7.NormalizedSchema.of(_schema); - const traits = ns.getMergedTraits(); - if (ns.isListSchema() && !Array.isArray(value)) { - return this.readSchema(ns, [value]); + +/***/ }), + +/***/ 4274: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +var xmlParser = __nccwpck_require__(3343); + +function escapeAttribute(value) { + return value.replace(/&/g, "&").replace(//g, ">").replace(/"/g, """); +} + +function escapeElement(value) { + return value + .replace(/&/g, "&") + .replace(/"/g, """) + .replace(/'/g, "'") + .replace(//g, ">") + .replace(/\r/g, " ") + .replace(/\n/g, " ") + .replace(/\u0085/g, "…") + .replace(/\u2028/, "
"); +} + +class XmlText { + value; + constructor(value) { + this.value = value; } - if (value == null) { - return value; + toString() { + return escapeElement("" + this.value); } - if (typeof value === "object") { - const sparse = !!traits.sparse; - const flat = !!traits.xmlFlattened; - if (ns.isListSchema()) { - const listValue = ns.getValueSchema(); - const buffer2 = []; - const sourceKey = listValue.getMergedTraits().xmlName ?? "member"; - const source = flat ? value : (value[0] ?? value)[sourceKey]; - const sourceArray = Array.isArray(source) ? source : [source]; - for (const v of sourceArray) { - if (v != null || sparse) { - buffer2.push(this.readSchema(listValue, v)); - } - } - return buffer2; - } - const buffer = {}; - if (ns.isMapSchema()) { - const keyNs = ns.getKeySchema(); - const memberNs = ns.getValueSchema(); - let entries; - if (flat) { - entries = Array.isArray(value) ? value : [value]; - } else { - entries = Array.isArray(value.entry) ? value.entry : [value.entry]; - } - const keyProperty = keyNs.getMergedTraits().xmlName ?? "key"; - const valueProperty = memberNs.getMergedTraits().xmlName ?? "value"; - for (const entry of entries) { - const key = entry[keyProperty]; - const value2 = entry[valueProperty]; - if (value2 != null || sparse) { - buffer[key] = this.readSchema(memberNs, value2); - } +} + +class XmlNode { + name; + children; + attributes = {}; + static of(name, childText, withName) { + const node = new XmlNode(name); + if (childText !== undefined) { + node.addChildNode(new XmlText(childText)); } - return buffer; - } - if (ns.isStructSchema()) { - for (const [memberName, memberSchema] of ns.structIterator()) { - const memberTraits = memberSchema.getMergedTraits(); - const xmlObjectKey = !memberTraits.httpPayload ? memberSchema.getMemberTraits().xmlName ?? memberName : memberTraits.xmlName ?? memberSchema.getName(); - if (value[xmlObjectKey] != null) { - buffer[memberName] = this.readSchema(memberSchema, value[xmlObjectKey]); - } + if (withName !== undefined) { + node.withName(withName); } - return buffer; - } - if (ns.isDocumentSchema()) { - return value; - } - throw new Error(`@aws-sdk/core/protocols - xml deserializer unhandled schema type for ${ns.getName(true)}`); + return node; } - if (ns.isListSchema()) { - return []; + constructor(name, children = []) { + this.name = name; + this.children = children; } - if (ns.isMapSchema() || ns.isStructSchema()) { - return {}; + withName(name) { + this.name = name; + return this; } - return this.stringDeserializer.read(ns, value); - } - parseXml(xml) { - if (xml.length) { - const parser = new import_fast_xml_parser.XMLParser({ - attributeNamePrefix: "", - htmlEntities: true, - ignoreAttributes: false, - ignoreDeclaration: true, - parseTagValue: false, - trimValues: false, - tagValueProcessor: /* @__PURE__ */ __name((_, val) => val.trim() === "" && val.includes("\n") ? "" : void 0, "tagValueProcessor") - }); - parser.addEntity("#xD", "\r"); - parser.addEntity("#10", "\n"); - let parsedObj; - try { - parsedObj = parser.parse(xml, true); - } catch (e) { - if (e && typeof e === "object") { - Object.defineProperty(e, "$responseBodyText", { - value: xml - }); + addAttribute(name, value) { + this.attributes[name] = value; + return this; + } + addChildNode(child) { + this.children.push(child); + return this; + } + removeAttribute(name) { + delete this.attributes[name]; + return this; + } + n(name) { + this.name = name; + return this; + } + c(child) { + this.children.push(child); + return this; + } + a(name, value) { + if (value != null) { + this.attributes[name] = value; } - throw e; - } - const textNodeName = "#text"; - const key = Object.keys(parsedObj)[0]; - const parsedObjToReturn = parsedObj[key]; - if (parsedObjToReturn[textNodeName]) { - parsedObjToReturn[key] = parsedObjToReturn[textNodeName]; - delete parsedObjToReturn[textNodeName]; - } - return (0, import_smithy_client3.getValueFromTextNode)(parsedObjToReturn); + return this; } - return {}; - } -}; - -// src/submodules/protocols/query/QueryShapeSerializer.ts -var import_protocols6 = __nccwpck_require__(3422); -var import_schema8 = __nccwpck_require__(6890); -var import_serde5 = __nccwpck_require__(2430); -var import_smithy_client4 = __nccwpck_require__(1411); -var import_util_base643 = __nccwpck_require__(8385); -var QueryShapeSerializer = class extends SerdeContextConfig { - constructor(settings) { - super(); - this.settings = settings; - } - static { - __name(this, "QueryShapeSerializer"); - } - buffer; - write(schema, value, prefix = "") { - if (this.buffer === void 0) { - this.buffer = ""; - } - const ns = import_schema8.NormalizedSchema.of(schema); - if (prefix && !prefix.endsWith(".")) { - prefix += "."; - } - if (ns.isBlobSchema()) { - if (typeof value === "string" || value instanceof Uint8Array) { - this.writeKey(prefix); - this.writeValue((this.serdeContext?.base64Encoder ?? import_util_base643.toBase64)(value)); - } - } else if (ns.isBooleanSchema() || ns.isNumericSchema() || ns.isStringSchema()) { - if (value != null) { - this.writeKey(prefix); - this.writeValue(String(value)); - } else if (ns.isIdempotencyToken()) { - this.writeKey(prefix); - this.writeValue((0, import_serde5.generateIdempotencyToken)()); - } - } else if (ns.isBigIntegerSchema()) { - if (value != null) { - this.writeKey(prefix); - this.writeValue(String(value)); - } - } else if (ns.isBigDecimalSchema()) { - if (value != null) { - this.writeKey(prefix); - this.writeValue(value instanceof import_serde5.NumericValue ? value.string : String(value)); - } - } else if (ns.isTimestampSchema()) { - if (value instanceof Date) { - this.writeKey(prefix); - const format = (0, import_protocols6.determineTimestampFormat)(ns, this.settings); - switch (format) { - case import_schema8.SCHEMA.TIMESTAMP_DATE_TIME: - this.writeValue(value.toISOString().replace(".000Z", "Z")); - break; - case import_schema8.SCHEMA.TIMESTAMP_HTTP_DATE: - this.writeValue((0, import_smithy_client4.dateToUtcString)(value)); - break; - case import_schema8.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - this.writeValue(String(value.getTime() / 1e3)); - break; + cc(input, field, withName = field) { + if (input[field] != null) { + const node = XmlNode.of(field, input[field]).withName(withName); + this.c(node); } - } - } else if (ns.isDocumentSchema()) { - throw new Error(`@aws-sdk/core/protocols - QuerySerializer unsupported document type ${ns.getName(true)}`); - } else if (ns.isListSchema()) { - if (Array.isArray(value)) { - if (value.length === 0) { - if (this.settings.serializeEmptyLists) { - this.writeKey(prefix); - this.writeValue(""); - } - } else { - const member = ns.getValueSchema(); - const flat = this.settings.flattenLists || ns.getMergedTraits().xmlFlattened; - let i = 1; - for (const item of value) { - if (item == null) { - continue; - } - const suffix = this.getKey("member", member.getMergedTraits().xmlName); - const key = flat ? `${prefix}${i}` : `${prefix}${suffix}.${i}`; - this.write(member, item, key); - ++i; - } - } - } - } else if (ns.isMapSchema()) { - if (value && typeof value === "object") { - const keySchema = ns.getKeySchema(); - const memberSchema = ns.getValueSchema(); - const flat = ns.getMergedTraits().xmlFlattened; - let i = 1; - for (const [k, v] of Object.entries(value)) { - if (v == null) { - continue; - } - const keySuffix = this.getKey("key", keySchema.getMergedTraits().xmlName); - const key = flat ? `${prefix}${i}.${keySuffix}` : `${prefix}entry.${i}.${keySuffix}`; - const valueSuffix = this.getKey("value", memberSchema.getMergedTraits().xmlName); - const valueKey = flat ? `${prefix}${i}.${valueSuffix}` : `${prefix}entry.${i}.${valueSuffix}`; - this.write(keySchema, k, key); - this.write(memberSchema, v, valueKey); - ++i; - } - } - } else if (ns.isStructSchema()) { - if (value && typeof value === "object") { - for (const [memberName, member] of ns.structIterator()) { - if (value[memberName] == null && !member.isIdempotencyToken()) { - continue; - } - const suffix = this.getKey(memberName, member.getMergedTraits().xmlName); - const key = `${prefix}${suffix}`; - this.write(member, value[memberName], key); - } - } - } else if (ns.isUnitSchema()) { - } else { - throw new Error(`@aws-sdk/core/protocols - QuerySerializer unrecognized schema type ${ns.getName(true)}`); - } - } - flush() { - if (this.buffer === void 0) { - throw new Error("@aws-sdk/core/protocols - QuerySerializer cannot flush with nothing written to buffer."); - } - const str = this.buffer; - delete this.buffer; - return str; - } - getKey(memberName, xmlName) { - const key = xmlName ?? memberName; - if (this.settings.capitalizeKeys) { - return key[0].toUpperCase() + key.slice(1); - } - return key; - } - writeKey(key) { - if (key.endsWith(".")) { - key = key.slice(0, key.length - 1); - } - this.buffer += `&${(0, import_protocols6.extendedEncodeURIComponent)(key)}=`; - } - writeValue(value) { - this.buffer += (0, import_protocols6.extendedEncodeURIComponent)(value); - } -}; - -// src/submodules/protocols/query/AwsQueryProtocol.ts -var AwsQueryProtocol = class extends import_protocols7.RpcProtocol { - constructor(options) { - super({ - defaultNamespace: options.defaultNamespace - }); - this.options = options; - const settings = { - timestampFormat: { - useTrait: true, - default: import_schema9.SCHEMA.TIMESTAMP_DATE_TIME - }, - httpBindings: false, - xmlNamespace: options.xmlNamespace, - serviceNamespace: options.defaultNamespace, - serializeEmptyLists: true - }; - this.serializer = new QueryShapeSerializer(settings); - this.deserializer = new XmlShapeDeserializer(settings); - } - static { - __name(this, "AwsQueryProtocol"); - } - serializer; - deserializer; - mixin = new ProtocolLib(); - getShapeId() { - return "aws.protocols#awsQuery"; - } - setSerdeContext(serdeContext) { - this.serializer.setSerdeContext(serdeContext); - this.deserializer.setSerdeContext(serdeContext); - } - getPayloadCodec() { - throw new Error("AWSQuery protocol has no payload codec."); - } - async serializeRequest(operationSchema, input, context) { - const request = await super.serializeRequest(operationSchema, input, context); - if (!request.path.endsWith("/")) { - request.path += "/"; - } - Object.assign(request.headers, { - "content-type": `application/x-www-form-urlencoded` - }); - if ((0, import_schema9.deref)(operationSchema.input) === "unit" || !request.body) { - request.body = ""; - } - const action = operationSchema.name.split("#")[1] ?? operationSchema.name; - request.body = `Action=${action}&Version=${this.options.version}` + request.body; - if (request.body.endsWith("&")) { - request.body = request.body.slice(-1); - } - try { - request.headers["content-length"] = this.mixin.calculateContentLength(request.body, this.serdeContext); - } catch (e) { - } - return request; - } - async deserializeResponse(operationSchema, context, response) { - const deserializer = this.deserializer; - const ns = import_schema9.NormalizedSchema.of(operationSchema.output); - const dataObject = {}; - if (response.statusCode >= 300) { - const bytes2 = await (0, import_protocols7.collectBody)(response.body, context); - if (bytes2.byteLength > 0) { - Object.assign(dataObject, await deserializer.read(import_schema9.SCHEMA.DOCUMENT, bytes2)); - } - await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); - } - for (const header in response.headers) { - const value = response.headers[header]; - delete response.headers[header]; - response.headers[header.toLowerCase()] = value; - } - const shortName = operationSchema.name.split("#")[1] ?? operationSchema.name; - const awsQueryResultKey = ns.isStructSchema() && this.useNestedResult() ? shortName + "Result" : void 0; - const bytes = await (0, import_protocols7.collectBody)(response.body, context); - if (bytes.byteLength > 0) { - Object.assign(dataObject, await deserializer.read(ns, bytes, awsQueryResultKey)); - } - const output = { - $metadata: this.deserializeMetadata(response), - ...dataObject - }; - return output; - } - /** - * EC2 Query overrides this. - */ - useNestedResult() { - return true; - } - async handleError(operationSchema, context, response, dataObject, metadata) { - const errorIdentifier = this.loadQueryErrorCode(response, dataObject) ?? "Unknown"; - const errorData = this.loadQueryError(dataObject); - const { errorSchema, errorMetadata } = await this.mixin.getErrorSchemaOrThrowBaseException( - errorIdentifier, - this.options.defaultNamespace, - response, - errorData, - metadata, - (registry, errorName) => registry.find( - (schema) => import_schema9.NormalizedSchema.of(schema).getMergedTraits().awsQueryError?.[0] === errorName - ) - ); - const ns = import_schema9.NormalizedSchema.of(errorSchema); - const message = this.loadQueryErrorMessage(dataObject); - const exception = new errorSchema.ctor(message); - const output = {}; - for (const [name, member] of ns.structIterator()) { - const target = member.getMergedTraits().xmlName ?? name; - const value = errorData[target] ?? dataObject[target]; - output[name] = this.deserializer.readSchema(member, value); - } - throw Object.assign( - exception, - errorMetadata, - { - $fault: ns.getMergedTraits().error, - message - }, - output - ); - } - /** - * The variations in the error and error message locations are attributed to - * divergence between AWS Query and EC2 Query behavior. - */ - loadQueryErrorCode(output, data) { - const code = (data.Errors?.[0]?.Error ?? data.Errors?.Error ?? data.Error)?.Code; - if (code !== void 0) { - return code; - } - if (output.statusCode == 404) { - return "NotFound"; - } - } - loadQueryError(data) { - return data.Errors?.[0]?.Error ?? data.Errors?.Error ?? data.Error; - } - loadQueryErrorMessage(data) { - const errorData = this.loadQueryError(data); - return errorData?.message ?? errorData?.Message ?? data.message ?? data.Message ?? "Unknown"; - } - /** - * @override - */ - getDefaultContentType() { - return "application/x-www-form-urlencoded"; - } -}; - -// src/submodules/protocols/query/AwsEc2QueryProtocol.ts -var AwsEc2QueryProtocol = class extends AwsQueryProtocol { - constructor(options) { - super(options); - this.options = options; - const ec2Settings = { - capitalizeKeys: true, - flattenLists: true, - serializeEmptyLists: false - }; - Object.assign(this.serializer.settings, ec2Settings); - } - static { - __name(this, "AwsEc2QueryProtocol"); - } - /** - * EC2 Query reads XResponse.XResult instead of XResponse directly. - */ - useNestedResult() { - return false; - } -}; - -// src/submodules/protocols/xml/AwsRestXmlProtocol.ts -var import_protocols9 = __nccwpck_require__(3422); -var import_schema11 = __nccwpck_require__(6890); - -// src/submodules/protocols/xml/parseXmlBody.ts -var import_smithy_client5 = __nccwpck_require__(1411); -var import_fast_xml_parser2 = __nccwpck_require__(591); -var parseXmlBody = /* @__PURE__ */ __name((streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { - if (encoded.length) { - const parser = new import_fast_xml_parser2.XMLParser({ - attributeNamePrefix: "", - htmlEntities: true, - ignoreAttributes: false, - ignoreDeclaration: true, - parseTagValue: false, - trimValues: false, - tagValueProcessor: /* @__PURE__ */ __name((_, val) => val.trim() === "" && val.includes("\n") ? "" : void 0, "tagValueProcessor") - }); - parser.addEntity("#xD", "\r"); - parser.addEntity("#10", "\n"); - let parsedObj; - try { - parsedObj = parser.parse(encoded, true); - } catch (e) { - if (e && typeof e === "object") { - Object.defineProperty(e, "$responseBodyText", { - value: encoded - }); - } - throw e; - } - const textNodeName = "#text"; - const key = Object.keys(parsedObj)[0]; - const parsedObjToReturn = parsedObj[key]; - if (parsedObjToReturn[textNodeName]) { - parsedObjToReturn[key] = parsedObjToReturn[textNodeName]; - delete parsedObjToReturn[textNodeName]; - } - return (0, import_smithy_client5.getValueFromTextNode)(parsedObjToReturn); - } - return {}; -}), "parseXmlBody"); -var parseXmlErrorBody = /* @__PURE__ */ __name(async (errorBody, context) => { - const value = await parseXmlBody(errorBody, context); - if (value.Error) { - value.Error.message = value.Error.message ?? value.Error.Message; - } - return value; -}, "parseXmlErrorBody"); -var loadRestXmlErrorCode = /* @__PURE__ */ __name((output, data) => { - if (data?.Error?.Code !== void 0) { - return data.Error.Code; - } - if (data?.Code !== void 0) { - return data.Code; - } - if (output.statusCode == 404) { - return "NotFound"; - } -}, "loadRestXmlErrorCode"); - -// src/submodules/protocols/xml/XmlShapeSerializer.ts -var import_xml_builder = __nccwpck_require__(4274); -var import_protocols8 = __nccwpck_require__(3422); -var import_schema10 = __nccwpck_require__(6890); -var import_serde6 = __nccwpck_require__(2430); -var import_smithy_client6 = __nccwpck_require__(1411); -var import_util_base644 = __nccwpck_require__(8385); -var XmlShapeSerializer = class extends SerdeContextConfig { - constructor(settings) { - super(); - this.settings = settings; - } - static { - __name(this, "XmlShapeSerializer"); - } - stringBuffer; - byteBuffer; - buffer; - write(schema, value) { - const ns = import_schema10.NormalizedSchema.of(schema); - if (ns.isStringSchema() && typeof value === "string") { - this.stringBuffer = value; - } else if (ns.isBlobSchema()) { - this.byteBuffer = "byteLength" in value ? value : (this.serdeContext?.base64Decoder ?? import_util_base644.fromBase64)(value); - } else { - this.buffer = this.writeStruct(ns, value, void 0); - const traits = ns.getMergedTraits(); - if (traits.httpPayload && !traits.xmlName) { - this.buffer.withName(ns.getName()); - } - } - } - flush() { - if (this.byteBuffer !== void 0) { - const bytes = this.byteBuffer; - delete this.byteBuffer; - return bytes; - } - if (this.stringBuffer !== void 0) { - const str = this.stringBuffer; - delete this.stringBuffer; - return str; - } - const buffer = this.buffer; - if (this.settings.xmlNamespace) { - if (!buffer?.attributes?.["xmlns"]) { - buffer.addAttribute("xmlns", this.settings.xmlNamespace); - } - } - delete this.buffer; - return buffer.toString(); - } - writeStruct(ns, value, parentXmlns) { - const traits = ns.getMergedTraits(); - const name = ns.isMemberSchema() && !traits.httpPayload ? ns.getMemberTraits().xmlName ?? ns.getMemberName() : traits.xmlName ?? ns.getName(); - if (!name || !ns.isStructSchema()) { - throw new Error( - `@aws-sdk/core/protocols - xml serializer, cannot write struct with empty name or non-struct, schema=${ns.getName( - true - )}.` - ); - } - const structXmlNode = import_xml_builder.XmlNode.of(name); - const [xmlnsAttr, xmlns] = this.getXmlnsAttribute(ns, parentXmlns); - for (const [memberName, memberSchema] of ns.structIterator()) { - const val = value[memberName]; - if (val != null || memberSchema.isIdempotencyToken()) { - if (memberSchema.getMergedTraits().xmlAttribute) { - structXmlNode.addAttribute( - memberSchema.getMergedTraits().xmlName ?? memberName, - this.writeSimple(memberSchema, val) - ); - continue; - } - if (memberSchema.isListSchema()) { - this.writeList(memberSchema, val, structXmlNode, xmlns); - } else if (memberSchema.isMapSchema()) { - this.writeMap(memberSchema, val, structXmlNode, xmlns); - } else if (memberSchema.isStructSchema()) { - structXmlNode.addChildNode(this.writeStruct(memberSchema, val, xmlns)); - } else { - const memberNode = import_xml_builder.XmlNode.of(memberSchema.getMergedTraits().xmlName ?? memberSchema.getMemberName()); - this.writeSimpleInto(memberSchema, val, memberNode, xmlns); - structXmlNode.addChildNode(memberNode); - } - } - } - if (xmlns) { - structXmlNode.addAttribute(xmlnsAttr, xmlns); - } - return structXmlNode; - } - writeList(listMember, array, container, parentXmlns) { - if (!listMember.isMemberSchema()) { - throw new Error( - `@aws-sdk/core/protocols - xml serializer, cannot write non-member list: ${listMember.getName(true)}` - ); } - const listTraits = listMember.getMergedTraits(); - const listValueSchema = listMember.getValueSchema(); - const listValueTraits = listValueSchema.getMergedTraits(); - const sparse = !!listValueTraits.sparse; - const flat = !!listTraits.xmlFlattened; - const [xmlnsAttr, xmlns] = this.getXmlnsAttribute(listMember, parentXmlns); - const writeItem = /* @__PURE__ */ __name((container2, value) => { - if (listValueSchema.isListSchema()) { - this.writeList(listValueSchema, Array.isArray(value) ? value : [value], container2, xmlns); - } else if (listValueSchema.isMapSchema()) { - this.writeMap(listValueSchema, value, container2, xmlns); - } else if (listValueSchema.isStructSchema()) { - const struct = this.writeStruct(listValueSchema, value, xmlns); - container2.addChildNode( - struct.withName(flat ? listTraits.xmlName ?? listMember.getMemberName() : listValueTraits.xmlName ?? "member") - ); - } else { - const listItemNode = import_xml_builder.XmlNode.of( - flat ? listTraits.xmlName ?? listMember.getMemberName() : listValueTraits.xmlName ?? "member" - ); - this.writeSimpleInto(listValueSchema, value, listItemNode, xmlns); - container2.addChildNode(listItemNode); - } - }, "writeItem"); - if (flat) { - for (const value of array) { - if (sparse || value != null) { - writeItem(container, value); - } - } - } else { - const listNode = import_xml_builder.XmlNode.of(listTraits.xmlName ?? listMember.getMemberName()); - if (xmlns) { - listNode.addAttribute(xmlnsAttr, xmlns); - } - for (const value of array) { - if (sparse || value != null) { - writeItem(listNode, value); + l(input, listName, memberName, valueProvider) { + if (input[listName] != null) { + const nodes = valueProvider(); + nodes.map((node) => { + node.withName(memberName); + this.c(node); + }); } - } - container.addChildNode(listNode); } - } - writeMap(mapMember, map, container, parentXmlns, containerIsMap = false) { - if (!mapMember.isMemberSchema()) { - throw new Error( - `@aws-sdk/core/protocols - xml serializer, cannot write non-member map: ${mapMember.getName(true)}` - ); - } - const mapTraits = mapMember.getMergedTraits(); - const mapKeySchema = mapMember.getKeySchema(); - const mapKeyTraits = mapKeySchema.getMergedTraits(); - const keyTag = mapKeyTraits.xmlName ?? "key"; - const mapValueSchema = mapMember.getValueSchema(); - const mapValueTraits = mapValueSchema.getMergedTraits(); - const valueTag = mapValueTraits.xmlName ?? "value"; - const sparse = !!mapValueTraits.sparse; - const flat = !!mapTraits.xmlFlattened; - const [xmlnsAttr, xmlns] = this.getXmlnsAttribute(mapMember, parentXmlns); - const addKeyValue = /* @__PURE__ */ __name((entry, key, val) => { - const keyNode = import_xml_builder.XmlNode.of(keyTag, key); - const [keyXmlnsAttr, keyXmlns] = this.getXmlnsAttribute(mapKeySchema, xmlns); - if (keyXmlns) { - keyNode.addAttribute(keyXmlnsAttr, keyXmlns); - } - entry.addChildNode(keyNode); - let valueNode = import_xml_builder.XmlNode.of(valueTag); - if (mapValueSchema.isListSchema()) { - this.writeList(mapValueSchema, val, valueNode, xmlns); - } else if (mapValueSchema.isMapSchema()) { - this.writeMap(mapValueSchema, val, valueNode, xmlns, true); - } else if (mapValueSchema.isStructSchema()) { - valueNode = this.writeStruct(mapValueSchema, val, xmlns); - } else { - this.writeSimpleInto(mapValueSchema, val, valueNode, xmlns); - } - entry.addChildNode(valueNode); - }, "addKeyValue"); - if (flat) { - for (const [key, val] of Object.entries(map)) { - if (sparse || val != null) { - const entry = import_xml_builder.XmlNode.of(mapTraits.xmlName ?? mapMember.getMemberName()); - addKeyValue(entry, key, val); - container.addChildNode(entry); - } - } - } else { - let mapNode; - if (!containerIsMap) { - mapNode = import_xml_builder.XmlNode.of(mapTraits.xmlName ?? mapMember.getMemberName()); - if (xmlns) { - mapNode.addAttribute(xmlnsAttr, xmlns); - } - container.addChildNode(mapNode); - } - for (const [key, val] of Object.entries(map)) { - if (sparse || val != null) { - const entry = import_xml_builder.XmlNode.of("entry"); - addKeyValue(entry, key, val); - (containerIsMap ? container : mapNode).addChildNode(entry); + lc(input, listName, memberName, valueProvider) { + if (input[listName] != null) { + const nodes = valueProvider(); + const containerNode = new XmlNode(memberName); + nodes.map((node) => { + containerNode.c(node); + }); + this.c(containerNode); } - } - } - } - writeSimple(_schema, value) { - if (null === value) { - throw new Error("@aws-sdk/core/protocols - (XML serializer) cannot write null value."); } - const ns = import_schema10.NormalizedSchema.of(_schema); - let nodeContents = null; - if (value && typeof value === "object") { - if (ns.isBlobSchema()) { - nodeContents = (this.serdeContext?.base64Encoder ?? import_util_base644.toBase64)(value); - } else if (ns.isTimestampSchema() && value instanceof Date) { - const format = (0, import_protocols8.determineTimestampFormat)(ns, this.settings); - switch (format) { - case import_schema10.SCHEMA.TIMESTAMP_DATE_TIME: - nodeContents = value.toISOString().replace(".000Z", "Z"); - break; - case import_schema10.SCHEMA.TIMESTAMP_HTTP_DATE: - nodeContents = (0, import_smithy_client6.dateToUtcString)(value); - break; - case import_schema10.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - nodeContents = String(value.getTime() / 1e3); - break; - default: - console.warn("Missing timestamp format, using http date", value); - nodeContents = (0, import_smithy_client6.dateToUtcString)(value); - break; - } - } else if (ns.isBigDecimalSchema() && value) { - if (value instanceof import_serde6.NumericValue) { - return value.string; + toString() { + const hasChildren = Boolean(this.children.length); + let xmlText = `<${this.name}`; + const attributes = this.attributes; + for (const attributeName of Object.keys(attributes)) { + const attribute = attributes[attributeName]; + if (attribute != null) { + xmlText += ` ${attributeName}="${escapeAttribute("" + attribute)}"`; + } } - return String(value); - } else if (ns.isMapSchema() || ns.isListSchema()) { - throw new Error( - "@aws-sdk/core/protocols - xml serializer, cannot call _write() on List/Map schema, call writeList or writeMap() instead." - ); - } else { - throw new Error( - `@aws-sdk/core/protocols - xml serializer, unhandled schema type for object value and schema: ${ns.getName( - true - )}` - ); - } - } - if (ns.isBooleanSchema() || ns.isNumericSchema() || ns.isBigIntegerSchema() || ns.isBigDecimalSchema()) { - nodeContents = String(value); + return (xmlText += !hasChildren ? "/>" : `>${this.children.map((c) => c.toString()).join("")}`); } - if (ns.isStringSchema()) { - if (value === void 0 && ns.isIdempotencyToken()) { - nodeContents = (0, import_serde6.generateIdempotencyToken)(); - } else { - nodeContents = String(value); - } - } - if (nodeContents === null) { - throw new Error(`Unhandled schema-value pair ${ns.getName(true)}=${value}`); - } - return nodeContents; - } - writeSimpleInto(_schema, value, into, parentXmlns) { - const nodeContents = this.writeSimple(_schema, value); - const ns = import_schema10.NormalizedSchema.of(_schema); - const content = new import_xml_builder.XmlText(nodeContents); - const [xmlnsAttr, xmlns] = this.getXmlnsAttribute(ns, parentXmlns); - if (xmlns) { - into.addAttribute(xmlnsAttr, xmlns); - } - into.addChildNode(content); - } - getXmlnsAttribute(ns, parentXmlns) { - const traits = ns.getMergedTraits(); - const [prefix, xmlns] = traits.xmlNamespace ?? []; - if (xmlns && xmlns !== parentXmlns) { - return [prefix ? `xmlns:${prefix}` : "xmlns", xmlns]; - } - return [void 0, void 0]; - } -}; - -// src/submodules/protocols/xml/XmlCodec.ts -var XmlCodec = class extends SerdeContextConfig { - constructor(settings) { - super(); - this.settings = settings; - } - static { - __name(this, "XmlCodec"); - } - createSerializer() { - const serializer = new XmlShapeSerializer(this.settings); - serializer.setSerdeContext(this.serdeContext); - return serializer; - } - createDeserializer() { - const deserializer = new XmlShapeDeserializer(this.settings); - deserializer.setSerdeContext(this.serdeContext); - return deserializer; - } -}; +} -// src/submodules/protocols/xml/AwsRestXmlProtocol.ts -var AwsRestXmlProtocol = class extends import_protocols9.HttpBindingProtocol { - static { - __name(this, "AwsRestXmlProtocol"); - } - codec; - serializer; - deserializer; - mixin = new ProtocolLib(); - constructor(options) { - super(options); - const settings = { - timestampFormat: { - useTrait: true, - default: import_schema11.SCHEMA.TIMESTAMP_DATE_TIME - }, - httpBindings: true, - xmlNamespace: options.xmlNamespace, - serviceNamespace: options.defaultNamespace - }; - this.codec = new XmlCodec(settings); - this.serializer = new import_protocols9.HttpInterceptingShapeSerializer(this.codec.createSerializer(), settings); - this.deserializer = new import_protocols9.HttpInterceptingShapeDeserializer(this.codec.createDeserializer(), settings); - } - getPayloadCodec() { - return this.codec; - } - getShapeId() { - return "aws.protocols#restXml"; - } - async serializeRequest(operationSchema, input, context) { - const request = await super.serializeRequest(operationSchema, input, context); - const inputSchema = import_schema11.NormalizedSchema.of(operationSchema.input); - if (!request.headers["content-type"]) { - const contentType = this.mixin.resolveRestContentType(this.getDefaultContentType(), inputSchema); - if (contentType) { - request.headers["content-type"] = contentType; - } - } - if (request.headers["content-type"] === this.getDefaultContentType()) { - if (typeof request.body === "string") { - request.body = '' + request.body; - } - } - if (request.body) { - try { - request.headers["content-length"] = this.mixin.calculateContentLength(request.body, this.serdeContext); - } catch (e) { - } - } - return request; - } - async deserializeResponse(operationSchema, context, response) { - return super.deserializeResponse(operationSchema, context, response); - } - async handleError(operationSchema, context, response, dataObject, metadata) { - const errorIdentifier = loadRestXmlErrorCode(response, dataObject) ?? "Unknown"; - const { errorSchema, errorMetadata } = await this.mixin.getErrorSchemaOrThrowBaseException( - errorIdentifier, - this.options.defaultNamespace, - response, - dataObject, - metadata - ); - const ns = import_schema11.NormalizedSchema.of(errorSchema); - const message = dataObject.Error?.message ?? dataObject.Error?.Message ?? dataObject.message ?? dataObject.Message ?? "Unknown"; - const exception = new errorSchema.ctor(message); - await this.deserializeHttpMessage(errorSchema, context, response, dataObject); - const output = {}; - for (const [name, member] of ns.structIterator()) { - const target = member.getMergedTraits().xmlName ?? name; - const value = dataObject.Error?.[target] ?? dataObject[target]; - output[name] = this.codec.createDeserializer().readSchema(member, value); - } - throw Object.assign( - exception, - errorMetadata, - { - $fault: ns.getMergedTraits().error, - message - }, - output - ); - } - /** - * @override - */ - getDefaultContentType() { - return "application/xml"; - } -}; -// Annotate the CommonJS export names for ESM import in node: -0 && (0); +Object.defineProperty(exports, "parseXML", ({ + enumerable: true, + get: function () { return xmlParser.parseXML; } +})); +exports.XmlNode = XmlNode; +exports.XmlText = XmlText; /***/ }), -/***/ 5606: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 3343: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - ENV_ACCOUNT_ID: () => ENV_ACCOUNT_ID, - ENV_CREDENTIAL_SCOPE: () => ENV_CREDENTIAL_SCOPE, - ENV_EXPIRATION: () => ENV_EXPIRATION, - ENV_KEY: () => ENV_KEY, - ENV_SECRET: () => ENV_SECRET, - ENV_SESSION: () => ENV_SESSION, - fromEnv: () => fromEnv +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.parseXML = parseXML; +const fast_xml_parser_1 = __nccwpck_require__(591); +const parser = new fast_xml_parser_1.XMLParser({ + attributeNamePrefix: "", + htmlEntities: true, + ignoreAttributes: false, + ignoreDeclaration: true, + parseTagValue: false, + trimValues: false, + tagValueProcessor: (_, val) => (val.trim() === "" && val.includes("\n") ? "" : undefined), }); -module.exports = __toCommonJS(index_exports); - -// src/fromEnv.ts -var import_client = __nccwpck_require__(5152); -var import_property_provider = __nccwpck_require__(1238); -var ENV_KEY = "AWS_ACCESS_KEY_ID"; -var ENV_SECRET = "AWS_SECRET_ACCESS_KEY"; -var ENV_SESSION = "AWS_SESSION_TOKEN"; -var ENV_EXPIRATION = "AWS_CREDENTIAL_EXPIRATION"; -var ENV_CREDENTIAL_SCOPE = "AWS_CREDENTIAL_SCOPE"; -var ENV_ACCOUNT_ID = "AWS_ACCOUNT_ID"; -var fromEnv = /* @__PURE__ */ __name((init) => async () => { - init?.logger?.debug("@aws-sdk/credential-provider-env - fromEnv"); - const accessKeyId = process.env[ENV_KEY]; - const secretAccessKey = process.env[ENV_SECRET]; - const sessionToken = process.env[ENV_SESSION]; - const expiry = process.env[ENV_EXPIRATION]; - const credentialScope = process.env[ENV_CREDENTIAL_SCOPE]; - const accountId = process.env[ENV_ACCOUNT_ID]; - if (accessKeyId && secretAccessKey) { - const credentials = { - accessKeyId, - secretAccessKey, - ...sessionToken && { sessionToken }, - ...expiry && { expiration: new Date(expiry) }, - ...credentialScope && { credentialScope }, - ...accountId && { accountId } - }; - (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_ENV_VARS", "g"); - return credentials; - } - throw new import_property_provider.CredentialsProviderError("Unable to find environment variable credentials.", { logger: init?.logger }); -}, "fromEnv"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - +parser.addEntity("#xD", "\r"); +parser.addEntity("#10", "\n"); +function parseXML(xmlString) { + return parser.parse(xmlString, true); +} /***/ }), -/***/ 1509: +/***/ 9320: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.checkUrl = void 0; -const property_provider_1 = __nccwpck_require__(1238); -const LOOPBACK_CIDR_IPv4 = "127.0.0.0/8"; -const LOOPBACK_CIDR_IPv6 = "::1/128"; -const ECS_CONTAINER_HOST = "169.254.170.2"; -const EKS_CONTAINER_HOST_IPv4 = "169.254.170.23"; -const EKS_CONTAINER_HOST_IPv6 = "[fd00:ec2::23]"; -const checkUrl = (url, logger) => { - if (url.protocol === "https:") { - return; + +var async_hooks = __nccwpck_require__(290); + +const noGlobalAwsLambda = process.env["AWS_LAMBDA_NODEJS_NO_GLOBAL_AWSLAMBDA"] === "1" || + process.env["AWS_LAMBDA_NODEJS_NO_GLOBAL_AWSLAMBDA"] === "true"; +if (!noGlobalAwsLambda) { + globalThis.awslambda = globalThis.awslambda || {}; +} +const PROTECTED_KEYS = { + REQUEST_ID: Symbol("_AWS_LAMBDA_REQUEST_ID"), + X_RAY_TRACE_ID: Symbol("_AWS_LAMBDA_X_RAY_TRACE_ID"), + TENANT_ID: Symbol("_AWS_LAMBDA_TENANT_ID"), +}; +class InvokeStoreImpl { + static storage = new async_hooks.AsyncLocalStorage(); + static PROTECTED_KEYS = PROTECTED_KEYS; + static run(context, fn) { + return this.storage.run({ ...context }, fn); } - if (url.hostname === ECS_CONTAINER_HOST || - url.hostname === EKS_CONTAINER_HOST_IPv4 || - url.hostname === EKS_CONTAINER_HOST_IPv6) { - return; + static getContext() { + return this.storage.getStore(); } - if (url.hostname.includes("[")) { - if (url.hostname === "[::1]" || url.hostname === "[0000:0000:0000:0000:0000:0000:0000:0001]") { - return; - } + static get(key) { + const context = this.storage.getStore(); + return context?.[key]; } - else { - if (url.hostname === "localhost") { - return; + static set(key, value) { + if (this.isProtectedKey(key)) { + throw new Error(`Cannot modify protected Lambda context field`); } - const ipComponents = url.hostname.split("."); - const inRange = (component) => { - const num = parseInt(component, 10); - return 0 <= num && num <= 255; - }; - if (ipComponents[0] === "127" && - inRange(ipComponents[1]) && - inRange(ipComponents[2]) && - inRange(ipComponents[3]) && - ipComponents.length === 4) { - return; + const context = this.storage.getStore(); + if (context) { + context[key] = value; } } - throw new property_provider_1.CredentialsProviderError(`URL not accepted. It must either be HTTPS or match one of the following: - - loopback CIDR 127.0.0.0/8 or [::1/128] - - ECS container host 169.254.170.2 - - EKS container host 169.254.170.23 or [fd00:ec2::23]`, { logger }); -}; -exports.checkUrl = checkUrl; + static getRequestId() { + return this.get(this.PROTECTED_KEYS.REQUEST_ID) ?? "-"; + } + static getXRayTraceId() { + return this.get(this.PROTECTED_KEYS.X_RAY_TRACE_ID); + } + static getTenantId() { + return this.get(this.PROTECTED_KEYS.TENANT_ID); + } + static hasContext() { + return this.storage.getStore() !== undefined; + } + static isProtectedKey(key) { + return (key === this.PROTECTED_KEYS.REQUEST_ID || + key === this.PROTECTED_KEYS.X_RAY_TRACE_ID); + } +} +let instance; +if (!noGlobalAwsLambda && globalThis.awslambda?.InvokeStore) { + instance = globalThis.awslambda.InvokeStore; +} +else { + instance = InvokeStoreImpl; + if (!noGlobalAwsLambda && globalThis.awslambda) { + globalThis.awslambda.InvokeStore = instance; + } +} +const InvokeStore = instance; + +exports.InvokeStore = InvokeStore; /***/ }), -/***/ 8712: +/***/ 9316: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromHttp = void 0; -const tslib_1 = __nccwpck_require__(1860); -const client_1 = __nccwpck_require__(5152); -const node_http_handler_1 = __nccwpck_require__(1279); -const property_provider_1 = __nccwpck_require__(1238); -const promises_1 = tslib_1.__importDefault(__nccwpck_require__(1943)); -const checkUrl_1 = __nccwpck_require__(1509); -const requestHelpers_1 = __nccwpck_require__(8914); -const retry_wrapper_1 = __nccwpck_require__(1122); -const AWS_CONTAINER_CREDENTIALS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; -const DEFAULT_LINK_LOCAL_HOST = "http://169.254.170.2"; -const AWS_CONTAINER_CREDENTIALS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; -const AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE = "AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE"; -const AWS_CONTAINER_AUTHORIZATION_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; -const fromHttp = (options = {}) => { - options.logger?.debug("@aws-sdk/credential-provider-http - fromHttp"); - let host; - const relative = options.awsContainerCredentialsRelativeUri ?? process.env[AWS_CONTAINER_CREDENTIALS_RELATIVE_URI]; - const full = options.awsContainerCredentialsFullUri ?? process.env[AWS_CONTAINER_CREDENTIALS_FULL_URI]; - const token = options.awsContainerAuthorizationToken ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN]; - const tokenFile = options.awsContainerAuthorizationTokenFile ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE]; - const warn = options.logger?.constructor?.name === "NoOpLogger" || !options.logger?.warn - ? console.warn - : options.logger.warn.bind(options.logger); - if (relative && full) { - warn("@aws-sdk/credential-provider-http: " + - "you have set both awsContainerCredentialsRelativeUri and awsContainerCredentialsFullUri."); - warn("awsContainerCredentialsFullUri will take precedence."); - } - if (token && tokenFile) { - warn("@aws-sdk/credential-provider-http: " + - "you have set both awsContainerAuthorizationToken and awsContainerAuthorizationTokenFile."); - warn("awsContainerAuthorizationToken will take precedence."); - } - if (full) { - host = full; - } - else if (relative) { - host = `${DEFAULT_LINK_LOCAL_HOST}${relative}`; - } - else { - throw new property_provider_1.CredentialsProviderError(`No HTTP credential provider host provided. -Set AWS_CONTAINER_CREDENTIALS_FULL_URI or AWS_CONTAINER_CREDENTIALS_RELATIVE_URI.`, { logger: options.logger }); - } - const url = new URL(host); - (0, checkUrl_1.checkUrl)(url, options.logger); - const requestHandler = node_http_handler_1.NodeHttpHandler.create({ - requestTimeout: options.timeout ?? 1000, - connectionTimeout: options.timeout ?? 1000, - }); - return (0, retry_wrapper_1.retryWrapper)(async () => { - const request = (0, requestHelpers_1.createGetRequest)(url); - if (token) { - request.headers.Authorization = token; - } - else if (tokenFile) { - request.headers.Authorization = (await promises_1.default.readFile(tokenFile)).toString(); - } - try { - const result = await requestHandler.handle(request); - return (0, requestHelpers_1.getCredentials)(result.response).then((creds) => (0, client_1.setCredentialFeature)(creds, "CREDENTIALS_HTTP", "z")); - } - catch (e) { - throw new property_provider_1.CredentialsProviderError(String(e), { logger: options.logger }); - } - }, options.maxRetries ?? 3, options.timeout ?? 1000); -}; -exports.fromHttp = fromHttp; +var utilConfigProvider = __nccwpck_require__(6716); +var utilMiddleware = __nccwpck_require__(6324); +var utilEndpoints = __nccwpck_require__(9674); -/***/ }), +const ENV_USE_DUALSTACK_ENDPOINT = "AWS_USE_DUALSTACK_ENDPOINT"; +const CONFIG_USE_DUALSTACK_ENDPOINT = "use_dualstack_endpoint"; +const DEFAULT_USE_DUALSTACK_ENDPOINT = false; +const NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => utilConfigProvider.booleanSelector(env, ENV_USE_DUALSTACK_ENDPOINT, utilConfigProvider.SelectorType.ENV), + configFileSelector: (profile) => utilConfigProvider.booleanSelector(profile, CONFIG_USE_DUALSTACK_ENDPOINT, utilConfigProvider.SelectorType.CONFIG), + default: false, +}; -/***/ 8914: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +const ENV_USE_FIPS_ENDPOINT = "AWS_USE_FIPS_ENDPOINT"; +const CONFIG_USE_FIPS_ENDPOINT = "use_fips_endpoint"; +const DEFAULT_USE_FIPS_ENDPOINT = false; +const NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => utilConfigProvider.booleanSelector(env, ENV_USE_FIPS_ENDPOINT, utilConfigProvider.SelectorType.ENV), + configFileSelector: (profile) => utilConfigProvider.booleanSelector(profile, CONFIG_USE_FIPS_ENDPOINT, utilConfigProvider.SelectorType.CONFIG), + default: false, +}; -"use strict"; +const resolveCustomEndpointsConfig = (input) => { + const { tls, endpoint, urlParser, useDualstackEndpoint } = input; + return Object.assign(input, { + tls: tls ?? true, + endpoint: utilMiddleware.normalizeProvider(typeof endpoint === "string" ? urlParser(endpoint) : endpoint), + isCustomEndpoint: true, + useDualstackEndpoint: utilMiddleware.normalizeProvider(useDualstackEndpoint ?? false), + }); +}; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.createGetRequest = createGetRequest; -exports.getCredentials = getCredentials; -const property_provider_1 = __nccwpck_require__(1238); -const protocol_http_1 = __nccwpck_require__(2356); -const smithy_client_1 = __nccwpck_require__(1411); -const util_stream_1 = __nccwpck_require__(4252); -function createGetRequest(url) { - return new protocol_http_1.HttpRequest({ - protocol: url.protocol, - hostname: url.hostname, - port: Number(url.port), - path: url.pathname, - query: Array.from(url.searchParams.entries()).reduce((acc, [k, v]) => { - acc[k] = v; - return acc; - }, {}), - fragment: url.hash, +const getEndpointFromRegion = async (input) => { + const { tls = true } = input; + const region = await input.region(); + const dnsHostRegex = new RegExp(/^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9-]{0,61}[a-zA-Z0-9])$/); + if (!dnsHostRegex.test(region)) { + throw new Error("Invalid region in client config"); + } + const useDualstackEndpoint = await input.useDualstackEndpoint(); + const useFipsEndpoint = await input.useFipsEndpoint(); + const { hostname } = (await input.regionInfoProvider(region, { useDualstackEndpoint, useFipsEndpoint })) ?? {}; + if (!hostname) { + throw new Error("Cannot resolve hostname from client config"); + } + return input.urlParser(`${tls ? "https:" : "http:"}//${hostname}`); +}; + +const resolveEndpointsConfig = (input) => { + const useDualstackEndpoint = utilMiddleware.normalizeProvider(input.useDualstackEndpoint ?? false); + const { endpoint, useFipsEndpoint, urlParser, tls } = input; + return Object.assign(input, { + tls: tls ?? true, + endpoint: endpoint + ? utilMiddleware.normalizeProvider(typeof endpoint === "string" ? urlParser(endpoint) : endpoint) + : () => getEndpointFromRegion({ ...input, useDualstackEndpoint, useFipsEndpoint }), + isCustomEndpoint: !!endpoint, + useDualstackEndpoint, }); -} -async function getCredentials(response, logger) { - const stream = (0, util_stream_1.sdkStreamMixin)(response.body); - const str = await stream.transformToString(); - if (response.statusCode === 200) { - const parsed = JSON.parse(str); - if (typeof parsed.AccessKeyId !== "string" || - typeof parsed.SecretAccessKey !== "string" || - typeof parsed.Token !== "string" || - typeof parsed.Expiration !== "string") { - throw new property_provider_1.CredentialsProviderError("HTTP credential provider response not of the required format, an object matching: " + - "{ AccessKeyId: string, SecretAccessKey: string, Token: string, Expiration: string(rfc3339) }", { logger }); +}; + +const REGION_ENV_NAME = "AWS_REGION"; +const REGION_INI_NAME = "region"; +const NODE_REGION_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[REGION_ENV_NAME], + configFileSelector: (profile) => profile[REGION_INI_NAME], + default: () => { + throw new Error("Region is missing"); + }, +}; +const NODE_REGION_CONFIG_FILE_OPTIONS = { + preferredFile: "credentials", +}; + +const validRegions = new Set(); +const checkRegion = (region, check = utilEndpoints.isValidHostLabel) => { + if (!validRegions.has(region) && !check(region)) { + if (region === "*") { + console.warn(`@smithy/config-resolver WARN - Please use the caller region instead of "*". See "sigv4a" in https://github.com/aws/aws-sdk-js-v3/blob/main/supplemental-docs/CLIENTS.md.`); } - return { - accessKeyId: parsed.AccessKeyId, - secretAccessKey: parsed.SecretAccessKey, - sessionToken: parsed.Token, - expiration: (0, smithy_client_1.parseRfc3339DateTime)(parsed.Expiration), - }; - } - if (response.statusCode >= 400 && response.statusCode < 500) { - let parsedBody = {}; - try { - parsedBody = JSON.parse(str); + else { + throw new Error(`Region not accepted: region="${region}" is not a valid hostname component.`); } - catch (e) { } - throw Object.assign(new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }), { - Code: parsedBody.Code, - Message: parsedBody.Message, - }); } - throw new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }); -} + else { + validRegions.add(region); + } +}; +const isFipsRegion = (region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")); -/***/ }), +const getRealRegion = (region) => isFipsRegion(region) + ? ["fips-aws-global", "aws-fips"].includes(region) + ? "us-east-1" + : region.replace(/fips-(dkr-|prod-)?|-fips/, "") + : region; -/***/ 1122: -/***/ ((__unused_webpack_module, exports) => { +const resolveRegionConfig = (input) => { + const { region, useFipsEndpoint } = input; + if (!region) { + throw new Error("Region is missing"); + } + return Object.assign(input, { + region: async () => { + const providedRegion = typeof region === "function" ? await region() : region; + const realRegion = getRealRegion(providedRegion); + checkRegion(realRegion); + return realRegion; + }, + useFipsEndpoint: async () => { + const providedRegion = typeof region === "string" ? region : await region(); + if (isFipsRegion(providedRegion)) { + return true; + } + return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); + }, + }); +}; -"use strict"; +const getHostnameFromVariants = (variants = [], { useFipsEndpoint, useDualstackEndpoint }) => variants.find(({ tags }) => useFipsEndpoint === tags.includes("fips") && useDualstackEndpoint === tags.includes("dualstack"))?.hostname; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.retryWrapper = void 0; -const retryWrapper = (toRetry, maxRetries, delayMs) => { - return async () => { - for (let i = 0; i < maxRetries; ++i) { - try { - return await toRetry(); - } - catch (e) { - await new Promise((resolve) => setTimeout(resolve, delayMs)); - } +const getResolvedHostname = (resolvedRegion, { regionHostname, partitionHostname }) => regionHostname + ? regionHostname + : partitionHostname + ? partitionHostname.replace("{region}", resolvedRegion) + : undefined; + +const getResolvedPartition = (region, { partitionHash }) => Object.keys(partitionHash || {}).find((key) => partitionHash[key].regions.includes(region)) ?? "aws"; + +const getResolvedSigningRegion = (hostname, { signingRegion, regionRegex, useFipsEndpoint }) => { + if (signingRegion) { + return signingRegion; + } + else if (useFipsEndpoint) { + const regionRegexJs = regionRegex.replace("\\\\", "\\").replace(/^\^/g, "\\.").replace(/\$$/g, "\\."); + const regionRegexmatchArray = hostname.match(regionRegexJs); + if (regionRegexmatchArray) { + return regionRegexmatchArray[0].slice(1, -1); } - return await toRetry(); + } +}; + +const getRegionInfo = (region, { useFipsEndpoint = false, useDualstackEndpoint = false, signingService, regionHash, partitionHash, }) => { + const partition = getResolvedPartition(region, { partitionHash }); + const resolvedRegion = region in regionHash ? region : partitionHash[partition]?.endpoint ?? region; + const hostnameOptions = { useFipsEndpoint, useDualstackEndpoint }; + const regionHostname = getHostnameFromVariants(regionHash[resolvedRegion]?.variants, hostnameOptions); + const partitionHostname = getHostnameFromVariants(partitionHash[partition]?.variants, hostnameOptions); + const hostname = getResolvedHostname(resolvedRegion, { regionHostname, partitionHostname }); + if (hostname === undefined) { + throw new Error(`Endpoint resolution failed for: ${{ resolvedRegion, useFipsEndpoint, useDualstackEndpoint }}`); + } + const signingRegion = getResolvedSigningRegion(hostname, { + signingRegion: regionHash[resolvedRegion]?.signingRegion, + regionRegex: partitionHash[partition].regionRegex, + useFipsEndpoint, + }); + return { + partition, + signingService, + hostname, + ...(signingRegion && { signingRegion }), + ...(regionHash[resolvedRegion]?.signingService && { + signingService: regionHash[resolvedRegion].signingService, + }), }; }; -exports.retryWrapper = retryWrapper; + +exports.CONFIG_USE_DUALSTACK_ENDPOINT = CONFIG_USE_DUALSTACK_ENDPOINT; +exports.CONFIG_USE_FIPS_ENDPOINT = CONFIG_USE_FIPS_ENDPOINT; +exports.DEFAULT_USE_DUALSTACK_ENDPOINT = DEFAULT_USE_DUALSTACK_ENDPOINT; +exports.DEFAULT_USE_FIPS_ENDPOINT = DEFAULT_USE_FIPS_ENDPOINT; +exports.ENV_USE_DUALSTACK_ENDPOINT = ENV_USE_DUALSTACK_ENDPOINT; +exports.ENV_USE_FIPS_ENDPOINT = ENV_USE_FIPS_ENDPOINT; +exports.NODE_REGION_CONFIG_FILE_OPTIONS = NODE_REGION_CONFIG_FILE_OPTIONS; +exports.NODE_REGION_CONFIG_OPTIONS = NODE_REGION_CONFIG_OPTIONS; +exports.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS; +exports.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS; +exports.REGION_ENV_NAME = REGION_ENV_NAME; +exports.REGION_INI_NAME = REGION_INI_NAME; +exports.getRegionInfo = getRegionInfo; +exports.resolveCustomEndpointsConfig = resolveCustomEndpointsConfig; +exports.resolveEndpointsConfig = resolveEndpointsConfig; +exports.resolveRegionConfig = resolveRegionConfig; /***/ }), -/***/ 8605: +/***/ 402: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromHttp = void 0; -var fromHttp_1 = __nccwpck_require__(8712); -Object.defineProperty(exports, "fromHttp", ({ enumerable: true, get: function () { return fromHttp_1.fromHttp; } })); - -/***/ }), - -/***/ 5869: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +var types = __nccwpck_require__(690); +var utilMiddleware = __nccwpck_require__(6324); +var middlewareSerde = __nccwpck_require__(3255); +var protocolHttp = __nccwpck_require__(2356); +var protocols = __nccwpck_require__(3422); -"use strict"; +const getSmithyContext = (context) => context[types.SMITHY_CONTEXT_KEY] || (context[types.SMITHY_CONTEXT_KEY] = {}); -var __create = Object.create; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); +const resolveAuthOptions = (candidateAuthOptions, authSchemePreference) => { + if (!authSchemePreference || authSchemePreference.length === 0) { + return candidateAuthOptions; + } + const preferredAuthOptions = []; + for (const preferredSchemeName of authSchemePreference) { + for (const candidateAuthOption of candidateAuthOptions) { + const candidateAuthSchemeName = candidateAuthOption.schemeId.split("#")[1]; + if (candidateAuthSchemeName === preferredSchemeName) { + preferredAuthOptions.push(candidateAuthOption); + } + } + } + for (const candidateAuthOption of candidateAuthOptions) { + if (!preferredAuthOptions.find(({ schemeId }) => schemeId === candidateAuthOption.schemeId)) { + preferredAuthOptions.push(candidateAuthOption); + } + } + return preferredAuthOptions; }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; + +function convertHttpAuthSchemesToMap(httpAuthSchemes) { + const map = new Map(); + for (const scheme of httpAuthSchemes) { + map.set(scheme.schemeId, scheme); + } + return map; +} +const httpAuthSchemeMiddleware = (config, mwOptions) => (next, context) => async (args) => { + const options = config.httpAuthSchemeProvider(await mwOptions.httpAuthSchemeParametersProvider(config, context, args.input)); + const authSchemePreference = config.authSchemePreference ? await config.authSchemePreference() : []; + const resolvedOptions = resolveAuthOptions(options, authSchemePreference); + const authSchemes = convertHttpAuthSchemesToMap(config.httpAuthSchemes); + const smithyContext = utilMiddleware.getSmithyContext(context); + const failureReasons = []; + for (const option of resolvedOptions) { + const scheme = authSchemes.get(option.schemeId); + if (!scheme) { + failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` was not enabled for this service.`); + continue; + } + const identityProvider = scheme.identityProvider(await mwOptions.identityProviderConfigProvider(config)); + if (!identityProvider) { + failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` did not have an IdentityProvider configured.`); + continue; + } + const { identityProperties = {}, signingProperties = {} } = option.propertiesExtractor?.(config, context) || {}; + option.identityProperties = Object.assign(option.identityProperties || {}, identityProperties); + option.signingProperties = Object.assign(option.signingProperties || {}, signingProperties); + smithyContext.selectedHttpAuthScheme = { + httpAuthOption: option, + identity: await identityProvider(option.identityProperties), + signer: scheme.signer, + }; + break; + } + if (!smithyContext.selectedHttpAuthScheme) { + throw new Error(failureReasons.join("\n")); + } + return next(args); }; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - fromIni: () => fromIni +const httpAuthSchemeEndpointRuleSetMiddlewareOptions = { + step: "serialize", + tags: ["HTTP_AUTH_SCHEME"], + name: "httpAuthSchemeMiddleware", + override: true, + relation: "before", + toMiddleware: "endpointV2Middleware", +}; +const getHttpAuthSchemeEndpointRuleSetPlugin = (config, { httpAuthSchemeParametersProvider, identityProviderConfigProvider, }) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(httpAuthSchemeMiddleware(config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider, + }), httpAuthSchemeEndpointRuleSetMiddlewareOptions); + }, }); -module.exports = __toCommonJS(index_exports); -// src/fromIni.ts +const httpAuthSchemeMiddlewareOptions = { + step: "serialize", + tags: ["HTTP_AUTH_SCHEME"], + name: "httpAuthSchemeMiddleware", + override: true, + relation: "before", + toMiddleware: middlewareSerde.serializerMiddlewareOption.name, +}; +const getHttpAuthSchemePlugin = (config, { httpAuthSchemeParametersProvider, identityProviderConfigProvider, }) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(httpAuthSchemeMiddleware(config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider, + }), httpAuthSchemeMiddlewareOptions); + }, +}); +const defaultErrorHandler = (signingProperties) => (error) => { + throw error; +}; +const defaultSuccessHandler = (httpResponse, signingProperties) => { }; +const httpSigningMiddleware = (config) => (next, context) => async (args) => { + if (!protocolHttp.HttpRequest.isInstance(args.request)) { + return next(args); + } + const smithyContext = utilMiddleware.getSmithyContext(context); + const scheme = smithyContext.selectedHttpAuthScheme; + if (!scheme) { + throw new Error(`No HttpAuthScheme was selected: unable to sign request`); + } + const { httpAuthOption: { signingProperties = {} }, identity, signer, } = scheme; + const output = await next({ + ...args, + request: await signer.sign(args.request, identity, signingProperties), + }).catch((signer.errorHandler || defaultErrorHandler)(signingProperties)); + (signer.successHandler || defaultSuccessHandler)(output.response, signingProperties); + return output; +}; -// src/resolveProfileData.ts +const httpSigningMiddlewareOptions = { + step: "finalizeRequest", + tags: ["HTTP_SIGNING"], + name: "httpSigningMiddleware", + aliases: ["apiKeyMiddleware", "tokenMiddleware", "awsAuthMiddleware"], + override: true, + relation: "after", + toMiddleware: "retryMiddleware", +}; +const getHttpSigningPlugin = (config) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(httpSigningMiddleware(), httpSigningMiddlewareOptions); + }, +}); +const normalizeProvider = (input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; +}; -// src/resolveAssumeRoleCredentials.ts +const makePagedClientRequest = async (CommandCtor, client, input, withCommand = (_) => _, ...args) => { + let command = new CommandCtor(input); + command = withCommand(command) ?? command; + return await client.send(command, ...args); +}; +function createPaginator(ClientCtor, CommandCtor, inputTokenName, outputTokenName, pageSizeTokenName) { + return async function* paginateOperation(config, input, ...additionalArguments) { + const _input = input; + let token = config.startingToken ?? _input[inputTokenName]; + let hasNext = true; + let page; + while (hasNext) { + _input[inputTokenName] = token; + if (pageSizeTokenName) { + _input[pageSizeTokenName] = _input[pageSizeTokenName] ?? config.pageSize; + } + if (config.client instanceof ClientCtor) { + page = await makePagedClientRequest(CommandCtor, config.client, input, config.withCommand, ...additionalArguments); + } + else { + throw new Error(`Invalid client, expected instance of ${ClientCtor.name}`); + } + yield page; + const prevToken = token; + token = get(page, outputTokenName); + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return undefined; + }; +} +const get = (fromObject, path) => { + let cursor = fromObject; + const pathComponents = path.split("."); + for (const step of pathComponents) { + if (!cursor || typeof cursor !== "object") { + return undefined; + } + cursor = cursor[step]; + } + return cursor; +}; +function setFeature(context, feature, value) { + if (!context.__smithy_context) { + context.__smithy_context = { + features: {}, + }; + } + else if (!context.__smithy_context.features) { + context.__smithy_context.features = {}; + } + context.__smithy_context.features[feature] = value; +} -var import_shared_ini_file_loader = __nccwpck_require__(4964); +class DefaultIdentityProviderConfig { + authSchemes = new Map(); + constructor(config) { + for (const [key, value] of Object.entries(config)) { + if (value !== undefined) { + this.authSchemes.set(key, value); + } + } + } + getIdentityProvider(schemeId) { + return this.authSchemes.get(schemeId); + } +} -// src/resolveCredentialSource.ts -var import_client = __nccwpck_require__(5152); -var import_property_provider = __nccwpck_require__(1238); -var resolveCredentialSource = /* @__PURE__ */ __name((credentialSource, profileName, logger) => { - const sourceProvidersMap = { - EcsContainer: /* @__PURE__ */ __name(async (options) => { - const { fromHttp } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(8605))); - const { fromContainerMetadata } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(566))); - logger?.debug("@aws-sdk/credential-provider-ini - credential_source is EcsContainer"); - return async () => (0, import_property_provider.chain)(fromHttp(options ?? {}), fromContainerMetadata(options))().then(setNamedProvider); - }, "EcsContainer"), - Ec2InstanceMetadata: /* @__PURE__ */ __name(async (options) => { - logger?.debug("@aws-sdk/credential-provider-ini - credential_source is Ec2InstanceMetadata"); - const { fromInstanceMetadata } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(566))); - return async () => fromInstanceMetadata(options)().then(setNamedProvider); - }, "Ec2InstanceMetadata"), - Environment: /* @__PURE__ */ __name(async (options) => { - logger?.debug("@aws-sdk/credential-provider-ini - credential_source is Environment"); - const { fromEnv } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(5606))); - return async () => fromEnv(options)().then(setNamedProvider); - }, "Environment") - }; - if (credentialSource in sourceProvidersMap) { - return sourceProvidersMap[credentialSource]; - } else { - throw new import_property_provider.CredentialsProviderError( - `Unsupported credential source in profile ${profileName}. Got ${credentialSource}, expected EcsContainer or Ec2InstanceMetadata or Environment.`, - { logger } - ); - } -}, "resolveCredentialSource"); -var setNamedProvider = /* @__PURE__ */ __name((creds) => (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_NAMED_PROVIDER", "p"), "setNamedProvider"); - -// src/resolveAssumeRoleCredentials.ts -var isAssumeRoleProfile = /* @__PURE__ */ __name((arg, { profile = "default", logger } = {}) => { - return Boolean(arg) && typeof arg === "object" && typeof arg.role_arn === "string" && ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1 && ["undefined", "string"].indexOf(typeof arg.external_id) > -1 && ["undefined", "string"].indexOf(typeof arg.mfa_serial) > -1 && (isAssumeRoleWithSourceProfile(arg, { profile, logger }) || isCredentialSourceProfile(arg, { profile, logger })); -}, "isAssumeRoleProfile"); -var isAssumeRoleWithSourceProfile = /* @__PURE__ */ __name((arg, { profile, logger }) => { - const withSourceProfile = typeof arg.source_profile === "string" && typeof arg.credential_source === "undefined"; - if (withSourceProfile) { - logger?.debug?.(` ${profile} isAssumeRoleWithSourceProfile source_profile=${arg.source_profile}`); - } - return withSourceProfile; -}, "isAssumeRoleWithSourceProfile"); -var isCredentialSourceProfile = /* @__PURE__ */ __name((arg, { profile, logger }) => { - const withProviderProfile = typeof arg.credential_source === "string" && typeof arg.source_profile === "undefined"; - if (withProviderProfile) { - logger?.debug?.(` ${profile} isCredentialSourceProfile credential_source=${arg.credential_source}`); - } - return withProviderProfile; -}, "isCredentialSourceProfile"); -var resolveAssumeRoleCredentials = /* @__PURE__ */ __name(async (profileName, profiles, options, visitedProfiles = {}) => { - options.logger?.debug("@aws-sdk/credential-provider-ini - resolveAssumeRoleCredentials (STS)"); - const profileData = profiles[profileName]; - const { source_profile, region } = profileData; - if (!options.roleAssumer) { - const { getDefaultRoleAssumer } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(1136))); - options.roleAssumer = getDefaultRoleAssumer( - { - ...options.clientConfig, - credentialProviderLogger: options.logger, - parentClientConfig: { - ...options?.parentClientConfig, - region: region ?? options?.parentClientConfig?.region +class HttpApiKeyAuthSigner { + async sign(httpRequest, identity, signingProperties) { + if (!signingProperties) { + throw new Error("request could not be signed with `apiKey` since the `name` and `in` signer properties are missing"); } - }, - options.clientPlugins - ); - } - if (source_profile && source_profile in visitedProfiles) { - throw new import_property_provider.CredentialsProviderError( - `Detected a cycle attempting to resolve credentials for profile ${(0, import_shared_ini_file_loader.getProfileName)(options)}. Profiles visited: ` + Object.keys(visitedProfiles).join(", "), - { logger: options.logger } - ); - } - options.logger?.debug( - `@aws-sdk/credential-provider-ini - finding credential resolver using ${source_profile ? `source_profile=[${source_profile}]` : `profile=[${profileName}]`}` - ); - const sourceCredsProvider = source_profile ? resolveProfileData( - source_profile, - profiles, - options, - { - ...visitedProfiles, - [source_profile]: true - }, - isCredentialSourceWithoutRoleArn(profiles[source_profile] ?? {}) - ) : (await resolveCredentialSource(profileData.credential_source, profileName, options.logger)(options))(); - if (isCredentialSourceWithoutRoleArn(profileData)) { - return sourceCredsProvider.then((creds) => (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_SOURCE_PROFILE", "o")); - } else { - const params = { - RoleArn: profileData.role_arn, - RoleSessionName: profileData.role_session_name || `aws-sdk-js-${Date.now()}`, - ExternalId: profileData.external_id, - DurationSeconds: parseInt(profileData.duration_seconds || "3600", 10) - }; - const { mfa_serial } = profileData; - if (mfa_serial) { - if (!options.mfaCodeProvider) { - throw new import_property_provider.CredentialsProviderError( - `Profile ${profileName} requires multi-factor authentication, but no MFA code callback was provided.`, - { logger: options.logger, tryNextLink: false } - ); - } - params.SerialNumber = mfa_serial; - params.TokenCode = await options.mfaCodeProvider(mfa_serial); + if (!signingProperties.name) { + throw new Error("request could not be signed with `apiKey` since the `name` signer property is missing"); + } + if (!signingProperties.in) { + throw new Error("request could not be signed with `apiKey` since the `in` signer property is missing"); + } + if (!identity.apiKey) { + throw new Error("request could not be signed with `apiKey` since the `apiKey` is not defined"); + } + const clonedRequest = protocolHttp.HttpRequest.clone(httpRequest); + if (signingProperties.in === types.HttpApiKeyAuthLocation.QUERY) { + clonedRequest.query[signingProperties.name] = identity.apiKey; + } + else if (signingProperties.in === types.HttpApiKeyAuthLocation.HEADER) { + clonedRequest.headers[signingProperties.name] = signingProperties.scheme + ? `${signingProperties.scheme} ${identity.apiKey}` + : identity.apiKey; + } + else { + throw new Error("request can only be signed with `apiKey` locations `query` or `header`, " + + "but found: `" + + signingProperties.in + + "`"); + } + return clonedRequest; } - const sourceCreds = await sourceCredsProvider; - return options.roleAssumer(sourceCreds, params).then( - (creds) => (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_SOURCE_PROFILE", "o") - ); - } -}, "resolveAssumeRoleCredentials"); -var isCredentialSourceWithoutRoleArn = /* @__PURE__ */ __name((section) => { - return !section.role_arn && !!section.credential_source; -}, "isCredentialSourceWithoutRoleArn"); - -// src/resolveProcessCredentials.ts - -var isProcessProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.credential_process === "string", "isProcessProfile"); -var resolveProcessCredentials = /* @__PURE__ */ __name(async (options, profile) => Promise.resolve().then(() => __toESM(__nccwpck_require__(5360))).then( - ({ fromProcess }) => fromProcess({ - ...options, - profile - })().then((creds) => (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_PROCESS", "v")) -), "resolveProcessCredentials"); - -// src/resolveSsoCredentials.ts - -var resolveSsoCredentials = /* @__PURE__ */ __name(async (profile, profileData, options = {}) => { - const { fromSSO } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(998))); - return fromSSO({ - profile, - logger: options.logger, - parentClientConfig: options.parentClientConfig, - clientConfig: options.clientConfig - })().then((creds) => { - if (profileData.sso_session) { - return (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_SSO", "r"); - } else { - return (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_SSO_LEGACY", "t"); +} + +class HttpBearerAuthSigner { + async sign(httpRequest, identity, signingProperties) { + const clonedRequest = protocolHttp.HttpRequest.clone(httpRequest); + if (!identity.token) { + throw new Error("request could not be signed with `token` since the `token` is not defined"); + } + clonedRequest.headers["Authorization"] = `Bearer ${identity.token}`; + return clonedRequest; } - }); -}, "resolveSsoCredentials"); -var isSsoProfile = /* @__PURE__ */ __name((arg) => arg && (typeof arg.sso_start_url === "string" || typeof arg.sso_account_id === "string" || typeof arg.sso_session === "string" || typeof arg.sso_region === "string" || typeof arg.sso_role_name === "string"), "isSsoProfile"); - -// src/resolveStaticCredentials.ts - -var isStaticCredsProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.aws_access_key_id === "string" && typeof arg.aws_secret_access_key === "string" && ["undefined", "string"].indexOf(typeof arg.aws_session_token) > -1 && ["undefined", "string"].indexOf(typeof arg.aws_account_id) > -1, "isStaticCredsProfile"); -var resolveStaticCredentials = /* @__PURE__ */ __name(async (profile, options) => { - options?.logger?.debug("@aws-sdk/credential-provider-ini - resolveStaticCredentials"); - const credentials = { - accessKeyId: profile.aws_access_key_id, - secretAccessKey: profile.aws_secret_access_key, - sessionToken: profile.aws_session_token, - ...profile.aws_credential_scope && { credentialScope: profile.aws_credential_scope }, - ...profile.aws_account_id && { accountId: profile.aws_account_id } - }; - return (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_PROFILE", "n"); -}, "resolveStaticCredentials"); - -// src/resolveWebIdentityCredentials.ts - -var isWebIdentityProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.web_identity_token_file === "string" && typeof arg.role_arn === "string" && ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1, "isWebIdentityProfile"); -var resolveWebIdentityCredentials = /* @__PURE__ */ __name(async (profile, options) => Promise.resolve().then(() => __toESM(__nccwpck_require__(9956))).then( - ({ fromTokenFile }) => fromTokenFile({ - webIdentityTokenFile: profile.web_identity_token_file, - roleArn: profile.role_arn, - roleSessionName: profile.role_session_name, - roleAssumerWithWebIdentity: options.roleAssumerWithWebIdentity, - logger: options.logger, - parentClientConfig: options.parentClientConfig - })().then((creds) => (0, import_client.setCredentialFeature)(creds, "CREDENTIALS_PROFILE_STS_WEB_ID_TOKEN", "q")) -), "resolveWebIdentityCredentials"); - -// src/resolveProfileData.ts -var resolveProfileData = /* @__PURE__ */ __name(async (profileName, profiles, options, visitedProfiles = {}, isAssumeRoleRecursiveCall = false) => { - const data = profiles[profileName]; - if (Object.keys(visitedProfiles).length > 0 && isStaticCredsProfile(data)) { - return resolveStaticCredentials(data, options); - } - if (isAssumeRoleRecursiveCall || isAssumeRoleProfile(data, { profile: profileName, logger: options.logger })) { - return resolveAssumeRoleCredentials(profileName, profiles, options, visitedProfiles); - } - if (isStaticCredsProfile(data)) { - return resolveStaticCredentials(data, options); - } - if (isWebIdentityProfile(data)) { - return resolveWebIdentityCredentials(data, options); - } - if (isProcessProfile(data)) { - return resolveProcessCredentials(options, profileName); - } - if (isSsoProfile(data)) { - return await resolveSsoCredentials(profileName, data, options); - } - throw new import_property_provider.CredentialsProviderError( - `Could not resolve credentials using profile: [${profileName}] in configuration/credentials file(s).`, - { logger: options.logger } - ); -}, "resolveProfileData"); +} -// src/fromIni.ts -var fromIni = /* @__PURE__ */ __name((_init = {}) => async ({ callerClientConfig } = {}) => { - const init = { - ..._init, - parentClientConfig: { - ...callerClientConfig, - ..._init.parentClientConfig +class NoAuthSigner { + async sign(httpRequest, identity, signingProperties) { + return httpRequest; } - }; - init.logger?.debug("@aws-sdk/credential-provider-ini - fromIni"); - const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); - return resolveProfileData( - (0, import_shared_ini_file_loader.getProfileName)({ - profile: _init.profile ?? callerClientConfig?.profile - }), - profiles, - init - ); -}, "fromIni"); -// Annotate the CommonJS export names for ESM import in node: +} -0 && (0); +const createIsIdentityExpiredFunction = (expirationMs) => function isIdentityExpired(identity) { + return doesIdentityRequireRefresh(identity) && identity.expiration.getTime() - Date.now() < expirationMs; +}; +const EXPIRATION_MS = 300_000; +const isIdentityExpired = createIsIdentityExpiredFunction(EXPIRATION_MS); +const doesIdentityRequireRefresh = (identity) => identity.expiration !== undefined; +const memoizeIdentityProvider = (provider, isExpired, requiresRefresh) => { + if (provider === undefined) { + return undefined; + } + const normalizedProvider = typeof provider !== "function" ? async () => Promise.resolve(provider) : provider; + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = async (options) => { + if (!pending) { + pending = normalizedProvider(options); + } + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } + finally { + pending = undefined; + } + return resolved; + }; + if (isExpired === undefined) { + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(options); + } + return resolved; + }; + } + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(options); + } + if (isConstant) { + return resolved; + } + if (!requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(options); + return resolved; + } + return resolved; + }; +}; +Object.defineProperty(exports, "requestBuilder", ({ + enumerable: true, + get: function () { return protocols.requestBuilder; } +})); +exports.DefaultIdentityProviderConfig = DefaultIdentityProviderConfig; +exports.EXPIRATION_MS = EXPIRATION_MS; +exports.HttpApiKeyAuthSigner = HttpApiKeyAuthSigner; +exports.HttpBearerAuthSigner = HttpBearerAuthSigner; +exports.NoAuthSigner = NoAuthSigner; +exports.createIsIdentityExpiredFunction = createIsIdentityExpiredFunction; +exports.createPaginator = createPaginator; +exports.doesIdentityRequireRefresh = doesIdentityRequireRefresh; +exports.getHttpAuthSchemeEndpointRuleSetPlugin = getHttpAuthSchemeEndpointRuleSetPlugin; +exports.getHttpAuthSchemePlugin = getHttpAuthSchemePlugin; +exports.getHttpSigningPlugin = getHttpSigningPlugin; +exports.getSmithyContext = getSmithyContext; +exports.httpAuthSchemeEndpointRuleSetMiddlewareOptions = httpAuthSchemeEndpointRuleSetMiddlewareOptions; +exports.httpAuthSchemeMiddleware = httpAuthSchemeMiddleware; +exports.httpAuthSchemeMiddlewareOptions = httpAuthSchemeMiddlewareOptions; +exports.httpSigningMiddleware = httpSigningMiddleware; +exports.httpSigningMiddlewareOptions = httpSigningMiddlewareOptions; +exports.isIdentityExpired = isIdentityExpired; +exports.memoizeIdentityProvider = memoizeIdentityProvider; +exports.normalizeProvider = normalizeProvider; +exports.setFeature = setFeature; /***/ }), -/***/ 5861: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 4645: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -var __create = Object.create; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - credentialsTreatedAsExpired: () => credentialsTreatedAsExpired, - credentialsWillNeedRefresh: () => credentialsWillNeedRefresh, - defaultProvider: () => defaultProvider -}); -module.exports = __toCommonJS(index_exports); - -// src/defaultProvider.ts -var import_credential_provider_env = __nccwpck_require__(5606); - -var import_shared_ini_file_loader = __nccwpck_require__(4964); - -// src/remoteProvider.ts -var import_property_provider = __nccwpck_require__(1238); -var ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; -var remoteProvider = /* @__PURE__ */ __name(async (init) => { - const { ENV_CMDS_FULL_URI, ENV_CMDS_RELATIVE_URI, fromContainerMetadata, fromInstanceMetadata } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(566))); - if (process.env[ENV_CMDS_RELATIVE_URI] || process.env[ENV_CMDS_FULL_URI]) { - init.logger?.debug("@aws-sdk/credential-provider-node - remoteProvider::fromHttp/fromContainerMetadata"); - const { fromHttp } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(8605))); - return (0, import_property_provider.chain)(fromHttp(init), fromContainerMetadata(init)); - } - if (process.env[ENV_IMDS_DISABLED] && process.env[ENV_IMDS_DISABLED] !== "false") { - return async () => { - throw new import_property_provider.CredentialsProviderError("EC2 Instance Metadata Service access disabled", { logger: init.logger }); - }; - } - init.logger?.debug("@aws-sdk/credential-provider-node - remoteProvider::fromInstanceMetadata"); - return fromInstanceMetadata(init); -}, "remoteProvider"); +var serde = __nccwpck_require__(2430); +var utilUtf8 = __nccwpck_require__(1577); +var protocols = __nccwpck_require__(3422); +var protocolHttp = __nccwpck_require__(2356); +var utilBodyLengthBrowser = __nccwpck_require__(2098); +var schema = __nccwpck_require__(6890); +var utilMiddleware = __nccwpck_require__(6324); +var utilBase64 = __nccwpck_require__(8385); + +const majorUint64 = 0; +const majorNegativeInt64 = 1; +const majorUnstructuredByteString = 2; +const majorUtf8String = 3; +const majorList = 4; +const majorMap = 5; +const majorTag = 6; +const majorSpecial = 7; +const specialFalse = 20; +const specialTrue = 21; +const specialNull = 22; +const specialUndefined = 23; +const extendedOneByte = 24; +const extendedFloat16 = 25; +const extendedFloat32 = 26; +const extendedFloat64 = 27; +const minorIndefinite = 31; +function alloc(size) { + return typeof Buffer !== "undefined" ? Buffer.alloc(size) : new Uint8Array(size); +} +const tagSymbol = Symbol("@smithy/core/cbor::tagSymbol"); +function tag(data) { + data[tagSymbol] = true; + return data; +} -// src/defaultProvider.ts -var multipleCredentialSourceWarningEmitted = false; -var defaultProvider = /* @__PURE__ */ __name((init = {}) => (0, import_property_provider.memoize)( - (0, import_property_provider.chain)( - async () => { - const profile = init.profile ?? process.env[import_shared_ini_file_loader.ENV_PROFILE]; - if (profile) { - const envStaticCredentialsAreSet = process.env[import_credential_provider_env.ENV_KEY] && process.env[import_credential_provider_env.ENV_SECRET]; - if (envStaticCredentialsAreSet) { - if (!multipleCredentialSourceWarningEmitted) { - const warnFn = init.logger?.warn && init.logger?.constructor?.name !== "NoOpLogger" ? init.logger.warn.bind(init.logger) : console.warn; - warnFn( - `@aws-sdk/credential-provider-node - defaultProvider::fromEnv WARNING: - Multiple credential sources detected: - Both AWS_PROFILE and the pair AWS_ACCESS_KEY_ID/AWS_SECRET_ACCESS_KEY static credentials are set. - This SDK will proceed with the AWS_PROFILE value. - - However, a future version may change this behavior to prefer the ENV static credentials. - Please ensure that your environment only sets either the AWS_PROFILE or the - AWS_ACCESS_KEY_ID/AWS_SECRET_ACCESS_KEY pair. -` - ); - multipleCredentialSourceWarningEmitted = true; - } +const USE_TEXT_DECODER = typeof TextDecoder !== "undefined"; +const USE_BUFFER$1 = typeof Buffer !== "undefined"; +let payload = alloc(0); +let dataView$1 = new DataView(payload.buffer, payload.byteOffset, payload.byteLength); +const textDecoder = USE_TEXT_DECODER ? new TextDecoder() : null; +let _offset = 0; +function setPayload(bytes) { + payload = bytes; + dataView$1 = new DataView(payload.buffer, payload.byteOffset, payload.byteLength); +} +function decode(at, to) { + if (at >= to) { + throw new Error("unexpected end of (decode) payload."); + } + const major = (payload[at] & 0b1110_0000) >> 5; + const minor = payload[at] & 0b0001_1111; + switch (major) { + case majorUint64: + case majorNegativeInt64: + case majorTag: + let unsignedInt; + let offset; + if (minor < 24) { + unsignedInt = minor; + offset = 1; + } + else { + switch (minor) { + case extendedOneByte: + case extendedFloat16: + case extendedFloat32: + case extendedFloat64: + const countLength = minorValueToArgumentLength[minor]; + const countOffset = (countLength + 1); + offset = countOffset; + if (to - at < countOffset) { + throw new Error(`countLength ${countLength} greater than remaining buf len.`); + } + const countIndex = at + 1; + if (countLength === 1) { + unsignedInt = payload[countIndex]; + } + else if (countLength === 2) { + unsignedInt = dataView$1.getUint16(countIndex); + } + else if (countLength === 4) { + unsignedInt = dataView$1.getUint32(countIndex); + } + else { + unsignedInt = dataView$1.getBigUint64(countIndex); + } + break; + default: + throw new Error(`unexpected minor value ${minor}.`); + } + } + if (major === majorUint64) { + _offset = offset; + return castBigInt(unsignedInt); + } + else if (major === majorNegativeInt64) { + let negativeInt; + if (typeof unsignedInt === "bigint") { + negativeInt = BigInt(-1) - unsignedInt; + } + else { + negativeInt = -1 - unsignedInt; + } + _offset = offset; + return castBigInt(negativeInt); + } + else { + if (minor === 2 || minor === 3) { + const length = decodeCount(at + offset, to); + let b = BigInt(0); + const start = at + offset + _offset; + for (let i = start; i < start + length; ++i) { + b = (b << BigInt(8)) | BigInt(payload[i]); + } + _offset = offset + _offset + length; + return minor === 3 ? -b - BigInt(1) : b; + } + else if (minor === 4) { + const decimalFraction = decode(at + offset, to); + const [exponent, mantissa] = decimalFraction; + const normalizer = mantissa < 0 ? -1 : 1; + const mantissaStr = "0".repeat(Math.abs(exponent) + 1) + String(BigInt(normalizer) * BigInt(mantissa)); + let numericString; + const sign = mantissa < 0 ? "-" : ""; + numericString = + exponent === 0 + ? mantissaStr + : mantissaStr.slice(0, mantissaStr.length + exponent) + "." + mantissaStr.slice(exponent); + numericString = numericString.replace(/^0+/g, ""); + if (numericString === "") { + numericString = "0"; + } + if (numericString[0] === ".") { + numericString = "0" + numericString; + } + numericString = sign + numericString; + _offset = offset + _offset; + return serde.nv(numericString); + } + else { + const value = decode(at + offset, to); + const valueOffset = _offset; + _offset = offset + valueOffset; + return tag({ tag: castBigInt(unsignedInt), value }); + } + } + case majorUtf8String: + case majorMap: + case majorList: + case majorUnstructuredByteString: + if (minor === minorIndefinite) { + switch (major) { + case majorUtf8String: + return decodeUtf8StringIndefinite(at, to); + case majorMap: + return decodeMapIndefinite(at, to); + case majorList: + return decodeListIndefinite(at, to); + case majorUnstructuredByteString: + return decodeUnstructuredByteStringIndefinite(at, to); + } + } + else { + switch (major) { + case majorUtf8String: + return decodeUtf8String(at, to); + case majorMap: + return decodeMap(at, to); + case majorList: + return decodeList(at, to); + case majorUnstructuredByteString: + return decodeUnstructuredByteString(at, to); + } + } + default: + return decodeSpecial(at, to); + } +} +function bytesToUtf8(bytes, at, to) { + if (USE_BUFFER$1 && bytes.constructor?.name === "Buffer") { + return bytes.toString("utf-8", at, to); + } + if (textDecoder) { + return textDecoder.decode(bytes.subarray(at, to)); + } + return utilUtf8.toUtf8(bytes.subarray(at, to)); +} +function demote(bigInteger) { + const num = Number(bigInteger); + if (num < Number.MIN_SAFE_INTEGER || Number.MAX_SAFE_INTEGER < num) { + console.warn(new Error(`@smithy/core/cbor - truncating BigInt(${bigInteger}) to ${num} with loss of precision.`)); + } + return num; +} +const minorValueToArgumentLength = { + [extendedOneByte]: 1, + [extendedFloat16]: 2, + [extendedFloat32]: 4, + [extendedFloat64]: 8, +}; +function bytesToFloat16(a, b) { + const sign = a >> 7; + const exponent = (a & 0b0111_1100) >> 2; + const fraction = ((a & 0b0000_0011) << 8) | b; + const scalar = sign === 0 ? 1 : -1; + let exponentComponent; + let summation; + if (exponent === 0b00000) { + if (fraction === 0b00000_00000) { + return 0; + } + else { + exponentComponent = Math.pow(2, 1 - 15); + summation = 0; } - throw new import_property_provider.CredentialsProviderError("AWS_PROFILE is set, skipping fromEnv provider.", { - logger: init.logger, - tryNextLink: true - }); - } - init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromEnv"); - return (0, import_credential_provider_env.fromEnv)(init)(); - }, - async () => { - init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromSSO"); - const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoSession } = init; - if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) { - throw new import_property_provider.CredentialsProviderError( - "Skipping SSO provider in default chain (inputs do not include SSO fields).", - { logger: init.logger } - ); - } - const { fromSSO } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(998))); - return fromSSO(init)(); - }, - async () => { - init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromIni"); - const { fromIni } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(5869))); - return fromIni(init)(); - }, - async () => { - init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromProcess"); - const { fromProcess } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(5360))); - return fromProcess(init)(); - }, - async () => { - init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromTokenFile"); - const { fromTokenFile } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(9956))); - return fromTokenFile(init)(); - }, - async () => { - init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::remoteProvider"); - return (await remoteProvider(init))(); - }, - async () => { - throw new import_property_provider.CredentialsProviderError("Could not load credentials from any providers", { - tryNextLink: false, - logger: init.logger - }); } - ), - credentialsTreatedAsExpired, - credentialsWillNeedRefresh -), "defaultProvider"); -var credentialsWillNeedRefresh = /* @__PURE__ */ __name((credentials) => credentials?.expiration !== void 0, "credentialsWillNeedRefresh"); -var credentialsTreatedAsExpired = /* @__PURE__ */ __name((credentials) => credentials?.expiration !== void 0 && credentials.expiration.getTime() - Date.now() < 3e5, "credentialsTreatedAsExpired"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), + else if (exponent === 0b11111) { + if (fraction === 0b00000_00000) { + return scalar * Infinity; + } + else { + return NaN; + } + } + else { + exponentComponent = Math.pow(2, exponent - 15); + summation = 1; + } + summation += fraction / 1024; + return scalar * (exponentComponent * summation); +} +function decodeCount(at, to) { + const minor = payload[at] & 0b0001_1111; + if (minor < 24) { + _offset = 1; + return minor; + } + if (minor === extendedOneByte || + minor === extendedFloat16 || + minor === extendedFloat32 || + minor === extendedFloat64) { + const countLength = minorValueToArgumentLength[minor]; + _offset = (countLength + 1); + if (to - at < _offset) { + throw new Error(`countLength ${countLength} greater than remaining buf len.`); + } + const countIndex = at + 1; + if (countLength === 1) { + return payload[countIndex]; + } + else if (countLength === 2) { + return dataView$1.getUint16(countIndex); + } + else if (countLength === 4) { + return dataView$1.getUint32(countIndex); + } + return demote(dataView$1.getBigUint64(countIndex)); + } + throw new Error(`unexpected minor value ${minor}.`); +} +function decodeUtf8String(at, to) { + const length = decodeCount(at, to); + const offset = _offset; + at += offset; + if (to - at < length) { + throw new Error(`string len ${length} greater than remaining buf len.`); + } + const value = bytesToUtf8(payload, at, at + length); + _offset = offset + length; + return value; +} +function decodeUtf8StringIndefinite(at, to) { + at += 1; + const vector = []; + for (const base = at; at < to;) { + if (payload[at] === 0b1111_1111) { + const data = alloc(vector.length); + data.set(vector, 0); + _offset = at - base + 2; + return bytesToUtf8(data, 0, data.length); + } + const major = (payload[at] & 0b1110_0000) >> 5; + const minor = payload[at] & 0b0001_1111; + if (major !== majorUtf8String) { + throw new Error(`unexpected major type ${major} in indefinite string.`); + } + if (minor === minorIndefinite) { + throw new Error("nested indefinite string."); + } + const bytes = decodeUnstructuredByteString(at, to); + const length = _offset; + at += length; + for (let i = 0; i < bytes.length; ++i) { + vector.push(bytes[i]); + } + } + throw new Error("expected break marker."); +} +function decodeUnstructuredByteString(at, to) { + const length = decodeCount(at, to); + const offset = _offset; + at += offset; + if (to - at < length) { + throw new Error(`unstructured byte string len ${length} greater than remaining buf len.`); + } + const value = payload.subarray(at, at + length); + _offset = offset + length; + return value; +} +function decodeUnstructuredByteStringIndefinite(at, to) { + at += 1; + const vector = []; + for (const base = at; at < to;) { + if (payload[at] === 0b1111_1111) { + const data = alloc(vector.length); + data.set(vector, 0); + _offset = at - base + 2; + return data; + } + const major = (payload[at] & 0b1110_0000) >> 5; + const minor = payload[at] & 0b0001_1111; + if (major !== majorUnstructuredByteString) { + throw new Error(`unexpected major type ${major} in indefinite string.`); + } + if (minor === minorIndefinite) { + throw new Error("nested indefinite string."); + } + const bytes = decodeUnstructuredByteString(at, to); + const length = _offset; + at += length; + for (let i = 0; i < bytes.length; ++i) { + vector.push(bytes[i]); + } + } + throw new Error("expected break marker."); +} +function decodeList(at, to) { + const listDataLength = decodeCount(at, to); + const offset = _offset; + at += offset; + const base = at; + const list = Array(listDataLength); + for (let i = 0; i < listDataLength; ++i) { + const item = decode(at, to); + const itemOffset = _offset; + list[i] = item; + at += itemOffset; + } + _offset = offset + (at - base); + return list; +} +function decodeListIndefinite(at, to) { + at += 1; + const list = []; + for (const base = at; at < to;) { + if (payload[at] === 0b1111_1111) { + _offset = at - base + 2; + return list; + } + const item = decode(at, to); + const n = _offset; + at += n; + list.push(item); + } + throw new Error("expected break marker."); +} +function decodeMap(at, to) { + const mapDataLength = decodeCount(at, to); + const offset = _offset; + at += offset; + const base = at; + const map = {}; + for (let i = 0; i < mapDataLength; ++i) { + if (at >= to) { + throw new Error("unexpected end of map payload."); + } + const major = (payload[at] & 0b1110_0000) >> 5; + if (major !== majorUtf8String) { + throw new Error(`unexpected major type ${major} for map key at index ${at}.`); + } + const key = decode(at, to); + at += _offset; + const value = decode(at, to); + at += _offset; + map[key] = value; + } + _offset = offset + (at - base); + return map; +} +function decodeMapIndefinite(at, to) { + at += 1; + const base = at; + const map = {}; + for (; at < to;) { + if (at >= to) { + throw new Error("unexpected end of map payload."); + } + if (payload[at] === 0b1111_1111) { + _offset = at - base + 2; + return map; + } + const major = (payload[at] & 0b1110_0000) >> 5; + if (major !== majorUtf8String) { + throw new Error(`unexpected major type ${major} for map key.`); + } + const key = decode(at, to); + at += _offset; + const value = decode(at, to); + at += _offset; + map[key] = value; + } + throw new Error("expected break marker."); +} +function decodeSpecial(at, to) { + const minor = payload[at] & 0b0001_1111; + switch (minor) { + case specialTrue: + case specialFalse: + _offset = 1; + return minor === specialTrue; + case specialNull: + _offset = 1; + return null; + case specialUndefined: + _offset = 1; + return null; + case extendedFloat16: + if (to - at < 3) { + throw new Error("incomplete float16 at end of buf."); + } + _offset = 3; + return bytesToFloat16(payload[at + 1], payload[at + 2]); + case extendedFloat32: + if (to - at < 5) { + throw new Error("incomplete float32 at end of buf."); + } + _offset = 5; + return dataView$1.getFloat32(at + 1); + case extendedFloat64: + if (to - at < 9) { + throw new Error("incomplete float64 at end of buf."); + } + _offset = 9; + return dataView$1.getFloat64(at + 1); + default: + throw new Error(`unexpected minor value ${minor}.`); + } +} +function castBigInt(bigInt) { + if (typeof bigInt === "number") { + return bigInt; + } + const num = Number(bigInt); + if (Number.MIN_SAFE_INTEGER <= num && num <= Number.MAX_SAFE_INTEGER) { + return num; + } + return bigInt; +} -/***/ 5360: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +const USE_BUFFER = typeof Buffer !== "undefined"; +const initialSize = 2048; +let data = alloc(initialSize); +let dataView = new DataView(data.buffer, data.byteOffset, data.byteLength); +let cursor = 0; +function ensureSpace(bytes) { + const remaining = data.byteLength - cursor; + if (remaining < bytes) { + if (cursor < 16_000_000) { + resize(Math.max(data.byteLength * 4, data.byteLength + bytes)); + } + else { + resize(data.byteLength + bytes + 16_000_000); + } + } +} +function toUint8Array() { + const out = alloc(cursor); + out.set(data.subarray(0, cursor), 0); + cursor = 0; + return out; +} +function resize(size) { + const old = data; + data = alloc(size); + if (old) { + if (old.copy) { + old.copy(data, 0, 0, old.byteLength); + } + else { + data.set(old, 0); + } + } + dataView = new DataView(data.buffer, data.byteOffset, data.byteLength); +} +function encodeHeader(major, value) { + if (value < 24) { + data[cursor++] = (major << 5) | value; + } + else if (value < 1 << 8) { + data[cursor++] = (major << 5) | 24; + data[cursor++] = value; + } + else if (value < 1 << 16) { + data[cursor++] = (major << 5) | extendedFloat16; + dataView.setUint16(cursor, value); + cursor += 2; + } + else if (value < 2 ** 32) { + data[cursor++] = (major << 5) | extendedFloat32; + dataView.setUint32(cursor, value); + cursor += 4; + } + else { + data[cursor++] = (major << 5) | extendedFloat64; + dataView.setBigUint64(cursor, typeof value === "bigint" ? value : BigInt(value)); + cursor += 8; + } +} +function encode(_input) { + const encodeStack = [_input]; + while (encodeStack.length) { + const input = encodeStack.pop(); + ensureSpace(typeof input === "string" ? input.length * 4 : 64); + if (typeof input === "string") { + if (USE_BUFFER) { + encodeHeader(majorUtf8String, Buffer.byteLength(input)); + cursor += data.write(input, cursor); + } + else { + const bytes = utilUtf8.fromUtf8(input); + encodeHeader(majorUtf8String, bytes.byteLength); + data.set(bytes, cursor); + cursor += bytes.byteLength; + } + continue; + } + else if (typeof input === "number") { + if (Number.isInteger(input)) { + const nonNegative = input >= 0; + const major = nonNegative ? majorUint64 : majorNegativeInt64; + const value = nonNegative ? input : -input - 1; + if (value < 24) { + data[cursor++] = (major << 5) | value; + } + else if (value < 256) { + data[cursor++] = (major << 5) | 24; + data[cursor++] = value; + } + else if (value < 65536) { + data[cursor++] = (major << 5) | extendedFloat16; + data[cursor++] = value >> 8; + data[cursor++] = value; + } + else if (value < 4294967296) { + data[cursor++] = (major << 5) | extendedFloat32; + dataView.setUint32(cursor, value); + cursor += 4; + } + else { + data[cursor++] = (major << 5) | extendedFloat64; + dataView.setBigUint64(cursor, BigInt(value)); + cursor += 8; + } + continue; + } + data[cursor++] = (majorSpecial << 5) | extendedFloat64; + dataView.setFloat64(cursor, input); + cursor += 8; + continue; + } + else if (typeof input === "bigint") { + const nonNegative = input >= 0; + const major = nonNegative ? majorUint64 : majorNegativeInt64; + const value = nonNegative ? input : -input - BigInt(1); + const n = Number(value); + if (n < 24) { + data[cursor++] = (major << 5) | n; + } + else if (n < 256) { + data[cursor++] = (major << 5) | 24; + data[cursor++] = n; + } + else if (n < 65536) { + data[cursor++] = (major << 5) | extendedFloat16; + data[cursor++] = n >> 8; + data[cursor++] = n & 0b1111_1111; + } + else if (n < 4294967296) { + data[cursor++] = (major << 5) | extendedFloat32; + dataView.setUint32(cursor, n); + cursor += 4; + } + else if (value < BigInt("18446744073709551616")) { + data[cursor++] = (major << 5) | extendedFloat64; + dataView.setBigUint64(cursor, value); + cursor += 8; + } + else { + const binaryBigInt = value.toString(2); + const bigIntBytes = new Uint8Array(Math.ceil(binaryBigInt.length / 8)); + let b = value; + let i = 0; + while (bigIntBytes.byteLength - ++i >= 0) { + bigIntBytes[bigIntBytes.byteLength - i] = Number(b & BigInt(255)); + b >>= BigInt(8); + } + ensureSpace(bigIntBytes.byteLength * 2); + data[cursor++] = nonNegative ? 0b110_00010 : 0b110_00011; + if (USE_BUFFER) { + encodeHeader(majorUnstructuredByteString, Buffer.byteLength(bigIntBytes)); + } + else { + encodeHeader(majorUnstructuredByteString, bigIntBytes.byteLength); + } + data.set(bigIntBytes, cursor); + cursor += bigIntBytes.byteLength; + } + continue; + } + else if (input === null) { + data[cursor++] = (majorSpecial << 5) | specialNull; + continue; + } + else if (typeof input === "boolean") { + data[cursor++] = (majorSpecial << 5) | (input ? specialTrue : specialFalse); + continue; + } + else if (typeof input === "undefined") { + throw new Error("@smithy/core/cbor: client may not serialize undefined value."); + } + else if (Array.isArray(input)) { + for (let i = input.length - 1; i >= 0; --i) { + encodeStack.push(input[i]); + } + encodeHeader(majorList, input.length); + continue; + } + else if (typeof input.byteLength === "number") { + ensureSpace(input.length * 2); + encodeHeader(majorUnstructuredByteString, input.length); + data.set(input, cursor); + cursor += input.byteLength; + continue; + } + else if (typeof input === "object") { + if (input instanceof serde.NumericValue) { + const decimalIndex = input.string.indexOf("."); + const exponent = decimalIndex === -1 ? 0 : decimalIndex - input.string.length + 1; + const mantissa = BigInt(input.string.replace(".", "")); + data[cursor++] = 0b110_00100; + encodeStack.push(mantissa); + encodeStack.push(exponent); + encodeHeader(majorList, 2); + continue; + } + if (input[tagSymbol]) { + if ("tag" in input && "value" in input) { + encodeStack.push(input.value); + encodeHeader(majorTag, input.tag); + continue; + } + else { + throw new Error("tag encountered with missing fields, need 'tag' and 'value', found: " + JSON.stringify(input)); + } + } + const keys = Object.keys(input); + for (let i = keys.length - 1; i >= 0; --i) { + const key = keys[i]; + encodeStack.push(input[key]); + encodeStack.push(key); + } + encodeHeader(majorMap, keys.length); + continue; + } + throw new Error(`data type ${input?.constructor?.name ?? typeof input} not compatible for encoding.`); + } +} -"use strict"; +const cbor = { + deserialize(payload) { + setPayload(payload); + return decode(0, payload.length); + }, + serialize(input) { + try { + encode(input); + return toUint8Array(); + } + catch (e) { + toUint8Array(); + throw e; + } + }, + resizeEncodingBuffer(size) { + resize(size); + }, +}; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); +const parseCborBody = (streamBody, context) => { + return protocols.collectBody(streamBody, context).then(async (bytes) => { + if (bytes.length) { + try { + return cbor.deserialize(bytes); + } + catch (e) { + Object.defineProperty(e, "$responseBodyText", { + value: context.utf8Encoder(bytes), + }); + throw e; + } + } + return {}; + }); }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; +const dateToTag = (date) => { + return tag({ + tag: 1, + value: date.getTime() / 1000, + }); }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - fromProcess: () => fromProcess -}); -module.exports = __toCommonJS(index_exports); - -// src/fromProcess.ts - - -// src/resolveProcessCredentials.ts -var import_property_provider = __nccwpck_require__(1238); -var import_shared_ini_file_loader = __nccwpck_require__(4964); -var import_child_process = __nccwpck_require__(5317); -var import_util = __nccwpck_require__(9023); - -// src/getValidatedProcessCredentials.ts -var import_client = __nccwpck_require__(5152); -var getValidatedProcessCredentials = /* @__PURE__ */ __name((profileName, data, profiles) => { - if (data.Version !== 1) { - throw Error(`Profile ${profileName} credential_process did not return Version 1.`); - } - if (data.AccessKeyId === void 0 || data.SecretAccessKey === void 0) { - throw Error(`Profile ${profileName} credential_process returned invalid credentials.`); - } - if (data.Expiration) { - const currentTime = /* @__PURE__ */ new Date(); - const expireTime = new Date(data.Expiration); - if (expireTime < currentTime) { - throw Error(`Profile ${profileName} credential_process returned expired credentials.`); - } - } - let accountId = data.AccountId; - if (!accountId && profiles?.[profileName]?.aws_account_id) { - accountId = profiles[profileName].aws_account_id; - } - const credentials = { - accessKeyId: data.AccessKeyId, - secretAccessKey: data.SecretAccessKey, - ...data.SessionToken && { sessionToken: data.SessionToken }, - ...data.Expiration && { expiration: new Date(data.Expiration) }, - ...data.CredentialScope && { credentialScope: data.CredentialScope }, - ...accountId && { accountId } - }; - (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_PROCESS", "w"); - return credentials; -}, "getValidatedProcessCredentials"); - -// src/resolveProcessCredentials.ts -var resolveProcessCredentials = /* @__PURE__ */ __name(async (profileName, profiles, logger) => { - const profile = profiles[profileName]; - if (profiles[profileName]) { - const credentialProcess = profile["credential_process"]; - if (credentialProcess !== void 0) { - const execPromise = (0, import_util.promisify)(import_shared_ini_file_loader.externalDataInterceptor?.getTokenRecord?.().exec ?? import_child_process.exec); - try { - const { stdout } = await execPromise(credentialProcess); - let data; - try { - data = JSON.parse(stdout.trim()); - } catch { - throw Error(`Profile ${profileName} credential_process returned invalid JSON.`); +const parseCborErrorBody = async (errorBody, context) => { + const value = await parseCborBody(errorBody, context); + value.message = value.message ?? value.Message; + return value; +}; +const loadSmithyRpcV2CborErrorCode = (output, data) => { + const sanitizeErrorCode = (rawValue) => { + let cleanValue = rawValue; + if (typeof cleanValue === "number") { + cleanValue = cleanValue.toString(); } - return getValidatedProcessCredentials(profileName, data, profiles); - } catch (error) { - throw new import_property_provider.CredentialsProviderError(error.message, { logger }); - } - } else { - throw new import_property_provider.CredentialsProviderError(`Profile ${profileName} did not contain credential_process.`, { logger }); + if (cleanValue.indexOf(",") >= 0) { + cleanValue = cleanValue.split(",")[0]; + } + if (cleanValue.indexOf(":") >= 0) { + cleanValue = cleanValue.split(":")[0]; + } + if (cleanValue.indexOf("#") >= 0) { + cleanValue = cleanValue.split("#")[1]; + } + return cleanValue; + }; + if (data["__type"] !== undefined) { + return sanitizeErrorCode(data["__type"]); + } + const codeKey = Object.keys(data).find((key) => key.toLowerCase() === "code"); + if (codeKey && data[codeKey] !== undefined) { + return sanitizeErrorCode(data[codeKey]); } - } else { - throw new import_property_provider.CredentialsProviderError(`Profile ${profileName} could not be found in shared credentials file.`, { - logger - }); - } -}, "resolveProcessCredentials"); - -// src/fromProcess.ts -var fromProcess = /* @__PURE__ */ __name((init = {}) => async ({ callerClientConfig } = {}) => { - init.logger?.debug("@aws-sdk/credential-provider-process - fromProcess"); - const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); - return resolveProcessCredentials( - (0, import_shared_ini_file_loader.getProfileName)({ - profile: init.profile ?? callerClientConfig?.profile - }), - profiles, - init.logger - ); -}, "fromProcess"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 998: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __esm = (fn, res) => function __init() { - return fn && (res = (0, fn[__getOwnPropNames(fn)[0]])(fn = 0)), res; }; -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); +const checkCborResponse = (response) => { + if (String(response.headers["smithy-protocol"]).toLowerCase() !== "rpc-v2-cbor") { + throw new Error("Malformed RPCv2 CBOR response, status: " + response.statusCode); + } }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; +const buildHttpRpcRequest = async (context, headers, path, resolvedHostname, body) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const contents = { + protocol, + hostname, + port, + method: "POST", + path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, + headers: { + ...headers, + }, + }; + if (resolvedHostname !== undefined) { + contents.hostname = resolvedHostname; + } + if (body !== undefined) { + contents.body = body; + try { + contents.headers["content-length"] = String(utilBodyLengthBrowser.calculateBodyLength(body)); + } + catch (e) { } + } + return new protocolHttp.HttpRequest(contents); }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/loadSso.ts -var loadSso_exports = {}; -__export(loadSso_exports, { - GetRoleCredentialsCommand: () => import_client_sso.GetRoleCredentialsCommand, - SSOClient: () => import_client_sso.SSOClient -}); -var import_client_sso; -var init_loadSso = __esm({ - "src/loadSso.ts"() { - "use strict"; - import_client_sso = __nccwpck_require__(2054); - } -}); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - fromSSO: () => fromSSO, - isSsoProfile: () => isSsoProfile, - validateSsoProfile: () => validateSsoProfile -}); -module.exports = __toCommonJS(index_exports); - -// src/fromSSO.ts - - - -// src/isSsoProfile.ts -var isSsoProfile = /* @__PURE__ */ __name((arg) => arg && (typeof arg.sso_start_url === "string" || typeof arg.sso_account_id === "string" || typeof arg.sso_session === "string" || typeof arg.sso_region === "string" || typeof arg.sso_role_name === "string"), "isSsoProfile"); - -// src/resolveSSOCredentials.ts -var import_client = __nccwpck_require__(5152); -var import_token_providers = __nccwpck_require__(5433); -var import_property_provider = __nccwpck_require__(1238); -var import_shared_ini_file_loader = __nccwpck_require__(4964); -var SHOULD_FAIL_CREDENTIAL_CHAIN = false; -var resolveSSOCredentials = /* @__PURE__ */ __name(async ({ - ssoStartUrl, - ssoSession, - ssoAccountId, - ssoRegion, - ssoRoleName, - ssoClient, - clientConfig, - parentClientConfig, - profile, - filepath, - configFilepath, - ignoreCache, - logger -}) => { - let token; - const refreshMessage = `To refresh this SSO session run aws sso login with the corresponding profile.`; - if (ssoSession) { - try { - const _token = await (0, import_token_providers.fromSso)({ - profile, - filepath, - configFilepath, - ignoreCache - })(); - token = { - accessToken: _token.token, - expiresAt: new Date(_token.expiration).toISOString() - }; - } catch (e) { - throw new import_property_provider.CredentialsProviderError(e.message, { - tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, - logger - }); +class CborCodec extends protocols.SerdeContext { + createSerializer() { + const serializer = new CborShapeSerializer(); + serializer.setSerdeContext(this.serdeContext); + return serializer; } - } else { - try { - token = await (0, import_shared_ini_file_loader.getSSOTokenFromFile)(ssoStartUrl); - } catch (e) { - throw new import_property_provider.CredentialsProviderError(`The SSO session associated with this profile is invalid. ${refreshMessage}`, { - tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, - logger - }); + createDeserializer() { + const deserializer = new CborShapeDeserializer(); + deserializer.setSerdeContext(this.serdeContext); + return deserializer; } - } - if (new Date(token.expiresAt).getTime() - Date.now() <= 0) { - throw new import_property_provider.CredentialsProviderError(`The SSO session associated with this profile has expired. ${refreshMessage}`, { - tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, - logger - }); - } - const { accessToken } = token; - const { SSOClient: SSOClient2, GetRoleCredentialsCommand: GetRoleCredentialsCommand2 } = await Promise.resolve().then(() => (init_loadSso(), loadSso_exports)); - const sso = ssoClient || new SSOClient2( - Object.assign({}, clientConfig ?? {}, { - logger: clientConfig?.logger ?? parentClientConfig?.logger, - region: clientConfig?.region ?? ssoRegion - }) - ); - let ssoResp; - try { - ssoResp = await sso.send( - new GetRoleCredentialsCommand2({ - accountId: ssoAccountId, - roleName: ssoRoleName, - accessToken - }) - ); - } catch (e) { - throw new import_property_provider.CredentialsProviderError(e, { - tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, - logger - }); - } - const { - roleCredentials: { accessKeyId, secretAccessKey, sessionToken, expiration, credentialScope, accountId } = {} - } = ssoResp; - if (!accessKeyId || !secretAccessKey || !sessionToken || !expiration) { - throw new import_property_provider.CredentialsProviderError("SSO returns an invalid temporary credential.", { - tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, - logger - }); - } - const credentials = { - accessKeyId, - secretAccessKey, - sessionToken, - expiration: new Date(expiration), - ...credentialScope && { credentialScope }, - ...accountId && { accountId } - }; - if (ssoSession) { - (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_SSO", "s"); - } else { - (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_SSO_LEGACY", "u"); - } - return credentials; -}, "resolveSSOCredentials"); - -// src/validateSsoProfile.ts - -var validateSsoProfile = /* @__PURE__ */ __name((profile, logger) => { - const { sso_start_url, sso_account_id, sso_region, sso_role_name } = profile; - if (!sso_start_url || !sso_account_id || !sso_region || !sso_role_name) { - throw new import_property_provider.CredentialsProviderError( - `Profile is configured with invalid SSO credentials. Required parameters "sso_account_id", "sso_region", "sso_role_name", "sso_start_url". Got ${Object.keys(profile).join( - ", " - )} -Reference: https://docs.aws.amazon.com/cli/latest/userguide/cli-configure-sso.html`, - { tryNextLink: false, logger } - ); - } - return profile; -}, "validateSsoProfile"); +} +class CborShapeSerializer extends protocols.SerdeContext { + value; + write(schema, value) { + this.value = this.serialize(schema, value); + } + serialize(schema$1, source) { + const ns = schema.NormalizedSchema.of(schema$1); + if (source == null) { + if (ns.isIdempotencyToken()) { + return serde.generateIdempotencyToken(); + } + return source; + } + if (ns.isBlobSchema()) { + if (typeof source === "string") { + return (this.serdeContext?.base64Decoder ?? utilBase64.fromBase64)(source); + } + return source; + } + if (ns.isTimestampSchema()) { + if (typeof source === "number" || typeof source === "bigint") { + return dateToTag(new Date((Number(source) / 1000) | 0)); + } + return dateToTag(source); + } + if (typeof source === "function" || typeof source === "object") { + const sourceObject = source; + if (ns.isListSchema() && Array.isArray(sourceObject)) { + const sparse = !!ns.getMergedTraits().sparse; + const newArray = []; + let i = 0; + for (const item of sourceObject) { + const value = this.serialize(ns.getValueSchema(), item); + if (value != null || sparse) { + newArray[i++] = value; + } + } + return newArray; + } + if (sourceObject instanceof Date) { + return dateToTag(sourceObject); + } + const newObject = {}; + if (ns.isMapSchema()) { + const sparse = !!ns.getMergedTraits().sparse; + for (const key of Object.keys(sourceObject)) { + const value = this.serialize(ns.getValueSchema(), sourceObject[key]); + if (value != null || sparse) { + newObject[key] = value; + } + } + } + else if (ns.isStructSchema()) { + for (const [key, memberSchema] of ns.structIterator()) { + const value = this.serialize(memberSchema, sourceObject[key]); + if (value != null) { + newObject[key] = value; + } + } + } + else if (ns.isDocumentSchema()) { + for (const key of Object.keys(sourceObject)) { + newObject[key] = this.serialize(ns.getValueSchema(), sourceObject[key]); + } + } + return newObject; + } + return source; + } + flush() { + const buffer = cbor.serialize(this.value); + this.value = undefined; + return buffer; + } +} +class CborShapeDeserializer extends protocols.SerdeContext { + read(schema, bytes) { + const data = cbor.deserialize(bytes); + return this.readValue(schema, data); + } + readValue(_schema, value) { + const ns = schema.NormalizedSchema.of(_schema); + if (ns.isTimestampSchema() && typeof value === "number") { + return serde._parseEpochTimestamp(value); + } + if (ns.isBlobSchema()) { + if (typeof value === "string") { + return (this.serdeContext?.base64Decoder ?? utilBase64.fromBase64)(value); + } + return value; + } + if (typeof value === "undefined" || + typeof value === "boolean" || + typeof value === "number" || + typeof value === "string" || + typeof value === "bigint" || + typeof value === "symbol") { + return value; + } + else if (typeof value === "function" || typeof value === "object") { + if (value === null) { + return null; + } + if ("byteLength" in value) { + return value; + } + if (value instanceof Date) { + return value; + } + if (ns.isDocumentSchema()) { + return value; + } + if (ns.isListSchema()) { + const newArray = []; + const memberSchema = ns.getValueSchema(); + const sparse = !!ns.getMergedTraits().sparse; + for (const item of value) { + const itemValue = this.readValue(memberSchema, item); + if (itemValue != null || sparse) { + newArray.push(itemValue); + } + } + return newArray; + } + const newObject = {}; + if (ns.isMapSchema()) { + const sparse = !!ns.getMergedTraits().sparse; + const targetSchema = ns.getValueSchema(); + for (const key of Object.keys(value)) { + const itemValue = this.readValue(targetSchema, value[key]); + if (itemValue != null || sparse) { + newObject[key] = itemValue; + } + } + } + else if (ns.isStructSchema()) { + for (const [key, memberSchema] of ns.structIterator()) { + newObject[key] = this.readValue(memberSchema, value[key]); + } + } + return newObject; + } + else { + return value; + } + } +} -// src/fromSSO.ts -var fromSSO = /* @__PURE__ */ __name((init = {}) => async ({ callerClientConfig } = {}) => { - init.logger?.debug("@aws-sdk/credential-provider-sso - fromSSO"); - const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoSession } = init; - const { ssoClient } = init; - const profileName = (0, import_shared_ini_file_loader.getProfileName)({ - profile: init.profile ?? callerClientConfig?.profile - }); - if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) { - const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); - const profile = profiles[profileName]; - if (!profile) { - throw new import_property_provider.CredentialsProviderError(`Profile ${profileName} was not found.`, { logger: init.logger }); - } - if (!isSsoProfile(profile)) { - throw new import_property_provider.CredentialsProviderError(`Profile ${profileName} is not configured with SSO credentials.`, { - logger: init.logger - }); +class SmithyRpcV2CborProtocol extends protocols.RpcProtocol { + codec = new CborCodec(); + serializer = this.codec.createSerializer(); + deserializer = this.codec.createDeserializer(); + constructor({ defaultNamespace }) { + super({ defaultNamespace }); } - if (profile?.sso_session) { - const ssoSessions = await (0, import_shared_ini_file_loader.loadSsoSessionData)(init); - const session = ssoSessions[profile.sso_session]; - const conflictMsg = ` configurations in profile ${profileName} and sso-session ${profile.sso_session}`; - if (ssoRegion && ssoRegion !== session.sso_region) { - throw new import_property_provider.CredentialsProviderError(`Conflicting SSO region` + conflictMsg, { - tryNextLink: false, - logger: init.logger - }); - } - if (ssoStartUrl && ssoStartUrl !== session.sso_start_url) { - throw new import_property_provider.CredentialsProviderError(`Conflicting SSO start_url` + conflictMsg, { - tryNextLink: false, - logger: init.logger + getShapeId() { + return "smithy.protocols#rpcv2Cbor"; + } + getPayloadCodec() { + return this.codec; + } + async serializeRequest(operationSchema, input, context) { + const request = await super.serializeRequest(operationSchema, input, context); + Object.assign(request.headers, { + "content-type": this.getDefaultContentType(), + "smithy-protocol": "rpc-v2-cbor", + accept: this.getDefaultContentType(), }); - } - profile.sso_region = session.sso_region; - profile.sso_start_url = session.sso_start_url; + if (schema.deref(operationSchema.input) === "unit") { + delete request.body; + delete request.headers["content-type"]; + } + else { + if (!request.body) { + this.serializer.write(15, {}); + request.body = this.serializer.flush(); + } + try { + request.headers["content-length"] = String(request.body.byteLength); + } + catch (e) { } + } + const { service, operation } = utilMiddleware.getSmithyContext(context); + const path = `/service/${service}/operation/${operation}`; + if (request.path.endsWith("/")) { + request.path += path.slice(1); + } + else { + request.path += path; + } + return request; } - const { sso_start_url, sso_account_id, sso_region, sso_role_name, sso_session } = validateSsoProfile( - profile, - init.logger - ); - return resolveSSOCredentials({ - ssoStartUrl: sso_start_url, - ssoSession: sso_session, - ssoAccountId: sso_account_id, - ssoRegion: sso_region, - ssoRoleName: sso_role_name, - ssoClient, - clientConfig: init.clientConfig, - parentClientConfig: init.parentClientConfig, - profile: profileName, - filepath: init.filepath, - configFilepath: init.configFilepath, - ignoreCache: init.ignoreCache, - logger: init.logger - }); - } else if (!ssoStartUrl || !ssoAccountId || !ssoRegion || !ssoRoleName) { - throw new import_property_provider.CredentialsProviderError( - 'Incomplete configuration. The fromSSO() argument hash must include "ssoStartUrl", "ssoAccountId", "ssoRegion", "ssoRoleName"', - { tryNextLink: false, logger: init.logger } - ); - } else { - return resolveSSOCredentials({ - ssoStartUrl, - ssoSession, - ssoAccountId, - ssoRegion, - ssoRoleName, - ssoClient, - clientConfig: init.clientConfig, - parentClientConfig: init.parentClientConfig, - profile: profileName, - filepath: init.filepath, - configFilepath: init.configFilepath, - ignoreCache: init.ignoreCache, - logger: init.logger - }); - } -}, "fromSSO"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); + async deserializeResponse(operationSchema, context, response) { + return super.deserializeResponse(operationSchema, context, response); + } + async handleError(operationSchema, context, response, dataObject, metadata) { + const errorName = loadSmithyRpcV2CborErrorCode(response, dataObject) ?? "Unknown"; + let namespace = this.options.defaultNamespace; + if (errorName.includes("#")) { + [namespace] = errorName.split("#"); + } + const errorMetadata = { + $metadata: metadata, + $response: response, + $fault: response.statusCode <= 500 ? "client" : "server", + }; + const registry = schema.TypeRegistry.for(namespace); + let errorSchema; + try { + errorSchema = registry.getSchema(errorName); + } + catch (e) { + if (dataObject.Message) { + dataObject.message = dataObject.Message; + } + const synthetic = schema.TypeRegistry.for("smithy.ts.sdk.synthetic." + namespace); + const baseExceptionSchema = synthetic.getBaseException(); + if (baseExceptionSchema) { + const ErrorCtor = synthetic.getErrorCtor(baseExceptionSchema); + throw Object.assign(new ErrorCtor({ name: errorName }), errorMetadata, dataObject); + } + throw Object.assign(new Error(errorName), errorMetadata, dataObject); + } + const ns = schema.NormalizedSchema.of(errorSchema); + const ErrorCtor = registry.getErrorCtor(errorSchema); + const message = dataObject.message ?? dataObject.Message ?? "Unknown"; + const exception = new ErrorCtor(message); + const output = {}; + for (const [name, member] of ns.structIterator()) { + output[name] = this.deserializer.readValue(member, dataObject[name]); + } + throw Object.assign(exception, errorMetadata, { + $fault: ns.getMergedTraits().error, + message, + }, output); + } + getDefaultContentType() { + return "application/cbor"; + } +} +exports.CborCodec = CborCodec; +exports.CborShapeDeserializer = CborShapeDeserializer; +exports.CborShapeSerializer = CborShapeSerializer; +exports.SmithyRpcV2CborProtocol = SmithyRpcV2CborProtocol; +exports.buildHttpRpcRequest = buildHttpRpcRequest; +exports.cbor = cbor; +exports.checkCborResponse = checkCborResponse; +exports.dateToTag = dateToTag; +exports.loadSmithyRpcV2CborErrorCode = loadSmithyRpcV2CborErrorCode; +exports.parseCborBody = parseCborBody; +exports.parseCborErrorBody = parseCborErrorBody; +exports.tag = tag; +exports.tagSymbol = tagSymbol; /***/ }), -/***/ 8079: +/***/ 3422: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromTokenFile = void 0; -const client_1 = __nccwpck_require__(5152); -const property_provider_1 = __nccwpck_require__(1238); -const shared_ini_file_loader_1 = __nccwpck_require__(4964); -const fs_1 = __nccwpck_require__(9896); -const fromWebToken_1 = __nccwpck_require__(4453); -const ENV_TOKEN_FILE = "AWS_WEB_IDENTITY_TOKEN_FILE"; -const ENV_ROLE_ARN = "AWS_ROLE_ARN"; -const ENV_ROLE_SESSION_NAME = "AWS_ROLE_SESSION_NAME"; -const fromTokenFile = (init = {}) => async () => { - init.logger?.debug("@aws-sdk/credential-provider-web-identity - fromTokenFile"); - const webIdentityTokenFile = init?.webIdentityTokenFile ?? process.env[ENV_TOKEN_FILE]; - const roleArn = init?.roleArn ?? process.env[ENV_ROLE_ARN]; - const roleSessionName = init?.roleSessionName ?? process.env[ENV_ROLE_SESSION_NAME]; - if (!webIdentityTokenFile || !roleArn) { - throw new property_provider_1.CredentialsProviderError("Web identity configuration not specified", { - logger: init.logger, - }); + +var utilStream = __nccwpck_require__(4252); +var schema = __nccwpck_require__(6890); +var serde = __nccwpck_require__(2430); +var protocolHttp = __nccwpck_require__(2356); +var utilBase64 = __nccwpck_require__(8385); +var utilUtf8 = __nccwpck_require__(1577); + +const collectBody = async (streamBody = new Uint8Array(), context) => { + if (streamBody instanceof Uint8Array) { + return utilStream.Uint8ArrayBlobAdapter.mutate(streamBody); } - const credentials = await (0, fromWebToken_1.fromWebToken)({ - ...init, - webIdentityToken: shared_ini_file_loader_1.externalDataInterceptor?.getTokenRecord?.()[webIdentityTokenFile] ?? - (0, fs_1.readFileSync)(webIdentityTokenFile, { encoding: "ascii" }), - roleArn, - roleSessionName, - })(); - if (webIdentityTokenFile === process.env[ENV_TOKEN_FILE]) { - (0, client_1.setCredentialFeature)(credentials, "CREDENTIALS_ENV_VARS_STS_WEB_ID_TOKEN", "h"); + if (!streamBody) { + return utilStream.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); } - return credentials; + const fromContext = context.streamCollector(streamBody); + return utilStream.Uint8ArrayBlobAdapter.mutate(await fromContext); }; -exports.fromTokenFile = fromTokenFile; - - -/***/ }), -/***/ 4453: -/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { +function extendedEncodeURIComponent(str) { + return encodeURIComponent(str).replace(/[!'()*]/g, function (c) { + return "%" + c.charCodeAt(0).toString(16).toUpperCase(); + }); +} -"use strict"; +class SerdeContext { + serdeContext; + setSerdeContext(serdeContext) { + this.serdeContext = serdeContext; + } +} -var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - var desc = Object.getOwnPropertyDescriptor(m, k); - if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { - desc = { enumerable: true, get: function() { return m[k]; } }; +class HttpProtocol extends SerdeContext { + options; + constructor(options) { + super(); + this.options = options; } - Object.defineProperty(o, k2, desc); -}) : (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - o[k2] = m[k]; -})); -var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { - Object.defineProperty(o, "default", { enumerable: true, value: v }); -}) : function(o, v) { - o["default"] = v; -}); -var __importStar = (this && this.__importStar) || (function () { - var ownKeys = function(o) { - ownKeys = Object.getOwnPropertyNames || function (o) { - var ar = []; - for (var k in o) if (Object.prototype.hasOwnProperty.call(o, k)) ar[ar.length] = k; - return ar; + getRequestType() { + return protocolHttp.HttpRequest; + } + getResponseType() { + return protocolHttp.HttpResponse; + } + setSerdeContext(serdeContext) { + this.serdeContext = serdeContext; + this.serializer.setSerdeContext(serdeContext); + this.deserializer.setSerdeContext(serdeContext); + if (this.getPayloadCodec()) { + this.getPayloadCodec().setSerdeContext(serdeContext); + } + } + updateServiceEndpoint(request, endpoint) { + if ("url" in endpoint) { + request.protocol = endpoint.url.protocol; + request.hostname = endpoint.url.hostname; + request.port = endpoint.url.port ? Number(endpoint.url.port) : undefined; + request.path = endpoint.url.pathname; + request.fragment = endpoint.url.hash || void 0; + request.username = endpoint.url.username || void 0; + request.password = endpoint.url.password || void 0; + if (!request.query) { + request.query = {}; + } + for (const [k, v] of endpoint.url.searchParams.entries()) { + request.query[k] = v; + } + return request; + } + else { + request.protocol = endpoint.protocol; + request.hostname = endpoint.hostname; + request.port = endpoint.port ? Number(endpoint.port) : undefined; + request.path = endpoint.path; + request.query = { + ...endpoint.query, + }; + return request; + } + } + setHostPrefix(request, operationSchema, input) { + const inputNs = schema.NormalizedSchema.of(operationSchema.input); + const opTraits = schema.translateTraits(operationSchema.traits ?? {}); + if (opTraits.endpoint) { + let hostPrefix = opTraits.endpoint?.[0]; + if (typeof hostPrefix === "string") { + const hostLabelInputs = [...inputNs.structIterator()].filter(([, member]) => member.getMergedTraits().hostLabel); + for (const [name] of hostLabelInputs) { + const replacement = input[name]; + if (typeof replacement !== "string") { + throw new Error(`@smithy/core/schema - ${name} in input must be a string as hostLabel.`); + } + hostPrefix = hostPrefix.replace(`{${name}}`, replacement); + } + request.hostname = hostPrefix + request.hostname; + } + } + } + deserializeMetadata(output) { + return { + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"], }; - return ownKeys(o); - }; - return function (mod) { - if (mod && mod.__esModule) return mod; - var result = {}; - if (mod != null) for (var k = ownKeys(mod), i = 0; i < k.length; i++) if (k[i] !== "default") __createBinding(result, mod, k[i]); - __setModuleDefault(result, mod); - return result; - }; -})(); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromWebToken = void 0; -const fromWebToken = (init) => async (awsIdentityProperties) => { - init.logger?.debug("@aws-sdk/credential-provider-web-identity - fromWebToken"); - const { roleArn, roleSessionName, webIdentityToken, providerId, policyArns, policy, durationSeconds } = init; - let { roleAssumerWithWebIdentity } = init; - if (!roleAssumerWithWebIdentity) { - const { getDefaultRoleAssumerWithWebIdentity } = await Promise.resolve().then(() => __importStar(__nccwpck_require__(1136))); - roleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity({ - ...init.clientConfig, - credentialProviderLogger: init.logger, - parentClientConfig: { - ...awsIdentityProperties?.callerClientConfig, - ...init.parentClientConfig, - }, - }, init.clientPlugins); - } - return roleAssumerWithWebIdentity({ - RoleArn: roleArn, - RoleSessionName: roleSessionName ?? `aws-sdk-js-session-${Date.now()}`, - WebIdentityToken: webIdentityToken, - ProviderId: providerId, - PolicyArns: policyArns, - Policy: policy, - DurationSeconds: durationSeconds, - }); -}; -exports.fromWebToken = fromWebToken; + } + async serializeEventStream({ eventStream, requestSchema, initialRequest, }) { + const eventStreamSerde = await this.loadEventStreamCapability(); + return eventStreamSerde.serializeEventStream({ + eventStream, + requestSchema, + initialRequest, + }); + } + async deserializeEventStream({ response, responseSchema, initialResponseContainer, }) { + const eventStreamSerde = await this.loadEventStreamCapability(); + return eventStreamSerde.deserializeEventStream({ + response, + responseSchema, + initialResponseContainer, + }); + } + async loadEventStreamCapability() { + const { EventStreamSerde } = await __nccwpck_require__.e(/* import() */ 579).then(__nccwpck_require__.t.bind(__nccwpck_require__, 6579, 19)); + return new EventStreamSerde({ + marshaller: this.getEventStreamMarshaller(), + serializer: this.serializer, + deserializer: this.deserializer, + serdeContext: this.serdeContext, + defaultContentType: this.getDefaultContentType(), + }); + } + getDefaultContentType() { + throw new Error(`@smithy/core/protocols - ${this.constructor.name} getDefaultContentType() implementation missing.`); + } + async deserializeHttpMessage(schema, context, response, arg4, arg5) { + return []; + } + getEventStreamMarshaller() { + const context = this.serdeContext; + if (!context.eventStreamMarshaller) { + throw new Error("@smithy/core - HttpProtocol: eventStreamMarshaller missing in serdeContext."); + } + return context.eventStreamMarshaller; + } +} +class HttpBindingProtocol extends HttpProtocol { + async serializeRequest(operationSchema, _input, context) { + const input = { + ...(_input ?? {}), + }; + const serializer = this.serializer; + const query = {}; + const headers = {}; + const endpoint = await context.endpoint(); + const ns = schema.NormalizedSchema.of(operationSchema?.input); + const schema$1 = ns.getSchema(); + let hasNonHttpBindingMember = false; + let payload; + const request = new protocolHttp.HttpRequest({ + protocol: "", + hostname: "", + port: undefined, + path: "", + fragment: undefined, + query: query, + headers: headers, + body: undefined, + }); + if (endpoint) { + this.updateServiceEndpoint(request, endpoint); + this.setHostPrefix(request, operationSchema, input); + const opTraits = schema.translateTraits(operationSchema.traits); + if (opTraits.http) { + request.method = opTraits.http[0]; + const [path, search] = opTraits.http[1].split("?"); + if (request.path == "/") { + request.path = path; + } + else { + request.path += path; + } + const traitSearchParams = new URLSearchParams(search ?? ""); + Object.assign(query, Object.fromEntries(traitSearchParams)); + } + } + for (const [memberName, memberNs] of ns.structIterator()) { + const memberTraits = memberNs.getMergedTraits() ?? {}; + const inputMemberValue = input[memberName]; + if (inputMemberValue == null) { + continue; + } + if (memberTraits.httpPayload) { + const isStreaming = memberNs.isStreaming(); + if (isStreaming) { + const isEventStream = memberNs.isStructSchema(); + if (isEventStream) { + if (input[memberName]) { + payload = await this.serializeEventStream({ + eventStream: input[memberName], + requestSchema: ns, + }); + } + } + else { + payload = inputMemberValue; + } + } + else { + serializer.write(memberNs, inputMemberValue); + payload = serializer.flush(); + } + delete input[memberName]; + } + else if (memberTraits.httpLabel) { + serializer.write(memberNs, inputMemberValue); + const replacement = serializer.flush(); + if (request.path.includes(`{${memberName}+}`)) { + request.path = request.path.replace(`{${memberName}+}`, replacement.split("/").map(extendedEncodeURIComponent).join("/")); + } + else if (request.path.includes(`{${memberName}}`)) { + request.path = request.path.replace(`{${memberName}}`, extendedEncodeURIComponent(replacement)); + } + delete input[memberName]; + } + else if (memberTraits.httpHeader) { + serializer.write(memberNs, inputMemberValue); + headers[memberTraits.httpHeader.toLowerCase()] = String(serializer.flush()); + delete input[memberName]; + } + else if (typeof memberTraits.httpPrefixHeaders === "string") { + for (const [key, val] of Object.entries(inputMemberValue)) { + const amalgam = memberTraits.httpPrefixHeaders + key; + serializer.write([memberNs.getValueSchema(), { httpHeader: amalgam }], val); + headers[amalgam.toLowerCase()] = serializer.flush(); + } + delete input[memberName]; + } + else if (memberTraits.httpQuery || memberTraits.httpQueryParams) { + this.serializeQuery(memberNs, inputMemberValue, query); + delete input[memberName]; + } + else { + hasNonHttpBindingMember = true; + } + } + if (hasNonHttpBindingMember && input) { + serializer.write(schema$1, input); + payload = serializer.flush(); + } + request.headers = headers; + request.query = query; + request.body = payload; + return request; + } + serializeQuery(ns, data, query) { + const serializer = this.serializer; + const traits = ns.getMergedTraits(); + if (traits.httpQueryParams) { + for (const [key, val] of Object.entries(data)) { + if (!(key in query)) { + const valueSchema = ns.getValueSchema(); + Object.assign(valueSchema.getMergedTraits(), { + ...traits, + httpQuery: key, + httpQueryParams: undefined, + }); + this.serializeQuery(valueSchema, val, query); + } + } + return; + } + if (ns.isListSchema()) { + const sparse = !!ns.getMergedTraits().sparse; + const buffer = []; + for (const item of data) { + serializer.write([ns.getValueSchema(), traits], item); + const serializable = serializer.flush(); + if (sparse || serializable !== undefined) { + buffer.push(serializable); + } + } + query[traits.httpQuery] = buffer; + } + else { + serializer.write([ns, traits], data); + query[traits.httpQuery] = serializer.flush(); + } + } + async deserializeResponse(operationSchema, context, response) { + const deserializer = this.deserializer; + const ns = schema.NormalizedSchema.of(operationSchema.output); + const dataObject = {}; + if (response.statusCode >= 300) { + const bytes = await collectBody(response.body, context); + if (bytes.byteLength > 0) { + Object.assign(dataObject, await deserializer.read(15, bytes)); + } + await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); + throw new Error("@smithy/core/protocols - HTTP Protocol error handler failed to throw."); + } + for (const header in response.headers) { + const value = response.headers[header]; + delete response.headers[header]; + response.headers[header.toLowerCase()] = value; + } + const nonHttpBindingMembers = await this.deserializeHttpMessage(ns, context, response, dataObject); + if (nonHttpBindingMembers.length) { + const bytes = await collectBody(response.body, context); + if (bytes.byteLength > 0) { + const dataFromBody = await deserializer.read(ns, bytes); + for (const member of nonHttpBindingMembers) { + dataObject[member] = dataFromBody[member]; + } + } + } + dataObject.$metadata = this.deserializeMetadata(response); + return dataObject; + } + async deserializeHttpMessage(schema$1, context, response, arg4, arg5) { + let dataObject; + if (arg4 instanceof Set) { + dataObject = arg5; + } + else { + dataObject = arg4; + } + const deserializer = this.deserializer; + const ns = schema.NormalizedSchema.of(schema$1); + const nonHttpBindingMembers = []; + for (const [memberName, memberSchema] of ns.structIterator()) { + const memberTraits = memberSchema.getMemberTraits(); + if (memberTraits.httpPayload) { + const isStreaming = memberSchema.isStreaming(); + if (isStreaming) { + const isEventStream = memberSchema.isStructSchema(); + if (isEventStream) { + dataObject[memberName] = await this.deserializeEventStream({ + response, + responseSchema: ns, + }); + } + else { + dataObject[memberName] = utilStream.sdkStreamMixin(response.body); + } + } + else if (response.body) { + const bytes = await collectBody(response.body, context); + if (bytes.byteLength > 0) { + dataObject[memberName] = await deserializer.read(memberSchema, bytes); + } + } + } + else if (memberTraits.httpHeader) { + const key = String(memberTraits.httpHeader).toLowerCase(); + const value = response.headers[key]; + if (null != value) { + if (memberSchema.isListSchema()) { + const headerListValueSchema = memberSchema.getValueSchema(); + headerListValueSchema.getMergedTraits().httpHeader = key; + let sections; + if (headerListValueSchema.isTimestampSchema() && + headerListValueSchema.getSchema() === 4) { + sections = serde.splitEvery(value, ",", 2); + } + else { + sections = serde.splitHeader(value); + } + const list = []; + for (const section of sections) { + list.push(await deserializer.read(headerListValueSchema, section.trim())); + } + dataObject[memberName] = list; + } + else { + dataObject[memberName] = await deserializer.read(memberSchema, value); + } + } + } + else if (memberTraits.httpPrefixHeaders !== undefined) { + dataObject[memberName] = {}; + for (const [header, value] of Object.entries(response.headers)) { + if (header.startsWith(memberTraits.httpPrefixHeaders)) { + const valueSchema = memberSchema.getValueSchema(); + valueSchema.getMergedTraits().httpHeader = header; + dataObject[memberName][header.slice(memberTraits.httpPrefixHeaders.length)] = await deserializer.read(valueSchema, value); + } + } + } + else if (memberTraits.httpResponseCode) { + dataObject[memberName] = response.statusCode; + } + else { + nonHttpBindingMembers.push(memberName); + } + } + return nonHttpBindingMembers; + } +} + +class RpcProtocol extends HttpProtocol { + async serializeRequest(operationSchema, input, context) { + const serializer = this.serializer; + const query = {}; + const headers = {}; + const endpoint = await context.endpoint(); + const ns = schema.NormalizedSchema.of(operationSchema?.input); + const schema$1 = ns.getSchema(); + let payload; + const request = new protocolHttp.HttpRequest({ + protocol: "", + hostname: "", + port: undefined, + path: "/", + fragment: undefined, + query: query, + headers: headers, + body: undefined, + }); + if (endpoint) { + this.updateServiceEndpoint(request, endpoint); + this.setHostPrefix(request, operationSchema, input); + } + const _input = { + ...input, + }; + if (input) { + const eventStreamMember = ns.getEventStreamMember(); + if (eventStreamMember) { + if (_input[eventStreamMember]) { + const initialRequest = {}; + for (const [memberName, memberSchema] of ns.structIterator()) { + if (memberName !== eventStreamMember && _input[memberName]) { + serializer.write(memberSchema, _input[memberName]); + initialRequest[memberName] = serializer.flush(); + } + } + payload = await this.serializeEventStream({ + eventStream: _input[eventStreamMember], + requestSchema: ns, + initialRequest, + }); + } + } + else { + serializer.write(schema$1, _input); + payload = serializer.flush(); + } + } + request.headers = headers; + request.query = query; + request.body = payload; + request.method = "POST"; + return request; + } + async deserializeResponse(operationSchema, context, response) { + const deserializer = this.deserializer; + const ns = schema.NormalizedSchema.of(operationSchema.output); + const dataObject = {}; + if (response.statusCode >= 300) { + const bytes = await collectBody(response.body, context); + if (bytes.byteLength > 0) { + Object.assign(dataObject, await deserializer.read(15, bytes)); + } + await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); + throw new Error("@smithy/core/protocols - RPC Protocol error handler failed to throw."); + } + for (const header in response.headers) { + const value = response.headers[header]; + delete response.headers[header]; + response.headers[header.toLowerCase()] = value; + } + const eventStreamMember = ns.getEventStreamMember(); + if (eventStreamMember) { + dataObject[eventStreamMember] = await this.deserializeEventStream({ + response, + responseSchema: ns, + initialResponseContainer: dataObject, + }); + } + else { + const bytes = await collectBody(response.body, context); + if (bytes.byteLength > 0) { + Object.assign(dataObject, await deserializer.read(ns, bytes)); + } + } + dataObject.$metadata = this.deserializeMetadata(response); + return dataObject; + } +} -/***/ }), +const resolvedPath = (resolvedPath, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { + if (input != null && input[memberName] !== undefined) { + const labelValue = labelValueProvider(); + if (labelValue.length <= 0) { + throw new Error("Empty value provided for input HTTP label: " + memberName + "."); + } + resolvedPath = resolvedPath.replace(uriLabel, isGreedyLabel + ? labelValue + .split("/") + .map((segment) => extendedEncodeURIComponent(segment)) + .join("/") + : extendedEncodeURIComponent(labelValue)); + } + else { + throw new Error("No value provided for input HTTP label: " + memberName + "."); + } + return resolvedPath; +}; -/***/ 9956: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +function requestBuilder(input, context) { + return new RequestBuilder(input, context); +} +class RequestBuilder { + input; + context; + query = {}; + method = ""; + headers = {}; + path = ""; + body = null; + hostname = ""; + resolvePathStack = []; + constructor(input, context) { + this.input = input; + this.context = context; + } + async build() { + const { hostname, protocol = "https", port, path: basePath } = await this.context.endpoint(); + this.path = basePath; + for (const resolvePath of this.resolvePathStack) { + resolvePath(this.path); + } + return new protocolHttp.HttpRequest({ + protocol, + hostname: this.hostname || hostname, + port, + method: this.method, + path: this.path, + query: this.query, + body: this.body, + headers: this.headers, + }); + } + hn(hostname) { + this.hostname = hostname; + return this; + } + bp(uriLabel) { + this.resolvePathStack.push((basePath) => { + this.path = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + uriLabel; + }); + return this; + } + p(memberName, labelValueProvider, uriLabel, isGreedyLabel) { + this.resolvePathStack.push((path) => { + this.path = resolvedPath(path, this.input, memberName, labelValueProvider, uriLabel, isGreedyLabel); + }); + return this; + } + h(headers) { + this.headers = headers; + return this; + } + q(query) { + this.query = query; + return this; + } + b(body) { + this.body = body; + return this; + } + m(method) { + this.method = method; + return this; + } +} -"use strict"; +function determineTimestampFormat(ns, settings) { + if (settings.timestampFormat.useTrait) { + if (ns.isTimestampSchema() && + (ns.getSchema() === 5 || + ns.getSchema() === 6 || + ns.getSchema() === 7)) { + return ns.getSchema(); + } + } + const { httpLabel, httpPrefixHeaders, httpHeader, httpQuery } = ns.getMergedTraits(); + const bindingFormat = settings.httpBindings + ? typeof httpPrefixHeaders === "string" || Boolean(httpHeader) + ? 6 + : Boolean(httpQuery) || Boolean(httpLabel) + ? 5 + : undefined + : undefined; + return bindingFormat ?? settings.timestampFormat.default; +} + +class FromStringShapeDeserializer extends SerdeContext { + settings; + constructor(settings) { + super(); + this.settings = settings; + } + read(_schema, data) { + const ns = schema.NormalizedSchema.of(_schema); + if (ns.isListSchema()) { + return serde.splitHeader(data).map((item) => this.read(ns.getValueSchema(), item)); + } + if (ns.isBlobSchema()) { + return (this.serdeContext?.base64Decoder ?? utilBase64.fromBase64)(data); + } + if (ns.isTimestampSchema()) { + const format = determineTimestampFormat(ns, this.settings); + switch (format) { + case 5: + return serde._parseRfc3339DateTimeWithOffset(data); + case 6: + return serde._parseRfc7231DateTime(data); + case 7: + return serde._parseEpochTimestamp(data); + default: + console.warn("Missing timestamp format, parsing value with Date constructor:", data); + return new Date(data); + } + } + if (ns.isStringSchema()) { + const mediaType = ns.getMergedTraits().mediaType; + let intermediateValue = data; + if (mediaType) { + if (ns.getMergedTraits().httpHeader) { + intermediateValue = this.base64ToUtf8(intermediateValue); + } + const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); + if (isJson) { + intermediateValue = serde.LazyJsonString.from(intermediateValue); + } + return intermediateValue; + } + } + if (ns.isNumericSchema()) { + return Number(data); + } + if (ns.isBigIntegerSchema()) { + return BigInt(data); + } + if (ns.isBigDecimalSchema()) { + return new serde.NumericValue(data, "bigDecimal"); + } + if (ns.isBooleanSchema()) { + return String(data).toLowerCase() === "true"; + } + return data; + } + base64ToUtf8(base64String) { + return (this.serdeContext?.utf8Encoder ?? utilUtf8.toUtf8)((this.serdeContext?.base64Decoder ?? utilBase64.fromBase64)(base64String)); + } +} -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +class HttpInterceptingShapeDeserializer extends SerdeContext { + codecDeserializer; + stringDeserializer; + constructor(codecDeserializer, codecSettings) { + super(); + this.codecDeserializer = codecDeserializer; + this.stringDeserializer = new FromStringShapeDeserializer(codecSettings); + } + setSerdeContext(serdeContext) { + this.stringDeserializer.setSerdeContext(serdeContext); + this.codecDeserializer.setSerdeContext(serdeContext); + this.serdeContext = serdeContext; + } + read(schema$1, data) { + const ns = schema.NormalizedSchema.of(schema$1); + const traits = ns.getMergedTraits(); + const toString = this.serdeContext?.utf8Encoder ?? utilUtf8.toUtf8; + if (traits.httpHeader || traits.httpResponseCode) { + return this.stringDeserializer.read(ns, toString(data)); + } + if (traits.httpPayload) { + if (ns.isBlobSchema()) { + const toBytes = this.serdeContext?.utf8Decoder ?? utilUtf8.fromUtf8; + if (typeof data === "string") { + return toBytes(data); + } + return data; + } + else if (ns.isStringSchema()) { + if ("byteLength" in data) { + return toString(data); + } + return data; + } + } + return this.codecDeserializer.read(ns, data); + } +} -// src/index.ts -var index_exports = {}; -module.exports = __toCommonJS(index_exports); -__reExport(index_exports, __nccwpck_require__(8079), module.exports); -__reExport(index_exports, __nccwpck_require__(4453), module.exports); -// Annotate the CommonJS export names for ESM import in node: +class ToStringShapeSerializer extends SerdeContext { + settings; + stringBuffer = ""; + constructor(settings) { + super(); + this.settings = settings; + } + write(schema$1, value) { + const ns = schema.NormalizedSchema.of(schema$1); + switch (typeof value) { + case "object": + if (value === null) { + this.stringBuffer = "null"; + return; + } + if (ns.isTimestampSchema()) { + if (!(value instanceof Date)) { + throw new Error(`@smithy/core/protocols - received non-Date value ${value} when schema expected Date in ${ns.getName(true)}`); + } + const format = determineTimestampFormat(ns, this.settings); + switch (format) { + case 5: + this.stringBuffer = value.toISOString().replace(".000Z", "Z"); + break; + case 6: + this.stringBuffer = serde.dateToUtcString(value); + break; + case 7: + this.stringBuffer = String(value.getTime() / 1000); + break; + default: + console.warn("Missing timestamp format, using epoch seconds", value); + this.stringBuffer = String(value.getTime() / 1000); + } + return; + } + if (ns.isBlobSchema() && "byteLength" in value) { + this.stringBuffer = (this.serdeContext?.base64Encoder ?? utilBase64.toBase64)(value); + return; + } + if (ns.isListSchema() && Array.isArray(value)) { + let buffer = ""; + for (const item of value) { + this.write([ns.getValueSchema(), ns.getMergedTraits()], item); + const headerItem = this.flush(); + const serialized = ns.getValueSchema().isTimestampSchema() ? headerItem : serde.quoteHeader(headerItem); + if (buffer !== "") { + buffer += ", "; + } + buffer += serialized; + } + this.stringBuffer = buffer; + return; + } + this.stringBuffer = JSON.stringify(value, null, 2); + break; + case "string": + const mediaType = ns.getMergedTraits().mediaType; + let intermediateValue = value; + if (mediaType) { + const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); + if (isJson) { + intermediateValue = serde.LazyJsonString.from(intermediateValue); + } + if (ns.getMergedTraits().httpHeader) { + this.stringBuffer = (this.serdeContext?.base64Encoder ?? utilBase64.toBase64)(intermediateValue.toString()); + return; + } + } + this.stringBuffer = value; + break; + default: + this.stringBuffer = String(value); + } + } + flush() { + const buffer = this.stringBuffer; + this.stringBuffer = ""; + return buffer; + } +} -0 && (0); +class HttpInterceptingShapeSerializer { + codecSerializer; + stringSerializer; + buffer; + constructor(codecSerializer, codecSettings, stringSerializer = new ToStringShapeSerializer(codecSettings)) { + this.codecSerializer = codecSerializer; + this.stringSerializer = stringSerializer; + } + setSerdeContext(serdeContext) { + this.codecSerializer.setSerdeContext(serdeContext); + this.stringSerializer.setSerdeContext(serdeContext); + } + write(schema$1, value) { + const ns = schema.NormalizedSchema.of(schema$1); + const traits = ns.getMergedTraits(); + if (traits.httpHeader || traits.httpLabel || traits.httpQuery) { + this.stringSerializer.write(ns, value); + this.buffer = this.stringSerializer.flush(); + return; + } + return this.codecSerializer.write(ns, value); + } + flush() { + if (this.buffer !== undefined) { + const buffer = this.buffer; + this.buffer = undefined; + return buffer; + } + return this.codecSerializer.flush(); + } +} +exports.FromStringShapeDeserializer = FromStringShapeDeserializer; +exports.HttpBindingProtocol = HttpBindingProtocol; +exports.HttpInterceptingShapeDeserializer = HttpInterceptingShapeDeserializer; +exports.HttpInterceptingShapeSerializer = HttpInterceptingShapeSerializer; +exports.HttpProtocol = HttpProtocol; +exports.RequestBuilder = RequestBuilder; +exports.RpcProtocol = RpcProtocol; +exports.SerdeContext = SerdeContext; +exports.ToStringShapeSerializer = ToStringShapeSerializer; +exports.collectBody = collectBody; +exports.determineTimestampFormat = determineTimestampFormat; +exports.extendedEncodeURIComponent = extendedEncodeURIComponent; +exports.requestBuilder = requestBuilder; +exports.resolvedPath = resolvedPath; /***/ }), -/***/ 2590: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 6890: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - getHostHeaderPlugin: () => getHostHeaderPlugin, - hostHeaderMiddleware: () => hostHeaderMiddleware, - hostHeaderMiddlewareOptions: () => hostHeaderMiddlewareOptions, - resolveHostHeaderConfig: () => resolveHostHeaderConfig -}); -module.exports = __toCommonJS(index_exports); -var import_protocol_http = __nccwpck_require__(2356); -function resolveHostHeaderConfig(input) { - return input; -} -__name(resolveHostHeaderConfig, "resolveHostHeaderConfig"); -var hostHeaderMiddleware = /* @__PURE__ */ __name((options) => (next) => async (args) => { - if (!import_protocol_http.HttpRequest.isInstance(args.request)) return next(args); - const { request } = args; - const { handlerProtocol = "" } = options.requestHandler.metadata || {}; - if (handlerProtocol.indexOf("h2") >= 0 && !request.headers[":authority"]) { - delete request.headers["host"]; - request.headers[":authority"] = request.hostname + (request.port ? ":" + request.port : ""); - } else if (!request.headers["host"]) { - let host = request.hostname; - if (request.port != null) host += `:${request.port}`; - request.headers["host"] = host; - } - return next(args); -}, "hostHeaderMiddleware"); -var hostHeaderMiddlewareOptions = { - name: "hostHeaderMiddleware", - step: "build", - priority: "low", - tags: ["HOST"], - override: true -}; -var getHostHeaderPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.add(hostHeaderMiddleware(options), hostHeaderMiddlewareOptions); - }, "applyToStack") -}), "getHostHeaderPlugin"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - -/***/ }), +var protocolHttp = __nccwpck_require__(2356); +var utilMiddleware = __nccwpck_require__(6324); -/***/ 5242: -/***/ ((module) => { +const deref = (schemaRef) => { + if (typeof schemaRef === "function") { + return schemaRef(); + } + return schemaRef; +}; -"use strict"; +const operation = (namespace, name, traits, input, output) => ({ + name, + namespace, + traits, + input, + output, +}); -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); +const schemaDeserializationMiddleware = (config) => (next, context) => async (args) => { + const { response } = await next(args); + const { operationSchema } = utilMiddleware.getSmithyContext(context); + const [, ns, n, t, i, o] = operationSchema ?? []; + try { + const parsed = await config.protocol.deserializeResponse(operation(ns, n, t, i, o), { + ...config, + ...context, + }, response); + return { + response, + output: parsed, + }; + } + catch (error) { + Object.defineProperty(error, "$response", { + value: response, + }); + if (!("$metadata" in error)) { + const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; + try { + error.message += "\n " + hint; + } + catch (e) { + if (!context.logger || context.logger?.constructor?.name === "NoOpLogger") { + console.warn(hint); + } + else { + context.logger?.warn?.(hint); + } + } + if (typeof error.$responseBodyText !== "undefined") { + if (error.$response) { + error.$response.body = error.$responseBodyText; + } + } + try { + if (protocolHttp.HttpResponse.isInstance(response)) { + const { headers = {} } = response; + const headerEntries = Object.entries(headers); + error.$metadata = { + httpStatusCode: response.statusCode, + requestId: findHeader(/^x-[\w-]+-request-?id$/, headerEntries), + extendedRequestId: findHeader(/^x-[\w-]+-id-2$/, headerEntries), + cfId: findHeader(/^x-[\w-]+-cf-id$/, headerEntries), + }; + } + } + catch (e) { + } + } + throw error; + } }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; +const findHeader = (pattern, headers) => { + return (headers.find(([k]) => { + return k.match(pattern); + }) || [void 0, void 0])[1]; }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - getLoggerPlugin: () => getLoggerPlugin, - loggerMiddleware: () => loggerMiddleware, - loggerMiddlewareOptions: () => loggerMiddlewareOptions -}); -module.exports = __toCommonJS(index_exports); - -// src/loggerMiddleware.ts -var loggerMiddleware = /* @__PURE__ */ __name(() => (next, context) => async (args) => { - try { - const response = await next(args); - const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; - const { overrideInputFilterSensitiveLog, overrideOutputFilterSensitiveLog } = dynamoDbDocumentClientOptions; - const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog; - const outputFilterSensitiveLog = overrideOutputFilterSensitiveLog ?? context.outputFilterSensitiveLog; - const { $metadata, ...outputWithoutMetadata } = response.output; - logger?.info?.({ - clientName, - commandName, - input: inputFilterSensitiveLog(args.input), - output: outputFilterSensitiveLog(outputWithoutMetadata), - metadata: $metadata +const schemaSerializationMiddleware = (config) => (next, context) => async (args) => { + const { operationSchema } = utilMiddleware.getSmithyContext(context); + const [, ns, n, t, i, o] = operationSchema ?? []; + const endpoint = context.endpointV2?.url && config.urlParser + ? async () => config.urlParser(context.endpointV2.url) + : config.endpoint; + const request = await config.protocol.serializeRequest(operation(ns, n, t, i, o), args.input, { + ...config, + ...context, + endpoint, }); - return response; - } catch (error) { - const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; - const { overrideInputFilterSensitiveLog } = dynamoDbDocumentClientOptions; - const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog; - logger?.error?.({ - clientName, - commandName, - input: inputFilterSensitiveLog(args.input), - error, - metadata: error.$metadata + return next({ + ...args, + request, }); - throw error; - } -}, "loggerMiddleware"); -var loggerMiddlewareOptions = { - name: "loggerMiddleware", - tags: ["LOGGER"], - step: "initialize", - override: true -}; -var getLoggerPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.add(loggerMiddleware(), loggerMiddlewareOptions); - }, "applyToStack") -}), "getLoggerPlugin"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); +}; +const deserializerMiddlewareOption = { + name: "deserializerMiddleware", + step: "deserialize", + tags: ["DESERIALIZER"], + override: true, +}; +const serializerMiddlewareOption = { + name: "serializerMiddleware", + step: "serialize", + tags: ["SERIALIZER"], + override: true, +}; +function getSchemaSerdePlugin(config) { + return { + applyToStack: (commandStack) => { + commandStack.add(schemaSerializationMiddleware(config), serializerMiddlewareOption); + commandStack.add(schemaDeserializationMiddleware(config), deserializerMiddlewareOption); + config.protocol.setSerdeContext(config); + }, + }; +} +class Schema { + name; + namespace; + traits; + static assign(instance, values) { + const schema = Object.assign(instance, values); + return schema; + } + static [Symbol.hasInstance](lhs) { + const isPrototype = this.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const list = lhs; + return list.symbol === this.symbol; + } + return isPrototype; + } + getName() { + return this.namespace + "#" + this.name; + } +} -/***/ }), +class ListSchema extends Schema { + static symbol = Symbol.for("@smithy/lis"); + name; + traits; + valueSchema; + symbol = ListSchema.symbol; +} +const list = (namespace, name, traits, valueSchema) => Schema.assign(new ListSchema(), { + name, + namespace, + traits, + valueSchema, +}); -/***/ 1568: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +class MapSchema extends Schema { + static symbol = Symbol.for("@smithy/map"); + name; + traits; + keySchema; + valueSchema; + symbol = MapSchema.symbol; +} +const map = (namespace, name, traits, keySchema, valueSchema) => Schema.assign(new MapSchema(), { + name, + namespace, + traits, + keySchema, + valueSchema, +}); -"use strict"; +class OperationSchema extends Schema { + static symbol = Symbol.for("@smithy/ope"); + name; + traits; + input; + output; + symbol = OperationSchema.symbol; +} +const op = (namespace, name, traits, input, output) => Schema.assign(new OperationSchema(), { + name, + namespace, + traits, + input, + output, +}); -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +class StructureSchema extends Schema { + static symbol = Symbol.for("@smithy/str"); + name; + traits; + memberNames; + memberList; + symbol = StructureSchema.symbol; +} +const struct = (namespace, name, traits, memberNames, memberList) => Schema.assign(new StructureSchema(), { + name, + namespace, + traits, + memberNames, + memberList, +}); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - getRecursionDetectionPlugin: () => getRecursionDetectionPlugin +class ErrorSchema extends StructureSchema { + static symbol = Symbol.for("@smithy/err"); + ctor; + symbol = ErrorSchema.symbol; +} +const error = (namespace, name, traits, memberNames, memberList, ctor) => Schema.assign(new ErrorSchema(), { + name, + namespace, + traits, + memberNames, + memberList, + ctor: null, }); -module.exports = __toCommonJS(index_exports); -// src/configuration.ts -var recursionDetectionMiddlewareOptions = { - step: "build", - tags: ["RECURSION_DETECTION"], - name: "recursionDetectionMiddleware", - override: true, - priority: "low" -}; +function translateTraits(indicator) { + if (typeof indicator === "object") { + return indicator; + } + indicator = indicator | 0; + const traits = {}; + let i = 0; + for (const trait of [ + "httpLabel", + "idempotent", + "idempotencyToken", + "sensitive", + "httpPayload", + "httpResponseCode", + "httpQueryParams", + ]) { + if (((indicator >> i++) & 1) === 1) { + traits[trait] = 1; + } + } + return traits; +} -// src/getRecursionDetectionPlugin.ts -var import_recursionDetectionMiddleware = __nccwpck_require__(2521); -var getRecursionDetectionPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.add((0, import_recursionDetectionMiddleware.recursionDetectionMiddleware)(), recursionDetectionMiddlewareOptions); - }, "applyToStack") -}), "getRecursionDetectionPlugin"); +class NormalizedSchema { + ref; + memberName; + static symbol = Symbol.for("@smithy/nor"); + symbol = NormalizedSchema.symbol; + name; + schema; + _isMemberSchema; + traits; + memberTraits; + normalizedTraits; + constructor(ref, memberName) { + this.ref = ref; + this.memberName = memberName; + const traitStack = []; + let _ref = ref; + let schema = ref; + this._isMemberSchema = false; + while (isMemberSchema(_ref)) { + traitStack.push(_ref[1]); + _ref = _ref[0]; + schema = deref(_ref); + this._isMemberSchema = true; + } + if (traitStack.length > 0) { + this.memberTraits = {}; + for (let i = traitStack.length - 1; i >= 0; --i) { + const traitSet = traitStack[i]; + Object.assign(this.memberTraits, translateTraits(traitSet)); + } + } + else { + this.memberTraits = 0; + } + if (schema instanceof NormalizedSchema) { + const computedMemberTraits = this.memberTraits; + Object.assign(this, schema); + this.memberTraits = Object.assign({}, computedMemberTraits, schema.getMemberTraits(), this.getMemberTraits()); + this.normalizedTraits = void 0; + this.memberName = memberName ?? schema.memberName; + return; + } + this.schema = deref(schema); + if (isStaticSchema(this.schema)) { + this.name = `${this.schema[1]}#${this.schema[2]}`; + this.traits = this.schema[3]; + } + else { + this.name = this.memberName ?? String(schema); + this.traits = 0; + } + if (this._isMemberSchema && !memberName) { + throw new Error(`@smithy/core/schema - NormalizedSchema member init ${this.getName(true)} missing member name.`); + } + } + static [Symbol.hasInstance](lhs) { + const isPrototype = this.prototype.isPrototypeOf(lhs); + if (!isPrototype && typeof lhs === "object" && lhs !== null) { + const ns = lhs; + return ns.symbol === this.symbol; + } + return isPrototype; + } + static of(ref) { + const sc = deref(ref); + if (sc instanceof NormalizedSchema) { + return sc; + } + if (isMemberSchema(sc)) { + const [ns, traits] = sc; + if (ns instanceof NormalizedSchema) { + Object.assign(ns.getMergedTraits(), translateTraits(traits)); + return ns; + } + throw new Error(`@smithy/core/schema - may not init unwrapped member schema=${JSON.stringify(ref, null, 2)}.`); + } + return new NormalizedSchema(sc); + } + getSchema() { + const sc = this.schema; + if (sc[0] === 0) { + return sc[4]; + } + return sc; + } + getName(withNamespace = false) { + const { name } = this; + const short = !withNamespace && name && name.includes("#"); + return short ? name.split("#")[1] : name || undefined; + } + getMemberName() { + return this.memberName; + } + isMemberSchema() { + return this._isMemberSchema; + } + isListSchema() { + const sc = this.getSchema(); + return typeof sc === "number" + ? sc >= 64 && sc < 128 + : sc[0] === 1; + } + isMapSchema() { + const sc = this.getSchema(); + return typeof sc === "number" + ? sc >= 128 && sc <= 0b1111_1111 + : sc[0] === 2; + } + isStructSchema() { + const sc = this.getSchema(); + return (sc[0] === 3 || + sc[0] === -3); + } + isBlobSchema() { + const sc = this.getSchema(); + return sc === 21 || sc === 42; + } + isTimestampSchema() { + const sc = this.getSchema(); + return (typeof sc === "number" && + sc >= 4 && + sc <= 7); + } + isUnitSchema() { + return this.getSchema() === "unit"; + } + isDocumentSchema() { + return this.getSchema() === 15; + } + isStringSchema() { + return this.getSchema() === 0; + } + isBooleanSchema() { + return this.getSchema() === 2; + } + isNumericSchema() { + return this.getSchema() === 1; + } + isBigIntegerSchema() { + return this.getSchema() === 17; + } + isBigDecimalSchema() { + return this.getSchema() === 19; + } + isStreaming() { + const { streaming } = this.getMergedTraits(); + return !!streaming || this.getSchema() === 42; + } + isIdempotencyToken() { + const match = (traits) => (traits & 0b0100) === 0b0100 || + !!traits?.idempotencyToken; + const { normalizedTraits, traits, memberTraits } = this; + return match(normalizedTraits) || match(traits) || match(memberTraits); + } + getMergedTraits() { + return (this.normalizedTraits ?? + (this.normalizedTraits = { + ...this.getOwnTraits(), + ...this.getMemberTraits(), + })); + } + getMemberTraits() { + return translateTraits(this.memberTraits); + } + getOwnTraits() { + return translateTraits(this.traits); + } + getKeySchema() { + const [isDoc, isMap] = [this.isDocumentSchema(), this.isMapSchema()]; + if (!isDoc && !isMap) { + throw new Error(`@smithy/core/schema - cannot get key for non-map: ${this.getName(true)}`); + } + const schema = this.getSchema(); + const memberSchema = isDoc + ? 15 + : schema[4] ?? 0; + return member([memberSchema, 0], "key"); + } + getValueSchema() { + const sc = this.getSchema(); + const [isDoc, isMap, isList] = [this.isDocumentSchema(), this.isMapSchema(), this.isListSchema()]; + const memberSchema = typeof sc === "number" + ? 0b0011_1111 & sc + : sc && typeof sc === "object" && (isMap || isList) + ? sc[3 + sc[0]] + : isDoc + ? 15 + : void 0; + if (memberSchema != null) { + return member([memberSchema, 0], isMap ? "value" : "member"); + } + throw new Error(`@smithy/core/schema - ${this.getName(true)} has no value member.`); + } + getMemberSchema(memberName) { + const struct = this.getSchema(); + if (this.isStructSchema() && struct[4].includes(memberName)) { + const i = struct[4].indexOf(memberName); + const memberSchema = struct[5][i]; + return member(isMemberSchema(memberSchema) ? memberSchema : [memberSchema, 0], memberName); + } + if (this.isDocumentSchema()) { + return member([15, 0], memberName); + } + throw new Error(`@smithy/core/schema - ${this.getName(true)} has no no member=${memberName}.`); + } + getMemberSchemas() { + const buffer = {}; + try { + for (const [k, v] of this.structIterator()) { + buffer[k] = v; + } + } + catch (ignored) { } + return buffer; + } + getEventStreamMember() { + if (this.isStructSchema()) { + for (const [memberName, memberSchema] of this.structIterator()) { + if (memberSchema.isStreaming() && memberSchema.isStructSchema()) { + return memberName; + } + } + } + return ""; + } + *structIterator() { + if (this.isUnitSchema()) { + return; + } + if (!this.isStructSchema()) { + throw new Error("@smithy/core/schema - cannot iterate non-struct schema."); + } + const struct = this.getSchema(); + for (let i = 0; i < struct[4].length; ++i) { + yield [struct[4][i], member([struct[5][i], 0], struct[4][i])]; + } + } +} +function member(memberSchema, memberName) { + if (memberSchema instanceof NormalizedSchema) { + return Object.assign(memberSchema, { + memberName, + _isMemberSchema: true, + }); + } + const internalCtorAccess = NormalizedSchema; + return new internalCtorAccess(memberSchema, memberName); +} +const isMemberSchema = (sc) => Array.isArray(sc) && sc.length === 2; +const isStaticSchema = (sc) => Array.isArray(sc) && sc.length >= 5; -// src/index.ts -__reExport(index_exports, __nccwpck_require__(2521), module.exports); -// Annotate the CommonJS export names for ESM import in node: +class SimpleSchema extends Schema { + static symbol = Symbol.for("@smithy/sim"); + name; + schemaRef; + traits; + symbol = SimpleSchema.symbol; +} +const sim = (namespace, name, schemaRef, traits) => Schema.assign(new SimpleSchema(), { + name, + namespace, + traits, + schemaRef, +}); +const simAdapter = (namespace, name, traits, schemaRef) => Schema.assign(new SimpleSchema(), { + name, + namespace, + traits, + schemaRef, +}); -0 && (0); +const SCHEMA = { + BLOB: 0b0001_0101, + STREAMING_BLOB: 0b0010_1010, + BOOLEAN: 0b0000_0010, + STRING: 0b0000_0000, + NUMERIC: 0b0000_0001, + BIG_INTEGER: 0b0001_0001, + BIG_DECIMAL: 0b0001_0011, + DOCUMENT: 0b0000_1111, + TIMESTAMP_DEFAULT: 0b0000_0100, + TIMESTAMP_DATE_TIME: 0b0000_0101, + TIMESTAMP_HTTP_DATE: 0b0000_0110, + TIMESTAMP_EPOCH_SECONDS: 0b0000_0111, + LIST_MODIFIER: 0b0100_0000, + MAP_MODIFIER: 0b1000_0000, +}; + +class TypeRegistry { + namespace; + schemas; + exceptions; + static registries = new Map(); + constructor(namespace, schemas = new Map(), exceptions = new Map()) { + this.namespace = namespace; + this.schemas = schemas; + this.exceptions = exceptions; + } + static for(namespace) { + if (!TypeRegistry.registries.has(namespace)) { + TypeRegistry.registries.set(namespace, new TypeRegistry(namespace)); + } + return TypeRegistry.registries.get(namespace); + } + register(shapeId, schema) { + const qualifiedName = this.normalizeShapeId(shapeId); + const registry = TypeRegistry.for(qualifiedName.split("#")[0]); + registry.schemas.set(qualifiedName, schema); + } + getSchema(shapeId) { + const id = this.normalizeShapeId(shapeId); + if (!this.schemas.has(id)) { + throw new Error(`@smithy/core/schema - schema not found for ${id}`); + } + return this.schemas.get(id); + } + registerError(es, ctor) { + const $error = es; + const registry = TypeRegistry.for($error[1]); + registry.schemas.set($error[1] + "#" + $error[2], $error); + registry.exceptions.set($error, ctor); + } + getErrorCtor(es) { + const $error = es; + const registry = TypeRegistry.for($error[1]); + return registry.exceptions.get($error); + } + getBaseException() { + for (const exceptionKey of this.exceptions.keys()) { + if (Array.isArray(exceptionKey)) { + const [, ns, name] = exceptionKey; + const id = ns + "#" + name; + if (id.startsWith("smithy.ts.sdk.synthetic.") && id.endsWith("ServiceException")) { + return exceptionKey; + } + } + } + return undefined; + } + find(predicate) { + return [...this.schemas.values()].find(predicate); + } + clear() { + this.schemas.clear(); + this.exceptions.clear(); + } + normalizeShapeId(shapeId) { + if (shapeId.includes("#")) { + return shapeId; + } + return this.namespace + "#" + shapeId; + } +} +exports.ErrorSchema = ErrorSchema; +exports.ListSchema = ListSchema; +exports.MapSchema = MapSchema; +exports.NormalizedSchema = NormalizedSchema; +exports.OperationSchema = OperationSchema; +exports.SCHEMA = SCHEMA; +exports.Schema = Schema; +exports.SimpleSchema = SimpleSchema; +exports.StructureSchema = StructureSchema; +exports.TypeRegistry = TypeRegistry; +exports.deref = deref; +exports.deserializerMiddlewareOption = deserializerMiddlewareOption; +exports.error = error; +exports.getSchemaSerdePlugin = getSchemaSerdePlugin; +exports.isStaticSchema = isStaticSchema; +exports.list = list; +exports.map = map; +exports.op = op; +exports.operation = operation; +exports.serializerMiddlewareOption = serializerMiddlewareOption; +exports.sim = sim; +exports.simAdapter = simAdapter; +exports.struct = struct; +exports.translateTraits = translateTraits; /***/ }), -/***/ 2521: +/***/ 2430: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.recursionDetectionMiddleware = void 0; -const lambda_invoke_store_1 = __nccwpck_require__(7453); -const protocol_http_1 = __nccwpck_require__(2356); -const TRACE_ID_HEADER_NAME = "X-Amzn-Trace-Id"; -const ENV_LAMBDA_FUNCTION_NAME = "AWS_LAMBDA_FUNCTION_NAME"; -const ENV_TRACE_ID = "_X_AMZN_TRACE_ID"; -const recursionDetectionMiddleware = () => (next) => async (args) => { - const { request } = args; - if (!protocol_http_1.HttpRequest.isInstance(request)) { - return next(args); - } - const traceIdHeader = Object.keys(request.headers ?? {}).find((h) => h.toLowerCase() === TRACE_ID_HEADER_NAME.toLowerCase()) ?? - TRACE_ID_HEADER_NAME; - if (request.headers.hasOwnProperty(traceIdHeader)) { - return next(args); - } - const functionName = process.env[ENV_LAMBDA_FUNCTION_NAME]; - const traceIdFromEnv = process.env[ENV_TRACE_ID]; - const traceIdFromInvokeStore = lambda_invoke_store_1.InvokeStore.getXRayTraceId(); - const traceId = traceIdFromInvokeStore ?? traceIdFromEnv; - const nonEmptyString = (str) => typeof str === "string" && str.length > 0; - if (nonEmptyString(functionName) && nonEmptyString(traceId)) { - request.headers[TRACE_ID_HEADER_NAME] = traceId; - } - return next({ - ...args, - request, - }); -}; -exports.recursionDetectionMiddleware = recursionDetectionMiddleware; - - -/***/ }), -/***/ 2959: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +var uuid = __nccwpck_require__(266); -"use strict"; +const copyDocumentWithTransform = (source, schemaRef, transform = (_) => _) => source; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); +const parseBoolean = (value) => { + switch (value) { + case "true": + return true; + case "false": + return false; + default: + throw new Error(`Unable to parse boolean value "${value}"`); + } }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; +const expectBoolean = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value === "number") { + if (value === 0 || value === 1) { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (value === 0) { + return false; + } + if (value === 1) { + return true; + } + } + if (typeof value === "string") { + const lower = value.toLowerCase(); + if (lower === "false" || lower === "true") { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (lower === "false") { + return false; + } + if (lower === "true") { + return true; + } + } + if (typeof value === "boolean") { + return value; + } + throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); +}; +const expectNumber = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value === "string") { + const parsed = parseFloat(value); + if (!Number.isNaN(parsed)) { + if (String(parsed) !== String(value)) { + logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); + } + return parsed; + } + } + if (typeof value === "number") { + return value; + } + throw new TypeError(`Expected number, got ${typeof value}: ${value}`); +}; +const MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); +const expectFloat32 = (value) => { + const expected = expectNumber(value); + if (expected !== undefined && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { + if (Math.abs(expected) > MAX_FLOAT) { + throw new TypeError(`Expected 32-bit float, got ${value}`); + } + } + return expected; +}; +const expectLong = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (Number.isInteger(value) && !Number.isNaN(value)) { + return value; + } + throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); +}; +const expectInt = expectLong; +const expectInt32 = (value) => expectSizedInt(value, 32); +const expectShort = (value) => expectSizedInt(value, 16); +const expectByte = (value) => expectSizedInt(value, 8); +const expectSizedInt = (value, size) => { + const expected = expectLong(value); + if (expected !== undefined && castInt(expected, size) !== expected) { + throw new TypeError(`Expected ${size}-bit integer, got ${value}`); + } + return expected; +}; +const castInt = (value, size) => { + switch (size) { + case 32: + return Int32Array.of(value)[0]; + case 16: + return Int16Array.of(value)[0]; + case 8: + return Int8Array.of(value)[0]; + } +}; +const expectNonNull = (value, location) => { + if (value === null || value === undefined) { + if (location) { + throw new TypeError(`Expected a non-null value for ${location}`); + } + throw new TypeError("Expected a non-null value"); + } + return value; +}; +const expectObject = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value === "object" && !Array.isArray(value)) { + return value; + } + const receivedType = Array.isArray(value) ? "array" : typeof value; + throw new TypeError(`Expected object, got ${receivedType}: ${value}`); +}; +const expectString = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value === "string") { + return value; + } + if (["boolean", "number", "bigint"].includes(typeof value)) { + logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); + return String(value); + } + throw new TypeError(`Expected string, got ${typeof value}: ${value}`); +}; +const expectUnion = (value) => { + if (value === null || value === undefined) { + return undefined; + } + const asObject = expectObject(value); + const setKeys = Object.entries(asObject) + .filter(([, v]) => v != null) + .map(([k]) => k); + if (setKeys.length === 0) { + throw new TypeError(`Unions must have exactly one non-null member. None were found.`); + } + if (setKeys.length > 1) { + throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); + } + return asObject; +}; +const strictParseDouble = (value) => { + if (typeof value == "string") { + return expectNumber(parseNumber(value)); + } + return expectNumber(value); +}; +const strictParseFloat = strictParseDouble; +const strictParseFloat32 = (value) => { + if (typeof value == "string") { + return expectFloat32(parseNumber(value)); + } + return expectFloat32(value); +}; +const NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; +const parseNumber = (value) => { + const matches = value.match(NUMBER_REGEX); + if (matches === null || matches[0].length !== value.length) { + throw new TypeError(`Expected real number, got implicit NaN`); + } + return parseFloat(value); +}; +const limitedParseDouble = (value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectNumber(value); +}; +const handleFloat = limitedParseDouble; +const limitedParseFloat = limitedParseDouble; +const limitedParseFloat32 = (value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectFloat32(value); +}; +const parseFloatString = (value) => { + switch (value) { + case "NaN": + return NaN; + case "Infinity": + return Infinity; + case "-Infinity": + return -Infinity; + default: + throw new Error(`Unable to parse float value: ${value}`); + } +}; +const strictParseLong = (value) => { + if (typeof value === "string") { + return expectLong(parseNumber(value)); + } + return expectLong(value); +}; +const strictParseInt = strictParseLong; +const strictParseInt32 = (value) => { + if (typeof value === "string") { + return expectInt32(parseNumber(value)); + } + return expectInt32(value); +}; +const strictParseShort = (value) => { + if (typeof value === "string") { + return expectShort(parseNumber(value)); + } + return expectShort(value); +}; +const strictParseByte = (value) => { + if (typeof value === "string") { + return expectByte(parseNumber(value)); + } + return expectByte(value); +}; +const stackTraceWarning = (message) => { + return String(new TypeError(message).stack || message) + .split("\n") + .slice(0, 5) + .filter((s) => !s.includes("stackTraceWarning")) + .join("\n"); +}; +const logger = { + warn: console.warn, }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - DEFAULT_UA_APP_ID: () => DEFAULT_UA_APP_ID, - getUserAgentMiddlewareOptions: () => getUserAgentMiddlewareOptions, - getUserAgentPlugin: () => getUserAgentPlugin, - resolveUserAgentConfig: () => resolveUserAgentConfig, - userAgentMiddleware: () => userAgentMiddleware -}); -module.exports = __toCommonJS(index_exports); -// src/configurations.ts -var import_core = __nccwpck_require__(402); -var DEFAULT_UA_APP_ID = void 0; -function isValidUserAgentAppId(appId) { - if (appId === void 0) { - return true; - } - return typeof appId === "string" && appId.length <= 50; -} -__name(isValidUserAgentAppId, "isValidUserAgentAppId"); -function resolveUserAgentConfig(input) { - const normalizedAppIdProvider = (0, import_core.normalizeProvider)(input.userAgentAppId ?? DEFAULT_UA_APP_ID); - const { customUserAgent } = input; - return Object.assign(input, { - customUserAgent: typeof customUserAgent === "string" ? [[customUserAgent]] : customUserAgent, - userAgentAppId: /* @__PURE__ */ __name(async () => { - const appId = await normalizedAppIdProvider(); - if (!isValidUserAgentAppId(appId)) { - const logger = input.logger?.constructor?.name === "NoOpLogger" || !input.logger ? console : input.logger; - if (typeof appId !== "string") { - logger?.warn("userAgentAppId must be a string or undefined."); - } else if (appId.length > 50) { - logger?.warn("The provided userAgentAppId exceeds the maximum length of 50 characters."); - } - } - return appId; - }, "userAgentAppId") - }); -} -__name(resolveUserAgentConfig, "resolveUserAgentConfig"); +const DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; +const MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; +function dateToUtcString(date) { + const year = date.getUTCFullYear(); + const month = date.getUTCMonth(); + const dayOfWeek = date.getUTCDay(); + const dayOfMonthInt = date.getUTCDate(); + const hoursInt = date.getUTCHours(); + const minutesInt = date.getUTCMinutes(); + const secondsInt = date.getUTCSeconds(); + const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; + const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; + const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; + const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; + return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; +} +const RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); +const parseRfc3339DateTime = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); + } + const match = RFC3339.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); + } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); +}; +const RFC3339_WITH_OFFSET$1 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/); +const parseRfc3339DateTimeWithOffset = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); + } + const match = RFC3339_WITH_OFFSET$1.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); + } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); + if (offsetStr.toUpperCase() != "Z") { + date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); + } + return date; +}; +const IMF_FIXDATE$1 = new RegExp(/^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/); +const RFC_850_DATE$1 = new RegExp(/^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/); +const ASC_TIME$1 = new RegExp(/^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/); +const parseRfc7231DateTime = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value !== "string") { + throw new TypeError("RFC-7231 date-times must be expressed as strings"); + } + let match = IMF_FIXDATE$1.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return buildDate(strictParseShort(stripLeadingZeroes(yearStr)), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { hours, minutes, seconds, fractionalMilliseconds }); + } + match = RFC_850_DATE$1.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return adjustRfc850Year(buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { + hours, + minutes, + seconds, + fractionalMilliseconds, + })); + } + match = ASC_TIME$1.exec(value); + if (match) { + const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; + return buildDate(strictParseShort(stripLeadingZeroes(yearStr)), parseMonthByShortName(monthStr), parseDateValue(dayStr.trimLeft(), "day", 1, 31), { hours, minutes, seconds, fractionalMilliseconds }); + } + throw new TypeError("Invalid RFC-7231 date-time value"); +}; +const parseEpochTimestamp = (value) => { + if (value === null || value === undefined) { + return undefined; + } + let valueAsDouble; + if (typeof value === "number") { + valueAsDouble = value; + } + else if (typeof value === "string") { + valueAsDouble = strictParseDouble(value); + } + else if (typeof value === "object" && value.tag === 1) { + valueAsDouble = value.value; + } + else { + throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); + } + if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { + throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); + } + return new Date(Math.round(valueAsDouble * 1000)); +}; +const buildDate = (year, month, day, time) => { + const adjustedMonth = month - 1; + validateDayOfMonth(year, adjustedMonth, day); + return new Date(Date.UTC(year, adjustedMonth, day, parseDateValue(time.hours, "hour", 0, 23), parseDateValue(time.minutes, "minute", 0, 59), parseDateValue(time.seconds, "seconds", 0, 60), parseMilliseconds(time.fractionalMilliseconds))); +}; +const parseTwoDigitYear = (value) => { + const thisYear = new Date().getUTCFullYear(); + const valueInThisCentury = Math.floor(thisYear / 100) * 100 + strictParseShort(stripLeadingZeroes(value)); + if (valueInThisCentury < thisYear) { + return valueInThisCentury + 100; + } + return valueInThisCentury; +}; +const FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1000; +const adjustRfc850Year = (input) => { + if (input.getTime() - new Date().getTime() > FIFTY_YEARS_IN_MILLIS) { + return new Date(Date.UTC(input.getUTCFullYear() - 100, input.getUTCMonth(), input.getUTCDate(), input.getUTCHours(), input.getUTCMinutes(), input.getUTCSeconds(), input.getUTCMilliseconds())); + } + return input; +}; +const parseMonthByShortName = (value) => { + const monthIdx = MONTHS.indexOf(value); + if (monthIdx < 0) { + throw new TypeError(`Invalid month: ${value}`); + } + return monthIdx + 1; +}; +const DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; +const validateDayOfMonth = (year, month, day) => { + let maxDays = DAYS_IN_MONTH[month]; + if (month === 1 && isLeapYear(year)) { + maxDays = 29; + } + if (day > maxDays) { + throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); + } +}; +const isLeapYear = (year) => { + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); +}; +const parseDateValue = (value, type, lower, upper) => { + const dateVal = strictParseByte(stripLeadingZeroes(value)); + if (dateVal < lower || dateVal > upper) { + throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); + } + return dateVal; +}; +const parseMilliseconds = (value) => { + if (value === null || value === undefined) { + return 0; + } + return strictParseFloat32("0." + value) * 1000; +}; +const parseOffsetToMilliseconds = (value) => { + const directionStr = value[0]; + let direction = 1; + if (directionStr == "+") { + direction = 1; + } + else if (directionStr == "-") { + direction = -1; + } + else { + throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); + } + const hour = Number(value.substring(1, 3)); + const minute = Number(value.substring(4, 6)); + return direction * (hour * 60 + minute) * 60 * 1000; +}; +const stripLeadingZeroes = (value) => { + let idx = 0; + while (idx < value.length - 1 && value.charAt(idx) === "0") { + idx++; + } + if (idx === 0) { + return value; + } + return value.slice(idx); +}; -// src/user-agent-middleware.ts -var import_util_endpoints = __nccwpck_require__(3068); -var import_protocol_http = __nccwpck_require__(2356); +const LazyJsonString = function LazyJsonString(val) { + const str = Object.assign(new String(val), { + deserializeJSON() { + return JSON.parse(String(val)); + }, + toString() { + return String(val); + }, + toJSON() { + return String(val); + }, + }); + return str; +}; +LazyJsonString.from = (object) => { + if (object && typeof object === "object" && (object instanceof LazyJsonString || "deserializeJSON" in object)) { + return object; + } + else if (typeof object === "string" || Object.getPrototypeOf(object) === String.prototype) { + return LazyJsonString(String(object)); + } + return LazyJsonString(JSON.stringify(object)); +}; +LazyJsonString.fromObject = LazyJsonString.from; -// src/check-features.ts -var import_core2 = __nccwpck_require__(8704); -var ACCOUNT_ID_ENDPOINT_REGEX = /\d{12}\.ddb/; -async function checkFeatures(context, config, args) { - const request = args.request; - if (request?.headers?.["smithy-protocol"] === "rpc-v2-cbor") { - (0, import_core2.setFeature)(context, "PROTOCOL_RPC_V2_CBOR", "M"); - } - if (typeof config.retryStrategy === "function") { - const retryStrategy = await config.retryStrategy(); - if (typeof retryStrategy.acquireInitialRetryToken === "function") { - if (retryStrategy.constructor?.name?.includes("Adaptive")) { - (0, import_core2.setFeature)(context, "RETRY_MODE_ADAPTIVE", "F"); - } else { - (0, import_core2.setFeature)(context, "RETRY_MODE_STANDARD", "E"); - } - } else { - (0, import_core2.setFeature)(context, "RETRY_MODE_LEGACY", "D"); +function quoteHeader(part) { + if (part.includes(",") || part.includes('"')) { + part = `"${part.replace(/"/g, '\\"')}"`; + } + return part; +} + +const ddd = `(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun)(?:[ne|u?r]?s?day)?`; +const mmm = `(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)`; +const time = `(\\d?\\d):(\\d{2}):(\\d{2})(?:\\.(\\d+))?`; +const date = `(\\d?\\d)`; +const year = `(\\d{4})`; +const RFC3339_WITH_OFFSET = new RegExp(/^(\d{4})-(\d\d)-(\d\d)[tT](\d\d):(\d\d):(\d\d)(\.(\d+))?(([-+]\d\d:\d\d)|[zZ])$/); +const IMF_FIXDATE = new RegExp(`^${ddd}, ${date} ${mmm} ${year} ${time} GMT$`); +const RFC_850_DATE = new RegExp(`^${ddd}, ${date}-${mmm}-(\\d\\d) ${time} GMT$`); +const ASC_TIME = new RegExp(`^${ddd} ${mmm} ( [1-9]|\\d\\d) ${time} ${year}$`); +const months = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; +const _parseEpochTimestamp = (value) => { + if (value == null) { + return void 0; } - } - if (typeof config.accountIdEndpointMode === "function") { - const endpointV2 = context.endpointV2; - if (String(endpointV2?.url?.hostname).match(ACCOUNT_ID_ENDPOINT_REGEX)) { - (0, import_core2.setFeature)(context, "ACCOUNT_ID_ENDPOINT", "O"); + let num = NaN; + if (typeof value === "number") { + num = value; } - switch (await config.accountIdEndpointMode?.()) { - case "disabled": - (0, import_core2.setFeature)(context, "ACCOUNT_ID_MODE_DISABLED", "Q"); - break; - case "preferred": - (0, import_core2.setFeature)(context, "ACCOUNT_ID_MODE_PREFERRED", "P"); - break; - case "required": - (0, import_core2.setFeature)(context, "ACCOUNT_ID_MODE_REQUIRED", "R"); - break; + else if (typeof value === "string") { + if (!/^-?\d*\.?\d+$/.test(value)) { + throw new TypeError(`parseEpochTimestamp - numeric string invalid.`); + } + num = Number.parseFloat(value); } - } - const identity = context.__smithy_context?.selectedHttpAuthScheme?.identity; - if (identity?.$source) { - const credentials = identity; - if (credentials.accountId) { - (0, import_core2.setFeature)(context, "RESOLVED_ACCOUNT_ID", "T"); + else if (typeof value === "object" && value.tag === 1) { + num = value.value; } - for (const [key, value] of Object.entries(credentials.$source ?? {})) { - (0, import_core2.setFeature)(context, key, value); + if (isNaN(num) || Math.abs(num) === Infinity) { + throw new TypeError("Epoch timestamps must be valid finite numbers."); + } + return new Date(Math.round(num * 1000)); +}; +const _parseRfc3339DateTimeWithOffset = (value) => { + if (value == null) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC3339 timestamps must be strings"); + } + const matches = RFC3339_WITH_OFFSET.exec(value); + if (!matches) { + throw new TypeError(`Invalid RFC3339 timestamp format ${value}`); + } + const [, yearStr, monthStr, dayStr, hours, minutes, seconds, , ms, offsetStr] = matches; + range(monthStr, 1, 12); + range(dayStr, 1, 31); + range(hours, 0, 23); + range(minutes, 0, 59); + range(seconds, 0, 60); + const date = new Date(Date.UTC(Number(yearStr), Number(monthStr) - 1, Number(dayStr), Number(hours), Number(minutes), Number(seconds), Number(ms) ? Math.round(parseFloat(`0.${ms}`) * 1000) : 0)); + date.setUTCFullYear(Number(yearStr)); + if (offsetStr.toUpperCase() != "Z") { + const [, sign, offsetH, offsetM] = /([+-])(\d\d):(\d\d)/.exec(offsetStr) || [void 0, "+", 0, 0]; + const scalar = sign === "-" ? 1 : -1; + date.setTime(date.getTime() + scalar * (Number(offsetH) * 60 * 60 * 1000 + Number(offsetM) * 60 * 1000)); + } + return date; +}; +const _parseRfc7231DateTime = (value) => { + if (value == null) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC7231 timestamps must be strings."); + } + let day; + let month; + let year; + let hour; + let minute; + let second; + let fraction; + let matches; + if ((matches = IMF_FIXDATE.exec(value))) { + [, day, month, year, hour, minute, second, fraction] = matches; + } + else if ((matches = RFC_850_DATE.exec(value))) { + [, day, month, year, hour, minute, second, fraction] = matches; + year = (Number(year) + 1900).toString(); + } + else if ((matches = ASC_TIME.exec(value))) { + [, month, day, hour, minute, second, fraction, year] = matches; + } + if (year && second) { + const timestamp = Date.UTC(Number(year), months.indexOf(month), Number(day), Number(hour), Number(minute), Number(second), fraction ? Math.round(parseFloat(`0.${fraction}`) * 1000) : 0); + range(day, 1, 31); + range(hour, 0, 23); + range(minute, 0, 59); + range(second, 0, 60); + const date = new Date(timestamp); + date.setUTCFullYear(Number(year)); + return date; + } + throw new TypeError(`Invalid RFC7231 date-time value ${value}.`); +}; +function range(v, min, max) { + const _v = Number(v); + if (_v < min || _v > max) { + throw new Error(`Value ${_v} out of range [${min}, ${max}]`); } - } } -__name(checkFeatures, "checkFeatures"); -// src/constants.ts -var USER_AGENT = "user-agent"; -var X_AMZ_USER_AGENT = "x-amz-user-agent"; -var SPACE = " "; -var UA_NAME_SEPARATOR = "/"; -var UA_NAME_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w]/g; -var UA_VALUE_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w\#]/g; -var UA_ESCAPE_CHAR = "-"; - -// src/encode-features.ts -var BYTE_LIMIT = 1024; -function encodeFeatures(features) { - let buffer = ""; - for (const key in features) { - const val = features[key]; - if (buffer.length + val.length + 1 <= BYTE_LIMIT) { - if (buffer.length) { - buffer += "," + val; - } else { - buffer += val; - } - continue; +function splitEvery(value, delimiter, numDelimiters) { + if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { + throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); } - break; - } - return buffer; + const segments = value.split(delimiter); + if (numDelimiters === 1) { + return segments; + } + const compoundSegments = []; + let currentSegment = ""; + for (let i = 0; i < segments.length; i++) { + if (currentSegment === "") { + currentSegment = segments[i]; + } + else { + currentSegment += delimiter + segments[i]; + } + if ((i + 1) % numDelimiters === 0) { + compoundSegments.push(currentSegment); + currentSegment = ""; + } + } + if (currentSegment !== "") { + compoundSegments.push(currentSegment); + } + return compoundSegments; } -__name(encodeFeatures, "encodeFeatures"); -// src/user-agent-middleware.ts -var userAgentMiddleware = /* @__PURE__ */ __name((options) => (next, context) => async (args) => { - const { request } = args; - if (!import_protocol_http.HttpRequest.isInstance(request)) { - return next(args); - } - const { headers } = request; - const userAgent = context?.userAgent?.map(escapeUserAgent) || []; - const defaultUserAgent = (await options.defaultUserAgentProvider()).map(escapeUserAgent); - await checkFeatures(context, options, args); - const awsContext = context; - defaultUserAgent.push( - `m/${encodeFeatures( - Object.assign({}, context.__smithy_context?.features, awsContext.__aws_sdk_context?.features) - )}` - ); - const customUserAgent = options?.customUserAgent?.map(escapeUserAgent) || []; - const appId = await options.userAgentAppId(); - if (appId) { - defaultUserAgent.push(escapeUserAgent([`app/${appId}`])); - } - const prefix = (0, import_util_endpoints.getUserAgentPrefix)(); - const sdkUserAgentValue = (prefix ? [prefix] : []).concat([...defaultUserAgent, ...userAgent, ...customUserAgent]).join(SPACE); - const normalUAValue = [ - ...defaultUserAgent.filter((section) => section.startsWith("aws-sdk-")), - ...customUserAgent - ].join(SPACE); - if (options.runtime !== "browser") { - if (normalUAValue) { - headers[X_AMZ_USER_AGENT] = headers[X_AMZ_USER_AGENT] ? `${headers[USER_AGENT]} ${normalUAValue}` : normalUAValue; - } - headers[USER_AGENT] = sdkUserAgentValue; - } else { - headers[X_AMZ_USER_AGENT] = sdkUserAgentValue; - } - return next({ - ...args, - request - }); -}, "userAgentMiddleware"); -var escapeUserAgent = /* @__PURE__ */ __name((userAgentPair) => { - const name = userAgentPair[0].split(UA_NAME_SEPARATOR).map((part) => part.replace(UA_NAME_ESCAPE_REGEX, UA_ESCAPE_CHAR)).join(UA_NAME_SEPARATOR); - const version = userAgentPair[1]?.replace(UA_VALUE_ESCAPE_REGEX, UA_ESCAPE_CHAR); - const prefixSeparatorIndex = name.indexOf(UA_NAME_SEPARATOR); - const prefix = name.substring(0, prefixSeparatorIndex); - let uaName = name.substring(prefixSeparatorIndex + 1); - if (prefix === "api") { - uaName = uaName.toLowerCase(); - } - return [prefix, uaName, version].filter((item) => item && item.length > 0).reduce((acc, item, index) => { - switch (index) { - case 0: - return item; - case 1: - return `${acc}/${item}`; - default: - return `${acc}#${item}`; - } - }, ""); -}, "escapeUserAgent"); -var getUserAgentMiddlewareOptions = { - name: "getUserAgentMiddleware", - step: "build", - priority: "low", - tags: ["SET_USER_AGENT", "USER_AGENT"], - override: true -}; -var getUserAgentPlugin = /* @__PURE__ */ __name((config) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.add(userAgentMiddleware(config), getUserAgentMiddlewareOptions); - }, "applyToStack") -}), "getUserAgentPlugin"); -// Annotate the CommonJS export names for ESM import in node: +const splitHeader = (value) => { + const z = value.length; + const values = []; + let withinQuotes = false; + let prevChar = undefined; + let anchor = 0; + for (let i = 0; i < z; ++i) { + const char = value[i]; + switch (char) { + case `"`: + if (prevChar !== "\\") { + withinQuotes = !withinQuotes; + } + break; + case ",": + if (!withinQuotes) { + values.push(value.slice(anchor, i)); + anchor = i + 1; + } + break; + } + prevChar = char; + } + values.push(value.slice(anchor)); + return values.map((v) => { + v = v.trim(); + const z = v.length; + if (z < 2) { + return v; + } + if (v[0] === `"` && v[z - 1] === `"`) { + v = v.slice(1, z - 1); + } + return v.replace(/\\"/g, '"'); + }); +}; -0 && (0); +const format = /^-?\d*(\.\d+)?$/; +class NumericValue { + string; + type; + constructor(string, type) { + this.string = string; + this.type = type; + if (!format.test(string)) { + throw new Error(`@smithy/core/serde - NumericValue must only contain [0-9], at most one decimal point ".", and an optional negation prefix "-".`); + } + } + toString() { + return this.string; + } + static [Symbol.hasInstance](object) { + if (!object || typeof object !== "object") { + return false; + } + const _nv = object; + return NumericValue.prototype.isPrototypeOf(object) || (_nv.type === "bigDecimal" && format.test(_nv.string)); + } +} +function nv(input) { + return new NumericValue(String(input), "bigDecimal"); +} +Object.defineProperty(exports, "generateIdempotencyToken", ({ + enumerable: true, + get: function () { return uuid.v4; } +})); +exports.LazyJsonString = LazyJsonString; +exports.NumericValue = NumericValue; +exports._parseEpochTimestamp = _parseEpochTimestamp; +exports._parseRfc3339DateTimeWithOffset = _parseRfc3339DateTimeWithOffset; +exports._parseRfc7231DateTime = _parseRfc7231DateTime; +exports.copyDocumentWithTransform = copyDocumentWithTransform; +exports.dateToUtcString = dateToUtcString; +exports.expectBoolean = expectBoolean; +exports.expectByte = expectByte; +exports.expectFloat32 = expectFloat32; +exports.expectInt = expectInt; +exports.expectInt32 = expectInt32; +exports.expectLong = expectLong; +exports.expectNonNull = expectNonNull; +exports.expectNumber = expectNumber; +exports.expectObject = expectObject; +exports.expectShort = expectShort; +exports.expectString = expectString; +exports.expectUnion = expectUnion; +exports.handleFloat = handleFloat; +exports.limitedParseDouble = limitedParseDouble; +exports.limitedParseFloat = limitedParseFloat; +exports.limitedParseFloat32 = limitedParseFloat32; +exports.logger = logger; +exports.nv = nv; +exports.parseBoolean = parseBoolean; +exports.parseEpochTimestamp = parseEpochTimestamp; +exports.parseRfc3339DateTime = parseRfc3339DateTime; +exports.parseRfc3339DateTimeWithOffset = parseRfc3339DateTimeWithOffset; +exports.parseRfc7231DateTime = parseRfc7231DateTime; +exports.quoteHeader = quoteHeader; +exports.splitEvery = splitEvery; +exports.splitHeader = splitHeader; +exports.strictParseByte = strictParseByte; +exports.strictParseDouble = strictParseDouble; +exports.strictParseFloat = strictParseFloat; +exports.strictParseFloat32 = strictParseFloat32; +exports.strictParseInt = strictParseInt; +exports.strictParseInt32 = strictParseInt32; +exports.strictParseLong = strictParseLong; +exports.strictParseShort = strictParseShort; /***/ }), -/***/ 8396: +/***/ 7809: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveHttpAuthSchemeConfig = exports.defaultSSOOIDCHttpAuthSchemeProvider = exports.defaultSSOOIDCHttpAuthSchemeParametersProvider = void 0; -const core_1 = __nccwpck_require__(8704); -const util_middleware_1 = __nccwpck_require__(6324); -const defaultSSOOIDCHttpAuthSchemeParametersProvider = async (config, context, input) => { - return { - operation: (0, util_middleware_1.getSmithyContext)(context).operation, - region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) || - (() => { - throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); - })(), - }; -}; -exports.defaultSSOOIDCHttpAuthSchemeParametersProvider = defaultSSOOIDCHttpAuthSchemeParametersProvider; -function createAwsAuthSigv4HttpAuthOption(authParameters) { - return { - schemeId: "aws.auth#sigv4", - signingProperties: { - name: "sso-oauth", - region: authParameters.region, - }, - propertiesExtractor: (config, context) => ({ - signingProperties: { - config, - context, - }, - }), - }; + +var protocolHttp = __nccwpck_require__(2356); +var querystringBuilder = __nccwpck_require__(8256); +var utilBase64 = __nccwpck_require__(8385); + +function createRequest(url, requestOptions) { + return new Request(url, requestOptions); } -function createSmithyApiNoAuthHttpAuthOption(authParameters) { - return { - schemeId: "smithy.api#noAuth", - }; + +function requestTimeout(timeoutInMs = 0) { + return new Promise((resolve, reject) => { + if (timeoutInMs) { + setTimeout(() => { + const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`); + timeoutError.name = "TimeoutError"; + reject(timeoutError); + }, timeoutInMs); + } + }); } -const defaultSSOOIDCHttpAuthSchemeProvider = (authParameters) => { - const options = []; - switch (authParameters.operation) { - case "CreateToken": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; + +const keepAliveSupport = { + supported: undefined, +}; +class FetchHttpHandler { + config; + configProvider; + static create(instanceOrOptions) { + if (typeof instanceOrOptions?.handle === "function") { + return instanceOrOptions; } - default: { - options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + return new FetchHttpHandler(instanceOrOptions); + } + constructor(options) { + if (typeof options === "function") { + this.configProvider = options().then((opts) => opts || {}); + } + else { + this.config = options ?? {}; + this.configProvider = Promise.resolve(this.config); + } + if (keepAliveSupport.supported === undefined) { + keepAliveSupport.supported = Boolean(typeof Request !== "undefined" && "keepalive" in createRequest("https://[::1]")); } } - return options; + destroy() { + } + async handle(request, { abortSignal, requestTimeout: requestTimeout$1 } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + const requestTimeoutInMs = requestTimeout$1 ?? this.config.requestTimeout; + const keepAlive = this.config.keepAlive === true; + const credentials = this.config.credentials; + if (abortSignal?.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + return Promise.reject(abortError); + } + let path = request.path; + const queryString = querystringBuilder.buildQueryString(request.query || {}); + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + let auth = ""; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}@`; + } + const { port, method } = request; + const url = `${request.protocol}//${auth}${request.hostname}${port ? `:${port}` : ""}${path}`; + const body = method === "GET" || method === "HEAD" ? undefined : request.body; + const requestOptions = { + body, + headers: new Headers(request.headers), + method: method, + credentials, + }; + if (this.config?.cache) { + requestOptions.cache = this.config.cache; + } + if (body) { + requestOptions.duplex = "half"; + } + if (typeof AbortController !== "undefined") { + requestOptions.signal = abortSignal; + } + if (keepAliveSupport.supported) { + requestOptions.keepalive = keepAlive; + } + if (typeof this.config.requestInit === "function") { + Object.assign(requestOptions, this.config.requestInit(request)); + } + let removeSignalEventListener = () => { }; + const fetchRequest = createRequest(url, requestOptions); + const raceOfPromises = [ + fetch(fetchRequest).then((response) => { + const fetchHeaders = response.headers; + const transformedHeaders = {}; + for (const pair of fetchHeaders.entries()) { + transformedHeaders[pair[0]] = pair[1]; + } + const hasReadableStream = response.body != undefined; + if (!hasReadableStream) { + return response.blob().then((body) => ({ + response: new protocolHttp.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body, + }), + })); + } + return { + response: new protocolHttp.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body: response.body, + }), + }; + }), + requestTimeout(requestTimeoutInMs), + ]; + if (abortSignal) { + raceOfPromises.push(new Promise((resolve, reject) => { + const onAbort = () => { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }; + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + removeSignalEventListener = () => signal.removeEventListener("abort", onAbort); + } + else { + abortSignal.onabort = onAbort; + } + })); + } + return Promise.race(raceOfPromises).finally(removeSignalEventListener); + } + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + config[key] = value; + return config; + }); + } + httpHandlerConfigs() { + return this.config ?? {}; + } +} + +const streamCollector = async (stream) => { + if ((typeof Blob === "function" && stream instanceof Blob) || stream.constructor?.name === "Blob") { + if (Blob.prototype.arrayBuffer !== undefined) { + return new Uint8Array(await stream.arrayBuffer()); + } + return collectBlob(stream); + } + return collectStream(stream); }; -exports.defaultSSOOIDCHttpAuthSchemeProvider = defaultSSOOIDCHttpAuthSchemeProvider; -const resolveHttpAuthSchemeConfig = (config) => { - const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); - return Object.assign(config_0, { - authSchemePreference: (0, util_middleware_1.normalizeProvider)(config.authSchemePreference ?? []), +async function collectBlob(blob) { + const base64 = await readToBase64(blob); + const arrayBuffer = utilBase64.fromBase64(base64); + return new Uint8Array(arrayBuffer); +} +async function collectStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; + } + isDone = done; + } + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; + } + return collected; +} +function readToBase64(blob) { + return new Promise((resolve, reject) => { + const reader = new FileReader(); + reader.onloadend = () => { + if (reader.readyState !== 2) { + return reject(new Error("Reader aborted too early")); + } + const result = (reader.result ?? ""); + const commaIndex = result.indexOf(","); + const dataOffset = commaIndex > -1 ? commaIndex + 1 : result.length; + resolve(result.substring(dataOffset)); + }; + reader.onabort = () => reject(new Error("Read aborted")); + reader.onerror = () => reject(reader.error); + reader.readAsDataURL(blob); }); -}; -exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; +} + +exports.FetchHttpHandler = FetchHttpHandler; +exports.keepAliveSupport = keepAliveSupport; +exports.streamCollector = streamCollector; /***/ }), -/***/ 546: +/***/ 5092: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultEndpointResolver = void 0; -const util_endpoints_1 = __nccwpck_require__(3068); -const util_endpoints_2 = __nccwpck_require__(9674); -const ruleset_1 = __nccwpck_require__(9947); -const cache = new util_endpoints_2.EndpointCache({ - size: 50, - params: ["Endpoint", "Region", "UseDualStack", "UseFIPS"], -}); -const defaultEndpointResolver = (endpointParams, context = {}) => { - return cache.get(endpointParams, () => (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { - endpointParams: endpointParams, - logger: context.logger, - })); -}; -exports.defaultEndpointResolver = defaultEndpointResolver; -util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; + +var utilBufferFrom = __nccwpck_require__(4151); +var utilUtf8 = __nccwpck_require__(1577); +var buffer = __nccwpck_require__(181); +var crypto = __nccwpck_require__(6982); + +class Hash { + algorithmIdentifier; + secret; + hash; + constructor(algorithmIdentifier, secret) { + this.algorithmIdentifier = algorithmIdentifier; + this.secret = secret; + this.reset(); + } + update(toHash, encoding) { + this.hash.update(utilUtf8.toUint8Array(castSourceData(toHash, encoding))); + } + digest() { + return Promise.resolve(this.hash.digest()); + } + reset() { + this.hash = this.secret + ? crypto.createHmac(this.algorithmIdentifier, castSourceData(this.secret)) + : crypto.createHash(this.algorithmIdentifier); + } +} +function castSourceData(toCast, encoding) { + if (buffer.Buffer.isBuffer(toCast)) { + return toCast; + } + if (typeof toCast === "string") { + return utilBufferFrom.fromString(toCast, encoding); + } + if (ArrayBuffer.isView(toCast)) { + return utilBufferFrom.fromArrayBuffer(toCast.buffer, toCast.byteOffset, toCast.byteLength); + } + return utilBufferFrom.fromArrayBuffer(toCast); +} + +exports.Hash = Hash; /***/ }), -/***/ 9947: +/***/ 6130: /***/ ((__unused_webpack_module, exports) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ruleSet = void 0; -const u = "required", v = "fn", w = "argv", x = "ref"; -const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = "getAttr", i = { [u]: false, "type": "String" }, j = { [u]: true, "default": false, "type": "Boolean" }, k = { [x]: "Endpoint" }, l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }, m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }, n = {}, o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }, p = { [x]: g }, q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }, r = [l], s = [m], t = [{ [x]: "Region" }]; -const _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://oidc.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://oidc.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://oidc.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; -exports.ruleSet = _data; + +const isArrayBuffer = (arg) => (typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer) || + Object.prototype.toString.call(arg) === "[object ArrayBuffer]"; + +exports.isArrayBuffer = isArrayBuffer; /***/ }), -/***/ 9443: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 7212: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/submodules/sso-oidc/index.ts -var index_exports = {}; -__export(index_exports, { - $Command: () => import_smithy_client6.Command, - AccessDeniedException: () => AccessDeniedException, - AuthorizationPendingException: () => AuthorizationPendingException, - CreateTokenCommand: () => CreateTokenCommand, - CreateTokenRequestFilterSensitiveLog: () => CreateTokenRequestFilterSensitiveLog, - CreateTokenResponseFilterSensitiveLog: () => CreateTokenResponseFilterSensitiveLog, - ExpiredTokenException: () => ExpiredTokenException, - InternalServerException: () => InternalServerException, - InvalidClientException: () => InvalidClientException, - InvalidGrantException: () => InvalidGrantException, - InvalidRequestException: () => InvalidRequestException, - InvalidScopeException: () => InvalidScopeException, - SSOOIDC: () => SSOOIDC, - SSOOIDCClient: () => SSOOIDCClient, - SSOOIDCServiceException: () => SSOOIDCServiceException, - SlowDownException: () => SlowDownException, - UnauthorizedClientException: () => UnauthorizedClientException, - UnsupportedGrantTypeException: () => UnsupportedGrantTypeException, - __Client: () => import_smithy_client2.Client -}); -module.exports = __toCommonJS(index_exports); - -// src/submodules/sso-oidc/SSOOIDCClient.ts -var import_middleware_host_header = __nccwpck_require__(2590); -var import_middleware_logger = __nccwpck_require__(5242); -var import_middleware_recursion_detection = __nccwpck_require__(1568); -var import_middleware_user_agent = __nccwpck_require__(2959); -var import_config_resolver = __nccwpck_require__(9316); -var import_core = __nccwpck_require__(402); -var import_middleware_content_length = __nccwpck_require__(7212); -var import_middleware_endpoint = __nccwpck_require__(99); -var import_middleware_retry = __nccwpck_require__(9618); -var import_smithy_client2 = __nccwpck_require__(1411); -var import_httpAuthSchemeProvider = __nccwpck_require__(8396); - -// src/submodules/sso-oidc/endpoint/EndpointParameters.ts -var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { - return Object.assign(options, { - useDualstackEndpoint: options.useDualstackEndpoint ?? false, - useFipsEndpoint: options.useFipsEndpoint ?? false, - defaultSigningName: "sso-oauth" - }); -}, "resolveClientEndpointParameters"); -var commonParams = { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } -}; - -// src/submodules/sso-oidc/SSOOIDCClient.ts -var import_runtimeConfig = __nccwpck_require__(6901); - -// src/submodules/sso-oidc/runtimeExtensions.ts -var import_region_config_resolver = __nccwpck_require__(6463); -var import_protocol_http = __nccwpck_require__(2356); -var import_smithy_client = __nccwpck_require__(1411); - -// src/submodules/sso-oidc/auth/httpAuthExtensionConfiguration.ts -var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; - let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; - let _credentials = runtimeConfig.credentials; - return { - setHttpAuthScheme(httpAuthScheme) { - const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); - if (index === -1) { - _httpAuthSchemes.push(httpAuthScheme); - } else { - _httpAuthSchemes.splice(index, 1, httpAuthScheme); - } - }, - httpAuthSchemes() { - return _httpAuthSchemes; - }, - setHttpAuthSchemeProvider(httpAuthSchemeProvider) { - _httpAuthSchemeProvider = httpAuthSchemeProvider; - }, - httpAuthSchemeProvider() { - return _httpAuthSchemeProvider; - }, - setCredentials(credentials) { - _credentials = credentials; - }, - credentials() { - return _credentials; - } - }; -}, "getHttpAuthExtensionConfiguration"); -var resolveHttpAuthRuntimeConfig = /* @__PURE__ */ __name((config) => { - return { - httpAuthSchemes: config.httpAuthSchemes(), - httpAuthSchemeProvider: config.httpAuthSchemeProvider(), - credentials: config.credentials() - }; -}, "resolveHttpAuthRuntimeConfig"); - -// src/submodules/sso-oidc/runtimeExtensions.ts -var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { - const extensionConfiguration = Object.assign( - (0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig), - (0, import_smithy_client.getDefaultExtensionConfiguration)(runtimeConfig), - (0, import_protocol_http.getHttpHandlerExtensionConfiguration)(runtimeConfig), - getHttpAuthExtensionConfiguration(runtimeConfig) - ); - extensions.forEach((extension) => extension.configure(extensionConfiguration)); - return Object.assign( - runtimeConfig, - (0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), - (0, import_smithy_client.resolveDefaultRuntimeConfig)(extensionConfiguration), - (0, import_protocol_http.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), - resolveHttpAuthRuntimeConfig(extensionConfiguration) - ); -}, "resolveRuntimeExtensions"); +var protocolHttp = __nccwpck_require__(2356); -// src/submodules/sso-oidc/SSOOIDCClient.ts -var SSOOIDCClient = class extends import_smithy_client2.Client { - static { - __name(this, "SSOOIDCClient"); - } - /** - * The resolved configuration of SSOOIDCClient class. This is resolved and normalized from the {@link SSOOIDCClientConfig | constructor configuration interface}. - */ - config; - constructor(...[configuration]) { - const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); - super(_config_0); - this.initConfig = _config_0; - const _config_1 = resolveClientEndpointParameters(_config_0); - const _config_2 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_1); - const _config_3 = (0, import_middleware_retry.resolveRetryConfig)(_config_2); - const _config_4 = (0, import_config_resolver.resolveRegionConfig)(_config_3); - const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, import_middleware_endpoint.resolveEndpointConfig)(_config_5); - const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); - const _config_8 = resolveRuntimeExtensions(_config_7, configuration?.extensions || []); - this.config = _config_8; - this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_retry.getRetryPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); - this.middlewareStack.use((0, import_middleware_recursion_detection.getRecursionDetectionPlugin)(this.config)); - this.middlewareStack.use( - (0, import_core.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { - httpAuthSchemeParametersProvider: import_httpAuthSchemeProvider.defaultSSOOIDCHttpAuthSchemeParametersProvider, - identityProviderConfigProvider: /* @__PURE__ */ __name(async (config) => new import_core.DefaultIdentityProviderConfig({ - "aws.auth#sigv4": config.credentials - }), "identityProviderConfigProvider") - }) - ); - this.middlewareStack.use((0, import_core.getHttpSigningPlugin)(this.config)); - } - /** - * Destroy underlying resources, like sockets. It's usually not necessary to do this. - * However in Node.js, it's best to explicitly shut down the client's agent when it is no longer needed. - * Otherwise, sockets might stay open for quite a long time before the server terminates them. - */ - destroy() { - super.destroy(); - } +const CONTENT_LENGTH_HEADER = "content-length"; +function contentLengthMiddleware(bodyLengthChecker) { + return (next) => async (args) => { + const request = args.request; + if (protocolHttp.HttpRequest.isInstance(request)) { + const { body, headers } = request; + if (body && + Object.keys(headers) + .map((str) => str.toLowerCase()) + .indexOf(CONTENT_LENGTH_HEADER) === -1) { + try { + const length = bodyLengthChecker(body); + request.headers = { + ...request.headers, + [CONTENT_LENGTH_HEADER]: String(length), + }; + } + catch (error) { + } + } + } + return next({ + ...args, + request, + }); + }; +} +const contentLengthMiddlewareOptions = { + step: "build", + tags: ["SET_CONTENT_LENGTH", "CONTENT_LENGTH"], + name: "contentLengthMiddleware", + override: true, }; +const getContentLengthPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add(contentLengthMiddleware(options.bodyLengthChecker), contentLengthMiddlewareOptions); + }, +}); -// src/submodules/sso-oidc/SSOOIDC.ts -var import_smithy_client7 = __nccwpck_require__(1411); +exports.contentLengthMiddleware = contentLengthMiddleware; +exports.contentLengthMiddlewareOptions = contentLengthMiddlewareOptions; +exports.getContentLengthPlugin = getContentLengthPlugin; -// src/submodules/sso-oidc/commands/CreateTokenCommand.ts -var import_middleware_endpoint2 = __nccwpck_require__(99); -var import_middleware_serde = __nccwpck_require__(3255); -var import_smithy_client6 = __nccwpck_require__(1411); -// src/submodules/sso-oidc/models/models_0.ts -var import_smithy_client4 = __nccwpck_require__(1411); +/***/ }), -// src/submodules/sso-oidc/models/SSOOIDCServiceException.ts -var import_smithy_client3 = __nccwpck_require__(1411); -var SSOOIDCServiceException = class _SSOOIDCServiceException extends import_smithy_client3.ServiceException { - static { - __name(this, "SSOOIDCServiceException"); - } - /** - * @internal - */ - constructor(options) { - super(options); - Object.setPrototypeOf(this, _SSOOIDCServiceException.prototype); - } -}; - -// src/submodules/sso-oidc/models/models_0.ts -var AccessDeniedException = class _AccessDeniedException extends SSOOIDCServiceException { - static { - __name(this, "AccessDeniedException"); - } - name = "AccessDeniedException"; - $fault = "client"; - /** - *

Single error code. For this exception the value will be access_denied.

- * @public - */ - error; - /** - *

Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.

- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "AccessDeniedException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _AccessDeniedException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var AuthorizationPendingException = class _AuthorizationPendingException extends SSOOIDCServiceException { - static { - __name(this, "AuthorizationPendingException"); - } - name = "AuthorizationPendingException"; - $fault = "client"; - /** - *

Single error code. For this exception the value will be - * authorization_pending.

- * @public - */ - error; - /** - *

Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.

- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "AuthorizationPendingException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _AuthorizationPendingException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var CreateTokenRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.clientSecret && { clientSecret: import_smithy_client4.SENSITIVE_STRING }, - ...obj.refreshToken && { refreshToken: import_smithy_client4.SENSITIVE_STRING }, - ...obj.codeVerifier && { codeVerifier: import_smithy_client4.SENSITIVE_STRING } -}), "CreateTokenRequestFilterSensitiveLog"); -var CreateTokenResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.accessToken && { accessToken: import_smithy_client4.SENSITIVE_STRING }, - ...obj.refreshToken && { refreshToken: import_smithy_client4.SENSITIVE_STRING }, - ...obj.idToken && { idToken: import_smithy_client4.SENSITIVE_STRING } -}), "CreateTokenResponseFilterSensitiveLog"); -var ExpiredTokenException = class _ExpiredTokenException extends SSOOIDCServiceException { - static { - __name(this, "ExpiredTokenException"); - } - name = "ExpiredTokenException"; - $fault = "client"; - /** - *

Single error code. For this exception the value will be expired_token.

- * @public - */ - error; - /** - *

Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.

- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ExpiredTokenException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ExpiredTokenException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var InternalServerException = class _InternalServerException extends SSOOIDCServiceException { - static { - __name(this, "InternalServerException"); - } - name = "InternalServerException"; - $fault = "server"; - /** - *

Single error code. For this exception the value will be server_error.

- * @public - */ - error; - /** - *

Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.

- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "InternalServerException", - $fault: "server", - ...opts - }); - Object.setPrototypeOf(this, _InternalServerException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var InvalidClientException = class _InvalidClientException extends SSOOIDCServiceException { - static { - __name(this, "InvalidClientException"); - } - name = "InvalidClientException"; - $fault = "client"; - /** - *

Single error code. For this exception the value will be - * invalid_client.

- * @public - */ - error; - /** - *

Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.

- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "InvalidClientException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _InvalidClientException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var InvalidGrantException = class _InvalidGrantException extends SSOOIDCServiceException { - static { - __name(this, "InvalidGrantException"); - } - name = "InvalidGrantException"; - $fault = "client"; - /** - *

Single error code. For this exception the value will be invalid_grant.

- * @public - */ - error; - /** - *

Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.

- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "InvalidGrantException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _InvalidGrantException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var InvalidRequestException = class _InvalidRequestException extends SSOOIDCServiceException { - static { - __name(this, "InvalidRequestException"); - } - name = "InvalidRequestException"; - $fault = "client"; - /** - *

Single error code. For this exception the value will be - * invalid_request.

- * @public - */ - error; - /** - *

Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.

- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "InvalidRequestException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _InvalidRequestException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var InvalidScopeException = class _InvalidScopeException extends SSOOIDCServiceException { - static { - __name(this, "InvalidScopeException"); - } - name = "InvalidScopeException"; - $fault = "client"; - /** - *

Single error code. For this exception the value will be invalid_scope.

- * @public - */ - error; - /** - *

Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.

- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "InvalidScopeException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _InvalidScopeException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var SlowDownException = class _SlowDownException extends SSOOIDCServiceException { - static { - __name(this, "SlowDownException"); - } - name = "SlowDownException"; - $fault = "client"; - /** - *

Single error code. For this exception the value will be slow_down.

- * @public - */ - error; - /** - *

Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.

- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "SlowDownException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _SlowDownException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var UnauthorizedClientException = class _UnauthorizedClientException extends SSOOIDCServiceException { - static { - __name(this, "UnauthorizedClientException"); - } - name = "UnauthorizedClientException"; - $fault = "client"; - /** - *

Single error code. For this exception the value will be - * unauthorized_client.

- * @public - */ - error; - /** - *

Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.

- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "UnauthorizedClientException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _UnauthorizedClientException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; -var UnsupportedGrantTypeException = class _UnsupportedGrantTypeException extends SSOOIDCServiceException { - static { - __name(this, "UnsupportedGrantTypeException"); - } - name = "UnsupportedGrantTypeException"; - $fault = "client"; - /** - *

Single error code. For this exception the value will be - * unsupported_grant_type.

- * @public - */ - error; - /** - *

Human-readable text providing additional information, used to assist the client developer - * in understanding the error that occurred.

- * @public - */ - error_description; - /** - * @internal - */ - constructor(opts) { - super({ - name: "UnsupportedGrantTypeException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _UnsupportedGrantTypeException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -}; - -// src/submodules/sso-oidc/protocols/Aws_restJson1.ts -var import_core2 = __nccwpck_require__(8704); -var import_core3 = __nccwpck_require__(402); -var import_smithy_client5 = __nccwpck_require__(1411); -var se_CreateTokenCommand = /* @__PURE__ */ __name(async (input, context) => { - const b = (0, import_core3.requestBuilder)(input, context); - const headers = { - "content-type": "application/json" - }; - b.bp("/token"); - let body; - body = JSON.stringify( - (0, import_smithy_client5.take)(input, { - clientId: [], - clientSecret: [], - code: [], - codeVerifier: [], - deviceCode: [], - grantType: [], - redirectUri: [], - refreshToken: [], - scope: /* @__PURE__ */ __name((_) => (0, import_smithy_client5._json)(_), "scope") - }) - ); - b.m("POST").h(headers).b(body); - return b.build(); -}, "se_CreateTokenCommand"); -var de_CreateTokenCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_CommandError(output, context); - } - const contents = (0, import_smithy_client5.map)({ - $metadata: deserializeMetadata(output) - }); - const data = (0, import_smithy_client5.expectNonNull)((0, import_smithy_client5.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); - const doc = (0, import_smithy_client5.take)(data, { - accessToken: import_smithy_client5.expectString, - expiresIn: import_smithy_client5.expectInt32, - idToken: import_smithy_client5.expectString, - refreshToken: import_smithy_client5.expectString, - tokenType: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - return contents; -}, "de_CreateTokenCommand"); -var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { - const parsedOutput = { - ...output, - body: await (0, import_core2.parseJsonErrorBody)(output.body, context) - }; - const errorCode = (0, import_core2.loadRestJsonErrorCode)(output, parsedOutput.body); - switch (errorCode) { - case "AccessDeniedException": - case "com.amazonaws.ssooidc#AccessDeniedException": - throw await de_AccessDeniedExceptionRes(parsedOutput, context); - case "AuthorizationPendingException": - case "com.amazonaws.ssooidc#AuthorizationPendingException": - throw await de_AuthorizationPendingExceptionRes(parsedOutput, context); - case "ExpiredTokenException": - case "com.amazonaws.ssooidc#ExpiredTokenException": - throw await de_ExpiredTokenExceptionRes(parsedOutput, context); - case "InternalServerException": - case "com.amazonaws.ssooidc#InternalServerException": - throw await de_InternalServerExceptionRes(parsedOutput, context); - case "InvalidClientException": - case "com.amazonaws.ssooidc#InvalidClientException": - throw await de_InvalidClientExceptionRes(parsedOutput, context); - case "InvalidGrantException": - case "com.amazonaws.ssooidc#InvalidGrantException": - throw await de_InvalidGrantExceptionRes(parsedOutput, context); - case "InvalidRequestException": - case "com.amazonaws.ssooidc#InvalidRequestException": - throw await de_InvalidRequestExceptionRes(parsedOutput, context); - case "InvalidScopeException": - case "com.amazonaws.ssooidc#InvalidScopeException": - throw await de_InvalidScopeExceptionRes(parsedOutput, context); - case "SlowDownException": - case "com.amazonaws.ssooidc#SlowDownException": - throw await de_SlowDownExceptionRes(parsedOutput, context); - case "UnauthorizedClientException": - case "com.amazonaws.ssooidc#UnauthorizedClientException": - throw await de_UnauthorizedClientExceptionRes(parsedOutput, context); - case "UnsupportedGrantTypeException": - case "com.amazonaws.ssooidc#UnsupportedGrantTypeException": - throw await de_UnsupportedGrantTypeExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode - }); - } -}, "de_CommandError"); -var throwDefaultError = (0, import_smithy_client5.withBaseException)(SSOOIDCServiceException); -var de_AccessDeniedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new AccessDeniedException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_AccessDeniedExceptionRes"); -var de_AuthorizationPendingExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new AuthorizationPendingException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_AuthorizationPendingExceptionRes"); -var de_ExpiredTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new ExpiredTokenException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_ExpiredTokenExceptionRes"); -var de_InternalServerExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new InternalServerException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_InternalServerExceptionRes"); -var de_InvalidClientExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new InvalidClientException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_InvalidClientExceptionRes"); -var de_InvalidGrantExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new InvalidGrantException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_InvalidGrantExceptionRes"); -var de_InvalidRequestExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new InvalidRequestException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_InvalidRequestExceptionRes"); -var de_InvalidScopeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new InvalidScopeException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_InvalidScopeExceptionRes"); -var de_SlowDownExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new SlowDownException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_SlowDownExceptionRes"); -var de_UnauthorizedClientExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new UnauthorizedClientException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_UnauthorizedClientExceptionRes"); -var de_UnsupportedGrantTypeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const contents = (0, import_smithy_client5.map)({}); - const data = parsedOutput.body; - const doc = (0, import_smithy_client5.take)(data, { - error: import_smithy_client5.expectString, - error_description: import_smithy_client5.expectString - }); - Object.assign(contents, doc); - const exception = new UnsupportedGrantTypeException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents - }); - return (0, import_smithy_client5.decorateServiceException)(exception, parsedOutput.body); -}, "de_UnsupportedGrantTypeExceptionRes"); -var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"] -}), "deserializeMetadata"); - -// src/submodules/sso-oidc/commands/CreateTokenCommand.ts -var CreateTokenCommand = class extends import_smithy_client6.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AWSSSOOIDCService", "CreateToken", {}).n("SSOOIDCClient", "CreateTokenCommand").f(CreateTokenRequestFilterSensitiveLog, CreateTokenResponseFilterSensitiveLog).ser(se_CreateTokenCommand).de(de_CreateTokenCommand).build() { - static { - __name(this, "CreateTokenCommand"); - } -}; - -// src/submodules/sso-oidc/SSOOIDC.ts -var commands = { - CreateTokenCommand -}; -var SSOOIDC = class extends SSOOIDCClient { - static { - __name(this, "SSOOIDC"); - } -}; -(0, import_smithy_client7.createAggregatedClient)(commands, SSOOIDC); -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 6901: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 6041: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const tslib_1 = __nccwpck_require__(1860); -const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(9955)); -const core_1 = __nccwpck_require__(8704); -const util_user_agent_node_1 = __nccwpck_require__(1656); -const config_resolver_1 = __nccwpck_require__(9316); -const hash_node_1 = __nccwpck_require__(5092); -const middleware_retry_1 = __nccwpck_require__(9618); +exports.getEndpointFromConfig = void 0; const node_config_provider_1 = __nccwpck_require__(5704); -const node_http_handler_1 = __nccwpck_require__(1279); -const util_body_length_node_1 = __nccwpck_require__(3638); -const util_retry_1 = __nccwpck_require__(5518); -const runtimeConfig_shared_1 = __nccwpck_require__(1546); -const smithy_client_1 = __nccwpck_require__(1411); -const util_defaults_mode_node_1 = __nccwpck_require__(5435); -const smithy_client_2 = __nccwpck_require__(1411); -const getRuntimeConfig = (config) => { - (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); - const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); - const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); - const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); - (0, core_1.emitWarningIfUnsupportedVersion)(process.version); - const loaderConfig = { - profile: config?.profile, - logger: clientSharedValues.logger, - }; - return { - ...clientSharedValues, - ...config, - runtime: "node", - defaultsMode, - authSchemePreference: config?.authSchemePreference ?? (0, node_config_provider_1.loadConfig)(core_1.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, loaderConfig), - bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, - defaultUserAgentProvider: config?.defaultUserAgentProvider ?? - (0, util_user_agent_node_1.createDefaultUserAgentProvider)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), - maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS, config), - region: config?.region ?? - (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, { ...config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS, ...loaderConfig }), - requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), - retryMode: config?.retryMode ?? - (0, node_config_provider_1.loadConfig)({ - ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, - default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, - }, config), - sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), - streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, - useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, loaderConfig), - useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, loaderConfig), - userAgentAppId: config?.userAgentAppId ?? (0, node_config_provider_1.loadConfig)(util_user_agent_node_1.NODE_APP_ID_CONFIG_OPTIONS, loaderConfig), - }; -}; -exports.getRuntimeConfig = getRuntimeConfig; +const getEndpointUrlConfig_1 = __nccwpck_require__(8008); +const getEndpointFromConfig = async (serviceId) => (0, node_config_provider_1.loadConfig)((0, getEndpointUrlConfig_1.getEndpointUrlConfig)(serviceId ?? ""))(); +exports.getEndpointFromConfig = getEndpointFromConfig; /***/ }), -/***/ 1546: +/***/ 8008: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const core_1 = __nccwpck_require__(8704); -const core_2 = __nccwpck_require__(402); -const smithy_client_1 = __nccwpck_require__(1411); -const url_parser_1 = __nccwpck_require__(4494); -const util_base64_1 = __nccwpck_require__(8385); -const util_utf8_1 = __nccwpck_require__(1577); -const httpAuthSchemeProvider_1 = __nccwpck_require__(8396); -const endpointResolver_1 = __nccwpck_require__(546); -const getRuntimeConfig = (config) => { - return { - apiVersion: "2019-06-10", - base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, - base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, - disableHostPrefix: config?.disableHostPrefix ?? false, - endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, - extensions: config?.extensions ?? [], - httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSSOOIDCHttpAuthSchemeProvider, - httpAuthSchemes: config?.httpAuthSchemes ?? [ - { - schemeId: "aws.auth#sigv4", - identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), - signer: new core_1.AwsSdkSigV4Signer(), - }, - { - schemeId: "smithy.api#noAuth", - identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), - signer: new core_2.NoAuthSigner(), - }, - ], - logger: config?.logger ?? new smithy_client_1.NoOpLogger(), - serviceId: config?.serviceId ?? "SSO OIDC", - urlParser: config?.urlParser ?? url_parser_1.parseUrl, - utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, - utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, - }; -}; -exports.getRuntimeConfig = getRuntimeConfig; +exports.getEndpointUrlConfig = void 0; +const shared_ini_file_loader_1 = __nccwpck_require__(4964); +const ENV_ENDPOINT_URL = "AWS_ENDPOINT_URL"; +const CONFIG_ENDPOINT_URL = "endpoint_url"; +const getEndpointUrlConfig = (serviceId) => ({ + environmentVariableSelector: (env) => { + const serviceSuffixParts = serviceId.split(" ").map((w) => w.toUpperCase()); + const serviceEndpointUrl = env[[ENV_ENDPOINT_URL, ...serviceSuffixParts].join("_")]; + if (serviceEndpointUrl) + return serviceEndpointUrl; + const endpointUrl = env[ENV_ENDPOINT_URL]; + if (endpointUrl) + return endpointUrl; + return undefined; + }, + configFileSelector: (profile, config) => { + if (config && profile.services) { + const servicesSection = config[["services", profile.services].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; + if (servicesSection) { + const servicePrefixParts = serviceId.split(" ").map((w) => w.toLowerCase()); + const endpointUrl = servicesSection[[servicePrefixParts.join("_"), CONFIG_ENDPOINT_URL].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; + if (endpointUrl) + return endpointUrl; + } + } + const endpointUrl = profile[CONFIG_ENDPOINT_URL]; + if (endpointUrl) + return endpointUrl; + return undefined; + }, + default: undefined, +}); +exports.getEndpointUrlConfig = getEndpointUrlConfig; /***/ }), -/***/ 3723: +/***/ 99: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.STSClient = exports.__Client = void 0; -const middleware_host_header_1 = __nccwpck_require__(2590); -const middleware_logger_1 = __nccwpck_require__(5242); -const middleware_recursion_detection_1 = __nccwpck_require__(1568); -const middleware_user_agent_1 = __nccwpck_require__(2959); -const config_resolver_1 = __nccwpck_require__(9316); -const core_1 = __nccwpck_require__(402); -const middleware_content_length_1 = __nccwpck_require__(7212); -const middleware_endpoint_1 = __nccwpck_require__(99); -const middleware_retry_1 = __nccwpck_require__(9618); -const smithy_client_1 = __nccwpck_require__(1411); -Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } })); -const httpAuthSchemeProvider_1 = __nccwpck_require__(7851); -const EndpointParameters_1 = __nccwpck_require__(6811); -const runtimeConfig_1 = __nccwpck_require__(6578); -const runtimeExtensions_1 = __nccwpck_require__(7742); -class STSClient extends smithy_client_1.Client { - config; - constructor(...[configuration]) { - const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration || {}); - super(_config_0); - this.initConfig = _config_0; - const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); - const _config_2 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_1); - const _config_3 = (0, middleware_retry_1.resolveRetryConfig)(_config_2); - const _config_4 = (0, config_resolver_1.resolveRegionConfig)(_config_3); - const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_5); - const _config_7 = (0, httpAuthSchemeProvider_1.resolveHttpAuthSchemeConfig)(_config_6); - const _config_8 = (0, runtimeExtensions_1.resolveRuntimeExtensions)(_config_7, configuration?.extensions || []); - this.config = _config_8; - this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); - this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); - this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); - this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); - this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); - this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); - this.middlewareStack.use((0, core_1.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { - httpAuthSchemeParametersProvider: httpAuthSchemeProvider_1.defaultSTSHttpAuthSchemeParametersProvider, - identityProviderConfigProvider: async (config) => new core_1.DefaultIdentityProviderConfig({ - "aws.auth#sigv4": config.credentials, - }), - })); - this.middlewareStack.use((0, core_1.getHttpSigningPlugin)(this.config)); + +var getEndpointFromConfig = __nccwpck_require__(6041); +var urlParser = __nccwpck_require__(4494); +var core = __nccwpck_require__(402); +var utilMiddleware = __nccwpck_require__(6324); +var middlewareSerde = __nccwpck_require__(3255); + +const resolveParamsForS3 = async (endpointParams) => { + const bucket = endpointParams?.Bucket || ""; + if (typeof endpointParams.Bucket === "string") { + endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); } - destroy() { - super.destroy(); + if (isArnBucketName(bucket)) { + if (endpointParams.ForcePathStyle === true) { + throw new Error("Path-style addressing cannot be used with ARN buckets"); + } } -} -exports.STSClient = STSClient; - + else if (!isDnsCompatibleBucketName(bucket) || + (bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:")) || + bucket.toLowerCase() !== bucket || + bucket.length < 3) { + endpointParams.ForcePathStyle = true; + } + if (endpointParams.DisableMultiRegionAccessPoints) { + endpointParams.disableMultiRegionAccessPoints = true; + endpointParams.DisableMRAP = true; + } + return endpointParams; +}; +const DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; +const IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; +const DOTS_PATTERN = /\.\./; +const isDnsCompatibleBucketName = (bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName); +const isArnBucketName = (bucketName) => { + const [arn, partition, service, , , bucket] = bucketName.split(":"); + const isArn = arn === "arn" && bucketName.split(":").length >= 6; + const isValidArn = Boolean(isArn && partition && service && bucket); + if (isArn && !isValidArn) { + throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); + } + return isValidArn; +}; -/***/ }), +const createConfigValueProvider = (configKey, canonicalEndpointParamKey, config) => { + const configProvider = async () => { + const configValue = config[configKey] ?? config[canonicalEndpointParamKey]; + if (typeof configValue === "function") { + return configValue(); + } + return configValue; + }; + if (configKey === "credentialScope" || canonicalEndpointParamKey === "CredentialScope") { + return async () => { + const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; + const configValue = credentials?.credentialScope ?? credentials?.CredentialScope; + return configValue; + }; + } + if (configKey === "accountId" || canonicalEndpointParamKey === "AccountId") { + return async () => { + const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; + const configValue = credentials?.accountId ?? credentials?.AccountId; + return configValue; + }; + } + if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { + return async () => { + if (config.isCustomEndpoint === false) { + return undefined; + } + const endpoint = await configProvider(); + if (endpoint && typeof endpoint === "object") { + if ("url" in endpoint) { + return endpoint.url.href; + } + if ("hostname" in endpoint) { + const { protocol, hostname, port, path } = endpoint; + return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; + } + } + return endpoint; + }; + } + return configProvider; +}; -/***/ 4532: -/***/ ((__unused_webpack_module, exports) => { +const toEndpointV1 = (endpoint) => { + if (typeof endpoint === "object") { + if ("url" in endpoint) { + return urlParser.parseUrl(endpoint.url); + } + return endpoint; + } + return urlParser.parseUrl(endpoint); +}; -"use strict"; +const getEndpointFromInstructions = async (commandInput, instructionsSupplier, clientConfig, context) => { + if (!clientConfig.isCustomEndpoint) { + let endpointFromConfig; + if (clientConfig.serviceConfiguredEndpoint) { + endpointFromConfig = await clientConfig.serviceConfiguredEndpoint(); + } + else { + endpointFromConfig = await getEndpointFromConfig.getEndpointFromConfig(clientConfig.serviceId); + } + if (endpointFromConfig) { + clientConfig.endpoint = () => Promise.resolve(toEndpointV1(endpointFromConfig)); + clientConfig.isCustomEndpoint = true; + } + } + const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig); + if (typeof clientConfig.endpointProvider !== "function") { + throw new Error("config.endpointProvider is not set."); + } + const endpoint = clientConfig.endpointProvider(endpointParams, context); + return endpoint; +}; +const resolveParams = async (commandInput, instructionsSupplier, clientConfig) => { + const endpointParams = {}; + const instructions = instructionsSupplier?.getEndpointParameterInstructions?.() || {}; + for (const [name, instruction] of Object.entries(instructions)) { + switch (instruction.type) { + case "staticContextParams": + endpointParams[name] = instruction.value; + break; + case "contextParams": + endpointParams[name] = commandInput[instruction.name]; + break; + case "clientContextParams": + case "builtInParams": + endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig)(); + break; + case "operationContextParams": + endpointParams[name] = instruction.get(commandInput); + break; + default: + throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); + } + } + if (Object.keys(instructions).length === 0) { + Object.assign(endpointParams, clientConfig); + } + if (String(clientConfig.serviceId).toLowerCase() === "s3") { + await resolveParamsForS3(endpointParams); + } + return endpointParams; +}; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveHttpAuthRuntimeConfig = exports.getHttpAuthExtensionConfiguration = void 0; -const getHttpAuthExtensionConfiguration = (runtimeConfig) => { - const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; - let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; - let _credentials = runtimeConfig.credentials; - return { - setHttpAuthScheme(httpAuthScheme) { - const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); - if (index === -1) { - _httpAuthSchemes.push(httpAuthScheme); - } - else { - _httpAuthSchemes.splice(index, 1, httpAuthScheme); +const endpointMiddleware = ({ config, instructions, }) => { + return (next, context) => async (args) => { + if (config.isCustomEndpoint) { + core.setFeature(context, "ENDPOINT_OVERRIDE", "N"); + } + const endpoint = await getEndpointFromInstructions(args.input, { + getEndpointParameterInstructions() { + return instructions; + }, + }, { ...config }, context); + context.endpointV2 = endpoint; + context.authSchemes = endpoint.properties?.authSchemes; + const authScheme = context.authSchemes?.[0]; + if (authScheme) { + context["signing_region"] = authScheme.signingRegion; + context["signing_service"] = authScheme.signingName; + const smithyContext = utilMiddleware.getSmithyContext(context); + const httpAuthOption = smithyContext?.selectedHttpAuthScheme?.httpAuthOption; + if (httpAuthOption) { + httpAuthOption.signingProperties = Object.assign(httpAuthOption.signingProperties || {}, { + signing_region: authScheme.signingRegion, + signingRegion: authScheme.signingRegion, + signing_service: authScheme.signingName, + signingName: authScheme.signingName, + signingRegionSet: authScheme.signingRegionSet, + }, authScheme.properties); } - }, - httpAuthSchemes() { - return _httpAuthSchemes; - }, - setHttpAuthSchemeProvider(httpAuthSchemeProvider) { - _httpAuthSchemeProvider = httpAuthSchemeProvider; - }, - httpAuthSchemeProvider() { - return _httpAuthSchemeProvider; - }, - setCredentials(credentials) { - _credentials = credentials; - }, - credentials() { - return _credentials; - }, + } + return next({ + ...args, + }); }; }; -exports.getHttpAuthExtensionConfiguration = getHttpAuthExtensionConfiguration; -const resolveHttpAuthRuntimeConfig = (config) => { - return { - httpAuthSchemes: config.httpAuthSchemes(), - httpAuthSchemeProvider: config.httpAuthSchemeProvider(), - credentials: config.credentials(), + +const endpointMiddlewareOptions = { + step: "serialize", + tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], + name: "endpointV2Middleware", + override: true, + relation: "before", + toMiddleware: middlewareSerde.serializerMiddlewareOption.name, +}; +const getEndpointPlugin = (config, instructions) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(endpointMiddleware({ + config, + instructions, + }), endpointMiddlewareOptions); + }, +}); + +const resolveEndpointConfig = (input) => { + const tls = input.tls ?? true; + const { endpoint, useDualstackEndpoint, useFipsEndpoint } = input; + const customEndpointProvider = endpoint != null ? async () => toEndpointV1(await utilMiddleware.normalizeProvider(endpoint)()) : undefined; + const isCustomEndpoint = !!endpoint; + const resolvedConfig = Object.assign(input, { + endpoint: customEndpointProvider, + tls, + isCustomEndpoint, + useDualstackEndpoint: utilMiddleware.normalizeProvider(useDualstackEndpoint ?? false), + useFipsEndpoint: utilMiddleware.normalizeProvider(useFipsEndpoint ?? false), + }); + let configuredEndpointPromise = undefined; + resolvedConfig.serviceConfiguredEndpoint = async () => { + if (input.serviceId && !configuredEndpointPromise) { + configuredEndpointPromise = getEndpointFromConfig.getEndpointFromConfig(input.serviceId); + } + return configuredEndpointPromise; }; + return resolvedConfig; +}; + +const resolveEndpointRequiredConfig = (input) => { + const { endpoint } = input; + if (endpoint === undefined) { + input.endpoint = async () => { + throw new Error("@smithy/middleware-endpoint: (default endpointRuleSet) endpoint is not set - you must configure an endpoint."); + }; + } + return input; }; -exports.resolveHttpAuthRuntimeConfig = resolveHttpAuthRuntimeConfig; + +exports.endpointMiddleware = endpointMiddleware; +exports.endpointMiddlewareOptions = endpointMiddlewareOptions; +exports.getEndpointFromInstructions = getEndpointFromInstructions; +exports.getEndpointPlugin = getEndpointPlugin; +exports.resolveEndpointConfig = resolveEndpointConfig; +exports.resolveEndpointRequiredConfig = resolveEndpointRequiredConfig; +exports.resolveParams = resolveParams; +exports.toEndpointV1 = toEndpointV1; /***/ }), -/***/ 7851: +/***/ 9618: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveHttpAuthSchemeConfig = exports.resolveStsAuthConfig = exports.defaultSTSHttpAuthSchemeProvider = exports.defaultSTSHttpAuthSchemeParametersProvider = void 0; -const core_1 = __nccwpck_require__(8704); -const util_middleware_1 = __nccwpck_require__(6324); -const STSClient_1 = __nccwpck_require__(3723); -const defaultSTSHttpAuthSchemeParametersProvider = async (config, context, input) => { - return { - operation: (0, util_middleware_1.getSmithyContext)(context).operation, - region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) || - (() => { - throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); - })(), - }; -}; -exports.defaultSTSHttpAuthSchemeParametersProvider = defaultSTSHttpAuthSchemeParametersProvider; -function createAwsAuthSigv4HttpAuthOption(authParameters) { - return { - schemeId: "aws.auth#sigv4", - signingProperties: { - name: "sts", - region: authParameters.region, - }, - propertiesExtractor: (config, context) => ({ - signingProperties: { - config, - context, - }, - }), + +var utilRetry = __nccwpck_require__(5518); +var protocolHttp = __nccwpck_require__(2356); +var serviceErrorClassification = __nccwpck_require__(2058); +var uuid = __nccwpck_require__(266); +var utilMiddleware = __nccwpck_require__(6324); +var smithyClient = __nccwpck_require__(1411); +var isStreamingPayload = __nccwpck_require__(9831); + +const getDefaultRetryQuota = (initialRetryTokens, options) => { + const MAX_CAPACITY = initialRetryTokens; + const noRetryIncrement = utilRetry.NO_RETRY_INCREMENT; + const retryCost = utilRetry.RETRY_COST; + const timeoutRetryCost = utilRetry.TIMEOUT_RETRY_COST; + let availableCapacity = initialRetryTokens; + const getCapacityAmount = (error) => (error.name === "TimeoutError" ? timeoutRetryCost : retryCost); + const hasRetryTokens = (error) => getCapacityAmount(error) <= availableCapacity; + const retrieveRetryTokens = (error) => { + if (!hasRetryTokens(error)) { + throw new Error("No retry token available"); + } + const capacityAmount = getCapacityAmount(error); + availableCapacity -= capacityAmount; + return capacityAmount; }; -} -function createSmithyApiNoAuthHttpAuthOption(authParameters) { - return { - schemeId: "smithy.api#noAuth", + const releaseRetryTokens = (capacityReleaseAmount) => { + availableCapacity += capacityReleaseAmount ?? noRetryIncrement; + availableCapacity = Math.min(availableCapacity, MAX_CAPACITY); }; -} -const defaultSTSHttpAuthSchemeProvider = (authParameters) => { - const options = []; - switch (authParameters.operation) { - case "AssumeRoleWithWebIdentity": { - options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); - break; - } - default: { - options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); - } - } - return options; -}; -exports.defaultSTSHttpAuthSchemeProvider = defaultSTSHttpAuthSchemeProvider; -const resolveStsAuthConfig = (input) => Object.assign(input, { - stsClientCtor: STSClient_1.STSClient, -}); -exports.resolveStsAuthConfig = resolveStsAuthConfig; -const resolveHttpAuthSchemeConfig = (config) => { - const config_0 = (0, exports.resolveStsAuthConfig)(config); - const config_1 = (0, core_1.resolveAwsSdkSigV4Config)(config_0); - return Object.assign(config_1, { - authSchemePreference: (0, util_middleware_1.normalizeProvider)(config.authSchemePreference ?? []), + return Object.freeze({ + hasRetryTokens, + retrieveRetryTokens, + releaseRetryTokens, }); }; -exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; +const defaultDelayDecider = (delayBase, attempts) => Math.floor(Math.min(utilRetry.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); -/***/ }), +const defaultRetryDecider = (error) => { + if (!error) { + return false; + } + return serviceErrorClassification.isRetryableByTrait(error) || serviceErrorClassification.isClockSkewError(error) || serviceErrorClassification.isThrottlingError(error) || serviceErrorClassification.isTransientError(error); +}; -/***/ 6811: -/***/ ((__unused_webpack_module, exports) => { +const asSdkError = (error) => { + if (error instanceof Error) + return error; + if (error instanceof Object) + return Object.assign(new Error(), error); + if (typeof error === "string") + return new Error(error); + return new Error(`AWS SDK error wrapper for ${error}`); +}; -"use strict"; +class StandardRetryStrategy { + maxAttemptsProvider; + retryDecider; + delayDecider; + retryQuota; + mode = utilRetry.RETRY_MODES.STANDARD; + constructor(maxAttemptsProvider, options) { + this.maxAttemptsProvider = maxAttemptsProvider; + this.retryDecider = options?.retryDecider ?? defaultRetryDecider; + this.delayDecider = options?.delayDecider ?? defaultDelayDecider; + this.retryQuota = options?.retryQuota ?? getDefaultRetryQuota(utilRetry.INITIAL_RETRY_TOKENS); + } + shouldRetry(error, attempts, maxAttempts) { + return attempts < maxAttempts && this.retryDecider(error) && this.retryQuota.hasRetryTokens(error); + } + async getMaxAttempts() { + let maxAttempts; + try { + maxAttempts = await this.maxAttemptsProvider(); + } + catch (error) { + maxAttempts = utilRetry.DEFAULT_MAX_ATTEMPTS; + } + return maxAttempts; + } + async retry(next, args, options) { + let retryTokenAmount; + let attempts = 0; + let totalDelay = 0; + const maxAttempts = await this.getMaxAttempts(); + const { request } = args; + if (protocolHttp.HttpRequest.isInstance(request)) { + request.headers[utilRetry.INVOCATION_ID_HEADER] = uuid.v4(); + } + while (true) { + try { + if (protocolHttp.HttpRequest.isInstance(request)) { + request.headers[utilRetry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; + } + if (options?.beforeRequest) { + await options.beforeRequest(); + } + const { response, output } = await next(args); + if (options?.afterRequest) { + options.afterRequest(response); + } + this.retryQuota.releaseRetryTokens(retryTokenAmount); + output.$metadata.attempts = attempts + 1; + output.$metadata.totalRetryDelay = totalDelay; + return { response, output }; + } + catch (e) { + const err = asSdkError(e); + attempts++; + if (this.shouldRetry(err, attempts, maxAttempts)) { + retryTokenAmount = this.retryQuota.retrieveRetryTokens(err); + const delayFromDecider = this.delayDecider(serviceErrorClassification.isThrottlingError(err) ? utilRetry.THROTTLING_RETRY_DELAY_BASE : utilRetry.DEFAULT_RETRY_DELAY_BASE, attempts); + const delayFromResponse = getDelayFromRetryAfterHeader(err.$response); + const delay = Math.max(delayFromResponse || 0, delayFromDecider); + totalDelay += delay; + await new Promise((resolve) => setTimeout(resolve, delay)); + continue; + } + if (!err.$metadata) { + err.$metadata = {}; + } + err.$metadata.attempts = attempts; + err.$metadata.totalRetryDelay = totalDelay; + throw err; + } + } + } +} +const getDelayFromRetryAfterHeader = (response) => { + if (!protocolHttp.HttpResponse.isInstance(response)) + return; + const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); + if (!retryAfterHeaderName) + return; + const retryAfter = response.headers[retryAfterHeaderName]; + const retryAfterSeconds = Number(retryAfter); + if (!Number.isNaN(retryAfterSeconds)) + return retryAfterSeconds * 1000; + const retryAfterDate = new Date(retryAfter); + return retryAfterDate.getTime() - Date.now(); +}; + +class AdaptiveRetryStrategy extends StandardRetryStrategy { + rateLimiter; + constructor(maxAttemptsProvider, options) { + const { rateLimiter, ...superOptions } = options ?? {}; + super(maxAttemptsProvider, superOptions); + this.rateLimiter = rateLimiter ?? new utilRetry.DefaultRateLimiter(); + this.mode = utilRetry.RETRY_MODES.ADAPTIVE; + } + async retry(next, args) { + return super.retry(next, args, { + beforeRequest: async () => { + return this.rateLimiter.getSendToken(); + }, + afterRequest: (response) => { + this.rateLimiter.updateClientSendingRate(response); + }, + }); + } +} -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.commonParams = exports.resolveClientEndpointParameters = void 0; -const resolveClientEndpointParameters = (options) => { - return Object.assign(options, { - useDualstackEndpoint: options.useDualstackEndpoint ?? false, - useFipsEndpoint: options.useFipsEndpoint ?? false, - useGlobalEndpoint: options.useGlobalEndpoint ?? false, - defaultSigningName: "sts", +const ENV_MAX_ATTEMPTS = "AWS_MAX_ATTEMPTS"; +const CONFIG_MAX_ATTEMPTS = "max_attempts"; +const NODE_MAX_ATTEMPT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => { + const value = env[ENV_MAX_ATTEMPTS]; + if (!value) + return undefined; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Environment variable ${ENV_MAX_ATTEMPTS} mast be a number, got "${value}"`); + } + return maxAttempt; + }, + configFileSelector: (profile) => { + const value = profile[CONFIG_MAX_ATTEMPTS]; + if (!value) + return undefined; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Shared config file entry ${CONFIG_MAX_ATTEMPTS} mast be a number, got "${value}"`); + } + return maxAttempt; + }, + default: utilRetry.DEFAULT_MAX_ATTEMPTS, +}; +const resolveRetryConfig = (input) => { + const { retryStrategy, retryMode: _retryMode, maxAttempts: _maxAttempts } = input; + const maxAttempts = utilMiddleware.normalizeProvider(_maxAttempts ?? utilRetry.DEFAULT_MAX_ATTEMPTS); + return Object.assign(input, { + maxAttempts, + retryStrategy: async () => { + if (retryStrategy) { + return retryStrategy; + } + const retryMode = await utilMiddleware.normalizeProvider(_retryMode)(); + if (retryMode === utilRetry.RETRY_MODES.ADAPTIVE) { + return new utilRetry.AdaptiveRetryStrategy(maxAttempts); + } + return new utilRetry.StandardRetryStrategy(maxAttempts); + }, }); }; -exports.resolveClientEndpointParameters = resolveClientEndpointParameters; -exports.commonParams = { - UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, +const ENV_RETRY_MODE = "AWS_RETRY_MODE"; +const CONFIG_RETRY_MODE = "retry_mode"; +const NODE_RETRY_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_RETRY_MODE], + configFileSelector: (profile) => profile[CONFIG_RETRY_MODE], + default: utilRetry.DEFAULT_RETRY_MODE, +}; + +const omitRetryHeadersMiddleware = () => (next) => async (args) => { + const { request } = args; + if (protocolHttp.HttpRequest.isInstance(request)) { + delete request.headers[utilRetry.INVOCATION_ID_HEADER]; + delete request.headers[utilRetry.REQUEST_HEADER]; + } + return next(args); }; +const omitRetryHeadersMiddlewareOptions = { + name: "omitRetryHeadersMiddleware", + tags: ["RETRY", "HEADERS", "OMIT_RETRY_HEADERS"], + relation: "before", + toMiddleware: "awsAuthMiddleware", + override: true, +}; +const getOmitRetryHeadersPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(omitRetryHeadersMiddleware(), omitRetryHeadersMiddlewareOptions); + }, +}); + +const retryMiddleware = (options) => (next, context) => async (args) => { + let retryStrategy = await options.retryStrategy(); + const maxAttempts = await options.maxAttempts(); + if (isRetryStrategyV2(retryStrategy)) { + retryStrategy = retryStrategy; + let retryToken = await retryStrategy.acquireInitialRetryToken(context["partition_id"]); + let lastError = new Error(); + let attempts = 0; + let totalRetryDelay = 0; + const { request } = args; + const isRequest = protocolHttp.HttpRequest.isInstance(request); + if (isRequest) { + request.headers[utilRetry.INVOCATION_ID_HEADER] = uuid.v4(); + } + while (true) { + try { + if (isRequest) { + request.headers[utilRetry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; + } + const { response, output } = await next(args); + retryStrategy.recordSuccess(retryToken); + output.$metadata.attempts = attempts + 1; + output.$metadata.totalRetryDelay = totalRetryDelay; + return { response, output }; + } + catch (e) { + const retryErrorInfo = getRetryErrorInfo(e); + lastError = asSdkError(e); + if (isRequest && isStreamingPayload.isStreamingPayload(request)) { + (context.logger instanceof smithyClient.NoOpLogger ? console : context.logger)?.warn("An error was encountered in a non-retryable streaming request."); + throw lastError; + } + try { + retryToken = await retryStrategy.refreshRetryTokenForRetry(retryToken, retryErrorInfo); + } + catch (refreshError) { + if (!lastError.$metadata) { + lastError.$metadata = {}; + } + lastError.$metadata.attempts = attempts + 1; + lastError.$metadata.totalRetryDelay = totalRetryDelay; + throw lastError; + } + attempts = retryToken.getRetryCount(); + const delay = retryToken.getRetryDelay(); + totalRetryDelay += delay; + await new Promise((resolve) => setTimeout(resolve, delay)); + } + } + } + else { + retryStrategy = retryStrategy; + if (retryStrategy?.mode) + context.userAgent = [...(context.userAgent || []), ["cfg/retry-mode", retryStrategy.mode]]; + return retryStrategy.retry(next, args); + } +}; +const isRetryStrategyV2 = (retryStrategy) => typeof retryStrategy.acquireInitialRetryToken !== "undefined" && + typeof retryStrategy.refreshRetryTokenForRetry !== "undefined" && + typeof retryStrategy.recordSuccess !== "undefined"; +const getRetryErrorInfo = (error) => { + const errorInfo = { + error, + errorType: getRetryErrorType(error), + }; + const retryAfterHint = getRetryAfterHint(error.$response); + if (retryAfterHint) { + errorInfo.retryAfterHint = retryAfterHint; + } + return errorInfo; +}; +const getRetryErrorType = (error) => { + if (serviceErrorClassification.isThrottlingError(error)) + return "THROTTLING"; + if (serviceErrorClassification.isTransientError(error)) + return "TRANSIENT"; + if (serviceErrorClassification.isServerError(error)) + return "SERVER_ERROR"; + return "CLIENT_ERROR"; +}; +const retryMiddlewareOptions = { + name: "retryMiddleware", + tags: ["RETRY"], + step: "finalizeRequest", + priority: "high", + override: true, +}; +const getRetryPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add(retryMiddleware(options), retryMiddlewareOptions); + }, +}); +const getRetryAfterHint = (response) => { + if (!protocolHttp.HttpResponse.isInstance(response)) + return; + const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); + if (!retryAfterHeaderName) + return; + const retryAfter = response.headers[retryAfterHeaderName]; + const retryAfterSeconds = Number(retryAfter); + if (!Number.isNaN(retryAfterSeconds)) + return new Date(retryAfterSeconds * 1000); + const retryAfterDate = new Date(retryAfter); + return retryAfterDate; +}; + +exports.AdaptiveRetryStrategy = AdaptiveRetryStrategy; +exports.CONFIG_MAX_ATTEMPTS = CONFIG_MAX_ATTEMPTS; +exports.CONFIG_RETRY_MODE = CONFIG_RETRY_MODE; +exports.ENV_MAX_ATTEMPTS = ENV_MAX_ATTEMPTS; +exports.ENV_RETRY_MODE = ENV_RETRY_MODE; +exports.NODE_MAX_ATTEMPT_CONFIG_OPTIONS = NODE_MAX_ATTEMPT_CONFIG_OPTIONS; +exports.NODE_RETRY_MODE_CONFIG_OPTIONS = NODE_RETRY_MODE_CONFIG_OPTIONS; +exports.StandardRetryStrategy = StandardRetryStrategy; +exports.defaultDelayDecider = defaultDelayDecider; +exports.defaultRetryDecider = defaultRetryDecider; +exports.getOmitRetryHeadersPlugin = getOmitRetryHeadersPlugin; +exports.getRetryAfterHint = getRetryAfterHint; +exports.getRetryPlugin = getRetryPlugin; +exports.omitRetryHeadersMiddleware = omitRetryHeadersMiddleware; +exports.omitRetryHeadersMiddlewareOptions = omitRetryHeadersMiddlewareOptions; +exports.resolveRetryConfig = resolveRetryConfig; +exports.retryMiddleware = retryMiddleware; +exports.retryMiddlewareOptions = retryMiddlewareOptions; /***/ }), -/***/ 9765: +/***/ 9831: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultEndpointResolver = void 0; -const util_endpoints_1 = __nccwpck_require__(3068); -const util_endpoints_2 = __nccwpck_require__(9674); -const ruleset_1 = __nccwpck_require__(1670); -const cache = new util_endpoints_2.EndpointCache({ - size: 50, - params: ["Endpoint", "Region", "UseDualStack", "UseFIPS", "UseGlobalEndpoint"], -}); -const defaultEndpointResolver = (endpointParams, context = {}) => { - return cache.get(endpointParams, () => (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { - endpointParams: endpointParams, - logger: context.logger, - })); -}; -exports.defaultEndpointResolver = defaultEndpointResolver; -util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; +exports.isStreamingPayload = void 0; +const stream_1 = __nccwpck_require__(2203); +const isStreamingPayload = (request) => request?.body instanceof stream_1.Readable || + (typeof ReadableStream !== "undefined" && request?.body instanceof ReadableStream); +exports.isStreamingPayload = isStreamingPayload; /***/ }), -/***/ 1670: -/***/ ((__unused_webpack_module, exports) => { +/***/ 3255: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ruleSet = void 0; -const F = "required", G = "type", H = "fn", I = "argv", J = "ref"; -const a = false, b = true, c = "booleanEquals", d = "stringEquals", e = "sigv4", f = "sts", g = "us-east-1", h = "endpoint", i = "https://sts.{Region}.{PartitionResult#dnsSuffix}", j = "tree", k = "error", l = "getAttr", m = { [F]: false, [G]: "String" }, n = { [F]: true, "default": false, [G]: "Boolean" }, o = { [J]: "Endpoint" }, p = { [H]: "isSet", [I]: [{ [J]: "Region" }] }, q = { [J]: "Region" }, r = { [H]: "aws.partition", [I]: [q], "assign": "PartitionResult" }, s = { [J]: "UseFIPS" }, t = { [J]: "UseDualStack" }, u = { "url": "https://sts.amazonaws.com", "properties": { "authSchemes": [{ "name": e, "signingName": f, "signingRegion": g }] }, "headers": {} }, v = {}, w = { "conditions": [{ [H]: d, [I]: [q, "aws-global"] }], [h]: u, [G]: h }, x = { [H]: c, [I]: [s, true] }, y = { [H]: c, [I]: [t, true] }, z = { [H]: l, [I]: [{ [J]: "PartitionResult" }, "supportsFIPS"] }, A = { [J]: "PartitionResult" }, B = { [H]: c, [I]: [true, { [H]: l, [I]: [A, "supportsDualStack"] }] }, C = [{ [H]: "isSet", [I]: [o] }], D = [x], E = [y]; -const _data = { version: "1.0", parameters: { Region: m, UseDualStack: n, UseFIPS: n, Endpoint: m, UseGlobalEndpoint: n }, rules: [{ conditions: [{ [H]: c, [I]: [{ [J]: "UseGlobalEndpoint" }, b] }, { [H]: "not", [I]: C }, p, r, { [H]: c, [I]: [s, a] }, { [H]: c, [I]: [t, a] }], rules: [{ conditions: [{ [H]: d, [I]: [q, "ap-northeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-south-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-2"] }], endpoint: u, [G]: h }, w, { conditions: [{ [H]: d, [I]: [q, "ca-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-north-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-3"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "sa-east-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, g] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-east-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-2"] }], endpoint: u, [G]: h }, { endpoint: { url: i, properties: { authSchemes: [{ name: e, signingName: f, signingRegion: "{Region}" }] }, headers: v }, [G]: h }], [G]: j }, { conditions: C, rules: [{ conditions: D, error: "Invalid Configuration: FIPS and custom endpoint are not supported", [G]: k }, { conditions: E, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", [G]: k }, { endpoint: { url: o, properties: v, headers: v }, [G]: h }], [G]: j }, { conditions: [p], rules: [{ conditions: [r], rules: [{ conditions: [x, y], rules: [{ conditions: [{ [H]: c, [I]: [b, z] }, B], rules: [{ endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", [G]: k }], [G]: j }, { conditions: D, rules: [{ conditions: [{ [H]: c, [I]: [z, b] }], rules: [{ conditions: [{ [H]: d, [I]: [{ [H]: l, [I]: [A, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://sts.{Region}.amazonaws.com", properties: v, headers: v }, [G]: h }, { endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS is enabled but this partition does not support FIPS", [G]: k }], [G]: j }, { conditions: E, rules: [{ conditions: [B], rules: [{ endpoint: { url: "https://sts.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "DualStack is enabled but this partition does not support DualStack", [G]: k }], [G]: j }, w, { endpoint: { url: i, properties: v, headers: v }, [G]: h }], [G]: j }], [G]: j }, { error: "Invalid Configuration: Missing Region", [G]: k }] }; -exports.ruleSet = _data; - - -/***/ }), - -/***/ 1136: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/submodules/sts/index.ts -var index_exports = {}; -__export(index_exports, { - AssumeRoleCommand: () => AssumeRoleCommand, - AssumeRoleResponseFilterSensitiveLog: () => AssumeRoleResponseFilterSensitiveLog, - AssumeRoleWithWebIdentityCommand: () => AssumeRoleWithWebIdentityCommand, - AssumeRoleWithWebIdentityRequestFilterSensitiveLog: () => AssumeRoleWithWebIdentityRequestFilterSensitiveLog, - AssumeRoleWithWebIdentityResponseFilterSensitiveLog: () => AssumeRoleWithWebIdentityResponseFilterSensitiveLog, - ClientInputEndpointParameters: () => import_EndpointParameters3.ClientInputEndpointParameters, - CredentialsFilterSensitiveLog: () => CredentialsFilterSensitiveLog, - ExpiredTokenException: () => ExpiredTokenException, - IDPCommunicationErrorException: () => IDPCommunicationErrorException, - IDPRejectedClaimException: () => IDPRejectedClaimException, - InvalidIdentityTokenException: () => InvalidIdentityTokenException, - MalformedPolicyDocumentException: () => MalformedPolicyDocumentException, - PackedPolicyTooLargeException: () => PackedPolicyTooLargeException, - RegionDisabledException: () => RegionDisabledException, - STS: () => STS, - STSServiceException: () => STSServiceException, - decorateDefaultCredentialProvider: () => decorateDefaultCredentialProvider, - getDefaultRoleAssumer: () => getDefaultRoleAssumer2, - getDefaultRoleAssumerWithWebIdentity: () => getDefaultRoleAssumerWithWebIdentity2 -}); -module.exports = __toCommonJS(index_exports); -__reExport(index_exports, __nccwpck_require__(3723), module.exports); - -// src/submodules/sts/STS.ts -var import_smithy_client6 = __nccwpck_require__(1411); - -// src/submodules/sts/commands/AssumeRoleCommand.ts -var import_middleware_endpoint = __nccwpck_require__(99); -var import_middleware_serde = __nccwpck_require__(3255); -var import_smithy_client4 = __nccwpck_require__(1411); -var import_EndpointParameters = __nccwpck_require__(6811); - -// src/submodules/sts/models/models_0.ts -var import_smithy_client2 = __nccwpck_require__(1411); - -// src/submodules/sts/models/STSServiceException.ts -var import_smithy_client = __nccwpck_require__(1411); -var STSServiceException = class _STSServiceException extends import_smithy_client.ServiceException { - static { - __name(this, "STSServiceException"); - } - /** - * @internal - */ - constructor(options) { - super(options); - Object.setPrototypeOf(this, _STSServiceException.prototype); - } -}; - -// src/submodules/sts/models/models_0.ts -var CredentialsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.SecretAccessKey && { SecretAccessKey: import_smithy_client2.SENSITIVE_STRING } -}), "CredentialsFilterSensitiveLog"); -var AssumeRoleResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } -}), "AssumeRoleResponseFilterSensitiveLog"); -var ExpiredTokenException = class _ExpiredTokenException extends STSServiceException { - static { - __name(this, "ExpiredTokenException"); - } - name = "ExpiredTokenException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "ExpiredTokenException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _ExpiredTokenException.prototype); - } -}; -var MalformedPolicyDocumentException = class _MalformedPolicyDocumentException extends STSServiceException { - static { - __name(this, "MalformedPolicyDocumentException"); - } - name = "MalformedPolicyDocumentException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "MalformedPolicyDocumentException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _MalformedPolicyDocumentException.prototype); - } -}; -var PackedPolicyTooLargeException = class _PackedPolicyTooLargeException extends STSServiceException { - static { - __name(this, "PackedPolicyTooLargeException"); - } - name = "PackedPolicyTooLargeException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "PackedPolicyTooLargeException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _PackedPolicyTooLargeException.prototype); - } -}; -var RegionDisabledException = class _RegionDisabledException extends STSServiceException { - static { - __name(this, "RegionDisabledException"); - } - name = "RegionDisabledException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "RegionDisabledException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _RegionDisabledException.prototype); - } -}; -var IDPRejectedClaimException = class _IDPRejectedClaimException extends STSServiceException { - static { - __name(this, "IDPRejectedClaimException"); - } - name = "IDPRejectedClaimException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "IDPRejectedClaimException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _IDPRejectedClaimException.prototype); - } -}; -var InvalidIdentityTokenException = class _InvalidIdentityTokenException extends STSServiceException { - static { - __name(this, "InvalidIdentityTokenException"); - } - name = "InvalidIdentityTokenException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "InvalidIdentityTokenException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _InvalidIdentityTokenException.prototype); - } -}; -var AssumeRoleWithWebIdentityRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.WebIdentityToken && { WebIdentityToken: import_smithy_client2.SENSITIVE_STRING } -}), "AssumeRoleWithWebIdentityRequestFilterSensitiveLog"); -var AssumeRoleWithWebIdentityResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ - ...obj, - ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } -}), "AssumeRoleWithWebIdentityResponseFilterSensitiveLog"); -var IDPCommunicationErrorException = class _IDPCommunicationErrorException extends STSServiceException { - static { - __name(this, "IDPCommunicationErrorException"); - } - name = "IDPCommunicationErrorException"; - $fault = "client"; - /** - * @internal - */ - constructor(opts) { - super({ - name: "IDPCommunicationErrorException", - $fault: "client", - ...opts - }); - Object.setPrototypeOf(this, _IDPCommunicationErrorException.prototype); - } -}; - -// src/submodules/sts/protocols/Aws_query.ts -var import_core = __nccwpck_require__(8704); -var import_protocol_http = __nccwpck_require__(2356); -var import_smithy_client3 = __nccwpck_require__(1411); -var se_AssumeRoleCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = SHARED_HEADERS; - let body; - body = buildFormUrlencodedString({ - ...se_AssumeRoleRequest(input, context), - [_A]: _AR, - [_V]: _ - }); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_AssumeRoleCommand"); -var se_AssumeRoleWithWebIdentityCommand = /* @__PURE__ */ __name(async (input, context) => { - const headers = SHARED_HEADERS; - let body; - body = buildFormUrlencodedString({ - ...se_AssumeRoleWithWebIdentityRequest(input, context), - [_A]: _ARWWI, - [_V]: _ - }); - return buildHttpRpcRequest(context, headers, "/", void 0, body); -}, "se_AssumeRoleWithWebIdentityCommand"); -var de_AssumeRoleCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core.parseXmlBody)(output.body, context); - let contents = {}; - contents = de_AssumeRoleResponse(data.AssumeRoleResult, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_AssumeRoleCommand"); -var de_AssumeRoleWithWebIdentityCommand = /* @__PURE__ */ __name(async (output, context) => { - if (output.statusCode >= 300) { - return de_CommandError(output, context); - } - const data = await (0, import_core.parseXmlBody)(output.body, context); - let contents = {}; - contents = de_AssumeRoleWithWebIdentityResponse(data.AssumeRoleWithWebIdentityResult, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents - }; - return response; -}, "de_AssumeRoleWithWebIdentityCommand"); -var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { - const parsedOutput = { - ...output, - body: await (0, import_core.parseXmlErrorBody)(output.body, context) - }; - const errorCode = loadQueryErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "ExpiredTokenException": - case "com.amazonaws.sts#ExpiredTokenException": - throw await de_ExpiredTokenExceptionRes(parsedOutput, context); - case "MalformedPolicyDocument": - case "com.amazonaws.sts#MalformedPolicyDocumentException": - throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context); - case "PackedPolicyTooLarge": - case "com.amazonaws.sts#PackedPolicyTooLargeException": - throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context); - case "RegionDisabledException": - case "com.amazonaws.sts#RegionDisabledException": - throw await de_RegionDisabledExceptionRes(parsedOutput, context); - case "IDPCommunicationError": - case "com.amazonaws.sts#IDPCommunicationErrorException": - throw await de_IDPCommunicationErrorExceptionRes(parsedOutput, context); - case "IDPRejectedClaim": - case "com.amazonaws.sts#IDPRejectedClaimException": - throw await de_IDPRejectedClaimExceptionRes(parsedOutput, context); - case "InvalidIdentityToken": - case "com.amazonaws.sts#InvalidIdentityTokenException": - throw await de_InvalidIdentityTokenExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody: parsedBody.Error, - errorCode - }); - } -}, "de_CommandError"); -var de_ExpiredTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_ExpiredTokenException(body.Error, context); - const exception = new ExpiredTokenException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_ExpiredTokenExceptionRes"); -var de_IDPCommunicationErrorExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_IDPCommunicationErrorException(body.Error, context); - const exception = new IDPCommunicationErrorException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_IDPCommunicationErrorExceptionRes"); -var de_IDPRejectedClaimExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_IDPRejectedClaimException(body.Error, context); - const exception = new IDPRejectedClaimException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_IDPRejectedClaimExceptionRes"); -var de_InvalidIdentityTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_InvalidIdentityTokenException(body.Error, context); - const exception = new InvalidIdentityTokenException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_InvalidIdentityTokenExceptionRes"); -var de_MalformedPolicyDocumentExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_MalformedPolicyDocumentException(body.Error, context); - const exception = new MalformedPolicyDocumentException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_MalformedPolicyDocumentExceptionRes"); -var de_PackedPolicyTooLargeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_PackedPolicyTooLargeException(body.Error, context); - const exception = new PackedPolicyTooLargeException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_PackedPolicyTooLargeExceptionRes"); -var de_RegionDisabledExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_RegionDisabledException(body.Error, context); - const exception = new RegionDisabledException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized - }); - return (0, import_smithy_client3.decorateServiceException)(exception, body); -}, "de_RegionDisabledExceptionRes"); -var se_AssumeRoleRequest = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - if (input[_RA] != null) { - entries[_RA] = input[_RA]; - } - if (input[_RSN] != null) { - entries[_RSN] = input[_RSN]; - } - if (input[_PA] != null) { - const memberEntries = se_policyDescriptorListType(input[_PA], context); - if (input[_PA]?.length === 0) { - entries.PolicyArns = []; - } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `PolicyArns.${key}`; - entries[loc] = value; - }); - } - if (input[_P] != null) { - entries[_P] = input[_P]; - } - if (input[_DS] != null) { - entries[_DS] = input[_DS]; - } - if (input[_T] != null) { - const memberEntries = se_tagListType(input[_T], context); - if (input[_T]?.length === 0) { - entries.Tags = []; - } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `Tags.${key}`; - entries[loc] = value; - }); - } - if (input[_TTK] != null) { - const memberEntries = se_tagKeyListType(input[_TTK], context); - if (input[_TTK]?.length === 0) { - entries.TransitiveTagKeys = []; - } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `TransitiveTagKeys.${key}`; - entries[loc] = value; - }); - } - if (input[_EI] != null) { - entries[_EI] = input[_EI]; - } - if (input[_SN] != null) { - entries[_SN] = input[_SN]; - } - if (input[_TC] != null) { - entries[_TC] = input[_TC]; - } - if (input[_SI] != null) { - entries[_SI] = input[_SI]; - } - if (input[_PC] != null) { - const memberEntries = se_ProvidedContextsListType(input[_PC], context); - if (input[_PC]?.length === 0) { - entries.ProvidedContexts = []; - } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `ProvidedContexts.${key}`; - entries[loc] = value; - }); - } - return entries; -}, "se_AssumeRoleRequest"); -var se_AssumeRoleWithWebIdentityRequest = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - if (input[_RA] != null) { - entries[_RA] = input[_RA]; - } - if (input[_RSN] != null) { - entries[_RSN] = input[_RSN]; - } - if (input[_WIT] != null) { - entries[_WIT] = input[_WIT]; - } - if (input[_PI] != null) { - entries[_PI] = input[_PI]; - } - if (input[_PA] != null) { - const memberEntries = se_policyDescriptorListType(input[_PA], context); - if (input[_PA]?.length === 0) { - entries.PolicyArns = []; - } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `PolicyArns.${key}`; - entries[loc] = value; - }); - } - if (input[_P] != null) { - entries[_P] = input[_P]; - } - if (input[_DS] != null) { - entries[_DS] = input[_DS]; - } - return entries; -}, "se_AssumeRoleWithWebIdentityRequest"); -var se_policyDescriptorListType = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - let counter = 1; - for (const entry of input) { - if (entry === null) { - continue; - } - const memberEntries = se_PolicyDescriptorType(entry, context); - Object.entries(memberEntries).forEach(([key, value]) => { - entries[`member.${counter}.${key}`] = value; - }); - counter++; - } - return entries; -}, "se_policyDescriptorListType"); -var se_PolicyDescriptorType = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - if (input[_a] != null) { - entries[_a] = input[_a]; - } - return entries; -}, "se_PolicyDescriptorType"); -var se_ProvidedContext = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - if (input[_PAr] != null) { - entries[_PAr] = input[_PAr]; - } - if (input[_CA] != null) { - entries[_CA] = input[_CA]; - } - return entries; -}, "se_ProvidedContext"); -var se_ProvidedContextsListType = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - let counter = 1; - for (const entry of input) { - if (entry === null) { - continue; - } - const memberEntries = se_ProvidedContext(entry, context); - Object.entries(memberEntries).forEach(([key, value]) => { - entries[`member.${counter}.${key}`] = value; - }); - counter++; - } - return entries; -}, "se_ProvidedContextsListType"); -var se_Tag = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - if (input[_K] != null) { - entries[_K] = input[_K]; - } - if (input[_Va] != null) { - entries[_Va] = input[_Va]; - } - return entries; -}, "se_Tag"); -var se_tagKeyListType = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - let counter = 1; - for (const entry of input) { - if (entry === null) { - continue; - } - entries[`member.${counter}`] = entry; - counter++; - } - return entries; -}, "se_tagKeyListType"); -var se_tagListType = /* @__PURE__ */ __name((input, context) => { - const entries = {}; - let counter = 1; - for (const entry of input) { - if (entry === null) { - continue; - } - const memberEntries = se_Tag(entry, context); - Object.entries(memberEntries).forEach(([key, value]) => { - entries[`member.${counter}.${key}`] = value; - }); - counter++; - } - return entries; -}, "se_tagListType"); -var de_AssumedRoleUser = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_ARI] != null) { - contents[_ARI] = (0, import_smithy_client3.expectString)(output[_ARI]); - } - if (output[_Ar] != null) { - contents[_Ar] = (0, import_smithy_client3.expectString)(output[_Ar]); - } - return contents; -}, "de_AssumedRoleUser"); -var de_AssumeRoleResponse = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_C] != null) { - contents[_C] = de_Credentials(output[_C], context); - } - if (output[_ARU] != null) { - contents[_ARU] = de_AssumedRoleUser(output[_ARU], context); - } - if (output[_PPS] != null) { - contents[_PPS] = (0, import_smithy_client3.strictParseInt32)(output[_PPS]); - } - if (output[_SI] != null) { - contents[_SI] = (0, import_smithy_client3.expectString)(output[_SI]); - } - return contents; -}, "de_AssumeRoleResponse"); -var de_AssumeRoleWithWebIdentityResponse = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_C] != null) { - contents[_C] = de_Credentials(output[_C], context); - } - if (output[_SFWIT] != null) { - contents[_SFWIT] = (0, import_smithy_client3.expectString)(output[_SFWIT]); - } - if (output[_ARU] != null) { - contents[_ARU] = de_AssumedRoleUser(output[_ARU], context); - } - if (output[_PPS] != null) { - contents[_PPS] = (0, import_smithy_client3.strictParseInt32)(output[_PPS]); - } - if (output[_Pr] != null) { - contents[_Pr] = (0, import_smithy_client3.expectString)(output[_Pr]); - } - if (output[_Au] != null) { - contents[_Au] = (0, import_smithy_client3.expectString)(output[_Au]); - } - if (output[_SI] != null) { - contents[_SI] = (0, import_smithy_client3.expectString)(output[_SI]); - } - return contents; -}, "de_AssumeRoleWithWebIdentityResponse"); -var de_Credentials = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_AKI] != null) { - contents[_AKI] = (0, import_smithy_client3.expectString)(output[_AKI]); - } - if (output[_SAK] != null) { - contents[_SAK] = (0, import_smithy_client3.expectString)(output[_SAK]); - } - if (output[_ST] != null) { - contents[_ST] = (0, import_smithy_client3.expectString)(output[_ST]); - } - if (output[_E] != null) { - contents[_E] = (0, import_smithy_client3.expectNonNull)((0, import_smithy_client3.parseRfc3339DateTimeWithOffset)(output[_E])); - } - return contents; -}, "de_Credentials"); -var de_ExpiredTokenException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_ExpiredTokenException"); -var de_IDPCommunicationErrorException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_IDPCommunicationErrorException"); -var de_IDPRejectedClaimException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_IDPRejectedClaimException"); -var de_InvalidIdentityTokenException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_InvalidIdentityTokenException"); -var de_MalformedPolicyDocumentException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_MalformedPolicyDocumentException"); -var de_PackedPolicyTooLargeException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_PackedPolicyTooLargeException"); -var de_RegionDisabledException = /* @__PURE__ */ __name((output, context) => { - const contents = {}; - if (output[_m] != null) { - contents[_m] = (0, import_smithy_client3.expectString)(output[_m]); - } - return contents; -}, "de_RegionDisabledException"); -var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"] -}), "deserializeMetadata"); -var throwDefaultError = (0, import_smithy_client3.withBaseException)(STSServiceException); -var buildHttpRpcRequest = /* @__PURE__ */ __name(async (context, headers, path, resolvedHostname, body) => { - const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); - const contents = { - protocol, - hostname, - port, - method: "POST", - path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, - headers - }; - if (resolvedHostname !== void 0) { - contents.hostname = resolvedHostname; - } - if (body !== void 0) { - contents.body = body; - } - return new import_protocol_http.HttpRequest(contents); -}, "buildHttpRpcRequest"); -var SHARED_HEADERS = { - "content-type": "application/x-www-form-urlencoded" -}; -var _ = "2011-06-15"; -var _A = "Action"; -var _AKI = "AccessKeyId"; -var _AR = "AssumeRole"; -var _ARI = "AssumedRoleId"; -var _ARU = "AssumedRoleUser"; -var _ARWWI = "AssumeRoleWithWebIdentity"; -var _Ar = "Arn"; -var _Au = "Audience"; -var _C = "Credentials"; -var _CA = "ContextAssertion"; -var _DS = "DurationSeconds"; -var _E = "Expiration"; -var _EI = "ExternalId"; -var _K = "Key"; -var _P = "Policy"; -var _PA = "PolicyArns"; -var _PAr = "ProviderArn"; -var _PC = "ProvidedContexts"; -var _PI = "ProviderId"; -var _PPS = "PackedPolicySize"; -var _Pr = "Provider"; -var _RA = "RoleArn"; -var _RSN = "RoleSessionName"; -var _SAK = "SecretAccessKey"; -var _SFWIT = "SubjectFromWebIdentityToken"; -var _SI = "SourceIdentity"; -var _SN = "SerialNumber"; -var _ST = "SessionToken"; -var _T = "Tags"; -var _TC = "TokenCode"; -var _TTK = "TransitiveTagKeys"; -var _V = "Version"; -var _Va = "Value"; -var _WIT = "WebIdentityToken"; -var _a = "arn"; -var _m = "message"; -var buildFormUrlencodedString = /* @__PURE__ */ __name((formEntries) => Object.entries(formEntries).map(([key, value]) => (0, import_smithy_client3.extendedEncodeURIComponent)(key) + "=" + (0, import_smithy_client3.extendedEncodeURIComponent)(value)).join("&"), "buildFormUrlencodedString"); -var loadQueryErrorCode = /* @__PURE__ */ __name((output, data) => { - if (data.Error?.Code !== void 0) { - return data.Error.Code; - } - if (output.statusCode == 404) { - return "NotFound"; - } -}, "loadQueryErrorCode"); - -// src/submodules/sts/commands/AssumeRoleCommand.ts -var AssumeRoleCommand = class extends import_smithy_client4.Command.classBuilder().ep(import_EndpointParameters.commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AWSSecurityTokenServiceV20110615", "AssumeRole", {}).n("STSClient", "AssumeRoleCommand").f(void 0, AssumeRoleResponseFilterSensitiveLog).ser(se_AssumeRoleCommand).de(de_AssumeRoleCommand).build() { - static { - __name(this, "AssumeRoleCommand"); - } -}; - -// src/submodules/sts/commands/AssumeRoleWithWebIdentityCommand.ts -var import_middleware_endpoint2 = __nccwpck_require__(99); -var import_middleware_serde2 = __nccwpck_require__(3255); -var import_smithy_client5 = __nccwpck_require__(1411); -var import_EndpointParameters2 = __nccwpck_require__(6811); -var AssumeRoleWithWebIdentityCommand = class extends import_smithy_client5.Command.classBuilder().ep(import_EndpointParameters2.commonParams).m(function(Command, cs, config, o) { - return [ - (0, import_middleware_serde2.getSerdePlugin)(config, this.serialize, this.deserialize), - (0, import_middleware_endpoint2.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) - ]; -}).s("AWSSecurityTokenServiceV20110615", "AssumeRoleWithWebIdentity", {}).n("STSClient", "AssumeRoleWithWebIdentityCommand").f(AssumeRoleWithWebIdentityRequestFilterSensitiveLog, AssumeRoleWithWebIdentityResponseFilterSensitiveLog).ser(se_AssumeRoleWithWebIdentityCommand).de(de_AssumeRoleWithWebIdentityCommand).build() { - static { - __name(this, "AssumeRoleWithWebIdentityCommand"); - } -}; - -// src/submodules/sts/STS.ts -var import_STSClient = __nccwpck_require__(3723); -var commands = { - AssumeRoleCommand, - AssumeRoleWithWebIdentityCommand -}; -var STS = class extends import_STSClient.STSClient { - static { - __name(this, "STS"); - } -}; -(0, import_smithy_client6.createAggregatedClient)(commands, STS); - -// src/submodules/sts/index.ts -var import_EndpointParameters3 = __nccwpck_require__(6811); - -// src/submodules/sts/defaultStsRoleAssumers.ts -var import_client = __nccwpck_require__(5152); -var ASSUME_ROLE_DEFAULT_REGION = "us-east-1"; -var getAccountIdFromAssumedRoleUser = /* @__PURE__ */ __name((assumedRoleUser) => { - if (typeof assumedRoleUser?.Arn === "string") { - const arnComponents = assumedRoleUser.Arn.split(":"); - if (arnComponents.length > 4 && arnComponents[4] !== "") { - return arnComponents[4]; - } - } - return void 0; -}, "getAccountIdFromAssumedRoleUser"); -var resolveRegion = /* @__PURE__ */ __name(async (_region, _parentRegion, credentialProviderLogger) => { - const region = typeof _region === "function" ? await _region() : _region; - const parentRegion = typeof _parentRegion === "function" ? await _parentRegion() : _parentRegion; - credentialProviderLogger?.debug?.( - "@aws-sdk/client-sts::resolveRegion", - "accepting first of:", - `${region} (provider)`, - `${parentRegion} (parent client)`, - `${ASSUME_ROLE_DEFAULT_REGION} (STS default)` - ); - return region ?? parentRegion ?? ASSUME_ROLE_DEFAULT_REGION; -}, "resolveRegion"); -var getDefaultRoleAssumer = /* @__PURE__ */ __name((stsOptions, STSClient3) => { - let stsClient; - let closureSourceCreds; - return async (sourceCreds, params) => { - closureSourceCreds = sourceCreds; - if (!stsClient) { - const { - logger = stsOptions?.parentClientConfig?.logger, - region, - requestHandler = stsOptions?.parentClientConfig?.requestHandler, - credentialProviderLogger - } = stsOptions; - const resolvedRegion = await resolveRegion( - region, - stsOptions?.parentClientConfig?.region, - credentialProviderLogger - ); - const isCompatibleRequestHandler = !isH2(requestHandler); - stsClient = new STSClient3({ - profile: stsOptions?.parentClientConfig?.profile, - // A hack to make sts client uses the credential in current closure. - credentialDefaultProvider: /* @__PURE__ */ __name(() => async () => closureSourceCreds, "credentialDefaultProvider"), - region: resolvedRegion, - requestHandler: isCompatibleRequestHandler ? requestHandler : void 0, - logger - }); - } - const { Credentials: Credentials2, AssumedRoleUser: AssumedRoleUser2 } = await stsClient.send(new AssumeRoleCommand(params)); - if (!Credentials2 || !Credentials2.AccessKeyId || !Credentials2.SecretAccessKey) { - throw new Error(`Invalid response from STS.assumeRole call with role ${params.RoleArn}`); - } - const accountId = getAccountIdFromAssumedRoleUser(AssumedRoleUser2); - const credentials = { - accessKeyId: Credentials2.AccessKeyId, - secretAccessKey: Credentials2.SecretAccessKey, - sessionToken: Credentials2.SessionToken, - expiration: Credentials2.Expiration, - // TODO(credentialScope): access normally when shape is updated. - ...Credentials2.CredentialScope && { credentialScope: Credentials2.CredentialScope }, - ...accountId && { accountId } - }; - (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_STS_ASSUME_ROLE", "i"); - return credentials; - }; -}, "getDefaultRoleAssumer"); -var getDefaultRoleAssumerWithWebIdentity = /* @__PURE__ */ __name((stsOptions, STSClient3) => { - let stsClient; - return async (params) => { - if (!stsClient) { - const { - logger = stsOptions?.parentClientConfig?.logger, - region, - requestHandler = stsOptions?.parentClientConfig?.requestHandler, - credentialProviderLogger - } = stsOptions; - const resolvedRegion = await resolveRegion( - region, - stsOptions?.parentClientConfig?.region, - credentialProviderLogger - ); - const isCompatibleRequestHandler = !isH2(requestHandler); - stsClient = new STSClient3({ - profile: stsOptions?.parentClientConfig?.profile, - region: resolvedRegion, - requestHandler: isCompatibleRequestHandler ? requestHandler : void 0, - logger - }); - } - const { Credentials: Credentials2, AssumedRoleUser: AssumedRoleUser2 } = await stsClient.send(new AssumeRoleWithWebIdentityCommand(params)); - if (!Credentials2 || !Credentials2.AccessKeyId || !Credentials2.SecretAccessKey) { - throw new Error(`Invalid response from STS.assumeRoleWithWebIdentity call with role ${params.RoleArn}`); - } - const accountId = getAccountIdFromAssumedRoleUser(AssumedRoleUser2); - const credentials = { - accessKeyId: Credentials2.AccessKeyId, - secretAccessKey: Credentials2.SecretAccessKey, - sessionToken: Credentials2.SessionToken, - expiration: Credentials2.Expiration, - // TODO(credentialScope): access normally when shape is updated. - ...Credentials2.CredentialScope && { credentialScope: Credentials2.CredentialScope }, - ...accountId && { accountId } - }; - if (accountId) { - (0, import_client.setCredentialFeature)(credentials, "RESOLVED_ACCOUNT_ID", "T"); - } - (0, import_client.setCredentialFeature)(credentials, "CREDENTIALS_STS_ASSUME_ROLE_WEB_ID", "k"); - return credentials; - }; -}, "getDefaultRoleAssumerWithWebIdentity"); -var isH2 = /* @__PURE__ */ __name((requestHandler) => { - return requestHandler?.metadata?.handlerProtocol === "h2"; -}, "isH2"); - -// src/submodules/sts/defaultRoleAssumers.ts -var import_STSClient2 = __nccwpck_require__(3723); -var getCustomizableStsClientCtor = /* @__PURE__ */ __name((baseCtor, customizations) => { - if (!customizations) return baseCtor; - else - return class CustomizableSTSClient extends baseCtor { - static { - __name(this, "CustomizableSTSClient"); - } - constructor(config) { - super(config); - for (const customization of customizations) { - this.middlewareStack.use(customization); - } - } - }; -}, "getCustomizableStsClientCtor"); -var getDefaultRoleAssumer2 = /* @__PURE__ */ __name((stsOptions = {}, stsPlugins) => getDefaultRoleAssumer(stsOptions, getCustomizableStsClientCtor(import_STSClient2.STSClient, stsPlugins)), "getDefaultRoleAssumer"); -var getDefaultRoleAssumerWithWebIdentity2 = /* @__PURE__ */ __name((stsOptions = {}, stsPlugins) => getDefaultRoleAssumerWithWebIdentity(stsOptions, getCustomizableStsClientCtor(import_STSClient2.STSClient, stsPlugins)), "getDefaultRoleAssumerWithWebIdentity"); -var decorateDefaultCredentialProvider = /* @__PURE__ */ __name((provider) => (input) => provider({ - roleAssumer: getDefaultRoleAssumer2(input), - roleAssumerWithWebIdentity: getDefaultRoleAssumerWithWebIdentity2(input), - ...input -}), "decorateDefaultCredentialProvider"); -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 6578: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const tslib_1 = __nccwpck_require__(1860); -const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(9955)); -const core_1 = __nccwpck_require__(8704); -const util_user_agent_node_1 = __nccwpck_require__(1656); -const config_resolver_1 = __nccwpck_require__(9316); -const core_2 = __nccwpck_require__(402); -const hash_node_1 = __nccwpck_require__(5092); -const middleware_retry_1 = __nccwpck_require__(9618); -const node_config_provider_1 = __nccwpck_require__(5704); -const node_http_handler_1 = __nccwpck_require__(1279); -const util_body_length_node_1 = __nccwpck_require__(3638); -const util_retry_1 = __nccwpck_require__(5518); -const runtimeConfig_shared_1 = __nccwpck_require__(4443); -const smithy_client_1 = __nccwpck_require__(1411); -const util_defaults_mode_node_1 = __nccwpck_require__(5435); -const smithy_client_2 = __nccwpck_require__(1411); -const getRuntimeConfig = (config) => { - (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); - const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); - const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); - const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); - (0, core_1.emitWarningIfUnsupportedVersion)(process.version); - const loaderConfig = { - profile: config?.profile, - logger: clientSharedValues.logger, - }; - return { - ...clientSharedValues, - ...config, - runtime: "node", - defaultsMode, - authSchemePreference: config?.authSchemePreference ?? (0, node_config_provider_1.loadConfig)(core_1.NODE_AUTH_SCHEME_PREFERENCE_OPTIONS, loaderConfig), - bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, - defaultUserAgentProvider: config?.defaultUserAgentProvider ?? - (0, util_user_agent_node_1.createDefaultUserAgentProvider)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), - httpAuthSchemes: config?.httpAuthSchemes ?? [ - { - schemeId: "aws.auth#sigv4", - identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4") || - (async (idProps) => await config.credentialDefaultProvider(idProps?.__config || {})()), - signer: new core_1.AwsSdkSigV4Signer(), - }, - { - schemeId: "smithy.api#noAuth", - identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), - signer: new core_2.NoAuthSigner(), - }, - ], - maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS, config), - region: config?.region ?? - (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, { ...config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS, ...loaderConfig }), - requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), - retryMode: config?.retryMode ?? - (0, node_config_provider_1.loadConfig)({ - ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, - default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, - }, config), - sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), - streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, - useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, loaderConfig), - useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, loaderConfig), - userAgentAppId: config?.userAgentAppId ?? (0, node_config_provider_1.loadConfig)(util_user_agent_node_1.NODE_APP_ID_CONFIG_OPTIONS, loaderConfig), - }; -}; -exports.getRuntimeConfig = getRuntimeConfig; - - -/***/ }), - -/***/ 4443: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const core_1 = __nccwpck_require__(8704); -const core_2 = __nccwpck_require__(402); -const smithy_client_1 = __nccwpck_require__(1411); -const url_parser_1 = __nccwpck_require__(4494); -const util_base64_1 = __nccwpck_require__(8385); -const util_utf8_1 = __nccwpck_require__(1577); -const httpAuthSchemeProvider_1 = __nccwpck_require__(7851); -const endpointResolver_1 = __nccwpck_require__(9765); -const getRuntimeConfig = (config) => { - return { - apiVersion: "2011-06-15", - base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, - base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, - disableHostPrefix: config?.disableHostPrefix ?? false, - endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, - extensions: config?.extensions ?? [], - httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSTSHttpAuthSchemeProvider, - httpAuthSchemes: config?.httpAuthSchemes ?? [ - { - schemeId: "aws.auth#sigv4", - identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), - signer: new core_1.AwsSdkSigV4Signer(), - }, - { - schemeId: "smithy.api#noAuth", - identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), - signer: new core_2.NoAuthSigner(), - }, - ], - logger: config?.logger ?? new smithy_client_1.NoOpLogger(), - serviceId: config?.serviceId ?? "STS", - urlParser: config?.urlParser ?? url_parser_1.parseUrl, - utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, - utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, - }; -}; -exports.getRuntimeConfig = getRuntimeConfig; - - -/***/ }), - -/***/ 7742: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveRuntimeExtensions = void 0; -const region_config_resolver_1 = __nccwpck_require__(6463); -const protocol_http_1 = __nccwpck_require__(2356); -const smithy_client_1 = __nccwpck_require__(1411); -const httpAuthExtensionConfiguration_1 = __nccwpck_require__(4532); -const resolveRuntimeExtensions = (runtimeConfig, extensions) => { - const extensionConfiguration = Object.assign((0, region_config_resolver_1.getAwsRegionExtensionConfiguration)(runtimeConfig), (0, smithy_client_1.getDefaultExtensionConfiguration)(runtimeConfig), (0, protocol_http_1.getHttpHandlerExtensionConfiguration)(runtimeConfig), (0, httpAuthExtensionConfiguration_1.getHttpAuthExtensionConfiguration)(runtimeConfig)); - extensions.forEach((extension) => extension.configure(extensionConfiguration)); - return Object.assign(runtimeConfig, (0, region_config_resolver_1.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), (0, smithy_client_1.resolveDefaultRuntimeConfig)(extensionConfiguration), (0, protocol_http_1.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), (0, httpAuthExtensionConfiguration_1.resolveHttpAuthRuntimeConfig)(extensionConfiguration)); -}; -exports.resolveRuntimeExtensions = resolveRuntimeExtensions; - - -/***/ }), - -/***/ 6463: -/***/ ((module) => { - -"use strict"; - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - NODE_REGION_CONFIG_FILE_OPTIONS: () => NODE_REGION_CONFIG_FILE_OPTIONS, - NODE_REGION_CONFIG_OPTIONS: () => NODE_REGION_CONFIG_OPTIONS, - REGION_ENV_NAME: () => REGION_ENV_NAME, - REGION_INI_NAME: () => REGION_INI_NAME, - getAwsRegionExtensionConfiguration: () => getAwsRegionExtensionConfiguration, - resolveAwsRegionExtensionConfiguration: () => resolveAwsRegionExtensionConfiguration, - resolveRegionConfig: () => resolveRegionConfig -}); -module.exports = __toCommonJS(index_exports); - -// src/extensions/index.ts -var getAwsRegionExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return { - setRegion(region) { - runtimeConfig.region = region; - }, - region() { - return runtimeConfig.region; - } - }; -}, "getAwsRegionExtensionConfiguration"); -var resolveAwsRegionExtensionConfiguration = /* @__PURE__ */ __name((awsRegionExtensionConfiguration) => { - return { - region: awsRegionExtensionConfiguration.region() - }; -}, "resolveAwsRegionExtensionConfiguration"); - -// src/regionConfig/config.ts -var REGION_ENV_NAME = "AWS_REGION"; -var REGION_INI_NAME = "region"; -var NODE_REGION_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env) => env[REGION_ENV_NAME], "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => profile[REGION_INI_NAME], "configFileSelector"), - default: /* @__PURE__ */ __name(() => { - throw new Error("Region is missing"); - }, "default") -}; -var NODE_REGION_CONFIG_FILE_OPTIONS = { - preferredFile: "credentials" -}; - -// src/regionConfig/isFipsRegion.ts -var isFipsRegion = /* @__PURE__ */ __name((region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")), "isFipsRegion"); - -// src/regionConfig/getRealRegion.ts -var getRealRegion = /* @__PURE__ */ __name((region) => isFipsRegion(region) ? ["fips-aws-global", "aws-fips"].includes(region) ? "us-east-1" : region.replace(/fips-(dkr-|prod-)?|-fips/, "") : region, "getRealRegion"); - -// src/regionConfig/resolveRegionConfig.ts -var resolveRegionConfig = /* @__PURE__ */ __name((input) => { - const { region, useFipsEndpoint } = input; - if (!region) { - throw new Error("Region is missing"); - } - return Object.assign(input, { - region: /* @__PURE__ */ __name(async () => { - if (typeof region === "string") { - return getRealRegion(region); - } - const providedRegion = await region(); - return getRealRegion(providedRegion); - }, "region"), - useFipsEndpoint: /* @__PURE__ */ __name(async () => { - const providedRegion = typeof region === "string" ? region : await region(); - if (isFipsRegion(providedRegion)) { - return true; - } - return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); - }, "useFipsEndpoint") - }); -}, "resolveRegionConfig"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 5433: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; - -var __create = Object.create; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - fromEnvSigningName: () => fromEnvSigningName, - fromSso: () => fromSso, - fromStatic: () => fromStatic, - nodeProvider: () => nodeProvider -}); -module.exports = __toCommonJS(index_exports); - -// src/fromEnvSigningName.ts -var import_client = __nccwpck_require__(5152); -var import_httpAuthSchemes = __nccwpck_require__(7523); -var import_property_provider = __nccwpck_require__(1238); -var fromEnvSigningName = /* @__PURE__ */ __name(({ logger, signingName } = {}) => async () => { - logger?.debug?.("@aws-sdk/token-providers - fromEnvSigningName"); - if (!signingName) { - throw new import_property_provider.TokenProviderError("Please pass 'signingName' to compute environment variable key", { logger }); - } - const bearerTokenKey = (0, import_httpAuthSchemes.getBearerTokenEnvKey)(signingName); - if (!(bearerTokenKey in process.env)) { - throw new import_property_provider.TokenProviderError(`Token not present in '${bearerTokenKey}' environment variable`, { logger }); - } - const token = { token: process.env[bearerTokenKey] }; - (0, import_client.setTokenFeature)(token, "BEARER_SERVICE_ENV_VARS", "3"); - return token; -}, "fromEnvSigningName"); - -// src/fromSso.ts - - - -// src/constants.ts -var EXPIRE_WINDOW_MS = 5 * 60 * 1e3; -var REFRESH_MESSAGE = `To refresh this SSO session run 'aws sso login' with the corresponding profile.`; - -// src/getSsoOidcClient.ts -var getSsoOidcClient = /* @__PURE__ */ __name(async (ssoRegion, init = {}) => { - const { SSOOIDCClient } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(9443))); - const ssoOidcClient = new SSOOIDCClient( - Object.assign({}, init.clientConfig ?? {}, { - region: ssoRegion ?? init.clientConfig?.region, - logger: init.clientConfig?.logger ?? init.parentClientConfig?.logger - }) - ); - return ssoOidcClient; -}, "getSsoOidcClient"); - -// src/getNewSsoOidcToken.ts -var getNewSsoOidcToken = /* @__PURE__ */ __name(async (ssoToken, ssoRegion, init = {}) => { - const { CreateTokenCommand } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(9443))); - const ssoOidcClient = await getSsoOidcClient(ssoRegion, init); - return ssoOidcClient.send( - new CreateTokenCommand({ - clientId: ssoToken.clientId, - clientSecret: ssoToken.clientSecret, - refreshToken: ssoToken.refreshToken, - grantType: "refresh_token" - }) - ); -}, "getNewSsoOidcToken"); - -// src/validateTokenExpiry.ts - -var validateTokenExpiry = /* @__PURE__ */ __name((token) => { - if (token.expiration && token.expiration.getTime() < Date.now()) { - throw new import_property_provider.TokenProviderError(`Token is expired. ${REFRESH_MESSAGE}`, false); - } -}, "validateTokenExpiry"); - -// src/validateTokenKey.ts - -var validateTokenKey = /* @__PURE__ */ __name((key, value, forRefresh = false) => { - if (typeof value === "undefined") { - throw new import_property_provider.TokenProviderError( - `Value not present for '${key}' in SSO Token${forRefresh ? ". Cannot refresh" : ""}. ${REFRESH_MESSAGE}`, - false - ); - } -}, "validateTokenKey"); - -// src/writeSSOTokenToFile.ts -var import_shared_ini_file_loader = __nccwpck_require__(4964); -var import_fs = __nccwpck_require__(9896); -var { writeFile } = import_fs.promises; -var writeSSOTokenToFile = /* @__PURE__ */ __name((id, ssoToken) => { - const tokenFilepath = (0, import_shared_ini_file_loader.getSSOTokenFilepath)(id); - const tokenString = JSON.stringify(ssoToken, null, 2); - return writeFile(tokenFilepath, tokenString); -}, "writeSSOTokenToFile"); - -// src/fromSso.ts -var lastRefreshAttemptTime = /* @__PURE__ */ new Date(0); -var fromSso = /* @__PURE__ */ __name((_init = {}) => async ({ callerClientConfig } = {}) => { - const init = { - ..._init, - parentClientConfig: { - ...callerClientConfig, - ..._init.parentClientConfig - } - }; - init.logger?.debug("@aws-sdk/token-providers - fromSso"); - const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); - const profileName = (0, import_shared_ini_file_loader.getProfileName)({ - profile: init.profile ?? callerClientConfig?.profile - }); - const profile = profiles[profileName]; - if (!profile) { - throw new import_property_provider.TokenProviderError(`Profile '${profileName}' could not be found in shared credentials file.`, false); - } else if (!profile["sso_session"]) { - throw new import_property_provider.TokenProviderError(`Profile '${profileName}' is missing required property 'sso_session'.`); - } - const ssoSessionName = profile["sso_session"]; - const ssoSessions = await (0, import_shared_ini_file_loader.loadSsoSessionData)(init); - const ssoSession = ssoSessions[ssoSessionName]; - if (!ssoSession) { - throw new import_property_provider.TokenProviderError( - `Sso session '${ssoSessionName}' could not be found in shared credentials file.`, - false - ); - } - for (const ssoSessionRequiredKey of ["sso_start_url", "sso_region"]) { - if (!ssoSession[ssoSessionRequiredKey]) { - throw new import_property_provider.TokenProviderError( - `Sso session '${ssoSessionName}' is missing required property '${ssoSessionRequiredKey}'.`, - false - ); - } - } - const ssoStartUrl = ssoSession["sso_start_url"]; - const ssoRegion = ssoSession["sso_region"]; - let ssoToken; - try { - ssoToken = await (0, import_shared_ini_file_loader.getSSOTokenFromFile)(ssoSessionName); - } catch (e) { - throw new import_property_provider.TokenProviderError( - `The SSO session token associated with profile=${profileName} was not found or is invalid. ${REFRESH_MESSAGE}`, - false - ); - } - validateTokenKey("accessToken", ssoToken.accessToken); - validateTokenKey("expiresAt", ssoToken.expiresAt); - const { accessToken, expiresAt } = ssoToken; - const existingToken = { token: accessToken, expiration: new Date(expiresAt) }; - if (existingToken.expiration.getTime() - Date.now() > EXPIRE_WINDOW_MS) { - return existingToken; - } - if (Date.now() - lastRefreshAttemptTime.getTime() < 30 * 1e3) { - validateTokenExpiry(existingToken); - return existingToken; - } - validateTokenKey("clientId", ssoToken.clientId, true); - validateTokenKey("clientSecret", ssoToken.clientSecret, true); - validateTokenKey("refreshToken", ssoToken.refreshToken, true); - try { - lastRefreshAttemptTime.setTime(Date.now()); - const newSsoOidcToken = await getNewSsoOidcToken(ssoToken, ssoRegion, init); - validateTokenKey("accessToken", newSsoOidcToken.accessToken); - validateTokenKey("expiresIn", newSsoOidcToken.expiresIn); - const newTokenExpiration = new Date(Date.now() + newSsoOidcToken.expiresIn * 1e3); - try { - await writeSSOTokenToFile(ssoSessionName, { - ...ssoToken, - accessToken: newSsoOidcToken.accessToken, - expiresAt: newTokenExpiration.toISOString(), - refreshToken: newSsoOidcToken.refreshToken - }); - } catch (error) { - } - return { - token: newSsoOidcToken.accessToken, - expiration: newTokenExpiration - }; - } catch (error) { - validateTokenExpiry(existingToken); - return existingToken; - } -}, "fromSso"); - -// src/fromStatic.ts - -var fromStatic = /* @__PURE__ */ __name(({ token, logger }) => async () => { - logger?.debug("@aws-sdk/token-providers - fromStatic"); - if (!token || !token.token) { - throw new import_property_provider.TokenProviderError(`Please pass a valid token to fromStatic`, false); - } - return token; -}, "fromStatic"); - -// src/nodeProvider.ts - -var nodeProvider = /* @__PURE__ */ __name((init = {}) => (0, import_property_provider.memoize)( - (0, import_property_provider.chain)(fromSso(init), async () => { - throw new import_property_provider.TokenProviderError("Could not load token from any providers", false); - }), - (token) => token.expiration !== void 0 && token.expiration.getTime() - Date.now() < 3e5, - (token) => token.expiration !== void 0 -), "nodeProvider"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 3068: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - ConditionObject: () => import_util_endpoints.ConditionObject, - DeprecatedObject: () => import_util_endpoints.DeprecatedObject, - EndpointError: () => import_util_endpoints.EndpointError, - EndpointObject: () => import_util_endpoints.EndpointObject, - EndpointObjectHeaders: () => import_util_endpoints.EndpointObjectHeaders, - EndpointObjectProperties: () => import_util_endpoints.EndpointObjectProperties, - EndpointParams: () => import_util_endpoints.EndpointParams, - EndpointResolverOptions: () => import_util_endpoints.EndpointResolverOptions, - EndpointRuleObject: () => import_util_endpoints.EndpointRuleObject, - ErrorRuleObject: () => import_util_endpoints.ErrorRuleObject, - EvaluateOptions: () => import_util_endpoints.EvaluateOptions, - Expression: () => import_util_endpoints.Expression, - FunctionArgv: () => import_util_endpoints.FunctionArgv, - FunctionObject: () => import_util_endpoints.FunctionObject, - FunctionReturn: () => import_util_endpoints.FunctionReturn, - ParameterObject: () => import_util_endpoints.ParameterObject, - ReferenceObject: () => import_util_endpoints.ReferenceObject, - ReferenceRecord: () => import_util_endpoints.ReferenceRecord, - RuleSetObject: () => import_util_endpoints.RuleSetObject, - RuleSetRules: () => import_util_endpoints.RuleSetRules, - TreeRuleObject: () => import_util_endpoints.TreeRuleObject, - awsEndpointFunctions: () => awsEndpointFunctions, - getUserAgentPrefix: () => getUserAgentPrefix, - isIpAddress: () => import_util_endpoints.isIpAddress, - partition: () => partition, - resolveDefaultAwsRegionalEndpointsConfig: () => resolveDefaultAwsRegionalEndpointsConfig, - resolveEndpoint: () => import_util_endpoints.resolveEndpoint, - setPartitionInfo: () => setPartitionInfo, - toEndpointV1: () => toEndpointV1, - useDefaultPartitionInfo: () => useDefaultPartitionInfo -}); -module.exports = __toCommonJS(index_exports); - -// src/aws.ts - - -// src/lib/aws/isVirtualHostableS3Bucket.ts - - -// src/lib/isIpAddress.ts -var import_util_endpoints = __nccwpck_require__(9674); - -// src/lib/aws/isVirtualHostableS3Bucket.ts -var isVirtualHostableS3Bucket = /* @__PURE__ */ __name((value, allowSubDomains = false) => { - if (allowSubDomains) { - for (const label of value.split(".")) { - if (!isVirtualHostableS3Bucket(label)) { - return false; - } - } - return true; - } - if (!(0, import_util_endpoints.isValidHostLabel)(value)) { - return false; - } - if (value.length < 3 || value.length > 63) { - return false; - } - if (value !== value.toLowerCase()) { - return false; - } - if ((0, import_util_endpoints.isIpAddress)(value)) { - return false; - } - return true; -}, "isVirtualHostableS3Bucket"); - -// src/lib/aws/parseArn.ts -var ARN_DELIMITER = ":"; -var RESOURCE_DELIMITER = "/"; -var parseArn = /* @__PURE__ */ __name((value) => { - const segments = value.split(ARN_DELIMITER); - if (segments.length < 6) return null; - const [arn, partition2, service, region, accountId, ...resourcePath] = segments; - if (arn !== "arn" || partition2 === "" || service === "" || resourcePath.join(ARN_DELIMITER) === "") return null; - const resourceId = resourcePath.map((resource) => resource.split(RESOURCE_DELIMITER)).flat(); - return { - partition: partition2, - service, - region, - accountId, - resourceId - }; -}, "parseArn"); - -// src/lib/aws/partitions.json -var partitions_default = { - partitions: [{ - id: "aws", - outputs: { - dnsSuffix: "amazonaws.com", - dualStackDnsSuffix: "api.aws", - implicitGlobalRegion: "us-east-1", - name: "aws", - supportsDualStack: true, - supportsFIPS: true - }, - regionRegex: "^(us|eu|ap|sa|ca|me|af|il|mx)\\-\\w+\\-\\d+$", - regions: { - "af-south-1": { - description: "Africa (Cape Town)" - }, - "ap-east-1": { - description: "Asia Pacific (Hong Kong)" - }, - "ap-east-2": { - description: "Asia Pacific (Taipei)" - }, - "ap-northeast-1": { - description: "Asia Pacific (Tokyo)" - }, - "ap-northeast-2": { - description: "Asia Pacific (Seoul)" - }, - "ap-northeast-3": { - description: "Asia Pacific (Osaka)" - }, - "ap-south-1": { - description: "Asia Pacific (Mumbai)" - }, - "ap-south-2": { - description: "Asia Pacific (Hyderabad)" - }, - "ap-southeast-1": { - description: "Asia Pacific (Singapore)" - }, - "ap-southeast-2": { - description: "Asia Pacific (Sydney)" - }, - "ap-southeast-3": { - description: "Asia Pacific (Jakarta)" - }, - "ap-southeast-4": { - description: "Asia Pacific (Melbourne)" - }, - "ap-southeast-5": { - description: "Asia Pacific (Malaysia)" - }, - "ap-southeast-6": { - description: "Asia Pacific (New Zealand)" - }, - "ap-southeast-7": { - description: "Asia Pacific (Thailand)" - }, - "aws-global": { - description: "aws global region" - }, - "ca-central-1": { - description: "Canada (Central)" - }, - "ca-west-1": { - description: "Canada West (Calgary)" - }, - "eu-central-1": { - description: "Europe (Frankfurt)" - }, - "eu-central-2": { - description: "Europe (Zurich)" - }, - "eu-north-1": { - description: "Europe (Stockholm)" - }, - "eu-south-1": { - description: "Europe (Milan)" - }, - "eu-south-2": { - description: "Europe (Spain)" - }, - "eu-west-1": { - description: "Europe (Ireland)" - }, - "eu-west-2": { - description: "Europe (London)" - }, - "eu-west-3": { - description: "Europe (Paris)" - }, - "il-central-1": { - description: "Israel (Tel Aviv)" - }, - "me-central-1": { - description: "Middle East (UAE)" - }, - "me-south-1": { - description: "Middle East (Bahrain)" - }, - "mx-central-1": { - description: "Mexico (Central)" - }, - "sa-east-1": { - description: "South America (Sao Paulo)" - }, - "us-east-1": { - description: "US East (N. Virginia)" - }, - "us-east-2": { - description: "US East (Ohio)" - }, - "us-west-1": { - description: "US West (N. California)" - }, - "us-west-2": { - description: "US West (Oregon)" - } - } - }, { - id: "aws-cn", - outputs: { - dnsSuffix: "amazonaws.com.cn", - dualStackDnsSuffix: "api.amazonwebservices.com.cn", - implicitGlobalRegion: "cn-northwest-1", - name: "aws-cn", - supportsDualStack: true, - supportsFIPS: true - }, - regionRegex: "^cn\\-\\w+\\-\\d+$", - regions: { - "aws-cn-global": { - description: "aws-cn global region" - }, - "cn-north-1": { - description: "China (Beijing)" - }, - "cn-northwest-1": { - description: "China (Ningxia)" - } - } - }, { - id: "aws-eusc", - outputs: { - dnsSuffix: "amazonaws.eu", - dualStackDnsSuffix: "api.amazonwebservices.eu", - implicitGlobalRegion: "eusc-de-east-1", - name: "aws-eusc", - supportsDualStack: true, - supportsFIPS: true - }, - regionRegex: "^eusc\\-(de)\\-\\w+\\-\\d+$", - regions: { - "eusc-de-east-1": { - description: "EU (Germany)" - } - } - }, { - id: "aws-iso", - outputs: { - dnsSuffix: "c2s.ic.gov", - dualStackDnsSuffix: "api.aws.ic.gov", - implicitGlobalRegion: "us-iso-east-1", - name: "aws-iso", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^us\\-iso\\-\\w+\\-\\d+$", - regions: { - "aws-iso-global": { - description: "aws-iso global region" - }, - "us-iso-east-1": { - description: "US ISO East" - }, - "us-iso-west-1": { - description: "US ISO WEST" - } - } - }, { - id: "aws-iso-b", - outputs: { - dnsSuffix: "sc2s.sgov.gov", - dualStackDnsSuffix: "api.aws.scloud", - implicitGlobalRegion: "us-isob-east-1", - name: "aws-iso-b", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^us\\-isob\\-\\w+\\-\\d+$", - regions: { - "aws-iso-b-global": { - description: "aws-iso-b global region" - }, - "us-isob-east-1": { - description: "US ISOB East (Ohio)" - } - } - }, { - id: "aws-iso-e", - outputs: { - dnsSuffix: "cloud.adc-e.uk", - dualStackDnsSuffix: "api.cloud-aws.adc-e.uk", - implicitGlobalRegion: "eu-isoe-west-1", - name: "aws-iso-e", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^eu\\-isoe\\-\\w+\\-\\d+$", - regions: { - "aws-iso-e-global": { - description: "aws-iso-e global region" - }, - "eu-isoe-west-1": { - description: "EU ISOE West" - } - } - }, { - id: "aws-iso-f", - outputs: { - dnsSuffix: "csp.hci.ic.gov", - dualStackDnsSuffix: "api.aws.hci.ic.gov", - implicitGlobalRegion: "us-isof-south-1", - name: "aws-iso-f", - supportsDualStack: false, - supportsFIPS: true - }, - regionRegex: "^us\\-isof\\-\\w+\\-\\d+$", - regions: { - "aws-iso-f-global": { - description: "aws-iso-f global region" - }, - "us-isof-east-1": { - description: "US ISOF EAST" - }, - "us-isof-south-1": { - description: "US ISOF SOUTH" - } - } - }, { - id: "aws-us-gov", - outputs: { - dnsSuffix: "amazonaws.com", - dualStackDnsSuffix: "api.aws", - implicitGlobalRegion: "us-gov-west-1", - name: "aws-us-gov", - supportsDualStack: true, - supportsFIPS: true - }, - regionRegex: "^us\\-gov\\-\\w+\\-\\d+$", - regions: { - "aws-us-gov-global": { - description: "aws-us-gov global region" - }, - "us-gov-east-1": { - description: "AWS GovCloud (US-East)" - }, - "us-gov-west-1": { - description: "AWS GovCloud (US-West)" - } - } - }], - version: "1.1" -}; - -// src/lib/aws/partition.ts -var selectedPartitionsInfo = partitions_default; -var selectedUserAgentPrefix = ""; -var partition = /* @__PURE__ */ __name((value) => { - const { partitions } = selectedPartitionsInfo; - for (const partition2 of partitions) { - const { regions, outputs } = partition2; - for (const [region, regionData] of Object.entries(regions)) { - if (region === value) { - return { - ...outputs, - ...regionData - }; - } - } - } - for (const partition2 of partitions) { - const { regionRegex, outputs } = partition2; - if (new RegExp(regionRegex).test(value)) { - return { - ...outputs - }; - } - } - const DEFAULT_PARTITION = partitions.find((partition2) => partition2.id === "aws"); - if (!DEFAULT_PARTITION) { - throw new Error( - "Provided region was not found in the partition array or regex, and default partition with id 'aws' doesn't exist." - ); - } - return { - ...DEFAULT_PARTITION.outputs - }; -}, "partition"); -var setPartitionInfo = /* @__PURE__ */ __name((partitionsInfo, userAgentPrefix = "") => { - selectedPartitionsInfo = partitionsInfo; - selectedUserAgentPrefix = userAgentPrefix; -}, "setPartitionInfo"); -var useDefaultPartitionInfo = /* @__PURE__ */ __name(() => { - setPartitionInfo(partitions_default, ""); -}, "useDefaultPartitionInfo"); -var getUserAgentPrefix = /* @__PURE__ */ __name(() => selectedUserAgentPrefix, "getUserAgentPrefix"); - -// src/aws.ts -var awsEndpointFunctions = { - isVirtualHostableS3Bucket, - parseArn, - partition -}; -import_util_endpoints.customEndpointFunctions.aws = awsEndpointFunctions; - -// src/resolveDefaultAwsRegionalEndpointsConfig.ts -var import_url_parser = __nccwpck_require__(4494); -var resolveDefaultAwsRegionalEndpointsConfig = /* @__PURE__ */ __name((input) => { - if (typeof input.endpointProvider !== "function") { - throw new Error("@aws-sdk/util-endpoint - endpointProvider and endpoint missing in config for this client."); - } - const { endpoint } = input; - if (endpoint === void 0) { - input.endpoint = async () => { - return toEndpointV1( - input.endpointProvider( - { - Region: typeof input.region === "function" ? await input.region() : input.region, - UseDualStack: typeof input.useDualstackEndpoint === "function" ? await input.useDualstackEndpoint() : input.useDualstackEndpoint, - UseFIPS: typeof input.useFipsEndpoint === "function" ? await input.useFipsEndpoint() : input.useFipsEndpoint, - Endpoint: void 0 - }, - { logger: input.logger } - ) - ); - }; - } - return input; -}, "resolveDefaultAwsRegionalEndpointsConfig"); -var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => (0, import_url_parser.parseUrl)(endpoint.url), "toEndpointV1"); - -// src/resolveEndpoint.ts - - -// src/types/EndpointError.ts - - -// src/types/EndpointRuleObject.ts - - -// src/types/ErrorRuleObject.ts - - -// src/types/RuleSetObject.ts - - -// src/types/TreeRuleObject.ts - - -// src/types/shared.ts - -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 1656: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -"use strict"; - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - NODE_APP_ID_CONFIG_OPTIONS: () => NODE_APP_ID_CONFIG_OPTIONS, - UA_APP_ID_ENV_NAME: () => UA_APP_ID_ENV_NAME, - UA_APP_ID_INI_NAME: () => UA_APP_ID_INI_NAME, - createDefaultUserAgentProvider: () => createDefaultUserAgentProvider, - crtAvailability: () => crtAvailability, - defaultUserAgent: () => defaultUserAgent -}); -module.exports = __toCommonJS(index_exports); - -// src/defaultUserAgent.ts -var import_os = __nccwpck_require__(857); -var import_process = __nccwpck_require__(932); - -// src/crt-availability.ts -var crtAvailability = { - isCrtAvailable: false -}; - -// src/is-crt-available.ts -var isCrtAvailable = /* @__PURE__ */ __name(() => { - if (crtAvailability.isCrtAvailable) { - return ["md/crt-avail"]; - } - return null; -}, "isCrtAvailable"); - -// src/defaultUserAgent.ts -var createDefaultUserAgentProvider = /* @__PURE__ */ __name(({ serviceId, clientVersion }) => { - return async (config) => { - const sections = [ - // sdk-metadata - ["aws-sdk-js", clientVersion], - // ua-metadata - ["ua", "2.1"], - // os-metadata - [`os/${(0, import_os.platform)()}`, (0, import_os.release)()], - // language-metadata - // ECMAScript edition doesn't matter in JS, so no version needed. - ["lang/js"], - ["md/nodejs", `${import_process.versions.node}`] - ]; - const crtAvailable = isCrtAvailable(); - if (crtAvailable) { - sections.push(crtAvailable); - } - if (serviceId) { - sections.push([`api/${serviceId}`, clientVersion]); - } - if (import_process.env.AWS_EXECUTION_ENV) { - sections.push([`exec-env/${import_process.env.AWS_EXECUTION_ENV}`]); - } - const appId = await config?.userAgentAppId?.(); - const resolvedUserAgent = appId ? [...sections, [`app/${appId}`]] : [...sections]; - return resolvedUserAgent; - }; -}, "createDefaultUserAgentProvider"); -var defaultUserAgent = createDefaultUserAgentProvider; - -// src/nodeAppIdConfigOptions.ts -var import_middleware_user_agent = __nccwpck_require__(2959); -var UA_APP_ID_ENV_NAME = "AWS_SDK_UA_APP_ID"; -var UA_APP_ID_INI_NAME = "sdk_ua_app_id"; -var UA_APP_ID_INI_NAME_DEPRECATED = "sdk-ua-app-id"; -var NODE_APP_ID_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env2) => env2[UA_APP_ID_ENV_NAME], "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => profile[UA_APP_ID_INI_NAME] ?? profile[UA_APP_ID_INI_NAME_DEPRECATED], "configFileSelector"), - default: import_middleware_user_agent.DEFAULT_UA_APP_ID -}; -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 4274: -/***/ ((module) => { - -"use strict"; - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - XmlNode: () => XmlNode, - XmlText: () => XmlText -}); -module.exports = __toCommonJS(index_exports); - -// src/escape-attribute.ts -function escapeAttribute(value) { - return value.replace(/&/g, "&").replace(//g, ">").replace(/"/g, """); -} -__name(escapeAttribute, "escapeAttribute"); - -// src/escape-element.ts -function escapeElement(value) { - return value.replace(/&/g, "&").replace(/"/g, """).replace(/'/g, "'").replace(//g, ">").replace(/\r/g, " ").replace(/\n/g, " ").replace(/\u0085/g, "…").replace(/\u2028/, "
"); -} -__name(escapeElement, "escapeElement"); - -// src/XmlText.ts -var XmlText = class { - constructor(value) { - this.value = value; - } - static { - __name(this, "XmlText"); - } - toString() { - return escapeElement("" + this.value); - } -}; - -// src/XmlNode.ts -var XmlNode = class _XmlNode { - constructor(name, children = []) { - this.name = name; - this.children = children; - } - static { - __name(this, "XmlNode"); - } - attributes = {}; - static of(name, childText, withName) { - const node = new _XmlNode(name); - if (childText !== void 0) { - node.addChildNode(new XmlText(childText)); - } - if (withName !== void 0) { - node.withName(withName); - } - return node; - } - withName(name) { - this.name = name; - return this; - } - addAttribute(name, value) { - this.attributes[name] = value; - return this; - } - addChildNode(child) { - this.children.push(child); - return this; - } - removeAttribute(name) { - delete this.attributes[name]; - return this; - } - /** - * @internal - * Alias of {@link XmlNode#withName(string)} for codegen brevity. - */ - n(name) { - this.name = name; - return this; - } - /** - * @internal - * Alias of {@link XmlNode#addChildNode(string)} for codegen brevity. - */ - c(child) { - this.children.push(child); - return this; - } - /** - * @internal - * Checked version of {@link XmlNode#addAttribute(string)} for codegen brevity. - */ - a(name, value) { - if (value != null) { - this.attributes[name] = value; - } - return this; - } - /** - * Create a child node. - * Used in serialization of string fields. - * @internal - */ - cc(input, field, withName = field) { - if (input[field] != null) { - const node = _XmlNode.of(field, input[field]).withName(withName); - this.c(node); - } - } - /** - * Creates list child nodes. - * @internal - */ - l(input, listName, memberName, valueProvider) { - if (input[listName] != null) { - const nodes = valueProvider(); - nodes.map((node) => { - node.withName(memberName); - this.c(node); - }); - } - } - /** - * Creates list child nodes with container. - * @internal - */ - lc(input, listName, memberName, valueProvider) { - if (input[listName] != null) { - const nodes = valueProvider(); - const containerNode = new _XmlNode(memberName); - nodes.map((node) => { - containerNode.c(node); - }); - this.c(containerNode); - } - } - toString() { - const hasChildren = Boolean(this.children.length); - let xmlText = `<${this.name}`; - const attributes = this.attributes; - for (const attributeName of Object.keys(attributes)) { - const attribute = attributes[attributeName]; - if (attribute != null) { - xmlText += ` ${attributeName}="${escapeAttribute("" + attribute)}"`; - } - } - return xmlText += !hasChildren ? "/>" : `>${this.children.map((c) => c.toString()).join("")}`; - } -}; -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 7453: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.InvokeStore = void 0; -const async_hooks_1 = __nccwpck_require__(290); -// AWS_LAMBDA_NODEJS_NO_GLOBAL_AWSLAMBDA provides an escape hatch since we're modifying the global object which may not be expected to a customer's handler. -const noGlobalAwsLambda = process.env["AWS_LAMBDA_NODEJS_NO_GLOBAL_AWSLAMBDA"] === "1" || - process.env["AWS_LAMBDA_NODEJS_NO_GLOBAL_AWSLAMBDA"] === "true"; -if (!noGlobalAwsLambda) { - globalThis.awslambda = globalThis.awslambda || {}; -} -const PROTECTED_KEYS = { - REQUEST_ID: Symbol("_AWS_LAMBDA_REQUEST_ID"), - X_RAY_TRACE_ID: Symbol("_AWS_LAMBDA_X_RAY_TRACE_ID"), -}; -/** - * InvokeStore implementation class - */ -class InvokeStoreImpl { - static storage = new async_hooks_1.AsyncLocalStorage(); - // Protected keys for Lambda context fields - static PROTECTED_KEYS = PROTECTED_KEYS; - /** - * Initialize and run code within an invoke context - */ - static run(context, fn) { - return this.storage.run({ ...context }, fn); - } - /** - * Get the complete current context - */ - static getContext() { - return this.storage.getStore(); - } - /** - * Get a specific value from the context by key - */ - static get(key) { - const context = this.storage.getStore(); - return context?.[key]; - } - /** - * Set a custom value in the current context - * Protected Lambda context fields cannot be overwritten - */ - static set(key, value) { - if (this.isProtectedKey(key)) { - throw new Error(`Cannot modify protected Lambda context field`); - } - const context = this.storage.getStore(); - if (context) { - context[key] = value; - } - } - /** - * Get the current request ID - */ - static getRequestId() { - return this.get(this.PROTECTED_KEYS.REQUEST_ID) ?? "-"; - } - /** - * Get the current X-ray trace ID - */ - static getXRayTraceId() { - return this.get(this.PROTECTED_KEYS.X_RAY_TRACE_ID); - } - /** - * Check if we're currently within an invoke context - */ - static hasContext() { - return this.storage.getStore() !== undefined; - } - /** - * Check if a key is protected (readonly Lambda context field) - */ - static isProtectedKey(key) { - return (key === this.PROTECTED_KEYS.REQUEST_ID || - key === this.PROTECTED_KEYS.X_RAY_TRACE_ID); - } -} -let instance; -if (!noGlobalAwsLambda && globalThis.awslambda?.InvokeStore) { - instance = globalThis.awslambda.InvokeStore; -} -else { - instance = InvokeStoreImpl; - if (!noGlobalAwsLambda && globalThis.awslambda) { - globalThis.awslambda.InvokeStore = instance; - } -} -exports.InvokeStore = instance; - - -/***/ }), - -/***/ 9316: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - CONFIG_USE_DUALSTACK_ENDPOINT: () => CONFIG_USE_DUALSTACK_ENDPOINT, - CONFIG_USE_FIPS_ENDPOINT: () => CONFIG_USE_FIPS_ENDPOINT, - DEFAULT_USE_DUALSTACK_ENDPOINT: () => DEFAULT_USE_DUALSTACK_ENDPOINT, - DEFAULT_USE_FIPS_ENDPOINT: () => DEFAULT_USE_FIPS_ENDPOINT, - ENV_USE_DUALSTACK_ENDPOINT: () => ENV_USE_DUALSTACK_ENDPOINT, - ENV_USE_FIPS_ENDPOINT: () => ENV_USE_FIPS_ENDPOINT, - NODE_REGION_CONFIG_FILE_OPTIONS: () => NODE_REGION_CONFIG_FILE_OPTIONS, - NODE_REGION_CONFIG_OPTIONS: () => NODE_REGION_CONFIG_OPTIONS, - NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS: () => NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, - NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS: () => NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, - REGION_ENV_NAME: () => REGION_ENV_NAME, - REGION_INI_NAME: () => REGION_INI_NAME, - getRegionInfo: () => getRegionInfo, - resolveCustomEndpointsConfig: () => resolveCustomEndpointsConfig, - resolveEndpointsConfig: () => resolveEndpointsConfig, - resolveRegionConfig: () => resolveRegionConfig -}); -module.exports = __toCommonJS(index_exports); - -// src/endpointsConfig/NodeUseDualstackEndpointConfigOptions.ts -var import_util_config_provider = __nccwpck_require__(6716); -var ENV_USE_DUALSTACK_ENDPOINT = "AWS_USE_DUALSTACK_ENDPOINT"; -var CONFIG_USE_DUALSTACK_ENDPOINT = "use_dualstack_endpoint"; -var DEFAULT_USE_DUALSTACK_ENDPOINT = false; -var NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env) => (0, import_util_config_provider.booleanSelector)(env, ENV_USE_DUALSTACK_ENDPOINT, import_util_config_provider.SelectorType.ENV), "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => (0, import_util_config_provider.booleanSelector)(profile, CONFIG_USE_DUALSTACK_ENDPOINT, import_util_config_provider.SelectorType.CONFIG), "configFileSelector"), - default: false -}; - -// src/endpointsConfig/NodeUseFipsEndpointConfigOptions.ts - -var ENV_USE_FIPS_ENDPOINT = "AWS_USE_FIPS_ENDPOINT"; -var CONFIG_USE_FIPS_ENDPOINT = "use_fips_endpoint"; -var DEFAULT_USE_FIPS_ENDPOINT = false; -var NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env) => (0, import_util_config_provider.booleanSelector)(env, ENV_USE_FIPS_ENDPOINT, import_util_config_provider.SelectorType.ENV), "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => (0, import_util_config_provider.booleanSelector)(profile, CONFIG_USE_FIPS_ENDPOINT, import_util_config_provider.SelectorType.CONFIG), "configFileSelector"), - default: false -}; - -// src/endpointsConfig/resolveCustomEndpointsConfig.ts -var import_util_middleware = __nccwpck_require__(6324); -var resolveCustomEndpointsConfig = /* @__PURE__ */ __name((input) => { - const { tls, endpoint, urlParser, useDualstackEndpoint } = input; - return Object.assign(input, { - tls: tls ?? true, - endpoint: (0, import_util_middleware.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint), - isCustomEndpoint: true, - useDualstackEndpoint: (0, import_util_middleware.normalizeProvider)(useDualstackEndpoint ?? false) - }); -}, "resolveCustomEndpointsConfig"); - -// src/endpointsConfig/resolveEndpointsConfig.ts - - -// src/endpointsConfig/utils/getEndpointFromRegion.ts -var getEndpointFromRegion = /* @__PURE__ */ __name(async (input) => { - const { tls = true } = input; - const region = await input.region(); - const dnsHostRegex = new RegExp(/^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9-]{0,61}[a-zA-Z0-9])$/); - if (!dnsHostRegex.test(region)) { - throw new Error("Invalid region in client config"); - } - const useDualstackEndpoint = await input.useDualstackEndpoint(); - const useFipsEndpoint = await input.useFipsEndpoint(); - const { hostname } = await input.regionInfoProvider(region, { useDualstackEndpoint, useFipsEndpoint }) ?? {}; - if (!hostname) { - throw new Error("Cannot resolve hostname from client config"); - } - return input.urlParser(`${tls ? "https:" : "http:"}//${hostname}`); -}, "getEndpointFromRegion"); - -// src/endpointsConfig/resolveEndpointsConfig.ts -var resolveEndpointsConfig = /* @__PURE__ */ __name((input) => { - const useDualstackEndpoint = (0, import_util_middleware.normalizeProvider)(input.useDualstackEndpoint ?? false); - const { endpoint, useFipsEndpoint, urlParser, tls } = input; - return Object.assign(input, { - tls: tls ?? true, - endpoint: endpoint ? (0, import_util_middleware.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint) : () => getEndpointFromRegion({ ...input, useDualstackEndpoint, useFipsEndpoint }), - isCustomEndpoint: !!endpoint, - useDualstackEndpoint - }); -}, "resolveEndpointsConfig"); - -// src/regionConfig/config.ts -var REGION_ENV_NAME = "AWS_REGION"; -var REGION_INI_NAME = "region"; -var NODE_REGION_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env) => env[REGION_ENV_NAME], "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => profile[REGION_INI_NAME], "configFileSelector"), - default: /* @__PURE__ */ __name(() => { - throw new Error("Region is missing"); - }, "default") -}; -var NODE_REGION_CONFIG_FILE_OPTIONS = { - preferredFile: "credentials" -}; - -// src/regionConfig/isFipsRegion.ts -var isFipsRegion = /* @__PURE__ */ __name((region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")), "isFipsRegion"); - -// src/regionConfig/getRealRegion.ts -var getRealRegion = /* @__PURE__ */ __name((region) => isFipsRegion(region) ? ["fips-aws-global", "aws-fips"].includes(region) ? "us-east-1" : region.replace(/fips-(dkr-|prod-)?|-fips/, "") : region, "getRealRegion"); - -// src/regionConfig/resolveRegionConfig.ts -var resolveRegionConfig = /* @__PURE__ */ __name((input) => { - const { region, useFipsEndpoint } = input; - if (!region) { - throw new Error("Region is missing"); - } - return Object.assign(input, { - region: /* @__PURE__ */ __name(async () => { - if (typeof region === "string") { - return getRealRegion(region); - } - const providedRegion = await region(); - return getRealRegion(providedRegion); - }, "region"), - useFipsEndpoint: /* @__PURE__ */ __name(async () => { - const providedRegion = typeof region === "string" ? region : await region(); - if (isFipsRegion(providedRegion)) { - return true; - } - return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); - }, "useFipsEndpoint") - }); -}, "resolveRegionConfig"); - -// src/regionInfo/getHostnameFromVariants.ts -var getHostnameFromVariants = /* @__PURE__ */ __name((variants = [], { useFipsEndpoint, useDualstackEndpoint }) => variants.find( - ({ tags }) => useFipsEndpoint === tags.includes("fips") && useDualstackEndpoint === tags.includes("dualstack") -)?.hostname, "getHostnameFromVariants"); - -// src/regionInfo/getResolvedHostname.ts -var getResolvedHostname = /* @__PURE__ */ __name((resolvedRegion, { regionHostname, partitionHostname }) => regionHostname ? regionHostname : partitionHostname ? partitionHostname.replace("{region}", resolvedRegion) : void 0, "getResolvedHostname"); - -// src/regionInfo/getResolvedPartition.ts -var getResolvedPartition = /* @__PURE__ */ __name((region, { partitionHash }) => Object.keys(partitionHash || {}).find((key) => partitionHash[key].regions.includes(region)) ?? "aws", "getResolvedPartition"); - -// src/regionInfo/getResolvedSigningRegion.ts -var getResolvedSigningRegion = /* @__PURE__ */ __name((hostname, { signingRegion, regionRegex, useFipsEndpoint }) => { - if (signingRegion) { - return signingRegion; - } else if (useFipsEndpoint) { - const regionRegexJs = regionRegex.replace("\\\\", "\\").replace(/^\^/g, "\\.").replace(/\$$/g, "\\."); - const regionRegexmatchArray = hostname.match(regionRegexJs); - if (regionRegexmatchArray) { - return regionRegexmatchArray[0].slice(1, -1); - } - } -}, "getResolvedSigningRegion"); - -// src/regionInfo/getRegionInfo.ts -var getRegionInfo = /* @__PURE__ */ __name((region, { - useFipsEndpoint = false, - useDualstackEndpoint = false, - signingService, - regionHash, - partitionHash -}) => { - const partition = getResolvedPartition(region, { partitionHash }); - const resolvedRegion = region in regionHash ? region : partitionHash[partition]?.endpoint ?? region; - const hostnameOptions = { useFipsEndpoint, useDualstackEndpoint }; - const regionHostname = getHostnameFromVariants(regionHash[resolvedRegion]?.variants, hostnameOptions); - const partitionHostname = getHostnameFromVariants(partitionHash[partition]?.variants, hostnameOptions); - const hostname = getResolvedHostname(resolvedRegion, { regionHostname, partitionHostname }); - if (hostname === void 0) { - throw new Error(`Endpoint resolution failed for: ${{ resolvedRegion, useFipsEndpoint, useDualstackEndpoint }}`); - } - const signingRegion = getResolvedSigningRegion(hostname, { - signingRegion: regionHash[resolvedRegion]?.signingRegion, - regionRegex: partitionHash[partition].regionRegex, - useFipsEndpoint - }); - return { - partition, - signingService, - hostname, - ...signingRegion && { signingRegion }, - ...regionHash[resolvedRegion]?.signingService && { - signingService: regionHash[resolvedRegion].signingService - } - }; -}, "getRegionInfo"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 402: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - DefaultIdentityProviderConfig: () => DefaultIdentityProviderConfig, - EXPIRATION_MS: () => EXPIRATION_MS, - HttpApiKeyAuthSigner: () => HttpApiKeyAuthSigner, - HttpBearerAuthSigner: () => HttpBearerAuthSigner, - NoAuthSigner: () => NoAuthSigner, - createIsIdentityExpiredFunction: () => createIsIdentityExpiredFunction, - createPaginator: () => createPaginator, - doesIdentityRequireRefresh: () => doesIdentityRequireRefresh, - getHttpAuthSchemeEndpointRuleSetPlugin: () => getHttpAuthSchemeEndpointRuleSetPlugin, - getHttpAuthSchemePlugin: () => getHttpAuthSchemePlugin, - getHttpSigningPlugin: () => getHttpSigningPlugin, - getSmithyContext: () => getSmithyContext, - httpAuthSchemeEndpointRuleSetMiddlewareOptions: () => httpAuthSchemeEndpointRuleSetMiddlewareOptions, - httpAuthSchemeMiddleware: () => httpAuthSchemeMiddleware, - httpAuthSchemeMiddlewareOptions: () => httpAuthSchemeMiddlewareOptions, - httpSigningMiddleware: () => httpSigningMiddleware, - httpSigningMiddlewareOptions: () => httpSigningMiddlewareOptions, - isIdentityExpired: () => isIdentityExpired, - memoizeIdentityProvider: () => memoizeIdentityProvider, - normalizeProvider: () => normalizeProvider, - requestBuilder: () => import_protocols.requestBuilder, - setFeature: () => setFeature -}); -module.exports = __toCommonJS(index_exports); - -// src/getSmithyContext.ts -var import_types = __nccwpck_require__(690); -var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); - -// src/middleware-http-auth-scheme/httpAuthSchemeMiddleware.ts -var import_util_middleware = __nccwpck_require__(6324); - -// src/middleware-http-auth-scheme/resolveAuthOptions.ts -var resolveAuthOptions = /* @__PURE__ */ __name((candidateAuthOptions, authSchemePreference) => { - if (!authSchemePreference || authSchemePreference.length === 0) { - return candidateAuthOptions; - } - const preferredAuthOptions = []; - for (const preferredSchemeName of authSchemePreference) { - for (const candidateAuthOption of candidateAuthOptions) { - const candidateAuthSchemeName = candidateAuthOption.schemeId.split("#")[1]; - if (candidateAuthSchemeName === preferredSchemeName) { - preferredAuthOptions.push(candidateAuthOption); - } - } - } - for (const candidateAuthOption of candidateAuthOptions) { - if (!preferredAuthOptions.find(({ schemeId }) => schemeId === candidateAuthOption.schemeId)) { - preferredAuthOptions.push(candidateAuthOption); - } - } - return preferredAuthOptions; -}, "resolveAuthOptions"); - -// src/middleware-http-auth-scheme/httpAuthSchemeMiddleware.ts -function convertHttpAuthSchemesToMap(httpAuthSchemes) { - const map = /* @__PURE__ */ new Map(); - for (const scheme of httpAuthSchemes) { - map.set(scheme.schemeId, scheme); - } - return map; -} -__name(convertHttpAuthSchemesToMap, "convertHttpAuthSchemesToMap"); -var httpAuthSchemeMiddleware = /* @__PURE__ */ __name((config, mwOptions) => (next, context) => async (args) => { - const options = config.httpAuthSchemeProvider( - await mwOptions.httpAuthSchemeParametersProvider(config, context, args.input) - ); - const authSchemePreference = config.authSchemePreference ? await config.authSchemePreference() : []; - const resolvedOptions = resolveAuthOptions(options, authSchemePreference); - const authSchemes = convertHttpAuthSchemesToMap(config.httpAuthSchemes); - const smithyContext = (0, import_util_middleware.getSmithyContext)(context); - const failureReasons = []; - for (const option of resolvedOptions) { - const scheme = authSchemes.get(option.schemeId); - if (!scheme) { - failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` was not enabled for this service.`); - continue; - } - const identityProvider = scheme.identityProvider(await mwOptions.identityProviderConfigProvider(config)); - if (!identityProvider) { - failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` did not have an IdentityProvider configured.`); - continue; - } - const { identityProperties = {}, signingProperties = {} } = option.propertiesExtractor?.(config, context) || {}; - option.identityProperties = Object.assign(option.identityProperties || {}, identityProperties); - option.signingProperties = Object.assign(option.signingProperties || {}, signingProperties); - smithyContext.selectedHttpAuthScheme = { - httpAuthOption: option, - identity: await identityProvider(option.identityProperties), - signer: scheme.signer - }; - break; - } - if (!smithyContext.selectedHttpAuthScheme) { - throw new Error(failureReasons.join("\n")); - } - return next(args); -}, "httpAuthSchemeMiddleware"); - -// src/middleware-http-auth-scheme/getHttpAuthSchemeEndpointRuleSetPlugin.ts -var httpAuthSchemeEndpointRuleSetMiddlewareOptions = { - step: "serialize", - tags: ["HTTP_AUTH_SCHEME"], - name: "httpAuthSchemeMiddleware", - override: true, - relation: "before", - toMiddleware: "endpointV2Middleware" -}; -var getHttpAuthSchemeEndpointRuleSetPlugin = /* @__PURE__ */ __name((config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider -}) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.addRelativeTo( - httpAuthSchemeMiddleware(config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider - }), - httpAuthSchemeEndpointRuleSetMiddlewareOptions - ); - }, "applyToStack") -}), "getHttpAuthSchemeEndpointRuleSetPlugin"); - -// src/middleware-http-auth-scheme/getHttpAuthSchemePlugin.ts -var import_middleware_serde = __nccwpck_require__(3255); -var httpAuthSchemeMiddlewareOptions = { - step: "serialize", - tags: ["HTTP_AUTH_SCHEME"], - name: "httpAuthSchemeMiddleware", - override: true, - relation: "before", - toMiddleware: import_middleware_serde.serializerMiddlewareOption.name -}; -var getHttpAuthSchemePlugin = /* @__PURE__ */ __name((config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider -}) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.addRelativeTo( - httpAuthSchemeMiddleware(config, { - httpAuthSchemeParametersProvider, - identityProviderConfigProvider - }), - httpAuthSchemeMiddlewareOptions - ); - }, "applyToStack") -}), "getHttpAuthSchemePlugin"); - -// src/middleware-http-signing/httpSigningMiddleware.ts -var import_protocol_http = __nccwpck_require__(2356); - -var defaultErrorHandler = /* @__PURE__ */ __name((signingProperties) => (error) => { - throw error; -}, "defaultErrorHandler"); -var defaultSuccessHandler = /* @__PURE__ */ __name((httpResponse, signingProperties) => { -}, "defaultSuccessHandler"); -var httpSigningMiddleware = /* @__PURE__ */ __name((config) => (next, context) => async (args) => { - if (!import_protocol_http.HttpRequest.isInstance(args.request)) { - return next(args); - } - const smithyContext = (0, import_util_middleware.getSmithyContext)(context); - const scheme = smithyContext.selectedHttpAuthScheme; - if (!scheme) { - throw new Error(`No HttpAuthScheme was selected: unable to sign request`); - } - const { - httpAuthOption: { signingProperties = {} }, - identity, - signer - } = scheme; - const output = await next({ - ...args, - request: await signer.sign(args.request, identity, signingProperties) - }).catch((signer.errorHandler || defaultErrorHandler)(signingProperties)); - (signer.successHandler || defaultSuccessHandler)(output.response, signingProperties); - return output; -}, "httpSigningMiddleware"); - -// src/middleware-http-signing/getHttpSigningMiddleware.ts -var httpSigningMiddlewareOptions = { - step: "finalizeRequest", - tags: ["HTTP_SIGNING"], - name: "httpSigningMiddleware", - aliases: ["apiKeyMiddleware", "tokenMiddleware", "awsAuthMiddleware"], - override: true, - relation: "after", - toMiddleware: "retryMiddleware" -}; -var getHttpSigningPlugin = /* @__PURE__ */ __name((config) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.addRelativeTo(httpSigningMiddleware(config), httpSigningMiddlewareOptions); - }, "applyToStack") -}), "getHttpSigningPlugin"); - -// src/normalizeProvider.ts -var normalizeProvider = /* @__PURE__ */ __name((input) => { - if (typeof input === "function") return input; - const promisified = Promise.resolve(input); - return () => promisified; -}, "normalizeProvider"); - -// src/pagination/createPaginator.ts -var makePagedClientRequest = /* @__PURE__ */ __name(async (CommandCtor, client, input, withCommand = (_) => _, ...args) => { - let command = new CommandCtor(input); - command = withCommand(command) ?? command; - return await client.send(command, ...args); -}, "makePagedClientRequest"); -function createPaginator(ClientCtor, CommandCtor, inputTokenName, outputTokenName, pageSizeTokenName) { - return /* @__PURE__ */ __name(async function* paginateOperation(config, input, ...additionalArguments) { - const _input = input; - let token = config.startingToken ?? _input[inputTokenName]; - let hasNext = true; - let page; - while (hasNext) { - _input[inputTokenName] = token; - if (pageSizeTokenName) { - _input[pageSizeTokenName] = _input[pageSizeTokenName] ?? config.pageSize; - } - if (config.client instanceof ClientCtor) { - page = await makePagedClientRequest( - CommandCtor, - config.client, - input, - config.withCommand, - ...additionalArguments - ); - } else { - throw new Error(`Invalid client, expected instance of ${ClientCtor.name}`); - } - yield page; - const prevToken = token; - token = get(page, outputTokenName); - hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); - } - return void 0; - }, "paginateOperation"); -} -__name(createPaginator, "createPaginator"); -var get = /* @__PURE__ */ __name((fromObject, path) => { - let cursor = fromObject; - const pathComponents = path.split("."); - for (const step of pathComponents) { - if (!cursor || typeof cursor !== "object") { - return void 0; - } - cursor = cursor[step]; - } - return cursor; -}, "get"); - -// src/protocols/requestBuilder.ts -var import_protocols = __nccwpck_require__(3422); - -// src/setFeature.ts -function setFeature(context, feature, value) { - if (!context.__smithy_context) { - context.__smithy_context = { - features: {} - }; - } else if (!context.__smithy_context.features) { - context.__smithy_context.features = {}; - } - context.__smithy_context.features[feature] = value; -} -__name(setFeature, "setFeature"); - -// src/util-identity-and-auth/DefaultIdentityProviderConfig.ts -var DefaultIdentityProviderConfig = class { - /** - * Creates an IdentityProviderConfig with a record of scheme IDs to identity providers. - * - * @param config scheme IDs and identity providers to configure - */ - constructor(config) { - this.authSchemes = /* @__PURE__ */ new Map(); - for (const [key, value] of Object.entries(config)) { - if (value !== void 0) { - this.authSchemes.set(key, value); - } - } - } - static { - __name(this, "DefaultIdentityProviderConfig"); - } - getIdentityProvider(schemeId) { - return this.authSchemes.get(schemeId); - } -}; - -// src/util-identity-and-auth/httpAuthSchemes/httpApiKeyAuth.ts - - -var HttpApiKeyAuthSigner = class { - static { - __name(this, "HttpApiKeyAuthSigner"); - } - async sign(httpRequest, identity, signingProperties) { - if (!signingProperties) { - throw new Error( - "request could not be signed with `apiKey` since the `name` and `in` signer properties are missing" - ); - } - if (!signingProperties.name) { - throw new Error("request could not be signed with `apiKey` since the `name` signer property is missing"); - } - if (!signingProperties.in) { - throw new Error("request could not be signed with `apiKey` since the `in` signer property is missing"); - } - if (!identity.apiKey) { - throw new Error("request could not be signed with `apiKey` since the `apiKey` is not defined"); - } - const clonedRequest = import_protocol_http.HttpRequest.clone(httpRequest); - if (signingProperties.in === import_types.HttpApiKeyAuthLocation.QUERY) { - clonedRequest.query[signingProperties.name] = identity.apiKey; - } else if (signingProperties.in === import_types.HttpApiKeyAuthLocation.HEADER) { - clonedRequest.headers[signingProperties.name] = signingProperties.scheme ? `${signingProperties.scheme} ${identity.apiKey}` : identity.apiKey; - } else { - throw new Error( - "request can only be signed with `apiKey` locations `query` or `header`, but found: `" + signingProperties.in + "`" - ); - } - return clonedRequest; - } -}; - -// src/util-identity-and-auth/httpAuthSchemes/httpBearerAuth.ts - -var HttpBearerAuthSigner = class { - static { - __name(this, "HttpBearerAuthSigner"); - } - async sign(httpRequest, identity, signingProperties) { - const clonedRequest = import_protocol_http.HttpRequest.clone(httpRequest); - if (!identity.token) { - throw new Error("request could not be signed with `token` since the `token` is not defined"); - } - clonedRequest.headers["Authorization"] = `Bearer ${identity.token}`; - return clonedRequest; - } -}; - -// src/util-identity-and-auth/httpAuthSchemes/noAuth.ts -var NoAuthSigner = class { - static { - __name(this, "NoAuthSigner"); - } - async sign(httpRequest, identity, signingProperties) { - return httpRequest; - } -}; - -// src/util-identity-and-auth/memoizeIdentityProvider.ts -var createIsIdentityExpiredFunction = /* @__PURE__ */ __name((expirationMs) => (identity) => doesIdentityRequireRefresh(identity) && identity.expiration.getTime() - Date.now() < expirationMs, "createIsIdentityExpiredFunction"); -var EXPIRATION_MS = 3e5; -var isIdentityExpired = createIsIdentityExpiredFunction(EXPIRATION_MS); -var doesIdentityRequireRefresh = /* @__PURE__ */ __name((identity) => identity.expiration !== void 0, "doesIdentityRequireRefresh"); -var memoizeIdentityProvider = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { - if (provider === void 0) { - return void 0; - } - const normalizedProvider = typeof provider !== "function" ? async () => Promise.resolve(provider) : provider; - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = /* @__PURE__ */ __name(async (options) => { - if (!pending) { - pending = normalizedProvider(options); - } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } finally { - pending = void 0; - } - return resolved; - }, "coalesceProvider"); - if (isExpired === void 0) { - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(options); - } - return resolved; - }; - } - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(options); - } - if (isConstant) { - return resolved; - } - if (!requiresRefresh(resolved)) { - isConstant = true; - return resolved; - } - if (isExpired(resolved)) { - await coalesceProvider(options); - return resolved; - } - return resolved; - }; -}, "memoizeIdentityProvider"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 4645: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/submodules/cbor/index.ts -var index_exports = {}; -__export(index_exports, { - CborCodec: () => CborCodec, - CborShapeDeserializer: () => CborShapeDeserializer, - CborShapeSerializer: () => CborShapeSerializer, - SmithyRpcV2CborProtocol: () => SmithyRpcV2CborProtocol, - buildHttpRpcRequest: () => buildHttpRpcRequest, - cbor: () => cbor, - checkCborResponse: () => checkCborResponse, - dateToTag: () => dateToTag, - loadSmithyRpcV2CborErrorCode: () => loadSmithyRpcV2CborErrorCode, - parseCborBody: () => parseCborBody, - parseCborErrorBody: () => parseCborErrorBody, - tag: () => tag, - tagSymbol: () => tagSymbol -}); -module.exports = __toCommonJS(index_exports); - -// src/submodules/cbor/cbor-decode.ts -var import_serde = __nccwpck_require__(2430); -var import_util_utf8 = __nccwpck_require__(1577); - -// src/submodules/cbor/cbor-types.ts -var majorUint64 = 0; -var majorNegativeInt64 = 1; -var majorUnstructuredByteString = 2; -var majorUtf8String = 3; -var majorList = 4; -var majorMap = 5; -var majorTag = 6; -var majorSpecial = 7; -var specialFalse = 20; -var specialTrue = 21; -var specialNull = 22; -var specialUndefined = 23; -var extendedOneByte = 24; -var extendedFloat16 = 25; -var extendedFloat32 = 26; -var extendedFloat64 = 27; -var minorIndefinite = 31; -function alloc(size) { - return typeof Buffer !== "undefined" ? Buffer.alloc(size) : new Uint8Array(size); -} -var tagSymbol = Symbol("@smithy/core/cbor::tagSymbol"); -function tag(data2) { - data2[tagSymbol] = true; - return data2; -} - -// src/submodules/cbor/cbor-decode.ts -var USE_TEXT_DECODER = typeof TextDecoder !== "undefined"; -var USE_BUFFER = typeof Buffer !== "undefined"; -var payload = alloc(0); -var dataView = new DataView(payload.buffer, payload.byteOffset, payload.byteLength); -var textDecoder = USE_TEXT_DECODER ? new TextDecoder() : null; -var _offset = 0; -function setPayload(bytes) { - payload = bytes; - dataView = new DataView(payload.buffer, payload.byteOffset, payload.byteLength); -} -function decode(at, to) { - if (at >= to) { - throw new Error("unexpected end of (decode) payload."); - } - const major = (payload[at] & 224) >> 5; - const minor = payload[at] & 31; - switch (major) { - case majorUint64: - case majorNegativeInt64: - case majorTag: - let unsignedInt; - let offset; - if (minor < 24) { - unsignedInt = minor; - offset = 1; - } else { - switch (minor) { - case extendedOneByte: - case extendedFloat16: - case extendedFloat32: - case extendedFloat64: - const countLength = minorValueToArgumentLength[minor]; - const countOffset = countLength + 1; - offset = countOffset; - if (to - at < countOffset) { - throw new Error(`countLength ${countLength} greater than remaining buf len.`); - } - const countIndex = at + 1; - if (countLength === 1) { - unsignedInt = payload[countIndex]; - } else if (countLength === 2) { - unsignedInt = dataView.getUint16(countIndex); - } else if (countLength === 4) { - unsignedInt = dataView.getUint32(countIndex); - } else { - unsignedInt = dataView.getBigUint64(countIndex); - } - break; - default: - throw new Error(`unexpected minor value ${minor}.`); - } - } - if (major === majorUint64) { - _offset = offset; - return castBigInt(unsignedInt); - } else if (major === majorNegativeInt64) { - let negativeInt; - if (typeof unsignedInt === "bigint") { - negativeInt = BigInt(-1) - unsignedInt; - } else { - negativeInt = -1 - unsignedInt; - } - _offset = offset; - return castBigInt(negativeInt); - } else { - if (minor === 2 || minor === 3) { - const length = decodeCount(at + offset, to); - let b = BigInt(0); - const start = at + offset + _offset; - for (let i = start; i < start + length; ++i) { - b = b << BigInt(8) | BigInt(payload[i]); - } - _offset = offset + _offset + length; - return minor === 3 ? -b - BigInt(1) : b; - } else if (minor === 4) { - const decimalFraction = decode(at + offset, to); - const [exponent, mantissa] = decimalFraction; - const normalizer = mantissa < 0 ? -1 : 1; - const mantissaStr = "0".repeat(Math.abs(exponent) + 1) + String(BigInt(normalizer) * BigInt(mantissa)); - let numericString; - const sign = mantissa < 0 ? "-" : ""; - numericString = exponent === 0 ? mantissaStr : mantissaStr.slice(0, mantissaStr.length + exponent) + "." + mantissaStr.slice(exponent); - numericString = numericString.replace(/^0+/g, ""); - if (numericString === "") { - numericString = "0"; - } - if (numericString[0] === ".") { - numericString = "0" + numericString; - } - numericString = sign + numericString; - _offset = offset + _offset; - return (0, import_serde.nv)(numericString); - } else { - const value = decode(at + offset, to); - const valueOffset = _offset; - _offset = offset + valueOffset; - return tag({ tag: castBigInt(unsignedInt), value }); - } - } - case majorUtf8String: - case majorMap: - case majorList: - case majorUnstructuredByteString: - if (minor === minorIndefinite) { - switch (major) { - case majorUtf8String: - return decodeUtf8StringIndefinite(at, to); - case majorMap: - return decodeMapIndefinite(at, to); - case majorList: - return decodeListIndefinite(at, to); - case majorUnstructuredByteString: - return decodeUnstructuredByteStringIndefinite(at, to); - } - } else { - switch (major) { - case majorUtf8String: - return decodeUtf8String(at, to); - case majorMap: - return decodeMap(at, to); - case majorList: - return decodeList(at, to); - case majorUnstructuredByteString: - return decodeUnstructuredByteString(at, to); - } - } - default: - return decodeSpecial(at, to); - } -} -function bytesToUtf8(bytes, at, to) { - if (USE_BUFFER && bytes.constructor?.name === "Buffer") { - return bytes.toString("utf-8", at, to); - } - if (textDecoder) { - return textDecoder.decode(bytes.subarray(at, to)); - } - return (0, import_util_utf8.toUtf8)(bytes.subarray(at, to)); -} -function demote(bigInteger) { - const num = Number(bigInteger); - if (num < Number.MIN_SAFE_INTEGER || Number.MAX_SAFE_INTEGER < num) { - console.warn(new Error(`@smithy/core/cbor - truncating BigInt(${bigInteger}) to ${num} with loss of precision.`)); - } - return num; -} -var minorValueToArgumentLength = { - [extendedOneByte]: 1, - [extendedFloat16]: 2, - [extendedFloat32]: 4, - [extendedFloat64]: 8 -}; -function bytesToFloat16(a, b) { - const sign = a >> 7; - const exponent = (a & 124) >> 2; - const fraction = (a & 3) << 8 | b; - const scalar = sign === 0 ? 1 : -1; - let exponentComponent; - let summation; - if (exponent === 0) { - if (fraction === 0) { - return 0; - } else { - exponentComponent = Math.pow(2, 1 - 15); - summation = 0; - } - } else if (exponent === 31) { - if (fraction === 0) { - return scalar * Infinity; - } else { - return NaN; - } - } else { - exponentComponent = Math.pow(2, exponent - 15); - summation = 1; - } - summation += fraction / 1024; - return scalar * (exponentComponent * summation); -} -function decodeCount(at, to) { - const minor = payload[at] & 31; - if (minor < 24) { - _offset = 1; - return minor; - } - if (minor === extendedOneByte || minor === extendedFloat16 || minor === extendedFloat32 || minor === extendedFloat64) { - const countLength = minorValueToArgumentLength[minor]; - _offset = countLength + 1; - if (to - at < _offset) { - throw new Error(`countLength ${countLength} greater than remaining buf len.`); - } - const countIndex = at + 1; - if (countLength === 1) { - return payload[countIndex]; - } else if (countLength === 2) { - return dataView.getUint16(countIndex); - } else if (countLength === 4) { - return dataView.getUint32(countIndex); - } - return demote(dataView.getBigUint64(countIndex)); - } - throw new Error(`unexpected minor value ${minor}.`); -} -function decodeUtf8String(at, to) { - const length = decodeCount(at, to); - const offset = _offset; - at += offset; - if (to - at < length) { - throw new Error(`string len ${length} greater than remaining buf len.`); - } - const value = bytesToUtf8(payload, at, at + length); - _offset = offset + length; - return value; -} -function decodeUtf8StringIndefinite(at, to) { - at += 1; - const vector = []; - for (const base = at; at < to; ) { - if (payload[at] === 255) { - const data2 = alloc(vector.length); - data2.set(vector, 0); - _offset = at - base + 2; - return bytesToUtf8(data2, 0, data2.length); - } - const major = (payload[at] & 224) >> 5; - const minor = payload[at] & 31; - if (major !== majorUtf8String) { - throw new Error(`unexpected major type ${major} in indefinite string.`); - } - if (minor === minorIndefinite) { - throw new Error("nested indefinite string."); - } - const bytes = decodeUnstructuredByteString(at, to); - const length = _offset; - at += length; - for (let i = 0; i < bytes.length; ++i) { - vector.push(bytes[i]); - } - } - throw new Error("expected break marker."); -} -function decodeUnstructuredByteString(at, to) { - const length = decodeCount(at, to); - const offset = _offset; - at += offset; - if (to - at < length) { - throw new Error(`unstructured byte string len ${length} greater than remaining buf len.`); - } - const value = payload.subarray(at, at + length); - _offset = offset + length; - return value; -} -function decodeUnstructuredByteStringIndefinite(at, to) { - at += 1; - const vector = []; - for (const base = at; at < to; ) { - if (payload[at] === 255) { - const data2 = alloc(vector.length); - data2.set(vector, 0); - _offset = at - base + 2; - return data2; - } - const major = (payload[at] & 224) >> 5; - const minor = payload[at] & 31; - if (major !== majorUnstructuredByteString) { - throw new Error(`unexpected major type ${major} in indefinite string.`); - } - if (minor === minorIndefinite) { - throw new Error("nested indefinite string."); - } - const bytes = decodeUnstructuredByteString(at, to); - const length = _offset; - at += length; - for (let i = 0; i < bytes.length; ++i) { - vector.push(bytes[i]); - } - } - throw new Error("expected break marker."); -} -function decodeList(at, to) { - const listDataLength = decodeCount(at, to); - const offset = _offset; - at += offset; - const base = at; - const list = Array(listDataLength); - for (let i = 0; i < listDataLength; ++i) { - const item = decode(at, to); - const itemOffset = _offset; - list[i] = item; - at += itemOffset; - } - _offset = offset + (at - base); - return list; -} -function decodeListIndefinite(at, to) { - at += 1; - const list = []; - for (const base = at; at < to; ) { - if (payload[at] === 255) { - _offset = at - base + 2; - return list; - } - const item = decode(at, to); - const n = _offset; - at += n; - list.push(item); - } - throw new Error("expected break marker."); -} -function decodeMap(at, to) { - const mapDataLength = decodeCount(at, to); - const offset = _offset; - at += offset; - const base = at; - const map = {}; - for (let i = 0; i < mapDataLength; ++i) { - if (at >= to) { - throw new Error("unexpected end of map payload."); - } - const major = (payload[at] & 224) >> 5; - if (major !== majorUtf8String) { - throw new Error(`unexpected major type ${major} for map key at index ${at}.`); - } - const key = decode(at, to); - at += _offset; - const value = decode(at, to); - at += _offset; - map[key] = value; - } - _offset = offset + (at - base); - return map; -} -function decodeMapIndefinite(at, to) { - at += 1; - const base = at; - const map = {}; - for (; at < to; ) { - if (at >= to) { - throw new Error("unexpected end of map payload."); - } - if (payload[at] === 255) { - _offset = at - base + 2; - return map; - } - const major = (payload[at] & 224) >> 5; - if (major !== majorUtf8String) { - throw new Error(`unexpected major type ${major} for map key.`); - } - const key = decode(at, to); - at += _offset; - const value = decode(at, to); - at += _offset; - map[key] = value; - } - throw new Error("expected break marker."); -} -function decodeSpecial(at, to) { - const minor = payload[at] & 31; - switch (minor) { - case specialTrue: - case specialFalse: - _offset = 1; - return minor === specialTrue; - case specialNull: - _offset = 1; - return null; - case specialUndefined: - _offset = 1; - return null; - case extendedFloat16: - if (to - at < 3) { - throw new Error("incomplete float16 at end of buf."); - } - _offset = 3; - return bytesToFloat16(payload[at + 1], payload[at + 2]); - case extendedFloat32: - if (to - at < 5) { - throw new Error("incomplete float32 at end of buf."); - } - _offset = 5; - return dataView.getFloat32(at + 1); - case extendedFloat64: - if (to - at < 9) { - throw new Error("incomplete float64 at end of buf."); - } - _offset = 9; - return dataView.getFloat64(at + 1); - default: - throw new Error(`unexpected minor value ${minor}.`); - } -} -function castBigInt(bigInt) { - if (typeof bigInt === "number") { - return bigInt; - } - const num = Number(bigInt); - if (Number.MIN_SAFE_INTEGER <= num && num <= Number.MAX_SAFE_INTEGER) { - return num; - } - return bigInt; -} - -// src/submodules/cbor/cbor-encode.ts -var import_serde2 = __nccwpck_require__(2430); -var import_util_utf82 = __nccwpck_require__(1577); -var USE_BUFFER2 = typeof Buffer !== "undefined"; -var initialSize = 2048; -var data = alloc(initialSize); -var dataView2 = new DataView(data.buffer, data.byteOffset, data.byteLength); -var cursor = 0; -function ensureSpace(bytes) { - const remaining = data.byteLength - cursor; - if (remaining < bytes) { - if (cursor < 16e6) { - resize(Math.max(data.byteLength * 4, data.byteLength + bytes)); - } else { - resize(data.byteLength + bytes + 16e6); - } - } -} -function toUint8Array() { - const out = alloc(cursor); - out.set(data.subarray(0, cursor), 0); - cursor = 0; - return out; -} -function resize(size) { - const old = data; - data = alloc(size); - if (old) { - if (old.copy) { - old.copy(data, 0, 0, old.byteLength); - } else { - data.set(old, 0); - } - } - dataView2 = new DataView(data.buffer, data.byteOffset, data.byteLength); -} -function encodeHeader(major, value) { - if (value < 24) { - data[cursor++] = major << 5 | value; - } else if (value < 1 << 8) { - data[cursor++] = major << 5 | 24; - data[cursor++] = value; - } else if (value < 1 << 16) { - data[cursor++] = major << 5 | extendedFloat16; - dataView2.setUint16(cursor, value); - cursor += 2; - } else if (value < 2 ** 32) { - data[cursor++] = major << 5 | extendedFloat32; - dataView2.setUint32(cursor, value); - cursor += 4; - } else { - data[cursor++] = major << 5 | extendedFloat64; - dataView2.setBigUint64(cursor, typeof value === "bigint" ? value : BigInt(value)); - cursor += 8; - } -} -function encode(_input) { - const encodeStack = [_input]; - while (encodeStack.length) { - const input = encodeStack.pop(); - ensureSpace(typeof input === "string" ? input.length * 4 : 64); - if (typeof input === "string") { - if (USE_BUFFER2) { - encodeHeader(majorUtf8String, Buffer.byteLength(input)); - cursor += data.write(input, cursor); - } else { - const bytes = (0, import_util_utf82.fromUtf8)(input); - encodeHeader(majorUtf8String, bytes.byteLength); - data.set(bytes, cursor); - cursor += bytes.byteLength; - } - continue; - } else if (typeof input === "number") { - if (Number.isInteger(input)) { - const nonNegative = input >= 0; - const major = nonNegative ? majorUint64 : majorNegativeInt64; - const value = nonNegative ? input : -input - 1; - if (value < 24) { - data[cursor++] = major << 5 | value; - } else if (value < 256) { - data[cursor++] = major << 5 | 24; - data[cursor++] = value; - } else if (value < 65536) { - data[cursor++] = major << 5 | extendedFloat16; - data[cursor++] = value >> 8; - data[cursor++] = value; - } else if (value < 4294967296) { - data[cursor++] = major << 5 | extendedFloat32; - dataView2.setUint32(cursor, value); - cursor += 4; - } else { - data[cursor++] = major << 5 | extendedFloat64; - dataView2.setBigUint64(cursor, BigInt(value)); - cursor += 8; - } - continue; - } - data[cursor++] = majorSpecial << 5 | extendedFloat64; - dataView2.setFloat64(cursor, input); - cursor += 8; - continue; - } else if (typeof input === "bigint") { - const nonNegative = input >= 0; - const major = nonNegative ? majorUint64 : majorNegativeInt64; - const value = nonNegative ? input : -input - BigInt(1); - const n = Number(value); - if (n < 24) { - data[cursor++] = major << 5 | n; - } else if (n < 256) { - data[cursor++] = major << 5 | 24; - data[cursor++] = n; - } else if (n < 65536) { - data[cursor++] = major << 5 | extendedFloat16; - data[cursor++] = n >> 8; - data[cursor++] = n & 255; - } else if (n < 4294967296) { - data[cursor++] = major << 5 | extendedFloat32; - dataView2.setUint32(cursor, n); - cursor += 4; - } else if (value < BigInt("18446744073709551616")) { - data[cursor++] = major << 5 | extendedFloat64; - dataView2.setBigUint64(cursor, value); - cursor += 8; - } else { - const binaryBigInt = value.toString(2); - const bigIntBytes = new Uint8Array(Math.ceil(binaryBigInt.length / 8)); - let b = value; - let i = 0; - while (bigIntBytes.byteLength - ++i >= 0) { - bigIntBytes[bigIntBytes.byteLength - i] = Number(b & BigInt(255)); - b >>= BigInt(8); - } - ensureSpace(bigIntBytes.byteLength * 2); - data[cursor++] = nonNegative ? 194 : 195; - if (USE_BUFFER2) { - encodeHeader(majorUnstructuredByteString, Buffer.byteLength(bigIntBytes)); - } else { - encodeHeader(majorUnstructuredByteString, bigIntBytes.byteLength); - } - data.set(bigIntBytes, cursor); - cursor += bigIntBytes.byteLength; - } - continue; - } else if (input === null) { - data[cursor++] = majorSpecial << 5 | specialNull; - continue; - } else if (typeof input === "boolean") { - data[cursor++] = majorSpecial << 5 | (input ? specialTrue : specialFalse); - continue; - } else if (typeof input === "undefined") { - throw new Error("@smithy/core/cbor: client may not serialize undefined value."); - } else if (Array.isArray(input)) { - for (let i = input.length - 1; i >= 0; --i) { - encodeStack.push(input[i]); - } - encodeHeader(majorList, input.length); - continue; - } else if (typeof input.byteLength === "number") { - ensureSpace(input.length * 2); - encodeHeader(majorUnstructuredByteString, input.length); - data.set(input, cursor); - cursor += input.byteLength; - continue; - } else if (typeof input === "object") { - if (input instanceof import_serde2.NumericValue) { - const decimalIndex = input.string.indexOf("."); - const exponent = decimalIndex === -1 ? 0 : decimalIndex - input.string.length + 1; - const mantissa = BigInt(input.string.replace(".", "")); - data[cursor++] = 196; - encodeStack.push(mantissa); - encodeStack.push(exponent); - encodeHeader(majorList, 2); - continue; - } - if (input[tagSymbol]) { - if ("tag" in input && "value" in input) { - encodeStack.push(input.value); - encodeHeader(majorTag, input.tag); - continue; - } else { - throw new Error( - "tag encountered with missing fields, need 'tag' and 'value', found: " + JSON.stringify(input) - ); - } - } - const keys = Object.keys(input); - for (let i = keys.length - 1; i >= 0; --i) { - const key = keys[i]; - encodeStack.push(input[key]); - encodeStack.push(key); - } - encodeHeader(majorMap, keys.length); - continue; - } - throw new Error(`data type ${input?.constructor?.name ?? typeof input} not compatible for encoding.`); - } -} - -// src/submodules/cbor/cbor.ts -var cbor = { - deserialize(payload2) { - setPayload(payload2); - return decode(0, payload2.length); - }, - serialize(input) { - try { - encode(input); - return toUint8Array(); - } catch (e) { - toUint8Array(); - throw e; - } - }, - /** - * @public - * @param size - byte length to allocate. - * - * This may be used to garbage collect the CBOR - * shared encoding buffer space, - * e.g. resizeEncodingBuffer(0); - * - * This may also be used to pre-allocate more space for - * CBOR encoding, e.g. resizeEncodingBuffer(100_000_000); - */ - resizeEncodingBuffer(size) { - resize(size); - } -}; - -// src/submodules/cbor/parseCborBody.ts -var import_protocols = __nccwpck_require__(3422); -var import_protocol_http = __nccwpck_require__(2356); -var import_util_body_length_browser = __nccwpck_require__(2098); -var parseCborBody = (streamBody, context) => { - return (0, import_protocols.collectBody)(streamBody, context).then(async (bytes) => { - if (bytes.length) { - try { - return cbor.deserialize(bytes); - } catch (e) { - Object.defineProperty(e, "$responseBodyText", { - value: context.utf8Encoder(bytes) - }); - throw e; - } - } - return {}; - }); -}; -var dateToTag = (date) => { - return tag({ - tag: 1, - value: date.getTime() / 1e3 - }); -}; -var parseCborErrorBody = async (errorBody, context) => { - const value = await parseCborBody(errorBody, context); - value.message = value.message ?? value.Message; - return value; -}; -var loadSmithyRpcV2CborErrorCode = (output, data2) => { - const sanitizeErrorCode = (rawValue) => { - let cleanValue = rawValue; - if (typeof cleanValue === "number") { - cleanValue = cleanValue.toString(); - } - if (cleanValue.indexOf(",") >= 0) { - cleanValue = cleanValue.split(",")[0]; - } - if (cleanValue.indexOf(":") >= 0) { - cleanValue = cleanValue.split(":")[0]; - } - if (cleanValue.indexOf("#") >= 0) { - cleanValue = cleanValue.split("#")[1]; - } - return cleanValue; - }; - if (data2["__type"] !== void 0) { - return sanitizeErrorCode(data2["__type"]); - } - const codeKey = Object.keys(data2).find((key) => key.toLowerCase() === "code"); - if (codeKey && data2[codeKey] !== void 0) { - return sanitizeErrorCode(data2[codeKey]); - } -}; -var checkCborResponse = (response) => { - if (String(response.headers["smithy-protocol"]).toLowerCase() !== "rpc-v2-cbor") { - throw new Error("Malformed RPCv2 CBOR response, status: " + response.statusCode); - } -}; -var buildHttpRpcRequest = async (context, headers, path, resolvedHostname, body) => { - const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); - const contents = { - protocol, - hostname, - port, - method: "POST", - path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, - headers: { - // intentional copy. - ...headers - } - }; - if (resolvedHostname !== void 0) { - contents.hostname = resolvedHostname; - } - if (body !== void 0) { - contents.body = body; - try { - contents.headers["content-length"] = String((0, import_util_body_length_browser.calculateBodyLength)(body)); - } catch (e) { - } - } - return new import_protocol_http.HttpRequest(contents); -}; - -// src/submodules/cbor/SmithyRpcV2CborProtocol.ts -var import_protocols2 = __nccwpck_require__(3422); -var import_schema2 = __nccwpck_require__(6890); -var import_util_middleware = __nccwpck_require__(6324); - -// src/submodules/cbor/CborCodec.ts -var import_schema = __nccwpck_require__(6890); -var import_serde3 = __nccwpck_require__(2430); -var import_util_base64 = __nccwpck_require__(8385); -var CborCodec = class { - createSerializer() { - const serializer = new CborShapeSerializer(); - serializer.setSerdeContext(this.serdeContext); - return serializer; - } - createDeserializer() { - const deserializer = new CborShapeDeserializer(); - deserializer.setSerdeContext(this.serdeContext); - return deserializer; - } - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - } -}; -var CborShapeSerializer = class { - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - } - write(schema, value) { - this.value = this.serialize(schema, value); - } - /** - * Recursive serializer transform that copies and prepares the user input object - * for CBOR serialization. - */ - serialize(schema, source) { - const ns = import_schema.NormalizedSchema.of(schema); - if (source == null) { - if (ns.isIdempotencyToken()) { - return (0, import_serde3.generateIdempotencyToken)(); - } - return source; - } - if (ns.isBlobSchema()) { - if (typeof source === "string") { - return (this.serdeContext?.base64Decoder ?? import_util_base64.fromBase64)(source); - } - return source; - } - if (ns.isTimestampSchema()) { - if (typeof source === "number" || typeof source === "bigint") { - return dateToTag(new Date(Number(source) / 1e3 | 0)); - } - return dateToTag(source); - } - if (typeof source === "function" || typeof source === "object") { - const sourceObject = source; - if (ns.isListSchema() && Array.isArray(sourceObject)) { - const sparse = !!ns.getMergedTraits().sparse; - const newArray = []; - let i = 0; - for (const item of sourceObject) { - const value = this.serialize(ns.getValueSchema(), item); - if (value != null || sparse) { - newArray[i++] = value; - } - } - return newArray; - } - if (sourceObject instanceof Date) { - return dateToTag(sourceObject); - } - const newObject = {}; - if (ns.isMapSchema()) { - const sparse = !!ns.getMergedTraits().sparse; - for (const key of Object.keys(sourceObject)) { - const value = this.serialize(ns.getValueSchema(), sourceObject[key]); - if (value != null || sparse) { - newObject[key] = value; - } - } - } else if (ns.isStructSchema()) { - for (const [key, memberSchema] of ns.structIterator()) { - const value = this.serialize(memberSchema, sourceObject[key]); - if (value != null) { - newObject[key] = value; - } - } - } else if (ns.isDocumentSchema()) { - for (const key of Object.keys(sourceObject)) { - newObject[key] = this.serialize(ns.getValueSchema(), sourceObject[key]); - } - } - return newObject; - } - return source; - } - flush() { - const buffer = cbor.serialize(this.value); - this.value = void 0; - return buffer; - } -}; -var CborShapeDeserializer = class { - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - } - read(schema, bytes) { - const data2 = cbor.deserialize(bytes); - return this.readValue(schema, data2); - } - /** - * Public because it's called by the protocol implementation to deserialize errors. - * @internal - */ - readValue(_schema, value) { - const ns = import_schema.NormalizedSchema.of(_schema); - if (ns.isTimestampSchema() && typeof value === "number") { - return (0, import_serde3.parseEpochTimestamp)(value); - } - if (ns.isBlobSchema()) { - if (typeof value === "string") { - return (this.serdeContext?.base64Decoder ?? import_util_base64.fromBase64)(value); - } - return value; - } - if (typeof value === "undefined" || typeof value === "boolean" || typeof value === "number" || typeof value === "string" || typeof value === "bigint" || typeof value === "symbol") { - return value; - } else if (typeof value === "function" || typeof value === "object") { - if (value === null) { - return null; - } - if ("byteLength" in value) { - return value; - } - if (value instanceof Date) { - return value; - } - if (ns.isDocumentSchema()) { - return value; - } - if (ns.isListSchema()) { - const newArray = []; - const memberSchema = ns.getValueSchema(); - const sparse = !!ns.getMergedTraits().sparse; - for (const item of value) { - const itemValue = this.readValue(memberSchema, item); - if (itemValue != null || sparse) { - newArray.push(itemValue); - } - } - return newArray; - } - const newObject = {}; - if (ns.isMapSchema()) { - const sparse = !!ns.getMergedTraits().sparse; - const targetSchema = ns.getValueSchema(); - for (const key of Object.keys(value)) { - const itemValue = this.readValue(targetSchema, value[key]); - if (itemValue != null || sparse) { - newObject[key] = itemValue; - } - } - } else if (ns.isStructSchema()) { - for (const [key, memberSchema] of ns.structIterator()) { - newObject[key] = this.readValue(memberSchema, value[key]); - } - } - return newObject; - } else { - return value; - } - } -}; - -// src/submodules/cbor/SmithyRpcV2CborProtocol.ts -var SmithyRpcV2CborProtocol = class extends import_protocols2.RpcProtocol { - constructor({ defaultNamespace }) { - super({ defaultNamespace }); - this.codec = new CborCodec(); - this.serializer = this.codec.createSerializer(); - this.deserializer = this.codec.createDeserializer(); - } - getShapeId() { - return "smithy.protocols#rpcv2Cbor"; - } - getPayloadCodec() { - return this.codec; - } - async serializeRequest(operationSchema, input, context) { - const request = await super.serializeRequest(operationSchema, input, context); - Object.assign(request.headers, { - "content-type": this.getDefaultContentType(), - "smithy-protocol": "rpc-v2-cbor", - accept: this.getDefaultContentType() - }); - if ((0, import_schema2.deref)(operationSchema.input) === "unit") { - delete request.body; - delete request.headers["content-type"]; - } else { - if (!request.body) { - this.serializer.write(15, {}); - request.body = this.serializer.flush(); - } - try { - request.headers["content-length"] = String(request.body.byteLength); - } catch (e) { - } - } - const { service, operation } = (0, import_util_middleware.getSmithyContext)(context); - const path = `/service/${service}/operation/${operation}`; - if (request.path.endsWith("/")) { - request.path += path.slice(1); - } else { - request.path += path; - } - return request; - } - async deserializeResponse(operationSchema, context, response) { - return super.deserializeResponse(operationSchema, context, response); - } - async handleError(operationSchema, context, response, dataObject, metadata) { - const errorName = loadSmithyRpcV2CborErrorCode(response, dataObject) ?? "Unknown"; - let namespace = this.options.defaultNamespace; - if (errorName.includes("#")) { - [namespace] = errorName.split("#"); - } - const errorMetadata = { - $metadata: metadata, - $response: response, - $fault: response.statusCode <= 500 ? "client" : "server" - }; - const registry = import_schema2.TypeRegistry.for(namespace); - let errorSchema; - try { - errorSchema = registry.getSchema(errorName); - } catch (e) { - if (dataObject.Message) { - dataObject.message = dataObject.Message; - } - const baseExceptionSchema = import_schema2.TypeRegistry.for("smithy.ts.sdk.synthetic." + namespace).getBaseException(); - if (baseExceptionSchema) { - const ErrorCtor = baseExceptionSchema.ctor; - throw Object.assign(new ErrorCtor({ name: errorName }), errorMetadata, dataObject); - } - throw Object.assign(new Error(errorName), errorMetadata, dataObject); - } - const ns = import_schema2.NormalizedSchema.of(errorSchema); - const message = dataObject.message ?? dataObject.Message ?? "Unknown"; - const exception = new errorSchema.ctor(message); - const output = {}; - for (const [name, member] of ns.structIterator()) { - output[name] = this.deserializer.readValue(member, dataObject[name]); - } - throw Object.assign( - exception, - errorMetadata, - { - $fault: ns.getMergedTraits().error, - message - }, - output - ); - } - getDefaultContentType() { - return "application/cbor"; - } -}; -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 6579: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/submodules/event-streams/index.ts -var index_exports = {}; -__export(index_exports, { - EventStreamSerde: () => EventStreamSerde -}); -module.exports = __toCommonJS(index_exports); - -// src/submodules/event-streams/EventStreamSerde.ts -var import_schema = __nccwpck_require__(6890); -var import_util_utf8 = __nccwpck_require__(1577); -var EventStreamSerde = class { - /** - * Properties are injected by the HttpProtocol. - */ - constructor({ - marshaller, - serializer, - deserializer, - serdeContext, - defaultContentType - }) { - this.marshaller = marshaller; - this.serializer = serializer; - this.deserializer = deserializer; - this.serdeContext = serdeContext; - this.defaultContentType = defaultContentType; - } - /** - * @param eventStream - the iterable provided by the caller. - * @param requestSchema - the schema of the event stream container (struct). - * @param [initialRequest] - only provided if the initial-request is part of the event stream (RPC). - * - * @returns a stream suitable for the HTTP body of a request. - */ - async serializeEventStream({ - eventStream, - requestSchema, - initialRequest - }) { - const marshaller = this.marshaller; - const eventStreamMember = requestSchema.getEventStreamMember(); - const unionSchema = requestSchema.getMemberSchema(eventStreamMember); - const memberSchemas = unionSchema.getMemberSchemas(); - const serializer = this.serializer; - const defaultContentType = this.defaultContentType; - const initialRequestMarker = Symbol("initialRequestMarker"); - const eventStreamIterable = { - async *[Symbol.asyncIterator]() { - if (initialRequest) { - const headers = { - ":event-type": { type: "string", value: "initial-request" }, - ":message-type": { type: "string", value: "event" }, - ":content-type": { type: "string", value: defaultContentType } - }; - serializer.write(requestSchema, initialRequest); - const body = serializer.flush(); - yield { - [initialRequestMarker]: true, - headers, - body - }; - } - for await (const page of eventStream) { - yield page; - } - } - }; - return marshaller.serialize(eventStreamIterable, (event) => { - if (event[initialRequestMarker]) { - return { - headers: event.headers, - body: event.body - }; - } - const unionMember = Object.keys(event).find((key) => { - return key !== "__type"; - }) ?? ""; - const { additionalHeaders, body, eventType, explicitPayloadContentType } = this.writeEventBody( - unionMember, - unionSchema, - event - ); - const headers = { - ":event-type": { type: "string", value: eventType }, - ":message-type": { type: "string", value: "event" }, - ":content-type": { type: "string", value: explicitPayloadContentType ?? defaultContentType }, - ...additionalHeaders - }; - return { - headers, - body - }; - }); - } - /** - * @param response - http response from which to read the event stream. - * @param unionSchema - schema of the event stream container (struct). - * @param [initialResponseContainer] - provided and written to only if the initial response is part of the event stream (RPC). - * - * @returns the asyncIterable of the event stream for the end-user. - */ - async deserializeEventStream({ - response, - responseSchema, - initialResponseContainer - }) { - const marshaller = this.marshaller; - const eventStreamMember = responseSchema.getEventStreamMember(); - const unionSchema = responseSchema.getMemberSchema(eventStreamMember); - const memberSchemas = unionSchema.getMemberSchemas(); - const initialResponseMarker = Symbol("initialResponseMarker"); - const asyncIterable = marshaller.deserialize(response.body, async (event) => { - const unionMember = Object.keys(event).find((key) => { - return key !== "__type"; - }) ?? ""; - if (unionMember === "initial-response") { - const dataObject = await this.deserializer.read(responseSchema, event[unionMember].body); - delete dataObject[eventStreamMember]; - return { - [initialResponseMarker]: true, - ...dataObject - }; - } else if (unionMember in memberSchemas) { - const eventStreamSchema = memberSchemas[unionMember]; - return { - [unionMember]: await this.deserializer.read(eventStreamSchema, event[unionMember].body) - }; - } else { - return { - $unknown: event - }; - } - }); - const asyncIterator = asyncIterable[Symbol.asyncIterator](); - const firstEvent = await asyncIterator.next(); - if (firstEvent.done) { - return asyncIterable; - } - if (firstEvent.value?.[initialResponseMarker]) { - if (!responseSchema) { - throw new Error( - "@smithy::core/protocols - initial-response event encountered in event stream but no response schema given." - ); - } - for (const [key, value] of Object.entries(firstEvent.value)) { - initialResponseContainer[key] = value; - } - } - return { - async *[Symbol.asyncIterator]() { - if (!firstEvent?.value?.[initialResponseMarker]) { - yield firstEvent.value; - } - while (true) { - const { done, value } = await asyncIterator.next(); - if (done) { - break; - } - yield value; - } - } - }; - } - /** - * @param unionMember - member name within the structure that contains an event stream union. - * @param unionSchema - schema of the union. - * @param event - * - * @returns the event body (bytes) and event type (string). - */ - writeEventBody(unionMember, unionSchema, event) { - const serializer = this.serializer; - let eventType = unionMember; - let explicitPayloadMember = null; - let explicitPayloadContentType; - const isKnownSchema = unionSchema.hasMemberSchema(unionMember); - const additionalHeaders = {}; - if (!isKnownSchema) { - const [type, value] = event[unionMember]; - eventType = type; - serializer.write(import_schema.SCHEMA.DOCUMENT, value); - } else { - const eventSchema = unionSchema.getMemberSchema(unionMember); - if (eventSchema.isStructSchema()) { - for (const [memberName, memberSchema] of eventSchema.structIterator()) { - const { eventHeader, eventPayload } = memberSchema.getMergedTraits(); - if (eventPayload) { - explicitPayloadMember = memberName; - break; - } else if (eventHeader) { - const value = event[unionMember][memberName]; - let type = "binary"; - if (memberSchema.isNumericSchema()) { - if ((-2) ** 31 <= value && value <= 2 ** 31 - 1) { - type = "integer"; - } else { - type = "long"; - } - } else if (memberSchema.isTimestampSchema()) { - type = "timestamp"; - } else if (memberSchema.isStringSchema()) { - type = "string"; - } else if (memberSchema.isBooleanSchema()) { - type = "boolean"; - } - if (value != null) { - additionalHeaders[memberName] = { - type, - value - }; - delete event[unionMember][memberName]; - } - } - } - if (explicitPayloadMember !== null) { - const payloadSchema = eventSchema.getMemberSchema(explicitPayloadMember); - if (payloadSchema.isBlobSchema()) { - explicitPayloadContentType = "application/octet-stream"; - } else if (payloadSchema.isStringSchema()) { - explicitPayloadContentType = "text/plain"; - } - serializer.write(payloadSchema, event[unionMember][explicitPayloadMember]); - } else { - serializer.write(eventSchema, event[unionMember]); - } - } else { - throw new Error("@smithy/core/event-streams - non-struct member not supported in event stream union."); - } - } - const messageSerialization = serializer.flush(); - const body = typeof messageSerialization === "string" ? (this.serdeContext?.utf8Decoder ?? import_util_utf8.fromUtf8)(messageSerialization) : messageSerialization; - return { - body, - eventType, - explicitPayloadContentType, - additionalHeaders - }; - } -}; -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 3422: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __create = Object.create; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/submodules/protocols/index.ts -var index_exports = {}; -__export(index_exports, { - FromStringShapeDeserializer: () => FromStringShapeDeserializer, - HttpBindingProtocol: () => HttpBindingProtocol, - HttpInterceptingShapeDeserializer: () => HttpInterceptingShapeDeserializer, - HttpInterceptingShapeSerializer: () => HttpInterceptingShapeSerializer, - HttpProtocol: () => HttpProtocol, - RequestBuilder: () => RequestBuilder, - RpcProtocol: () => RpcProtocol, - ToStringShapeSerializer: () => ToStringShapeSerializer, - collectBody: () => collectBody, - determineTimestampFormat: () => determineTimestampFormat, - extendedEncodeURIComponent: () => extendedEncodeURIComponent, - requestBuilder: () => requestBuilder, - resolvedPath: () => resolvedPath -}); -module.exports = __toCommonJS(index_exports); - -// src/submodules/protocols/collect-stream-body.ts -var import_util_stream = __nccwpck_require__(4252); -var collectBody = async (streamBody = new Uint8Array(), context) => { - if (streamBody instanceof Uint8Array) { - return import_util_stream.Uint8ArrayBlobAdapter.mutate(streamBody); - } - if (!streamBody) { - return import_util_stream.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); - } - const fromContext = context.streamCollector(streamBody); - return import_util_stream.Uint8ArrayBlobAdapter.mutate(await fromContext); -}; - -// src/submodules/protocols/extended-encode-uri-component.ts -function extendedEncodeURIComponent(str) { - return encodeURIComponent(str).replace(/[!'()*]/g, function(c) { - return "%" + c.charCodeAt(0).toString(16).toUpperCase(); - }); -} - -// src/submodules/protocols/HttpBindingProtocol.ts -var import_schema2 = __nccwpck_require__(6890); -var import_serde = __nccwpck_require__(2430); -var import_protocol_http2 = __nccwpck_require__(2356); -var import_util_stream2 = __nccwpck_require__(4252); - -// src/submodules/protocols/HttpProtocol.ts -var import_schema = __nccwpck_require__(6890); -var import_protocol_http = __nccwpck_require__(2356); -var HttpProtocol = class { - constructor(options) { - this.options = options; - } - getRequestType() { - return import_protocol_http.HttpRequest; - } - getResponseType() { - return import_protocol_http.HttpResponse; - } - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - this.serializer.setSerdeContext(serdeContext); - this.deserializer.setSerdeContext(serdeContext); - if (this.getPayloadCodec()) { - this.getPayloadCodec().setSerdeContext(serdeContext); - } - } - updateServiceEndpoint(request, endpoint) { - if ("url" in endpoint) { - request.protocol = endpoint.url.protocol; - request.hostname = endpoint.url.hostname; - request.port = endpoint.url.port ? Number(endpoint.url.port) : void 0; - request.path = endpoint.url.pathname; - request.fragment = endpoint.url.hash || void 0; - request.username = endpoint.url.username || void 0; - request.password = endpoint.url.password || void 0; - for (const [k, v] of endpoint.url.searchParams.entries()) { - if (!request.query) { - request.query = {}; - } - request.query[k] = v; - } - return request; - } else { - request.protocol = endpoint.protocol; - request.hostname = endpoint.hostname; - request.port = endpoint.port ? Number(endpoint.port) : void 0; - request.path = endpoint.path; - request.query = { - ...endpoint.query - }; - return request; - } - } - setHostPrefix(request, operationSchema, input) { - const operationNs = import_schema.NormalizedSchema.of(operationSchema); - const inputNs = import_schema.NormalizedSchema.of(operationSchema.input); - if (operationNs.getMergedTraits().endpoint) { - let hostPrefix = operationNs.getMergedTraits().endpoint?.[0]; - if (typeof hostPrefix === "string") { - const hostLabelInputs = [...inputNs.structIterator()].filter( - ([, member]) => member.getMergedTraits().hostLabel - ); - for (const [name] of hostLabelInputs) { - const replacement = input[name]; - if (typeof replacement !== "string") { - throw new Error(`@smithy/core/schema - ${name} in input must be a string as hostLabel.`); - } - hostPrefix = hostPrefix.replace(`{${name}}`, replacement); - } - request.hostname = hostPrefix + request.hostname; - } - } - } - deserializeMetadata(output) { - return { - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"] - }; - } - /** - * @param eventStream - the iterable provided by the caller. - * @param requestSchema - the schema of the event stream container (struct). - * @param [initialRequest] - only provided if the initial-request is part of the event stream (RPC). - * - * @returns a stream suitable for the HTTP body of a request. - */ - async serializeEventStream({ - eventStream, - requestSchema, - initialRequest - }) { - const eventStreamSerde = await this.loadEventStreamCapability(); - return eventStreamSerde.serializeEventStream({ - eventStream, - requestSchema, - initialRequest - }); - } - /** - * @param response - http response from which to read the event stream. - * @param unionSchema - schema of the event stream container (struct). - * @param [initialResponseContainer] - provided and written to only if the initial response is part of the event stream (RPC). - * - * @returns the asyncIterable of the event stream. - */ - async deserializeEventStream({ - response, - responseSchema, - initialResponseContainer - }) { - const eventStreamSerde = await this.loadEventStreamCapability(); - return eventStreamSerde.deserializeEventStream({ - response, - responseSchema, - initialResponseContainer - }); - } - /** - * Loads eventStream capability async (for chunking). - */ - async loadEventStreamCapability() { - const { EventStreamSerde } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(6579))); - return new EventStreamSerde({ - marshaller: this.getEventStreamMarshaller(), - serializer: this.serializer, - deserializer: this.deserializer, - serdeContext: this.serdeContext, - defaultContentType: this.getDefaultContentType() - }); - } - /** - * @returns content-type default header value for event stream events and other documents. - */ - getDefaultContentType() { - throw new Error( - `@smithy/core/protocols - ${this.constructor.name} getDefaultContentType() implementation missing.` - ); - } - async deserializeHttpMessage(schema, context, response, arg4, arg5) { - void schema; - void context; - void response; - void arg4; - void arg5; - return []; - } - getEventStreamMarshaller() { - const context = this.serdeContext; - if (!context.eventStreamMarshaller) { - throw new Error("@smithy/core - HttpProtocol: eventStreamMarshaller missing in serdeContext."); - } - return context.eventStreamMarshaller; - } -}; - -// src/submodules/protocols/HttpBindingProtocol.ts -var HttpBindingProtocol = class extends HttpProtocol { - async serializeRequest(operationSchema, _input, context) { - const input = { - ..._input ?? {} - }; - const serializer = this.serializer; - const query = {}; - const headers = {}; - const endpoint = await context.endpoint(); - const ns = import_schema2.NormalizedSchema.of(operationSchema?.input); - const schema = ns.getSchema(); - let hasNonHttpBindingMember = false; - let payload; - const request = new import_protocol_http2.HttpRequest({ - protocol: "", - hostname: "", - port: void 0, - path: "", - fragment: void 0, - query, - headers, - body: void 0 - }); - if (endpoint) { - this.updateServiceEndpoint(request, endpoint); - this.setHostPrefix(request, operationSchema, input); - const opTraits = import_schema2.NormalizedSchema.translateTraits(operationSchema.traits); - if (opTraits.http) { - request.method = opTraits.http[0]; - const [path, search] = opTraits.http[1].split("?"); - if (request.path == "/") { - request.path = path; - } else { - request.path += path; - } - const traitSearchParams = new URLSearchParams(search ?? ""); - Object.assign(query, Object.fromEntries(traitSearchParams)); - } - } - for (const [memberName, memberNs] of ns.structIterator()) { - const memberTraits = memberNs.getMergedTraits() ?? {}; - const inputMemberValue = input[memberName]; - if (inputMemberValue == null) { - continue; - } - if (memberTraits.httpPayload) { - const isStreaming = memberNs.isStreaming(); - if (isStreaming) { - const isEventStream = memberNs.isStructSchema(); - if (isEventStream) { - if (input[memberName]) { - payload = await this.serializeEventStream({ - eventStream: input[memberName], - requestSchema: ns - }); - } - } else { - payload = inputMemberValue; - } - } else { - serializer.write(memberNs, inputMemberValue); - payload = serializer.flush(); - } - delete input[memberName]; - } else if (memberTraits.httpLabel) { - serializer.write(memberNs, inputMemberValue); - const replacement = serializer.flush(); - if (request.path.includes(`{${memberName}+}`)) { - request.path = request.path.replace( - `{${memberName}+}`, - replacement.split("/").map(extendedEncodeURIComponent).join("/") - ); - } else if (request.path.includes(`{${memberName}}`)) { - request.path = request.path.replace(`{${memberName}}`, extendedEncodeURIComponent(replacement)); - } - delete input[memberName]; - } else if (memberTraits.httpHeader) { - serializer.write(memberNs, inputMemberValue); - headers[memberTraits.httpHeader.toLowerCase()] = String(serializer.flush()); - delete input[memberName]; - } else if (typeof memberTraits.httpPrefixHeaders === "string") { - for (const [key, val] of Object.entries(inputMemberValue)) { - const amalgam = memberTraits.httpPrefixHeaders + key; - serializer.write([memberNs.getValueSchema(), { httpHeader: amalgam }], val); - headers[amalgam.toLowerCase()] = serializer.flush(); - } - delete input[memberName]; - } else if (memberTraits.httpQuery || memberTraits.httpQueryParams) { - this.serializeQuery(memberNs, inputMemberValue, query); - delete input[memberName]; - } else { - hasNonHttpBindingMember = true; - } - } - if (hasNonHttpBindingMember && input) { - serializer.write(schema, input); - payload = serializer.flush(); - } - request.headers = headers; - request.query = query; - request.body = payload; - return request; - } - serializeQuery(ns, data, query) { - const serializer = this.serializer; - const traits = ns.getMergedTraits(); - if (traits.httpQueryParams) { - for (const [key, val] of Object.entries(data)) { - if (!(key in query)) { - const valueSchema = ns.getValueSchema(); - Object.assign(valueSchema.getMergedTraits(), { - // We pass on the traits to the sub-schema - // because we are still in the process of serializing the map itself. - ...traits, - httpQuery: key, - httpQueryParams: void 0 - }); - this.serializeQuery(valueSchema, val, query); - } - } - return; - } - if (ns.isListSchema()) { - const sparse = !!ns.getMergedTraits().sparse; - const buffer = []; - for (const item of data) { - serializer.write([ns.getValueSchema(), traits], item); - const serializable = serializer.flush(); - if (sparse || serializable !== void 0) { - buffer.push(serializable); - } - } - query[traits.httpQuery] = buffer; - } else { - serializer.write([ns, traits], data); - query[traits.httpQuery] = serializer.flush(); - } - } - async deserializeResponse(operationSchema, context, response) { - const deserializer = this.deserializer; - const ns = import_schema2.NormalizedSchema.of(operationSchema.output); - const dataObject = {}; - if (response.statusCode >= 300) { - const bytes = await collectBody(response.body, context); - if (bytes.byteLength > 0) { - Object.assign(dataObject, await deserializer.read(import_schema2.SCHEMA.DOCUMENT, bytes)); - } - await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); - throw new Error("@smithy/core/protocols - HTTP Protocol error handler failed to throw."); - } - for (const header in response.headers) { - const value = response.headers[header]; - delete response.headers[header]; - response.headers[header.toLowerCase()] = value; - } - const nonHttpBindingMembers = await this.deserializeHttpMessage(ns, context, response, dataObject); - if (nonHttpBindingMembers.length) { - const bytes = await collectBody(response.body, context); - if (bytes.byteLength > 0) { - const dataFromBody = await deserializer.read(ns, bytes); - for (const member of nonHttpBindingMembers) { - dataObject[member] = dataFromBody[member]; - } - } - } - dataObject.$metadata = this.deserializeMetadata(response); - return dataObject; - } - async deserializeHttpMessage(schema, context, response, arg4, arg5) { - let dataObject; - if (arg4 instanceof Set) { - dataObject = arg5; - } else { - dataObject = arg4; - } - const deserializer = this.deserializer; - const ns = import_schema2.NormalizedSchema.of(schema); - const nonHttpBindingMembers = []; - for (const [memberName, memberSchema] of ns.structIterator()) { - const memberTraits = memberSchema.getMemberTraits(); - if (memberTraits.httpPayload) { - const isStreaming = memberSchema.isStreaming(); - if (isStreaming) { - const isEventStream = memberSchema.isStructSchema(); - if (isEventStream) { - dataObject[memberName] = await this.deserializeEventStream({ - response, - responseSchema: ns - }); - } else { - dataObject[memberName] = (0, import_util_stream2.sdkStreamMixin)(response.body); - } - } else if (response.body) { - const bytes = await collectBody(response.body, context); - if (bytes.byteLength > 0) { - dataObject[memberName] = await deserializer.read(memberSchema, bytes); - } - } - } else if (memberTraits.httpHeader) { - const key = String(memberTraits.httpHeader).toLowerCase(); - const value = response.headers[key]; - if (null != value) { - if (memberSchema.isListSchema()) { - const headerListValueSchema = memberSchema.getValueSchema(); - headerListValueSchema.getMergedTraits().httpHeader = key; - let sections; - if (headerListValueSchema.isTimestampSchema() && headerListValueSchema.getSchema() === import_schema2.SCHEMA.TIMESTAMP_DEFAULT) { - sections = (0, import_serde.splitEvery)(value, ",", 2); - } else { - sections = (0, import_serde.splitHeader)(value); - } - const list = []; - for (const section of sections) { - list.push(await deserializer.read(headerListValueSchema, section.trim())); - } - dataObject[memberName] = list; - } else { - dataObject[memberName] = await deserializer.read(memberSchema, value); - } - } - } else if (memberTraits.httpPrefixHeaders !== void 0) { - dataObject[memberName] = {}; - for (const [header, value] of Object.entries(response.headers)) { - if (header.startsWith(memberTraits.httpPrefixHeaders)) { - const valueSchema = memberSchema.getValueSchema(); - valueSchema.getMergedTraits().httpHeader = header; - dataObject[memberName][header.slice(memberTraits.httpPrefixHeaders.length)] = await deserializer.read( - valueSchema, - value - ); - } - } - } else if (memberTraits.httpResponseCode) { - dataObject[memberName] = response.statusCode; - } else { - nonHttpBindingMembers.push(memberName); - } - } - return nonHttpBindingMembers; - } -}; - -// src/submodules/protocols/RpcProtocol.ts -var import_schema3 = __nccwpck_require__(6890); -var import_protocol_http3 = __nccwpck_require__(2356); -var RpcProtocol = class extends HttpProtocol { - async serializeRequest(operationSchema, input, context) { - const serializer = this.serializer; - const query = {}; - const headers = {}; - const endpoint = await context.endpoint(); - const ns = import_schema3.NormalizedSchema.of(operationSchema?.input); - const schema = ns.getSchema(); - let payload; - const request = new import_protocol_http3.HttpRequest({ - protocol: "", - hostname: "", - port: void 0, - path: "/", - fragment: void 0, - query, - headers, - body: void 0 - }); - if (endpoint) { - this.updateServiceEndpoint(request, endpoint); - this.setHostPrefix(request, operationSchema, input); - } - const _input = { - ...input - }; - if (input) { - const eventStreamMember = ns.getEventStreamMember(); - if (eventStreamMember) { - if (_input[eventStreamMember]) { - const initialRequest = {}; - for (const [memberName, memberSchema] of ns.structIterator()) { - if (memberName !== eventStreamMember && _input[memberName]) { - serializer.write(memberSchema, _input[memberName]); - initialRequest[memberName] = serializer.flush(); - } - } - payload = await this.serializeEventStream({ - eventStream: _input[eventStreamMember], - requestSchema: ns, - initialRequest - }); - } - } else { - serializer.write(schema, _input); - payload = serializer.flush(); - } - } - request.headers = headers; - request.query = query; - request.body = payload; - request.method = "POST"; - return request; - } - async deserializeResponse(operationSchema, context, response) { - const deserializer = this.deserializer; - const ns = import_schema3.NormalizedSchema.of(operationSchema.output); - const dataObject = {}; - if (response.statusCode >= 300) { - const bytes = await collectBody(response.body, context); - if (bytes.byteLength > 0) { - Object.assign(dataObject, await deserializer.read(import_schema3.SCHEMA.DOCUMENT, bytes)); - } - await this.handleError(operationSchema, context, response, dataObject, this.deserializeMetadata(response)); - throw new Error("@smithy/core/protocols - RPC Protocol error handler failed to throw."); - } - for (const header in response.headers) { - const value = response.headers[header]; - delete response.headers[header]; - response.headers[header.toLowerCase()] = value; - } - const eventStreamMember = ns.getEventStreamMember(); - if (eventStreamMember) { - dataObject[eventStreamMember] = await this.deserializeEventStream({ - response, - responseSchema: ns, - initialResponseContainer: dataObject - }); - } else { - const bytes = await collectBody(response.body, context); - if (bytes.byteLength > 0) { - Object.assign(dataObject, await deserializer.read(ns, bytes)); - } - } - dataObject.$metadata = this.deserializeMetadata(response); - return dataObject; - } -}; - -// src/submodules/protocols/requestBuilder.ts -var import_protocol_http4 = __nccwpck_require__(2356); - -// src/submodules/protocols/resolve-path.ts -var resolvedPath = (resolvedPath2, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { - if (input != null && input[memberName] !== void 0) { - const labelValue = labelValueProvider(); - if (labelValue.length <= 0) { - throw new Error("Empty value provided for input HTTP label: " + memberName + "."); - } - resolvedPath2 = resolvedPath2.replace( - uriLabel, - isGreedyLabel ? labelValue.split("/").map((segment) => extendedEncodeURIComponent(segment)).join("/") : extendedEncodeURIComponent(labelValue) - ); - } else { - throw new Error("No value provided for input HTTP label: " + memberName + "."); - } - return resolvedPath2; -}; - -// src/submodules/protocols/requestBuilder.ts -function requestBuilder(input, context) { - return new RequestBuilder(input, context); -} -var RequestBuilder = class { - constructor(input, context) { - this.input = input; - this.context = context; - this.query = {}; - this.method = ""; - this.headers = {}; - this.path = ""; - this.body = null; - this.hostname = ""; - this.resolvePathStack = []; - } - async build() { - const { hostname, protocol = "https", port, path: basePath } = await this.context.endpoint(); - this.path = basePath; - for (const resolvePath of this.resolvePathStack) { - resolvePath(this.path); - } - return new import_protocol_http4.HttpRequest({ - protocol, - hostname: this.hostname || hostname, - port, - method: this.method, - path: this.path, - query: this.query, - body: this.body, - headers: this.headers - }); - } - /** - * Brevity setter for "hostname". - */ - hn(hostname) { - this.hostname = hostname; - return this; - } - /** - * Brevity initial builder for "basepath". - */ - bp(uriLabel) { - this.resolvePathStack.push((basePath) => { - this.path = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + uriLabel; - }); - return this; - } - /** - * Brevity incremental builder for "path". - */ - p(memberName, labelValueProvider, uriLabel, isGreedyLabel) { - this.resolvePathStack.push((path) => { - this.path = resolvedPath(path, this.input, memberName, labelValueProvider, uriLabel, isGreedyLabel); - }); - return this; - } - /** - * Brevity setter for "headers". - */ - h(headers) { - this.headers = headers; - return this; - } - /** - * Brevity setter for "query". - */ - q(query) { - this.query = query; - return this; - } - /** - * Brevity setter for "body". - */ - b(body) { - this.body = body; - return this; - } - /** - * Brevity setter for "method". - */ - m(method) { - this.method = method; - return this; - } -}; - -// src/submodules/protocols/serde/FromStringShapeDeserializer.ts -var import_schema5 = __nccwpck_require__(6890); -var import_serde2 = __nccwpck_require__(2430); -var import_util_base64 = __nccwpck_require__(8385); -var import_util_utf8 = __nccwpck_require__(1577); - -// src/submodules/protocols/serde/determineTimestampFormat.ts -var import_schema4 = __nccwpck_require__(6890); -function determineTimestampFormat(ns, settings) { - if (settings.timestampFormat.useTrait) { - if (ns.isTimestampSchema() && (ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_DATE_TIME || ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_HTTP_DATE || ns.getSchema() === import_schema4.SCHEMA.TIMESTAMP_EPOCH_SECONDS)) { - return ns.getSchema(); - } - } - const { httpLabel, httpPrefixHeaders, httpHeader, httpQuery } = ns.getMergedTraits(); - const bindingFormat = settings.httpBindings ? typeof httpPrefixHeaders === "string" || Boolean(httpHeader) ? import_schema4.SCHEMA.TIMESTAMP_HTTP_DATE : Boolean(httpQuery) || Boolean(httpLabel) ? import_schema4.SCHEMA.TIMESTAMP_DATE_TIME : void 0 : void 0; - return bindingFormat ?? settings.timestampFormat.default; -} - -// src/submodules/protocols/serde/FromStringShapeDeserializer.ts -var FromStringShapeDeserializer = class { - constructor(settings) { - this.settings = settings; - } - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - } - read(_schema, data) { - const ns = import_schema5.NormalizedSchema.of(_schema); - if (ns.isListSchema()) { - return (0, import_serde2.splitHeader)(data).map((item) => this.read(ns.getValueSchema(), item)); - } - if (ns.isBlobSchema()) { - return (this.serdeContext?.base64Decoder ?? import_util_base64.fromBase64)(data); - } - if (ns.isTimestampSchema()) { - const format = determineTimestampFormat(ns, this.settings); - switch (format) { - case import_schema5.SCHEMA.TIMESTAMP_DATE_TIME: - return (0, import_serde2.parseRfc3339DateTimeWithOffset)(data); - case import_schema5.SCHEMA.TIMESTAMP_HTTP_DATE: - return (0, import_serde2.parseRfc7231DateTime)(data); - case import_schema5.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - return (0, import_serde2.parseEpochTimestamp)(data); - default: - console.warn("Missing timestamp format, parsing value with Date constructor:", data); - return new Date(data); - } - } - if (ns.isStringSchema()) { - const mediaType = ns.getMergedTraits().mediaType; - let intermediateValue = data; - if (mediaType) { - if (ns.getMergedTraits().httpHeader) { - intermediateValue = this.base64ToUtf8(intermediateValue); - } - const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); - if (isJson) { - intermediateValue = import_serde2.LazyJsonString.from(intermediateValue); - } - return intermediateValue; - } - } - switch (true) { - case ns.isNumericSchema(): - return Number(data); - case ns.isBigIntegerSchema(): - return BigInt(data); - case ns.isBigDecimalSchema(): - return new import_serde2.NumericValue(data, "bigDecimal"); - case ns.isBooleanSchema(): - return String(data).toLowerCase() === "true"; - } - return data; - } - base64ToUtf8(base64String) { - return (this.serdeContext?.utf8Encoder ?? import_util_utf8.toUtf8)((this.serdeContext?.base64Decoder ?? import_util_base64.fromBase64)(base64String)); - } -}; - -// src/submodules/protocols/serde/HttpInterceptingShapeDeserializer.ts -var import_schema6 = __nccwpck_require__(6890); -var import_util_utf82 = __nccwpck_require__(1577); -var HttpInterceptingShapeDeserializer = class { - constructor(codecDeserializer, codecSettings) { - this.codecDeserializer = codecDeserializer; - this.stringDeserializer = new FromStringShapeDeserializer(codecSettings); - } - setSerdeContext(serdeContext) { - this.stringDeserializer.setSerdeContext(serdeContext); - this.codecDeserializer.setSerdeContext(serdeContext); - this.serdeContext = serdeContext; - } - read(schema, data) { - const ns = import_schema6.NormalizedSchema.of(schema); - const traits = ns.getMergedTraits(); - const toString = this.serdeContext?.utf8Encoder ?? import_util_utf82.toUtf8; - if (traits.httpHeader || traits.httpResponseCode) { - return this.stringDeserializer.read(ns, toString(data)); - } - if (traits.httpPayload) { - if (ns.isBlobSchema()) { - const toBytes = this.serdeContext?.utf8Decoder ?? import_util_utf82.fromUtf8; - if (typeof data === "string") { - return toBytes(data); - } - return data; - } else if (ns.isStringSchema()) { - if ("byteLength" in data) { - return toString(data); - } - return data; - } - } - return this.codecDeserializer.read(ns, data); - } -}; - -// src/submodules/protocols/serde/HttpInterceptingShapeSerializer.ts -var import_schema8 = __nccwpck_require__(6890); - -// src/submodules/protocols/serde/ToStringShapeSerializer.ts -var import_schema7 = __nccwpck_require__(6890); -var import_serde3 = __nccwpck_require__(2430); -var import_util_base642 = __nccwpck_require__(8385); -var ToStringShapeSerializer = class { - constructor(settings) { - this.settings = settings; - this.stringBuffer = ""; - this.serdeContext = void 0; - } - setSerdeContext(serdeContext) { - this.serdeContext = serdeContext; - } - write(schema, value) { - const ns = import_schema7.NormalizedSchema.of(schema); - switch (typeof value) { - case "object": - if (value === null) { - this.stringBuffer = "null"; - return; - } - if (ns.isTimestampSchema()) { - if (!(value instanceof Date)) { - throw new Error( - `@smithy/core/protocols - received non-Date value ${value} when schema expected Date in ${ns.getName( - true - )}` - ); - } - const format = determineTimestampFormat(ns, this.settings); - switch (format) { - case import_schema7.SCHEMA.TIMESTAMP_DATE_TIME: - this.stringBuffer = value.toISOString().replace(".000Z", "Z"); - break; - case import_schema7.SCHEMA.TIMESTAMP_HTTP_DATE: - this.stringBuffer = (0, import_serde3.dateToUtcString)(value); - break; - case import_schema7.SCHEMA.TIMESTAMP_EPOCH_SECONDS: - this.stringBuffer = String(value.getTime() / 1e3); - break; - default: - console.warn("Missing timestamp format, using epoch seconds", value); - this.stringBuffer = String(value.getTime() / 1e3); - } - return; - } - if (ns.isBlobSchema() && "byteLength" in value) { - this.stringBuffer = (this.serdeContext?.base64Encoder ?? import_util_base642.toBase64)(value); - return; - } - if (ns.isListSchema() && Array.isArray(value)) { - let buffer = ""; - for (const item of value) { - this.write([ns.getValueSchema(), ns.getMergedTraits()], item); - const headerItem = this.flush(); - const serialized = ns.getValueSchema().isTimestampSchema() ? headerItem : (0, import_serde3.quoteHeader)(headerItem); - if (buffer !== "") { - buffer += ", "; - } - buffer += serialized; - } - this.stringBuffer = buffer; - return; - } - this.stringBuffer = JSON.stringify(value, null, 2); - break; - case "string": - const mediaType = ns.getMergedTraits().mediaType; - let intermediateValue = value; - if (mediaType) { - const isJson = mediaType === "application/json" || mediaType.endsWith("+json"); - if (isJson) { - intermediateValue = import_serde3.LazyJsonString.from(intermediateValue); - } - if (ns.getMergedTraits().httpHeader) { - this.stringBuffer = (this.serdeContext?.base64Encoder ?? import_util_base642.toBase64)(intermediateValue.toString()); - return; - } - } - this.stringBuffer = value; - break; - default: - this.stringBuffer = String(value); - } - } - flush() { - const buffer = this.stringBuffer; - this.stringBuffer = ""; - return buffer; - } -}; - -// src/submodules/protocols/serde/HttpInterceptingShapeSerializer.ts -var HttpInterceptingShapeSerializer = class { - constructor(codecSerializer, codecSettings, stringSerializer = new ToStringShapeSerializer(codecSettings)) { - this.codecSerializer = codecSerializer; - this.stringSerializer = stringSerializer; - } - setSerdeContext(serdeContext) { - this.codecSerializer.setSerdeContext(serdeContext); - this.stringSerializer.setSerdeContext(serdeContext); - } - write(schema, value) { - const ns = import_schema8.NormalizedSchema.of(schema); - const traits = ns.getMergedTraits(); - if (traits.httpHeader || traits.httpLabel || traits.httpQuery) { - this.stringSerializer.write(ns, value); - this.buffer = this.stringSerializer.flush(); - return; - } - return this.codecSerializer.write(ns, value); - } - flush() { - if (this.buffer !== void 0) { - const buffer = this.buffer; - this.buffer = void 0; - return buffer; - } - return this.codecSerializer.flush(); - } -}; -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 6890: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/submodules/schema/index.ts -var index_exports = {}; -__export(index_exports, { - ErrorSchema: () => ErrorSchema, - ListSchema: () => ListSchema, - MapSchema: () => MapSchema, - NormalizedSchema: () => NormalizedSchema, - OperationSchema: () => OperationSchema, - SCHEMA: () => SCHEMA, - Schema: () => Schema, - SimpleSchema: () => SimpleSchema, - StructureSchema: () => StructureSchema, - TypeRegistry: () => TypeRegistry, - deref: () => deref, - deserializerMiddlewareOption: () => deserializerMiddlewareOption, - error: () => error, - getSchemaSerdePlugin: () => getSchemaSerdePlugin, - list: () => list, - map: () => map, - op: () => op, - serializerMiddlewareOption: () => serializerMiddlewareOption, - sim: () => sim, - struct: () => struct -}); -module.exports = __toCommonJS(index_exports); - -// src/submodules/schema/deref.ts -var deref = (schemaRef) => { - if (typeof schemaRef === "function") { - return schemaRef(); - } - return schemaRef; -}; - -// src/submodules/schema/middleware/schemaDeserializationMiddleware.ts -var import_protocol_http = __nccwpck_require__(2356); -var import_util_middleware = __nccwpck_require__(6324); -var schemaDeserializationMiddleware = (config) => (next, context) => async (args) => { - const { response } = await next(args); - const { operationSchema } = (0, import_util_middleware.getSmithyContext)(context); - try { - const parsed = await config.protocol.deserializeResponse( - operationSchema, - { - ...config, - ...context - }, - response - ); - return { - response, - output: parsed - }; - } catch (error2) { - Object.defineProperty(error2, "$response", { - value: response - }); - if (!("$metadata" in error2)) { - const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; - try { - error2.message += "\n " + hint; - } catch (e) { - if (!context.logger || context.logger?.constructor?.name === "NoOpLogger") { - console.warn(hint); - } else { - context.logger?.warn?.(hint); - } - } - if (typeof error2.$responseBodyText !== "undefined") { - if (error2.$response) { - error2.$response.body = error2.$responseBodyText; - } - } - try { - if (import_protocol_http.HttpResponse.isInstance(response)) { - const { headers = {} } = response; - const headerEntries = Object.entries(headers); - error2.$metadata = { - httpStatusCode: response.statusCode, - requestId: findHeader(/^x-[\w-]+-request-?id$/, headerEntries), - extendedRequestId: findHeader(/^x-[\w-]+-id-2$/, headerEntries), - cfId: findHeader(/^x-[\w-]+-cf-id$/, headerEntries) - }; - } - } catch (e) { - } - } - throw error2; - } -}; -var findHeader = (pattern, headers) => { - return (headers.find(([k]) => { - return k.match(pattern); - }) || [void 0, void 0])[1]; -}; - -// src/submodules/schema/middleware/schemaSerializationMiddleware.ts -var import_util_middleware2 = __nccwpck_require__(6324); -var schemaSerializationMiddleware = (config) => (next, context) => async (args) => { - const { operationSchema } = (0, import_util_middleware2.getSmithyContext)(context); - const endpoint = context.endpointV2?.url && config.urlParser ? async () => config.urlParser(context.endpointV2.url) : config.endpoint; - const request = await config.protocol.serializeRequest(operationSchema, args.input, { - ...config, - ...context, - endpoint - }); - return next({ - ...args, - request - }); -}; - -// src/submodules/schema/middleware/getSchemaSerdePlugin.ts -var deserializerMiddlewareOption = { - name: "deserializerMiddleware", - step: "deserialize", - tags: ["DESERIALIZER"], - override: true -}; -var serializerMiddlewareOption = { - name: "serializerMiddleware", - step: "serialize", - tags: ["SERIALIZER"], - override: true -}; -function getSchemaSerdePlugin(config) { - return { - applyToStack: (commandStack) => { - commandStack.add(schemaSerializationMiddleware(config), serializerMiddlewareOption); - commandStack.add(schemaDeserializationMiddleware(config), deserializerMiddlewareOption); - config.protocol.setSerdeContext(config); - } - }; -} - -// src/submodules/schema/TypeRegistry.ts -var TypeRegistry = class _TypeRegistry { - constructor(namespace, schemas = /* @__PURE__ */ new Map()) { - this.namespace = namespace; - this.schemas = schemas; - } - static { - this.registries = /* @__PURE__ */ new Map(); - } - /** - * @param namespace - specifier. - * @returns the schema for that namespace, creating it if necessary. - */ - static for(namespace) { - if (!_TypeRegistry.registries.has(namespace)) { - _TypeRegistry.registries.set(namespace, new _TypeRegistry(namespace)); - } - return _TypeRegistry.registries.get(namespace); - } - /** - * Adds the given schema to a type registry with the same namespace. - * - * @param shapeId - to be registered. - * @param schema - to be registered. - */ - register(shapeId, schema) { - const qualifiedName = this.normalizeShapeId(shapeId); - const registry = _TypeRegistry.for(this.getNamespace(shapeId)); - registry.schemas.set(qualifiedName, schema); - } - /** - * @param shapeId - query. - * @returns the schema. - */ - getSchema(shapeId) { - const id = this.normalizeShapeId(shapeId); - if (!this.schemas.has(id)) { - throw new Error(`@smithy/core/schema - schema not found for ${id}`); - } - return this.schemas.get(id); - } - /** - * The smithy-typescript code generator generates a synthetic (i.e. unmodeled) base exception, - * because generated SDKs before the introduction of schemas have the notion of a ServiceBaseException, which - * is unique per service/model. - * - * This is generated under a unique prefix that is combined with the service namespace, and this - * method is used to retrieve it. - * - * The base exception synthetic schema is used when an error is returned by a service, but we cannot - * determine what existing schema to use to deserialize it. - * - * @returns the synthetic base exception of the service namespace associated with this registry instance. - */ - getBaseException() { - for (const [id, schema] of this.schemas.entries()) { - if (id.startsWith("smithy.ts.sdk.synthetic.") && id.endsWith("ServiceException")) { - return schema; - } - } - return void 0; - } - /** - * @param predicate - criterion. - * @returns a schema in this registry matching the predicate. - */ - find(predicate) { - return [...this.schemas.values()].find(predicate); - } - /** - * Unloads the current TypeRegistry. - */ - destroy() { - _TypeRegistry.registries.delete(this.namespace); - this.schemas.clear(); - } - normalizeShapeId(shapeId) { - if (shapeId.includes("#")) { - return shapeId; - } - return this.namespace + "#" + shapeId; - } - getNamespace(shapeId) { - return this.normalizeShapeId(shapeId).split("#")[0]; - } -}; - -// src/submodules/schema/schemas/Schema.ts -var Schema = class { - static assign(instance, values) { - const schema = Object.assign(instance, values); - TypeRegistry.for(schema.namespace).register(schema.name, schema); - return schema; - } - static [Symbol.hasInstance](lhs) { - const isPrototype = this.prototype.isPrototypeOf(lhs); - if (!isPrototype && typeof lhs === "object" && lhs !== null) { - const list2 = lhs; - return list2.symbol === this.symbol; - } - return isPrototype; - } - getName() { - return this.namespace + "#" + this.name; - } -}; - -// src/submodules/schema/schemas/ListSchema.ts -var ListSchema = class _ListSchema extends Schema { - constructor() { - super(...arguments); - this.symbol = _ListSchema.symbol; - } - static { - this.symbol = Symbol.for("@smithy/lis"); - } -}; -var list = (namespace, name, traits, valueSchema) => Schema.assign(new ListSchema(), { - name, - namespace, - traits, - valueSchema -}); - -// src/submodules/schema/schemas/MapSchema.ts -var MapSchema = class _MapSchema extends Schema { - constructor() { - super(...arguments); - this.symbol = _MapSchema.symbol; - } - static { - this.symbol = Symbol.for("@smithy/map"); - } -}; -var map = (namespace, name, traits, keySchema, valueSchema) => Schema.assign(new MapSchema(), { - name, - namespace, - traits, - keySchema, - valueSchema -}); - -// src/submodules/schema/schemas/OperationSchema.ts -var OperationSchema = class _OperationSchema extends Schema { - constructor() { - super(...arguments); - this.symbol = _OperationSchema.symbol; - } - static { - this.symbol = Symbol.for("@smithy/ope"); - } -}; -var op = (namespace, name, traits, input, output) => Schema.assign(new OperationSchema(), { - name, - namespace, - traits, - input, - output -}); - -// src/submodules/schema/schemas/StructureSchema.ts -var StructureSchema = class _StructureSchema extends Schema { - constructor() { - super(...arguments); - this.symbol = _StructureSchema.symbol; - } - static { - this.symbol = Symbol.for("@smithy/str"); - } -}; -var struct = (namespace, name, traits, memberNames, memberList) => Schema.assign(new StructureSchema(), { - name, - namespace, - traits, - memberNames, - memberList -}); - -// src/submodules/schema/schemas/ErrorSchema.ts -var ErrorSchema = class _ErrorSchema extends StructureSchema { - constructor() { - super(...arguments); - this.symbol = _ErrorSchema.symbol; - } - static { - this.symbol = Symbol.for("@smithy/err"); - } -}; -var error = (namespace, name, traits, memberNames, memberList, ctor) => Schema.assign(new ErrorSchema(), { - name, - namespace, - traits, - memberNames, - memberList, - ctor -}); - -// src/submodules/schema/schemas/sentinels.ts -var SCHEMA = { - BLOB: 21, - // 21 - STREAMING_BLOB: 42, - // 42 - BOOLEAN: 2, - // 2 - STRING: 0, - // 0 - NUMERIC: 1, - // 1 - BIG_INTEGER: 17, - // 17 - BIG_DECIMAL: 19, - // 19 - DOCUMENT: 15, - // 15 - TIMESTAMP_DEFAULT: 4, - // 4 - TIMESTAMP_DATE_TIME: 5, - // 5 - TIMESTAMP_HTTP_DATE: 6, - // 6 - TIMESTAMP_EPOCH_SECONDS: 7, - // 7 - LIST_MODIFIER: 64, - // 64 - MAP_MODIFIER: 128 - // 128 -}; - -// src/submodules/schema/schemas/SimpleSchema.ts -var SimpleSchema = class _SimpleSchema extends Schema { - constructor() { - super(...arguments); - this.symbol = _SimpleSchema.symbol; - } - static { - this.symbol = Symbol.for("@smithy/sim"); - } -}; -var sim = (namespace, name, schemaRef, traits) => Schema.assign(new SimpleSchema(), { - name, - namespace, - traits, - schemaRef -}); - -// src/submodules/schema/schemas/NormalizedSchema.ts -var NormalizedSchema = class _NormalizedSchema { - /** - * @param ref - a polymorphic SchemaRef to be dereferenced/normalized. - * @param memberName - optional memberName if this NormalizedSchema should be considered a member schema. - */ - constructor(ref, memberName) { - this.ref = ref; - this.memberName = memberName; - this.symbol = _NormalizedSchema.symbol; - const traitStack = []; - let _ref = ref; - let schema = ref; - this._isMemberSchema = false; - while (Array.isArray(_ref)) { - traitStack.push(_ref[1]); - _ref = _ref[0]; - schema = deref(_ref); - this._isMemberSchema = true; - } - if (traitStack.length > 0) { - this.memberTraits = {}; - for (let i = traitStack.length - 1; i >= 0; --i) { - const traitSet = traitStack[i]; - Object.assign(this.memberTraits, _NormalizedSchema.translateTraits(traitSet)); - } - } else { - this.memberTraits = 0; - } - if (schema instanceof _NormalizedSchema) { - Object.assign(this, schema); - this.memberTraits = Object.assign({}, schema.getMemberTraits(), this.getMemberTraits()); - this.normalizedTraits = void 0; - this.memberName = memberName ?? schema.memberName; - return; - } - this.schema = deref(schema); - if (this.schema && typeof this.schema === "object") { - this.traits = this.schema?.traits ?? {}; - } else { - this.traits = 0; - } - this.name = (this.schema instanceof Schema ? this.schema.getName?.() : void 0) ?? this.memberName ?? this.getSchemaName(); - if (this._isMemberSchema && !memberName) { - throw new Error(`@smithy/core/schema - NormalizedSchema member init ${this.getName(true)} missing member name.`); - } - } - static { - this.symbol = Symbol.for("@smithy/nor"); - } - static [Symbol.hasInstance](lhs) { - return Schema[Symbol.hasInstance].bind(this)(lhs); - } - /** - * Static constructor that attempts to avoid wrapping a NormalizedSchema within another. - */ - static of(ref) { - if (ref instanceof _NormalizedSchema) { - return ref; - } - if (Array.isArray(ref)) { - const [ns, traits] = ref; - if (ns instanceof _NormalizedSchema) { - Object.assign(ns.getMergedTraits(), _NormalizedSchema.translateTraits(traits)); - return ns; - } - throw new Error(`@smithy/core/schema - may not init unwrapped member schema=${JSON.stringify(ref, null, 2)}.`); - } - return new _NormalizedSchema(ref); - } - /** - * @param indicator - numeric indicator for preset trait combination. - * @returns equivalent trait object. - */ - static translateTraits(indicator) { - if (typeof indicator === "object") { - return indicator; - } - indicator = indicator | 0; - const traits = {}; - let i = 0; - for (const trait of [ - "httpLabel", - "idempotent", - "idempotencyToken", - "sensitive", - "httpPayload", - "httpResponseCode", - "httpQueryParams" - ]) { - if ((indicator >> i++ & 1) === 1) { - traits[trait] = 1; - } - } - return traits; - } - /** - * @returns the underlying non-normalized schema. - */ - getSchema() { - if (this.schema instanceof _NormalizedSchema) { - Object.assign(this, { schema: this.schema.getSchema() }); - return this.schema; - } - if (this.schema instanceof SimpleSchema) { - return deref(this.schema.schemaRef); - } - return deref(this.schema); - } - /** - * @param withNamespace - qualifies the name. - * @returns e.g. `MyShape` or `com.namespace#MyShape`. - */ - getName(withNamespace = false) { - if (!withNamespace) { - if (this.name && this.name.includes("#")) { - return this.name.split("#")[1]; - } - } - return this.name || void 0; - } - /** - * @returns the member name if the schema is a member schema. - * @throws Error when the schema isn't a member schema. - */ - getMemberName() { - if (!this.isMemberSchema()) { - throw new Error(`@smithy/core/schema - non-member schema: ${this.getName(true)}`); - } - return this.memberName; - } - isMemberSchema() { - return this._isMemberSchema; - } - isUnitSchema() { - return this.getSchema() === "unit"; - } - /** - * boolean methods on this class help control flow in shape serialization and deserialization. - */ - isListSchema() { - const inner = this.getSchema(); - if (typeof inner === "number") { - return inner >= SCHEMA.LIST_MODIFIER && inner < SCHEMA.MAP_MODIFIER; - } - return inner instanceof ListSchema; - } - isMapSchema() { - const inner = this.getSchema(); - if (typeof inner === "number") { - return inner >= SCHEMA.MAP_MODIFIER && inner <= 255; - } - return inner instanceof MapSchema; - } - isStructSchema() { - const inner = this.getSchema(); - return inner !== null && typeof inner === "object" && "members" in inner || inner instanceof StructureSchema; - } - isBlobSchema() { - return this.getSchema() === SCHEMA.BLOB || this.getSchema() === SCHEMA.STREAMING_BLOB; - } - isTimestampSchema() { - const schema = this.getSchema(); - return typeof schema === "number" && schema >= SCHEMA.TIMESTAMP_DEFAULT && schema <= SCHEMA.TIMESTAMP_EPOCH_SECONDS; - } - isDocumentSchema() { - return this.getSchema() === SCHEMA.DOCUMENT; - } - isStringSchema() { - return this.getSchema() === SCHEMA.STRING; - } - isBooleanSchema() { - return this.getSchema() === SCHEMA.BOOLEAN; - } - isNumericSchema() { - return this.getSchema() === SCHEMA.NUMERIC; - } - isBigIntegerSchema() { - return this.getSchema() === SCHEMA.BIG_INTEGER; - } - isBigDecimalSchema() { - return this.getSchema() === SCHEMA.BIG_DECIMAL; - } - isStreaming() { - const streaming = !!this.getMergedTraits().streaming; - if (streaming) { - return true; - } - return this.getSchema() === SCHEMA.STREAMING_BLOB; - } - /** - * This is a shortcut to avoid calling `getMergedTraits().idempotencyToken` on every string. - * @returns whether the schema has the idempotencyToken trait. - */ - isIdempotencyToken() { - if (typeof this.traits === "number") { - return (this.traits & 4) === 4; - } else if (typeof this.traits === "object") { - return !!this.traits.idempotencyToken; - } - return false; - } - /** - * @returns own traits merged with member traits, where member traits of the same trait key take priority. - * This method is cached. - */ - getMergedTraits() { - return this.normalizedTraits ?? (this.normalizedTraits = { - ...this.getOwnTraits(), - ...this.getMemberTraits() - }); - } - /** - * @returns only the member traits. If the schema is not a member, this returns empty. - */ - getMemberTraits() { - return _NormalizedSchema.translateTraits(this.memberTraits); - } - /** - * @returns only the traits inherent to the shape or member target shape if this schema is a member. - * If there are any member traits they are excluded. - */ - getOwnTraits() { - return _NormalizedSchema.translateTraits(this.traits); - } - /** - * @returns the map's key's schema. Returns a dummy Document schema if this schema is a Document. - * - * @throws Error if the schema is not a Map or Document. - */ - getKeySchema() { - if (this.isDocumentSchema()) { - return this.memberFrom([SCHEMA.DOCUMENT, 0], "key"); - } - if (!this.isMapSchema()) { - throw new Error(`@smithy/core/schema - cannot get key for non-map: ${this.getName(true)}`); - } - const schema = this.getSchema(); - if (typeof schema === "number") { - return this.memberFrom([63 & schema, 0], "key"); - } - return this.memberFrom([schema.keySchema, 0], "key"); - } - /** - * @returns the schema of the map's value or list's member. - * Returns a dummy Document schema if this schema is a Document. - * - * @throws Error if the schema is not a Map, List, nor Document. - */ - getValueSchema() { - const schema = this.getSchema(); - if (typeof schema === "number") { - if (this.isMapSchema()) { - return this.memberFrom([63 & schema, 0], "value"); - } else if (this.isListSchema()) { - return this.memberFrom([63 & schema, 0], "member"); - } - } - if (schema && typeof schema === "object") { - if (this.isStructSchema()) { - throw new Error(`may not getValueSchema() on structure ${this.getName(true)}`); - } - const collection = schema; - if ("valueSchema" in collection) { - if (this.isMapSchema()) { - return this.memberFrom([collection.valueSchema, 0], "value"); - } else if (this.isListSchema()) { - return this.memberFrom([collection.valueSchema, 0], "member"); - } - } - } - if (this.isDocumentSchema()) { - return this.memberFrom([SCHEMA.DOCUMENT, 0], "value"); - } - throw new Error(`@smithy/core/schema - ${this.getName(true)} has no value member.`); - } - /** - * @param member - to query. - * @returns whether there is a memberSchema with the given member name. False if not a structure (or union). - */ - hasMemberSchema(member) { - if (this.isStructSchema()) { - const struct2 = this.getSchema(); - return struct2.memberNames.includes(member); - } - return false; - } - /** - * @returns the NormalizedSchema for the given member name. The returned instance will return true for `isMemberSchema()` - * and will have the member name given. - * @param member - which member to retrieve and wrap. - * - * @throws Error if member does not exist or the schema is neither a document nor structure. - * Note that errors are assumed to be structures and unions are considered structures for these purposes. - */ - getMemberSchema(member) { - if (this.isStructSchema()) { - const struct2 = this.getSchema(); - if (!struct2.memberNames.includes(member)) { - throw new Error(`@smithy/core/schema - ${this.getName(true)} has no member=${member}.`); - } - const i = struct2.memberNames.indexOf(member); - const memberSchema = struct2.memberList[i]; - return this.memberFrom(Array.isArray(memberSchema) ? memberSchema : [memberSchema, 0], member); - } - if (this.isDocumentSchema()) { - return this.memberFrom([SCHEMA.DOCUMENT, 0], member); - } - throw new Error(`@smithy/core/schema - ${this.getName(true)} has no members.`); - } - /** - * This can be used for checking the members as a hashmap. - * Prefer the structIterator method for iteration. - * - * This does NOT return list and map members, it is only for structures. - * - * @deprecated use (checked) structIterator instead. - * - * @returns a map of member names to member schemas (normalized). - */ - getMemberSchemas() { - const buffer = {}; - try { - for (const [k, v] of this.structIterator()) { - buffer[k] = v; - } - } catch (ignored) { - } - return buffer; - } - /** - * @returns member name of event stream or empty string indicating none exists or this - * isn't a structure schema. - */ - getEventStreamMember() { - if (this.isStructSchema()) { - for (const [memberName, memberSchema] of this.structIterator()) { - if (memberSchema.isStreaming() && memberSchema.isStructSchema()) { - return memberName; - } - } - } - return ""; - } - /** - * Allows iteration over members of a structure schema. - * Each yield is a pair of the member name and member schema. - * - * This avoids the overhead of calling Object.entries(ns.getMemberSchemas()). - */ - *structIterator() { - if (this.isUnitSchema()) { - return; - } - if (!this.isStructSchema()) { - throw new Error("@smithy/core/schema - cannot iterate non-struct schema."); - } - const struct2 = this.getSchema(); - for (let i = 0; i < struct2.memberNames.length; ++i) { - yield [struct2.memberNames[i], this.memberFrom([struct2.memberList[i], 0], struct2.memberNames[i])]; - } - } - /** - * Creates a normalized member schema from the given schema and member name. - */ - memberFrom(memberSchema, memberName) { - if (memberSchema instanceof _NormalizedSchema) { - return Object.assign(memberSchema, { - memberName, - _isMemberSchema: true - }); - } - return new _NormalizedSchema(memberSchema, memberName); - } - /** - * @returns a last-resort human-readable name for the schema if it has no other identifiers. - */ - getSchemaName() { - const schema = this.getSchema(); - if (typeof schema === "number") { - const _schema = 63 & schema; - const container = 192 & schema; - const type = Object.entries(SCHEMA).find(([, value]) => { - return value === _schema; - })?.[0] ?? "Unknown"; - switch (container) { - case SCHEMA.MAP_MODIFIER: - return `${type}Map`; - case SCHEMA.LIST_MODIFIER: - return `${type}List`; - case 0: - return type; - } - } - return "Unknown"; - } -}; -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 2430: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/submodules/serde/index.ts -var index_exports = {}; -__export(index_exports, { - LazyJsonString: () => LazyJsonString, - NumericValue: () => NumericValue, - copyDocumentWithTransform: () => copyDocumentWithTransform, - dateToUtcString: () => dateToUtcString, - expectBoolean: () => expectBoolean, - expectByte: () => expectByte, - expectFloat32: () => expectFloat32, - expectInt: () => expectInt, - expectInt32: () => expectInt32, - expectLong: () => expectLong, - expectNonNull: () => expectNonNull, - expectNumber: () => expectNumber, - expectObject: () => expectObject, - expectShort: () => expectShort, - expectString: () => expectString, - expectUnion: () => expectUnion, - generateIdempotencyToken: () => import_uuid.v4, - handleFloat: () => handleFloat, - limitedParseDouble: () => limitedParseDouble, - limitedParseFloat: () => limitedParseFloat, - limitedParseFloat32: () => limitedParseFloat32, - logger: () => logger, - nv: () => nv, - parseBoolean: () => parseBoolean, - parseEpochTimestamp: () => parseEpochTimestamp, - parseRfc3339DateTime: () => parseRfc3339DateTime, - parseRfc3339DateTimeWithOffset: () => parseRfc3339DateTimeWithOffset, - parseRfc7231DateTime: () => parseRfc7231DateTime, - quoteHeader: () => quoteHeader, - splitEvery: () => splitEvery, - splitHeader: () => splitHeader, - strictParseByte: () => strictParseByte, - strictParseDouble: () => strictParseDouble, - strictParseFloat: () => strictParseFloat, - strictParseFloat32: () => strictParseFloat32, - strictParseInt: () => strictParseInt, - strictParseInt32: () => strictParseInt32, - strictParseLong: () => strictParseLong, - strictParseShort: () => strictParseShort -}); -module.exports = __toCommonJS(index_exports); - -// src/submodules/serde/copyDocumentWithTransform.ts -var copyDocumentWithTransform = (source, schemaRef, transform = (_) => _) => source; - -// src/submodules/serde/parse-utils.ts -var parseBoolean = (value) => { - switch (value) { - case "true": - return true; - case "false": - return false; - default: - throw new Error(`Unable to parse boolean value "${value}"`); - } -}; -var expectBoolean = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "number") { - if (value === 0 || value === 1) { - logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); - } - if (value === 0) { - return false; - } - if (value === 1) { - return true; - } - } - if (typeof value === "string") { - const lower = value.toLowerCase(); - if (lower === "false" || lower === "true") { - logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); - } - if (lower === "false") { - return false; - } - if (lower === "true") { - return true; - } - } - if (typeof value === "boolean") { - return value; - } - throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); -}; -var expectNumber = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "string") { - const parsed = parseFloat(value); - if (!Number.isNaN(parsed)) { - if (String(parsed) !== String(value)) { - logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); - } - return parsed; - } - } - if (typeof value === "number") { - return value; - } - throw new TypeError(`Expected number, got ${typeof value}: ${value}`); -}; -var MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); -var expectFloat32 = (value) => { - const expected = expectNumber(value); - if (expected !== void 0 && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { - if (Math.abs(expected) > MAX_FLOAT) { - throw new TypeError(`Expected 32-bit float, got ${value}`); - } - } - return expected; -}; -var expectLong = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (Number.isInteger(value) && !Number.isNaN(value)) { - return value; - } - throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); -}; -var expectInt = expectLong; -var expectInt32 = (value) => expectSizedInt(value, 32); -var expectShort = (value) => expectSizedInt(value, 16); -var expectByte = (value) => expectSizedInt(value, 8); -var expectSizedInt = (value, size) => { - const expected = expectLong(value); - if (expected !== void 0 && castInt(expected, size) !== expected) { - throw new TypeError(`Expected ${size}-bit integer, got ${value}`); - } - return expected; -}; -var castInt = (value, size) => { - switch (size) { - case 32: - return Int32Array.of(value)[0]; - case 16: - return Int16Array.of(value)[0]; - case 8: - return Int8Array.of(value)[0]; - } -}; -var expectNonNull = (value, location) => { - if (value === null || value === void 0) { - if (location) { - throw new TypeError(`Expected a non-null value for ${location}`); - } - throw new TypeError("Expected a non-null value"); - } - return value; -}; -var expectObject = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "object" && !Array.isArray(value)) { - return value; - } - const receivedType = Array.isArray(value) ? "array" : typeof value; - throw new TypeError(`Expected object, got ${receivedType}: ${value}`); -}; -var expectString = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value === "string") { - return value; - } - if (["boolean", "number", "bigint"].includes(typeof value)) { - logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); - return String(value); - } - throw new TypeError(`Expected string, got ${typeof value}: ${value}`); -}; -var expectUnion = (value) => { - if (value === null || value === void 0) { - return void 0; - } - const asObject = expectObject(value); - const setKeys = Object.entries(asObject).filter(([, v]) => v != null).map(([k]) => k); - if (setKeys.length === 0) { - throw new TypeError(`Unions must have exactly one non-null member. None were found.`); - } - if (setKeys.length > 1) { - throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); - } - return asObject; -}; -var strictParseDouble = (value) => { - if (typeof value == "string") { - return expectNumber(parseNumber(value)); - } - return expectNumber(value); -}; -var strictParseFloat = strictParseDouble; -var strictParseFloat32 = (value) => { - if (typeof value == "string") { - return expectFloat32(parseNumber(value)); - } - return expectFloat32(value); -}; -var NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; -var parseNumber = (value) => { - const matches = value.match(NUMBER_REGEX); - if (matches === null || matches[0].length !== value.length) { - throw new TypeError(`Expected real number, got implicit NaN`); - } - return parseFloat(value); -}; -var limitedParseDouble = (value) => { - if (typeof value == "string") { - return parseFloatString(value); - } - return expectNumber(value); -}; -var handleFloat = limitedParseDouble; -var limitedParseFloat = limitedParseDouble; -var limitedParseFloat32 = (value) => { - if (typeof value == "string") { - return parseFloatString(value); - } - return expectFloat32(value); -}; -var parseFloatString = (value) => { - switch (value) { - case "NaN": - return NaN; - case "Infinity": - return Infinity; - case "-Infinity": - return -Infinity; - default: - throw new Error(`Unable to parse float value: ${value}`); - } -}; -var strictParseLong = (value) => { - if (typeof value === "string") { - return expectLong(parseNumber(value)); - } - return expectLong(value); -}; -var strictParseInt = strictParseLong; -var strictParseInt32 = (value) => { - if (typeof value === "string") { - return expectInt32(parseNumber(value)); - } - return expectInt32(value); -}; -var strictParseShort = (value) => { - if (typeof value === "string") { - return expectShort(parseNumber(value)); - } - return expectShort(value); -}; -var strictParseByte = (value) => { - if (typeof value === "string") { - return expectByte(parseNumber(value)); - } - return expectByte(value); -}; -var stackTraceWarning = (message) => { - return String(new TypeError(message).stack || message).split("\n").slice(0, 5).filter((s) => !s.includes("stackTraceWarning")).join("\n"); -}; -var logger = { - warn: console.warn -}; - -// src/submodules/serde/date-utils.ts -var DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; -var MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; -function dateToUtcString(date) { - const year = date.getUTCFullYear(); - const month = date.getUTCMonth(); - const dayOfWeek = date.getUTCDay(); - const dayOfMonthInt = date.getUTCDate(); - const hoursInt = date.getUTCHours(); - const minutesInt = date.getUTCMinutes(); - const secondsInt = date.getUTCSeconds(); - const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; - const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; - const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; - const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; - return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; -} -var RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); -var parseRfc3339DateTime = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value !== "string") { - throw new TypeError("RFC-3339 date-times must be expressed as strings"); - } - const match = RFC3339.exec(value); - if (!match) { - throw new TypeError("Invalid RFC-3339 date-time value"); - } - const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; - const year = strictParseShort(stripLeadingZeroes(yearStr)); - const month = parseDateValue(monthStr, "month", 1, 12); - const day = parseDateValue(dayStr, "day", 1, 31); - return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); -}; -var RFC3339_WITH_OFFSET = new RegExp( - /^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/ -); -var parseRfc3339DateTimeWithOffset = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value !== "string") { - throw new TypeError("RFC-3339 date-times must be expressed as strings"); - } - const match = RFC3339_WITH_OFFSET.exec(value); - if (!match) { - throw new TypeError("Invalid RFC-3339 date-time value"); - } - const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; - const year = strictParseShort(stripLeadingZeroes(yearStr)); - const month = parseDateValue(monthStr, "month", 1, 12); - const day = parseDateValue(dayStr, "day", 1, 31); - const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); - if (offsetStr.toUpperCase() != "Z") { - date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); - } - return date; -}; -var IMF_FIXDATE = new RegExp( - /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ -); -var RFC_850_DATE = new RegExp( - /^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ -); -var ASC_TIME = new RegExp( - /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/ -); -var parseRfc7231DateTime = (value) => { - if (value === null || value === void 0) { - return void 0; - } - if (typeof value !== "string") { - throw new TypeError("RFC-7231 date-times must be expressed as strings"); - } - let match = IMF_FIXDATE.exec(value); - if (match) { - const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; - return buildDate( - strictParseShort(stripLeadingZeroes(yearStr)), - parseMonthByShortName(monthStr), - parseDateValue(dayStr, "day", 1, 31), - { hours, minutes, seconds, fractionalMilliseconds } - ); - } - match = RFC_850_DATE.exec(value); - if (match) { - const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; - return adjustRfc850Year( - buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { - hours, - minutes, - seconds, - fractionalMilliseconds - }) - ); - } - match = ASC_TIME.exec(value); - if (match) { - const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; - return buildDate( - strictParseShort(stripLeadingZeroes(yearStr)), - parseMonthByShortName(monthStr), - parseDateValue(dayStr.trimLeft(), "day", 1, 31), - { hours, minutes, seconds, fractionalMilliseconds } - ); - } - throw new TypeError("Invalid RFC-7231 date-time value"); -}; -var parseEpochTimestamp = (value) => { - if (value === null || value === void 0) { - return void 0; - } - let valueAsDouble; - if (typeof value === "number") { - valueAsDouble = value; - } else if (typeof value === "string") { - valueAsDouble = strictParseDouble(value); - } else if (typeof value === "object" && value.tag === 1) { - valueAsDouble = value.value; - } else { - throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); - } - if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { - throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); - } - return new Date(Math.round(valueAsDouble * 1e3)); -}; -var buildDate = (year, month, day, time) => { - const adjustedMonth = month - 1; - validateDayOfMonth(year, adjustedMonth, day); - return new Date( - Date.UTC( - year, - adjustedMonth, - day, - parseDateValue(time.hours, "hour", 0, 23), - parseDateValue(time.minutes, "minute", 0, 59), - // seconds can go up to 60 for leap seconds - parseDateValue(time.seconds, "seconds", 0, 60), - parseMilliseconds(time.fractionalMilliseconds) - ) - ); -}; -var parseTwoDigitYear = (value) => { - const thisYear = (/* @__PURE__ */ new Date()).getUTCFullYear(); - const valueInThisCentury = Math.floor(thisYear / 100) * 100 + strictParseShort(stripLeadingZeroes(value)); - if (valueInThisCentury < thisYear) { - return valueInThisCentury + 100; - } - return valueInThisCentury; -}; -var FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1e3; -var adjustRfc850Year = (input) => { - if (input.getTime() - (/* @__PURE__ */ new Date()).getTime() > FIFTY_YEARS_IN_MILLIS) { - return new Date( - Date.UTC( - input.getUTCFullYear() - 100, - input.getUTCMonth(), - input.getUTCDate(), - input.getUTCHours(), - input.getUTCMinutes(), - input.getUTCSeconds(), - input.getUTCMilliseconds() - ) - ); - } - return input; -}; -var parseMonthByShortName = (value) => { - const monthIdx = MONTHS.indexOf(value); - if (monthIdx < 0) { - throw new TypeError(`Invalid month: ${value}`); - } - return monthIdx + 1; -}; -var DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; -var validateDayOfMonth = (year, month, day) => { - let maxDays = DAYS_IN_MONTH[month]; - if (month === 1 && isLeapYear(year)) { - maxDays = 29; - } - if (day > maxDays) { - throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); - } -}; -var isLeapYear = (year) => { - return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); -}; -var parseDateValue = (value, type, lower, upper) => { - const dateVal = strictParseByte(stripLeadingZeroes(value)); - if (dateVal < lower || dateVal > upper) { - throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); - } - return dateVal; -}; -var parseMilliseconds = (value) => { - if (value === null || value === void 0) { - return 0; - } - return strictParseFloat32("0." + value) * 1e3; -}; -var parseOffsetToMilliseconds = (value) => { - const directionStr = value[0]; - let direction = 1; - if (directionStr == "+") { - direction = 1; - } else if (directionStr == "-") { - direction = -1; - } else { - throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); - } - const hour = Number(value.substring(1, 3)); - const minute = Number(value.substring(4, 6)); - return direction * (hour * 60 + minute) * 60 * 1e3; -}; -var stripLeadingZeroes = (value) => { - let idx = 0; - while (idx < value.length - 1 && value.charAt(idx) === "0") { - idx++; - } - if (idx === 0) { - return value; - } - return value.slice(idx); -}; - -// src/submodules/serde/generateIdempotencyToken.ts -var import_uuid = __nccwpck_require__(2048); - -// src/submodules/serde/lazy-json.ts -var LazyJsonString = function LazyJsonString2(val) { - const str = Object.assign(new String(val), { - deserializeJSON() { - return JSON.parse(String(val)); - }, - toString() { - return String(val); - }, - toJSON() { - return String(val); - } - }); - return str; -}; -LazyJsonString.from = (object) => { - if (object && typeof object === "object" && (object instanceof LazyJsonString || "deserializeJSON" in object)) { - return object; - } else if (typeof object === "string" || Object.getPrototypeOf(object) === String.prototype) { - return LazyJsonString(String(object)); - } - return LazyJsonString(JSON.stringify(object)); -}; -LazyJsonString.fromObject = LazyJsonString.from; - -// src/submodules/serde/quote-header.ts -function quoteHeader(part) { - if (part.includes(",") || part.includes('"')) { - part = `"${part.replace(/"/g, '\\"')}"`; - } - return part; -} - -// src/submodules/serde/split-every.ts -function splitEvery(value, delimiter, numDelimiters) { - if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { - throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); - } - const segments = value.split(delimiter); - if (numDelimiters === 1) { - return segments; - } - const compoundSegments = []; - let currentSegment = ""; - for (let i = 0; i < segments.length; i++) { - if (currentSegment === "") { - currentSegment = segments[i]; - } else { - currentSegment += delimiter + segments[i]; - } - if ((i + 1) % numDelimiters === 0) { - compoundSegments.push(currentSegment); - currentSegment = ""; - } - } - if (currentSegment !== "") { - compoundSegments.push(currentSegment); - } - return compoundSegments; -} - -// src/submodules/serde/split-header.ts -var splitHeader = (value) => { - const z = value.length; - const values = []; - let withinQuotes = false; - let prevChar = void 0; - let anchor = 0; - for (let i = 0; i < z; ++i) { - const char = value[i]; - switch (char) { - case `"`: - if (prevChar !== "\\") { - withinQuotes = !withinQuotes; - } - break; - case ",": - if (!withinQuotes) { - values.push(value.slice(anchor, i)); - anchor = i + 1; - } - break; - default: - } - prevChar = char; - } - values.push(value.slice(anchor)); - return values.map((v) => { - v = v.trim(); - const z2 = v.length; - if (z2 < 2) { - return v; - } - if (v[0] === `"` && v[z2 - 1] === `"`) { - v = v.slice(1, z2 - 1); - } - return v.replace(/\\"/g, '"'); - }); -}; - -// src/submodules/serde/value/NumericValue.ts -var NumericValue = class _NumericValue { - constructor(string, type) { - this.string = string; - this.type = type; - let dot = 0; - for (let i = 0; i < string.length; ++i) { - const char = string.charCodeAt(i); - if (i === 0 && char === 45) { - continue; - } - if (char === 46) { - if (dot) { - throw new Error("@smithy/core/serde - NumericValue must contain at most one decimal point."); - } - dot = 1; - continue; - } - if (char < 48 || char > 57) { - throw new Error( - `@smithy/core/serde - NumericValue must only contain [0-9], at most one decimal point ".", and an optional negation prefix "-".` - ); - } - } - } - toString() { - return this.string; - } - static [Symbol.hasInstance](object) { - if (!object || typeof object !== "object") { - return false; - } - const _nv = object; - const prototypeMatch = _NumericValue.prototype.isPrototypeOf(object); - if (prototypeMatch) { - return prototypeMatch; - } - if (typeof _nv.string === "string" && typeof _nv.type === "string" && _nv.constructor?.name?.endsWith("NumericValue")) { - return true; - } - return prototypeMatch; - } -}; -function nv(input) { - return new NumericValue(String(input), "bigDecimal"); -} -// Annotate the CommonJS export names for ESM import in node: -0 && (0); - - -/***/ }), - -/***/ 566: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - DEFAULT_MAX_RETRIES: () => DEFAULT_MAX_RETRIES, - DEFAULT_TIMEOUT: () => DEFAULT_TIMEOUT, - ENV_CMDS_AUTH_TOKEN: () => ENV_CMDS_AUTH_TOKEN, - ENV_CMDS_FULL_URI: () => ENV_CMDS_FULL_URI, - ENV_CMDS_RELATIVE_URI: () => ENV_CMDS_RELATIVE_URI, - Endpoint: () => Endpoint, - fromContainerMetadata: () => fromContainerMetadata, - fromInstanceMetadata: () => fromInstanceMetadata, - getInstanceMetadataEndpoint: () => getInstanceMetadataEndpoint, - httpRequest: () => httpRequest, - providerConfigFromInit: () => providerConfigFromInit -}); -module.exports = __toCommonJS(index_exports); - -// src/fromContainerMetadata.ts - -var import_url = __nccwpck_require__(7016); - -// src/remoteProvider/httpRequest.ts -var import_property_provider = __nccwpck_require__(1238); -var import_buffer = __nccwpck_require__(181); -var import_http = __nccwpck_require__(8611); -function httpRequest(options) { - return new Promise((resolve, reject) => { - const req = (0, import_http.request)({ - method: "GET", - ...options, - // Node.js http module doesn't accept hostname with square brackets - // Refs: https://github.com/nodejs/node/issues/39738 - hostname: options.hostname?.replace(/^\[(.+)\]$/, "$1") - }); - req.on("error", (err) => { - reject(Object.assign(new import_property_provider.ProviderError("Unable to connect to instance metadata service"), err)); - req.destroy(); - }); - req.on("timeout", () => { - reject(new import_property_provider.ProviderError("TimeoutError from instance metadata service")); - req.destroy(); - }); - req.on("response", (res) => { - const { statusCode = 400 } = res; - if (statusCode < 200 || 300 <= statusCode) { - reject( - Object.assign(new import_property_provider.ProviderError("Error response received from instance metadata service"), { statusCode }) - ); - req.destroy(); - } - const chunks = []; - res.on("data", (chunk) => { - chunks.push(chunk); - }); - res.on("end", () => { - resolve(import_buffer.Buffer.concat(chunks)); - req.destroy(); - }); - }); - req.end(); - }); -} -__name(httpRequest, "httpRequest"); - -// src/remoteProvider/ImdsCredentials.ts -var isImdsCredentials = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.AccessKeyId === "string" && typeof arg.SecretAccessKey === "string" && typeof arg.Token === "string" && typeof arg.Expiration === "string", "isImdsCredentials"); -var fromImdsCredentials = /* @__PURE__ */ __name((creds) => ({ - accessKeyId: creds.AccessKeyId, - secretAccessKey: creds.SecretAccessKey, - sessionToken: creds.Token, - expiration: new Date(creds.Expiration), - ...creds.AccountId && { accountId: creds.AccountId } -}), "fromImdsCredentials"); - -// src/remoteProvider/RemoteProviderInit.ts -var DEFAULT_TIMEOUT = 1e3; -var DEFAULT_MAX_RETRIES = 0; -var providerConfigFromInit = /* @__PURE__ */ __name(({ - maxRetries = DEFAULT_MAX_RETRIES, - timeout = DEFAULT_TIMEOUT -}) => ({ maxRetries, timeout }), "providerConfigFromInit"); - -// src/remoteProvider/retry.ts -var retry = /* @__PURE__ */ __name((toRetry, maxRetries) => { - let promise = toRetry(); - for (let i = 0; i < maxRetries; i++) { - promise = promise.catch(toRetry); - } - return promise; -}, "retry"); - -// src/fromContainerMetadata.ts -var ENV_CMDS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; -var ENV_CMDS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; -var ENV_CMDS_AUTH_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; -var fromContainerMetadata = /* @__PURE__ */ __name((init = {}) => { - const { timeout, maxRetries } = providerConfigFromInit(init); - return () => retry(async () => { - const requestOptions = await getCmdsUri({ logger: init.logger }); - const credsResponse = JSON.parse(await requestFromEcsImds(timeout, requestOptions)); - if (!isImdsCredentials(credsResponse)) { - throw new import_property_provider.CredentialsProviderError("Invalid response received from instance metadata service.", { - logger: init.logger - }); - } - return fromImdsCredentials(credsResponse); - }, maxRetries); -}, "fromContainerMetadata"); -var requestFromEcsImds = /* @__PURE__ */ __name(async (timeout, options) => { - if (process.env[ENV_CMDS_AUTH_TOKEN]) { - options.headers = { - ...options.headers, - Authorization: process.env[ENV_CMDS_AUTH_TOKEN] - }; - } - const buffer = await httpRequest({ - ...options, - timeout - }); - return buffer.toString(); -}, "requestFromEcsImds"); -var CMDS_IP = "169.254.170.2"; -var GREENGRASS_HOSTS = { - localhost: true, - "127.0.0.1": true -}; -var GREENGRASS_PROTOCOLS = { - "http:": true, - "https:": true -}; -var getCmdsUri = /* @__PURE__ */ __name(async ({ logger }) => { - if (process.env[ENV_CMDS_RELATIVE_URI]) { - return { - hostname: CMDS_IP, - path: process.env[ENV_CMDS_RELATIVE_URI] - }; - } - if (process.env[ENV_CMDS_FULL_URI]) { - const parsed = (0, import_url.parse)(process.env[ENV_CMDS_FULL_URI]); - if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) { - throw new import_property_provider.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, { - tryNextLink: false, - logger - }); - } - if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) { - throw new import_property_provider.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, { - tryNextLink: false, - logger - }); - } - return { - ...parsed, - port: parsed.port ? parseInt(parsed.port, 10) : void 0 - }; - } - throw new import_property_provider.CredentialsProviderError( - `The container metadata credential provider cannot be used unless the ${ENV_CMDS_RELATIVE_URI} or ${ENV_CMDS_FULL_URI} environment variable is set`, - { - tryNextLink: false, - logger - } - ); -}, "getCmdsUri"); - -// src/fromInstanceMetadata.ts - - - -// src/error/InstanceMetadataV1FallbackError.ts - -var InstanceMetadataV1FallbackError = class _InstanceMetadataV1FallbackError extends import_property_provider.CredentialsProviderError { - constructor(message, tryNextLink = true) { - super(message, tryNextLink); - this.tryNextLink = tryNextLink; - this.name = "InstanceMetadataV1FallbackError"; - Object.setPrototypeOf(this, _InstanceMetadataV1FallbackError.prototype); - } - static { - __name(this, "InstanceMetadataV1FallbackError"); - } -}; - -// src/utils/getInstanceMetadataEndpoint.ts -var import_node_config_provider = __nccwpck_require__(5704); -var import_url_parser = __nccwpck_require__(4494); - -// src/config/Endpoint.ts -var Endpoint = /* @__PURE__ */ ((Endpoint2) => { - Endpoint2["IPv4"] = "http://169.254.169.254"; - Endpoint2["IPv6"] = "http://[fd00:ec2::254]"; - return Endpoint2; -})(Endpoint || {}); - -// src/config/EndpointConfigOptions.ts -var ENV_ENDPOINT_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT"; -var CONFIG_ENDPOINT_NAME = "ec2_metadata_service_endpoint"; -var ENDPOINT_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env) => env[ENV_ENDPOINT_NAME], "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => profile[CONFIG_ENDPOINT_NAME], "configFileSelector"), - default: void 0 -}; - -// src/config/EndpointMode.ts -var EndpointMode = /* @__PURE__ */ ((EndpointMode2) => { - EndpointMode2["IPv4"] = "IPv4"; - EndpointMode2["IPv6"] = "IPv6"; - return EndpointMode2; -})(EndpointMode || {}); - -// src/config/EndpointModeConfigOptions.ts -var ENV_ENDPOINT_MODE_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT_MODE"; -var CONFIG_ENDPOINT_MODE_NAME = "ec2_metadata_service_endpoint_mode"; -var ENDPOINT_MODE_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env) => env[ENV_ENDPOINT_MODE_NAME], "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => profile[CONFIG_ENDPOINT_MODE_NAME], "configFileSelector"), - default: "IPv4" /* IPv4 */ -}; - -// src/utils/getInstanceMetadataEndpoint.ts -var getInstanceMetadataEndpoint = /* @__PURE__ */ __name(async () => (0, import_url_parser.parseUrl)(await getFromEndpointConfig() || await getFromEndpointModeConfig()), "getInstanceMetadataEndpoint"); -var getFromEndpointConfig = /* @__PURE__ */ __name(async () => (0, import_node_config_provider.loadConfig)(ENDPOINT_CONFIG_OPTIONS)(), "getFromEndpointConfig"); -var getFromEndpointModeConfig = /* @__PURE__ */ __name(async () => { - const endpointMode = await (0, import_node_config_provider.loadConfig)(ENDPOINT_MODE_CONFIG_OPTIONS)(); - switch (endpointMode) { - case "IPv4" /* IPv4 */: - return "http://169.254.169.254" /* IPv4 */; - case "IPv6" /* IPv6 */: - return "http://[fd00:ec2::254]" /* IPv6 */; - default: - throw new Error(`Unsupported endpoint mode: ${endpointMode}. Select from ${Object.values(EndpointMode)}`); - } -}, "getFromEndpointModeConfig"); - -// src/utils/getExtendedInstanceMetadataCredentials.ts -var STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60; -var STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60; -var STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html"; -var getExtendedInstanceMetadataCredentials = /* @__PURE__ */ __name((credentials, logger) => { - const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS + Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS); - const newExpiration = new Date(Date.now() + refreshInterval * 1e3); - logger.warn( - `Attempting credential expiration extension due to a credential service availability issue. A refresh of these credentials will be attempted after ${new Date(newExpiration)}. -For more information, please visit: ` + STATIC_STABILITY_DOC_URL - ); - const originalExpiration = credentials.originalExpiration ?? credentials.expiration; - return { - ...credentials, - ...originalExpiration ? { originalExpiration } : {}, - expiration: newExpiration - }; -}, "getExtendedInstanceMetadataCredentials"); - -// src/utils/staticStabilityProvider.ts -var staticStabilityProvider = /* @__PURE__ */ __name((provider, options = {}) => { - const logger = options?.logger || console; - let pastCredentials; - return async () => { - let credentials; - try { - credentials = await provider(); - if (credentials.expiration && credentials.expiration.getTime() < Date.now()) { - credentials = getExtendedInstanceMetadataCredentials(credentials, logger); - } - } catch (e) { - if (pastCredentials) { - logger.warn("Credential renew failed: ", e); - credentials = getExtendedInstanceMetadataCredentials(pastCredentials, logger); - } else { - throw e; - } - } - pastCredentials = credentials; - return credentials; - }; -}, "staticStabilityProvider"); - -// src/fromInstanceMetadata.ts -var IMDS_PATH = "/latest/meta-data/iam/security-credentials/"; -var IMDS_TOKEN_PATH = "/latest/api/token"; -var AWS_EC2_METADATA_V1_DISABLED = "AWS_EC2_METADATA_V1_DISABLED"; -var PROFILE_AWS_EC2_METADATA_V1_DISABLED = "ec2_metadata_v1_disabled"; -var X_AWS_EC2_METADATA_TOKEN = "x-aws-ec2-metadata-token"; -var fromInstanceMetadata = /* @__PURE__ */ __name((init = {}) => staticStabilityProvider(getInstanceMetadataProvider(init), { logger: init.logger }), "fromInstanceMetadata"); -var getInstanceMetadataProvider = /* @__PURE__ */ __name((init = {}) => { - let disableFetchToken = false; - const { logger, profile } = init; - const { timeout, maxRetries } = providerConfigFromInit(init); - const getCredentials = /* @__PURE__ */ __name(async (maxRetries2, options) => { - const isImdsV1Fallback = disableFetchToken || options.headers?.[X_AWS_EC2_METADATA_TOKEN] == null; - if (isImdsV1Fallback) { - let fallbackBlockedFromProfile = false; - let fallbackBlockedFromProcessEnv = false; - const configValue = await (0, import_node_config_provider.loadConfig)( - { - environmentVariableSelector: /* @__PURE__ */ __name((env) => { - const envValue = env[AWS_EC2_METADATA_V1_DISABLED]; - fallbackBlockedFromProcessEnv = !!envValue && envValue !== "false"; - if (envValue === void 0) { - throw new import_property_provider.CredentialsProviderError( - `${AWS_EC2_METADATA_V1_DISABLED} not set in env, checking config file next.`, - { logger: init.logger } - ); - } - return fallbackBlockedFromProcessEnv; - }, "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile2) => { - const profileValue = profile2[PROFILE_AWS_EC2_METADATA_V1_DISABLED]; - fallbackBlockedFromProfile = !!profileValue && profileValue !== "false"; - return fallbackBlockedFromProfile; - }, "configFileSelector"), - default: false - }, - { - profile - } - )(); - if (init.ec2MetadataV1Disabled || configValue) { - const causes = []; - if (init.ec2MetadataV1Disabled) - causes.push("credential provider initialization (runtime option ec2MetadataV1Disabled)"); - if (fallbackBlockedFromProfile) causes.push(`config file profile (${PROFILE_AWS_EC2_METADATA_V1_DISABLED})`); - if (fallbackBlockedFromProcessEnv) - causes.push(`process environment variable (${AWS_EC2_METADATA_V1_DISABLED})`); - throw new InstanceMetadataV1FallbackError( - `AWS EC2 Metadata v1 fallback has been blocked by AWS SDK configuration in the following: [${causes.join( - ", " - )}].` - ); - } - } - const imdsProfile = (await retry(async () => { - let profile2; - try { - profile2 = await getProfile(options); - } catch (err) { - if (err.statusCode === 401) { - disableFetchToken = false; - } - throw err; - } - return profile2; - }, maxRetries2)).trim(); - return retry(async () => { - let creds; - try { - creds = await getCredentialsFromProfile(imdsProfile, options, init); - } catch (err) { - if (err.statusCode === 401) { - disableFetchToken = false; - } - throw err; - } - return creds; - }, maxRetries2); - }, "getCredentials"); - return async () => { - const endpoint = await getInstanceMetadataEndpoint(); - if (disableFetchToken) { - logger?.debug("AWS SDK Instance Metadata", "using v1 fallback (no token fetch)"); - return getCredentials(maxRetries, { ...endpoint, timeout }); - } else { - let token; - try { - token = (await getMetadataToken({ ...endpoint, timeout })).toString(); - } catch (error) { - if (error?.statusCode === 400) { - throw Object.assign(error, { - message: "EC2 Metadata token request returned error" - }); - } else if (error.message === "TimeoutError" || [403, 404, 405].includes(error.statusCode)) { - disableFetchToken = true; - } - logger?.debug("AWS SDK Instance Metadata", "using v1 fallback (initial)"); - return getCredentials(maxRetries, { ...endpoint, timeout }); - } - return getCredentials(maxRetries, { - ...endpoint, - headers: { - [X_AWS_EC2_METADATA_TOKEN]: token - }, - timeout - }); - } - }; -}, "getInstanceMetadataProvider"); -var getMetadataToken = /* @__PURE__ */ __name(async (options) => httpRequest({ - ...options, - path: IMDS_TOKEN_PATH, - method: "PUT", - headers: { - "x-aws-ec2-metadata-token-ttl-seconds": "21600" - } -}), "getMetadataToken"); -var getProfile = /* @__PURE__ */ __name(async (options) => (await httpRequest({ ...options, path: IMDS_PATH })).toString(), "getProfile"); -var getCredentialsFromProfile = /* @__PURE__ */ __name(async (profile, options, init) => { - const credentialsResponse = JSON.parse( - (await httpRequest({ - ...options, - path: IMDS_PATH + profile - })).toString() - ); - if (!isImdsCredentials(credentialsResponse)) { - throw new import_property_provider.CredentialsProviderError("Invalid response received from instance metadata service.", { - logger: init.logger - }); - } - return fromImdsCredentials(credentialsResponse); -}, "getCredentialsFromProfile"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 7809: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - FetchHttpHandler: () => FetchHttpHandler, - keepAliveSupport: () => keepAliveSupport, - streamCollector: () => streamCollector -}); -module.exports = __toCommonJS(index_exports); - -// src/fetch-http-handler.ts -var import_protocol_http = __nccwpck_require__(2356); -var import_querystring_builder = __nccwpck_require__(8256); - -// src/create-request.ts -function createRequest(url, requestOptions) { - return new Request(url, requestOptions); -} -__name(createRequest, "createRequest"); - -// src/request-timeout.ts -function requestTimeout(timeoutInMs = 0) { - return new Promise((resolve, reject) => { - if (timeoutInMs) { - setTimeout(() => { - const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`); - timeoutError.name = "TimeoutError"; - reject(timeoutError); - }, timeoutInMs); - } - }); -} -__name(requestTimeout, "requestTimeout"); - -// src/fetch-http-handler.ts -var keepAliveSupport = { - supported: void 0 -}; -var FetchHttpHandler = class _FetchHttpHandler { - static { - __name(this, "FetchHttpHandler"); - } - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof instanceOrOptions?.handle === "function") { - return instanceOrOptions; - } - return new _FetchHttpHandler(instanceOrOptions); - } - constructor(options) { - if (typeof options === "function") { - this.configProvider = options().then((opts) => opts || {}); - } else { - this.config = options ?? {}; - this.configProvider = Promise.resolve(this.config); - } - if (keepAliveSupport.supported === void 0) { - keepAliveSupport.supported = Boolean( - typeof Request !== "undefined" && "keepalive" in createRequest("https://[::1]") - ); - } - } - destroy() { - } - async handle(request, { abortSignal, requestTimeout: requestTimeout2 } = {}) { - if (!this.config) { - this.config = await this.configProvider; - } - const requestTimeoutInMs = requestTimeout2 ?? this.config.requestTimeout; - const keepAlive = this.config.keepAlive === true; - const credentials = this.config.credentials; - if (abortSignal?.aborted) { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - return Promise.reject(abortError); - } - let path = request.path; - const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); - if (queryString) { - path += `?${queryString}`; - } - if (request.fragment) { - path += `#${request.fragment}`; - } - let auth = ""; - if (request.username != null || request.password != null) { - const username = request.username ?? ""; - const password = request.password ?? ""; - auth = `${username}:${password}@`; - } - const { port, method } = request; - const url = `${request.protocol}//${auth}${request.hostname}${port ? `:${port}` : ""}${path}`; - const body = method === "GET" || method === "HEAD" ? void 0 : request.body; - const requestOptions = { - body, - headers: new Headers(request.headers), - method, - credentials - }; - if (this.config?.cache) { - requestOptions.cache = this.config.cache; - } - if (body) { - requestOptions.duplex = "half"; - } - if (typeof AbortController !== "undefined") { - requestOptions.signal = abortSignal; - } - if (keepAliveSupport.supported) { - requestOptions.keepalive = keepAlive; - } - if (typeof this.config.requestInit === "function") { - Object.assign(requestOptions, this.config.requestInit(request)); - } - let removeSignalEventListener = /* @__PURE__ */ __name(() => { - }, "removeSignalEventListener"); - const fetchRequest = createRequest(url, requestOptions); - const raceOfPromises = [ - fetch(fetchRequest).then((response) => { - const fetchHeaders = response.headers; - const transformedHeaders = {}; - for (const pair of fetchHeaders.entries()) { - transformedHeaders[pair[0]] = pair[1]; - } - const hasReadableStream = response.body != void 0; - if (!hasReadableStream) { - return response.blob().then((body2) => ({ - response: new import_protocol_http.HttpResponse({ - headers: transformedHeaders, - reason: response.statusText, - statusCode: response.status, - body: body2 - }) - })); - } - return { - response: new import_protocol_http.HttpResponse({ - headers: transformedHeaders, - reason: response.statusText, - statusCode: response.status, - body: response.body - }) - }; - }), - requestTimeout(requestTimeoutInMs) - ]; - if (abortSignal) { - raceOfPromises.push( - new Promise((resolve, reject) => { - const onAbort = /* @__PURE__ */ __name(() => { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - removeSignalEventListener = /* @__PURE__ */ __name(() => signal.removeEventListener("abort", onAbort), "removeSignalEventListener"); - } else { - abortSignal.onabort = onAbort; - } - }) - ); - } - return Promise.race(raceOfPromises).finally(removeSignalEventListener); - } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - config[key] = value; - return config; - }); - } - httpHandlerConfigs() { - return this.config ?? {}; - } -}; - -// src/stream-collector.ts -var import_util_base64 = __nccwpck_require__(8385); -var streamCollector = /* @__PURE__ */ __name(async (stream) => { - if (typeof Blob === "function" && stream instanceof Blob || stream.constructor?.name === "Blob") { - if (Blob.prototype.arrayBuffer !== void 0) { - return new Uint8Array(await stream.arrayBuffer()); - } - return collectBlob(stream); - } - return collectStream(stream); -}, "streamCollector"); -async function collectBlob(blob) { - const base64 = await readToBase64(blob); - const arrayBuffer = (0, import_util_base64.fromBase64)(base64); - return new Uint8Array(arrayBuffer); -} -__name(collectBlob, "collectBlob"); -async function collectStream(stream) { - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - let length = 0; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - length += value.length; - } - isDone = done; - } - const collected = new Uint8Array(length); - let offset = 0; - for (const chunk of chunks) { - collected.set(chunk, offset); - offset += chunk.length; - } - return collected; -} -__name(collectStream, "collectStream"); -function readToBase64(blob) { - return new Promise((resolve, reject) => { - const reader = new FileReader(); - reader.onloadend = () => { - if (reader.readyState !== 2) { - return reject(new Error("Reader aborted too early")); - } - const result = reader.result ?? ""; - const commaIndex = result.indexOf(","); - const dataOffset = commaIndex > -1 ? commaIndex + 1 : result.length; - resolve(result.substring(dataOffset)); - }; - reader.onabort = () => reject(new Error("Read aborted")); - reader.onerror = () => reject(reader.error); - reader.readAsDataURL(blob); - }); -} -__name(readToBase64, "readToBase64"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 5092: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - Hash: () => Hash -}); -module.exports = __toCommonJS(index_exports); -var import_util_buffer_from = __nccwpck_require__(4151); -var import_util_utf8 = __nccwpck_require__(1577); -var import_buffer = __nccwpck_require__(181); -var import_crypto = __nccwpck_require__(6982); -var Hash = class { - static { - __name(this, "Hash"); - } - constructor(algorithmIdentifier, secret) { - this.algorithmIdentifier = algorithmIdentifier; - this.secret = secret; - this.reset(); - } - update(toHash, encoding) { - this.hash.update((0, import_util_utf8.toUint8Array)(castSourceData(toHash, encoding))); - } - digest() { - return Promise.resolve(this.hash.digest()); - } - reset() { - this.hash = this.secret ? (0, import_crypto.createHmac)(this.algorithmIdentifier, castSourceData(this.secret)) : (0, import_crypto.createHash)(this.algorithmIdentifier); - } -}; -function castSourceData(toCast, encoding) { - if (import_buffer.Buffer.isBuffer(toCast)) { - return toCast; - } - if (typeof toCast === "string") { - return (0, import_util_buffer_from.fromString)(toCast, encoding); - } - if (ArrayBuffer.isView(toCast)) { - return (0, import_util_buffer_from.fromArrayBuffer)(toCast.buffer, toCast.byteOffset, toCast.byteLength); - } - return (0, import_util_buffer_from.fromArrayBuffer)(toCast); -} -__name(castSourceData, "castSourceData"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 6130: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - isArrayBuffer: () => isArrayBuffer -}); -module.exports = __toCommonJS(index_exports); -var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 7212: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - contentLengthMiddleware: () => contentLengthMiddleware, - contentLengthMiddlewareOptions: () => contentLengthMiddlewareOptions, - getContentLengthPlugin: () => getContentLengthPlugin -}); -module.exports = __toCommonJS(index_exports); -var import_protocol_http = __nccwpck_require__(2356); -var CONTENT_LENGTH_HEADER = "content-length"; -function contentLengthMiddleware(bodyLengthChecker) { - return (next) => async (args) => { - const request = args.request; - if (import_protocol_http.HttpRequest.isInstance(request)) { - const { body, headers } = request; - if (body && Object.keys(headers).map((str) => str.toLowerCase()).indexOf(CONTENT_LENGTH_HEADER) === -1) { - try { - const length = bodyLengthChecker(body); - request.headers = { - ...request.headers, - [CONTENT_LENGTH_HEADER]: String(length) - }; - } catch (error) { - } - } - } - return next({ - ...args, - request - }); - }; -} -__name(contentLengthMiddleware, "contentLengthMiddleware"); -var contentLengthMiddlewareOptions = { - step: "build", - tags: ["SET_CONTENT_LENGTH", "CONTENT_LENGTH"], - name: "contentLengthMiddleware", - override: true -}; -var getContentLengthPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.add(contentLengthMiddleware(options.bodyLengthChecker), contentLengthMiddlewareOptions); - }, "applyToStack") -}), "getContentLengthPlugin"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 6041: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getEndpointFromConfig = void 0; -const node_config_provider_1 = __nccwpck_require__(5704); -const getEndpointUrlConfig_1 = __nccwpck_require__(8008); -const getEndpointFromConfig = async (serviceId) => (0, node_config_provider_1.loadConfig)((0, getEndpointUrlConfig_1.getEndpointUrlConfig)(serviceId !== null && serviceId !== void 0 ? serviceId : ""))(); -exports.getEndpointFromConfig = getEndpointFromConfig; - - -/***/ }), - -/***/ 8008: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getEndpointUrlConfig = void 0; -const shared_ini_file_loader_1 = __nccwpck_require__(4964); -const ENV_ENDPOINT_URL = "AWS_ENDPOINT_URL"; -const CONFIG_ENDPOINT_URL = "endpoint_url"; -const getEndpointUrlConfig = (serviceId) => ({ - environmentVariableSelector: (env) => { - const serviceSuffixParts = serviceId.split(" ").map((w) => w.toUpperCase()); - const serviceEndpointUrl = env[[ENV_ENDPOINT_URL, ...serviceSuffixParts].join("_")]; - if (serviceEndpointUrl) - return serviceEndpointUrl; - const endpointUrl = env[ENV_ENDPOINT_URL]; - if (endpointUrl) - return endpointUrl; - return undefined; - }, - configFileSelector: (profile, config) => { - if (config && profile.services) { - const servicesSection = config[["services", profile.services].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; - if (servicesSection) { - const servicePrefixParts = serviceId.split(" ").map((w) => w.toLowerCase()); - const endpointUrl = servicesSection[[servicePrefixParts.join("_"), CONFIG_ENDPOINT_URL].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; - if (endpointUrl) - return endpointUrl; - } - } - const endpointUrl = profile[CONFIG_ENDPOINT_URL]; - if (endpointUrl) - return endpointUrl; - return undefined; - }, - default: undefined, -}); -exports.getEndpointUrlConfig = getEndpointUrlConfig; - - -/***/ }), - -/***/ 99: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - endpointMiddleware: () => endpointMiddleware, - endpointMiddlewareOptions: () => endpointMiddlewareOptions, - getEndpointFromInstructions: () => getEndpointFromInstructions, - getEndpointPlugin: () => getEndpointPlugin, - resolveEndpointConfig: () => resolveEndpointConfig, - resolveEndpointRequiredConfig: () => resolveEndpointRequiredConfig, - resolveParams: () => resolveParams, - toEndpointV1: () => toEndpointV1 -}); -module.exports = __toCommonJS(index_exports); - -// src/service-customizations/s3.ts -var resolveParamsForS3 = /* @__PURE__ */ __name(async (endpointParams) => { - const bucket = endpointParams?.Bucket || ""; - if (typeof endpointParams.Bucket === "string") { - endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); - } - if (isArnBucketName(bucket)) { - if (endpointParams.ForcePathStyle === true) { - throw new Error("Path-style addressing cannot be used with ARN buckets"); - } - } else if (!isDnsCompatibleBucketName(bucket) || bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:") || bucket.toLowerCase() !== bucket || bucket.length < 3) { - endpointParams.ForcePathStyle = true; - } - if (endpointParams.DisableMultiRegionAccessPoints) { - endpointParams.disableMultiRegionAccessPoints = true; - endpointParams.DisableMRAP = true; - } - return endpointParams; -}, "resolveParamsForS3"); -var DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; -var IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; -var DOTS_PATTERN = /\.\./; -var isDnsCompatibleBucketName = /* @__PURE__ */ __name((bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName), "isDnsCompatibleBucketName"); -var isArnBucketName = /* @__PURE__ */ __name((bucketName) => { - const [arn, partition, service, , , bucket] = bucketName.split(":"); - const isArn = arn === "arn" && bucketName.split(":").length >= 6; - const isValidArn = Boolean(isArn && partition && service && bucket); - if (isArn && !isValidArn) { - throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); - } - return isValidArn; -}, "isArnBucketName"); - -// src/adaptors/createConfigValueProvider.ts -var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndpointParamKey, config) => { - const configProvider = /* @__PURE__ */ __name(async () => { - const configValue = config[configKey] ?? config[canonicalEndpointParamKey]; - if (typeof configValue === "function") { - return configValue(); - } - return configValue; - }, "configProvider"); - if (configKey === "credentialScope" || canonicalEndpointParamKey === "CredentialScope") { - return async () => { - const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; - const configValue = credentials?.credentialScope ?? credentials?.CredentialScope; - return configValue; - }; - } - if (configKey === "accountId" || canonicalEndpointParamKey === "AccountId") { - return async () => { - const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; - const configValue = credentials?.accountId ?? credentials?.AccountId; - return configValue; - }; - } - if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { - return async () => { - if (config.isCustomEndpoint === false) { - return void 0; - } - const endpoint = await configProvider(); - if (endpoint && typeof endpoint === "object") { - if ("url" in endpoint) { - return endpoint.url.href; - } - if ("hostname" in endpoint) { - const { protocol, hostname, port, path } = endpoint; - return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; - } - } - return endpoint; - }; - } - return configProvider; -}, "createConfigValueProvider"); - -// src/adaptors/getEndpointFromInstructions.ts -var import_getEndpointFromConfig = __nccwpck_require__(6041); - -// src/adaptors/toEndpointV1.ts -var import_url_parser = __nccwpck_require__(4494); -var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => { - if (typeof endpoint === "object") { - if ("url" in endpoint) { - return (0, import_url_parser.parseUrl)(endpoint.url); - } - return endpoint; - } - return (0, import_url_parser.parseUrl)(endpoint); -}, "toEndpointV1"); - -// src/adaptors/getEndpointFromInstructions.ts -var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig, context) => { - if (!clientConfig.isCustomEndpoint) { - let endpointFromConfig; - if (clientConfig.serviceConfiguredEndpoint) { - endpointFromConfig = await clientConfig.serviceConfiguredEndpoint(); - } else { - endpointFromConfig = await (0, import_getEndpointFromConfig.getEndpointFromConfig)(clientConfig.serviceId); - } - if (endpointFromConfig) { - clientConfig.endpoint = () => Promise.resolve(toEndpointV1(endpointFromConfig)); - clientConfig.isCustomEndpoint = true; - } - } - const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig); - if (typeof clientConfig.endpointProvider !== "function") { - throw new Error("config.endpointProvider is not set."); - } - const endpoint = clientConfig.endpointProvider(endpointParams, context); - return endpoint; -}, "getEndpointFromInstructions"); -var resolveParams = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig) => { - const endpointParams = {}; - const instructions = instructionsSupplier?.getEndpointParameterInstructions?.() || {}; - for (const [name, instruction] of Object.entries(instructions)) { - switch (instruction.type) { - case "staticContextParams": - endpointParams[name] = instruction.value; - break; - case "contextParams": - endpointParams[name] = commandInput[instruction.name]; - break; - case "clientContextParams": - case "builtInParams": - endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig)(); - break; - case "operationContextParams": - endpointParams[name] = instruction.get(commandInput); - break; - default: - throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); - } - } - if (Object.keys(instructions).length === 0) { - Object.assign(endpointParams, clientConfig); - } - if (String(clientConfig.serviceId).toLowerCase() === "s3") { - await resolveParamsForS3(endpointParams); - } - return endpointParams; -}, "resolveParams"); - -// src/endpointMiddleware.ts -var import_core = __nccwpck_require__(402); -var import_util_middleware = __nccwpck_require__(6324); -var endpointMiddleware = /* @__PURE__ */ __name(({ - config, - instructions -}) => { - return (next, context) => async (args) => { - if (config.isCustomEndpoint) { - (0, import_core.setFeature)(context, "ENDPOINT_OVERRIDE", "N"); - } - const endpoint = await getEndpointFromInstructions( - args.input, - { - getEndpointParameterInstructions() { - return instructions; - } - }, - { ...config }, - context - ); - context.endpointV2 = endpoint; - context.authSchemes = endpoint.properties?.authSchemes; - const authScheme = context.authSchemes?.[0]; - if (authScheme) { - context["signing_region"] = authScheme.signingRegion; - context["signing_service"] = authScheme.signingName; - const smithyContext = (0, import_util_middleware.getSmithyContext)(context); - const httpAuthOption = smithyContext?.selectedHttpAuthScheme?.httpAuthOption; - if (httpAuthOption) { - httpAuthOption.signingProperties = Object.assign( - httpAuthOption.signingProperties || {}, - { - signing_region: authScheme.signingRegion, - signingRegion: authScheme.signingRegion, - signing_service: authScheme.signingName, - signingName: authScheme.signingName, - signingRegionSet: authScheme.signingRegionSet - }, - authScheme.properties - ); - } - } - return next({ - ...args - }); - }; -}, "endpointMiddleware"); - -// src/getEndpointPlugin.ts -var import_middleware_serde = __nccwpck_require__(3255); -var endpointMiddlewareOptions = { - step: "serialize", - tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], - name: "endpointV2Middleware", - override: true, - relation: "before", - toMiddleware: import_middleware_serde.serializerMiddlewareOption.name -}; -var getEndpointPlugin = /* @__PURE__ */ __name((config, instructions) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.addRelativeTo( - endpointMiddleware({ - config, - instructions - }), - endpointMiddlewareOptions - ); - }, "applyToStack") -}), "getEndpointPlugin"); - -// src/resolveEndpointConfig.ts - -var import_getEndpointFromConfig2 = __nccwpck_require__(6041); -var resolveEndpointConfig = /* @__PURE__ */ __name((input) => { - const tls = input.tls ?? true; - const { endpoint, useDualstackEndpoint, useFipsEndpoint } = input; - const customEndpointProvider = endpoint != null ? async () => toEndpointV1(await (0, import_util_middleware.normalizeProvider)(endpoint)()) : void 0; - const isCustomEndpoint = !!endpoint; - const resolvedConfig = Object.assign(input, { - endpoint: customEndpointProvider, - tls, - isCustomEndpoint, - useDualstackEndpoint: (0, import_util_middleware.normalizeProvider)(useDualstackEndpoint ?? false), - useFipsEndpoint: (0, import_util_middleware.normalizeProvider)(useFipsEndpoint ?? false) - }); - let configuredEndpointPromise = void 0; - resolvedConfig.serviceConfiguredEndpoint = async () => { - if (input.serviceId && !configuredEndpointPromise) { - configuredEndpointPromise = (0, import_getEndpointFromConfig2.getEndpointFromConfig)(input.serviceId); - } - return configuredEndpointPromise; - }; - return resolvedConfig; -}, "resolveEndpointConfig"); - -// src/resolveEndpointRequiredConfig.ts -var resolveEndpointRequiredConfig = /* @__PURE__ */ __name((input) => { - const { endpoint } = input; - if (endpoint === void 0) { - input.endpoint = async () => { - throw new Error( - "@smithy/middleware-endpoint: (default endpointRuleSet) endpoint is not set - you must configure an endpoint." - ); - }; - } - return input; -}, "resolveEndpointRequiredConfig"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 9618: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, - CONFIG_MAX_ATTEMPTS: () => CONFIG_MAX_ATTEMPTS, - CONFIG_RETRY_MODE: () => CONFIG_RETRY_MODE, - ENV_MAX_ATTEMPTS: () => ENV_MAX_ATTEMPTS, - ENV_RETRY_MODE: () => ENV_RETRY_MODE, - NODE_MAX_ATTEMPT_CONFIG_OPTIONS: () => NODE_MAX_ATTEMPT_CONFIG_OPTIONS, - NODE_RETRY_MODE_CONFIG_OPTIONS: () => NODE_RETRY_MODE_CONFIG_OPTIONS, - StandardRetryStrategy: () => StandardRetryStrategy, - defaultDelayDecider: () => defaultDelayDecider, - defaultRetryDecider: () => defaultRetryDecider, - getOmitRetryHeadersPlugin: () => getOmitRetryHeadersPlugin, - getRetryAfterHint: () => getRetryAfterHint, - getRetryPlugin: () => getRetryPlugin, - omitRetryHeadersMiddleware: () => omitRetryHeadersMiddleware, - omitRetryHeadersMiddlewareOptions: () => omitRetryHeadersMiddlewareOptions, - resolveRetryConfig: () => resolveRetryConfig, - retryMiddleware: () => retryMiddleware, - retryMiddlewareOptions: () => retryMiddlewareOptions -}); -module.exports = __toCommonJS(index_exports); - -// src/AdaptiveRetryStrategy.ts - - -// src/StandardRetryStrategy.ts -var import_protocol_http = __nccwpck_require__(2356); - - -var import_uuid = __nccwpck_require__(2048); - -// src/defaultRetryQuota.ts -var import_util_retry = __nccwpck_require__(5518); -var getDefaultRetryQuota = /* @__PURE__ */ __name((initialRetryTokens, options) => { - const MAX_CAPACITY = initialRetryTokens; - const noRetryIncrement = options?.noRetryIncrement ?? import_util_retry.NO_RETRY_INCREMENT; - const retryCost = options?.retryCost ?? import_util_retry.RETRY_COST; - const timeoutRetryCost = options?.timeoutRetryCost ?? import_util_retry.TIMEOUT_RETRY_COST; - let availableCapacity = initialRetryTokens; - const getCapacityAmount = /* @__PURE__ */ __name((error) => error.name === "TimeoutError" ? timeoutRetryCost : retryCost, "getCapacityAmount"); - const hasRetryTokens = /* @__PURE__ */ __name((error) => getCapacityAmount(error) <= availableCapacity, "hasRetryTokens"); - const retrieveRetryTokens = /* @__PURE__ */ __name((error) => { - if (!hasRetryTokens(error)) { - throw new Error("No retry token available"); - } - const capacityAmount = getCapacityAmount(error); - availableCapacity -= capacityAmount; - return capacityAmount; - }, "retrieveRetryTokens"); - const releaseRetryTokens = /* @__PURE__ */ __name((capacityReleaseAmount) => { - availableCapacity += capacityReleaseAmount ?? noRetryIncrement; - availableCapacity = Math.min(availableCapacity, MAX_CAPACITY); - }, "releaseRetryTokens"); - return Object.freeze({ - hasRetryTokens, - retrieveRetryTokens, - releaseRetryTokens - }); -}, "getDefaultRetryQuota"); - -// src/delayDecider.ts - -var defaultDelayDecider = /* @__PURE__ */ __name((delayBase, attempts) => Math.floor(Math.min(import_util_retry.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)), "defaultDelayDecider"); - -// src/retryDecider.ts -var import_service_error_classification = __nccwpck_require__(2058); -var defaultRetryDecider = /* @__PURE__ */ __name((error) => { - if (!error) { - return false; - } - return (0, import_service_error_classification.isRetryableByTrait)(error) || (0, import_service_error_classification.isClockSkewError)(error) || (0, import_service_error_classification.isThrottlingError)(error) || (0, import_service_error_classification.isTransientError)(error); -}, "defaultRetryDecider"); - -// src/util.ts -var asSdkError = /* @__PURE__ */ __name((error) => { - if (error instanceof Error) return error; - if (error instanceof Object) return Object.assign(new Error(), error); - if (typeof error === "string") return new Error(error); - return new Error(`AWS SDK error wrapper for ${error}`); -}, "asSdkError"); - -// src/StandardRetryStrategy.ts -var StandardRetryStrategy = class { - constructor(maxAttemptsProvider, options) { - this.maxAttemptsProvider = maxAttemptsProvider; - this.mode = import_util_retry.RETRY_MODES.STANDARD; - this.retryDecider = options?.retryDecider ?? defaultRetryDecider; - this.delayDecider = options?.delayDecider ?? defaultDelayDecider; - this.retryQuota = options?.retryQuota ?? getDefaultRetryQuota(import_util_retry.INITIAL_RETRY_TOKENS); - } - static { - __name(this, "StandardRetryStrategy"); - } - shouldRetry(error, attempts, maxAttempts) { - return attempts < maxAttempts && this.retryDecider(error) && this.retryQuota.hasRetryTokens(error); - } - async getMaxAttempts() { - let maxAttempts; - try { - maxAttempts = await this.maxAttemptsProvider(); - } catch (error) { - maxAttempts = import_util_retry.DEFAULT_MAX_ATTEMPTS; - } - return maxAttempts; - } - async retry(next, args, options) { - let retryTokenAmount; - let attempts = 0; - let totalDelay = 0; - const maxAttempts = await this.getMaxAttempts(); - const { request } = args; - if (import_protocol_http.HttpRequest.isInstance(request)) { - request.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); - } - while (true) { - try { - if (import_protocol_http.HttpRequest.isInstance(request)) { - request.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; - } - if (options?.beforeRequest) { - await options.beforeRequest(); - } - const { response, output } = await next(args); - if (options?.afterRequest) { - options.afterRequest(response); - } - this.retryQuota.releaseRetryTokens(retryTokenAmount); - output.$metadata.attempts = attempts + 1; - output.$metadata.totalRetryDelay = totalDelay; - return { response, output }; - } catch (e) { - const err = asSdkError(e); - attempts++; - if (this.shouldRetry(err, attempts, maxAttempts)) { - retryTokenAmount = this.retryQuota.retrieveRetryTokens(err); - const delayFromDecider = this.delayDecider( - (0, import_service_error_classification.isThrottlingError)(err) ? import_util_retry.THROTTLING_RETRY_DELAY_BASE : import_util_retry.DEFAULT_RETRY_DELAY_BASE, - attempts - ); - const delayFromResponse = getDelayFromRetryAfterHeader(err.$response); - const delay = Math.max(delayFromResponse || 0, delayFromDecider); - totalDelay += delay; - await new Promise((resolve) => setTimeout(resolve, delay)); - continue; - } - if (!err.$metadata) { - err.$metadata = {}; - } - err.$metadata.attempts = attempts; - err.$metadata.totalRetryDelay = totalDelay; - throw err; - } - } - } -}; -var getDelayFromRetryAfterHeader = /* @__PURE__ */ __name((response) => { - if (!import_protocol_http.HttpResponse.isInstance(response)) return; - const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); - if (!retryAfterHeaderName) return; - const retryAfter = response.headers[retryAfterHeaderName]; - const retryAfterSeconds = Number(retryAfter); - if (!Number.isNaN(retryAfterSeconds)) return retryAfterSeconds * 1e3; - const retryAfterDate = new Date(retryAfter); - return retryAfterDate.getTime() - Date.now(); -}, "getDelayFromRetryAfterHeader"); - -// src/AdaptiveRetryStrategy.ts -var AdaptiveRetryStrategy = class extends StandardRetryStrategy { - static { - __name(this, "AdaptiveRetryStrategy"); - } - constructor(maxAttemptsProvider, options) { - const { rateLimiter, ...superOptions } = options ?? {}; - super(maxAttemptsProvider, superOptions); - this.rateLimiter = rateLimiter ?? new import_util_retry.DefaultRateLimiter(); - this.mode = import_util_retry.RETRY_MODES.ADAPTIVE; - } - async retry(next, args) { - return super.retry(next, args, { - beforeRequest: /* @__PURE__ */ __name(async () => { - return this.rateLimiter.getSendToken(); - }, "beforeRequest"), - afterRequest: /* @__PURE__ */ __name((response) => { - this.rateLimiter.updateClientSendingRate(response); - }, "afterRequest") - }); - } -}; - -// src/configurations.ts -var import_util_middleware = __nccwpck_require__(6324); - -var ENV_MAX_ATTEMPTS = "AWS_MAX_ATTEMPTS"; -var CONFIG_MAX_ATTEMPTS = "max_attempts"; -var NODE_MAX_ATTEMPT_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env) => { - const value = env[ENV_MAX_ATTEMPTS]; - if (!value) return void 0; - const maxAttempt = parseInt(value); - if (Number.isNaN(maxAttempt)) { - throw new Error(`Environment variable ${ENV_MAX_ATTEMPTS} mast be a number, got "${value}"`); - } - return maxAttempt; - }, "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => { - const value = profile[CONFIG_MAX_ATTEMPTS]; - if (!value) return void 0; - const maxAttempt = parseInt(value); - if (Number.isNaN(maxAttempt)) { - throw new Error(`Shared config file entry ${CONFIG_MAX_ATTEMPTS} mast be a number, got "${value}"`); - } - return maxAttempt; - }, "configFileSelector"), - default: import_util_retry.DEFAULT_MAX_ATTEMPTS -}; -var resolveRetryConfig = /* @__PURE__ */ __name((input) => { - const { retryStrategy, retryMode: _retryMode, maxAttempts: _maxAttempts } = input; - const maxAttempts = (0, import_util_middleware.normalizeProvider)(_maxAttempts ?? import_util_retry.DEFAULT_MAX_ATTEMPTS); - return Object.assign(input, { - maxAttempts, - retryStrategy: /* @__PURE__ */ __name(async () => { - if (retryStrategy) { - return retryStrategy; - } - const retryMode = await (0, import_util_middleware.normalizeProvider)(_retryMode)(); - if (retryMode === import_util_retry.RETRY_MODES.ADAPTIVE) { - return new import_util_retry.AdaptiveRetryStrategy(maxAttempts); - } - return new import_util_retry.StandardRetryStrategy(maxAttempts); - }, "retryStrategy") - }); -}, "resolveRetryConfig"); -var ENV_RETRY_MODE = "AWS_RETRY_MODE"; -var CONFIG_RETRY_MODE = "retry_mode"; -var NODE_RETRY_MODE_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env) => env[ENV_RETRY_MODE], "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => profile[CONFIG_RETRY_MODE], "configFileSelector"), - default: import_util_retry.DEFAULT_RETRY_MODE -}; - -// src/omitRetryHeadersMiddleware.ts - - -var omitRetryHeadersMiddleware = /* @__PURE__ */ __name(() => (next) => async (args) => { - const { request } = args; - if (import_protocol_http.HttpRequest.isInstance(request)) { - delete request.headers[import_util_retry.INVOCATION_ID_HEADER]; - delete request.headers[import_util_retry.REQUEST_HEADER]; - } - return next(args); -}, "omitRetryHeadersMiddleware"); -var omitRetryHeadersMiddlewareOptions = { - name: "omitRetryHeadersMiddleware", - tags: ["RETRY", "HEADERS", "OMIT_RETRY_HEADERS"], - relation: "before", - toMiddleware: "awsAuthMiddleware", - override: true -}; -var getOmitRetryHeadersPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.addRelativeTo(omitRetryHeadersMiddleware(), omitRetryHeadersMiddlewareOptions); - }, "applyToStack") -}), "getOmitRetryHeadersPlugin"); - -// src/retryMiddleware.ts - - -var import_smithy_client = __nccwpck_require__(1411); - - -var import_isStreamingPayload = __nccwpck_require__(9831); -var retryMiddleware = /* @__PURE__ */ __name((options) => (next, context) => async (args) => { - let retryStrategy = await options.retryStrategy(); - const maxAttempts = await options.maxAttempts(); - if (isRetryStrategyV2(retryStrategy)) { - retryStrategy = retryStrategy; - let retryToken = await retryStrategy.acquireInitialRetryToken(context["partition_id"]); - let lastError = new Error(); - let attempts = 0; - let totalRetryDelay = 0; - const { request } = args; - const isRequest = import_protocol_http.HttpRequest.isInstance(request); - if (isRequest) { - request.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); - } - while (true) { - try { - if (isRequest) { - request.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; - } - const { response, output } = await next(args); - retryStrategy.recordSuccess(retryToken); - output.$metadata.attempts = attempts + 1; - output.$metadata.totalRetryDelay = totalRetryDelay; - return { response, output }; - } catch (e) { - const retryErrorInfo = getRetryErrorInfo(e); - lastError = asSdkError(e); - if (isRequest && (0, import_isStreamingPayload.isStreamingPayload)(request)) { - (context.logger instanceof import_smithy_client.NoOpLogger ? console : context.logger)?.warn( - "An error was encountered in a non-retryable streaming request." - ); - throw lastError; - } - try { - retryToken = await retryStrategy.refreshRetryTokenForRetry(retryToken, retryErrorInfo); - } catch (refreshError) { - if (!lastError.$metadata) { - lastError.$metadata = {}; - } - lastError.$metadata.attempts = attempts + 1; - lastError.$metadata.totalRetryDelay = totalRetryDelay; - throw lastError; - } - attempts = retryToken.getRetryCount(); - const delay = retryToken.getRetryDelay(); - totalRetryDelay += delay; - await new Promise((resolve) => setTimeout(resolve, delay)); - } - } - } else { - retryStrategy = retryStrategy; - if (retryStrategy?.mode) - context.userAgent = [...context.userAgent || [], ["cfg/retry-mode", retryStrategy.mode]]; - return retryStrategy.retry(next, args); - } -}, "retryMiddleware"); -var isRetryStrategyV2 = /* @__PURE__ */ __name((retryStrategy) => typeof retryStrategy.acquireInitialRetryToken !== "undefined" && typeof retryStrategy.refreshRetryTokenForRetry !== "undefined" && typeof retryStrategy.recordSuccess !== "undefined", "isRetryStrategyV2"); -var getRetryErrorInfo = /* @__PURE__ */ __name((error) => { - const errorInfo = { - error, - errorType: getRetryErrorType(error) - }; - const retryAfterHint = getRetryAfterHint(error.$response); - if (retryAfterHint) { - errorInfo.retryAfterHint = retryAfterHint; - } - return errorInfo; -}, "getRetryErrorInfo"); -var getRetryErrorType = /* @__PURE__ */ __name((error) => { - if ((0, import_service_error_classification.isThrottlingError)(error)) return "THROTTLING"; - if ((0, import_service_error_classification.isTransientError)(error)) return "TRANSIENT"; - if ((0, import_service_error_classification.isServerError)(error)) return "SERVER_ERROR"; - return "CLIENT_ERROR"; -}, "getRetryErrorType"); -var retryMiddlewareOptions = { - name: "retryMiddleware", - tags: ["RETRY"], - step: "finalizeRequest", - priority: "high", - override: true -}; -var getRetryPlugin = /* @__PURE__ */ __name((options) => ({ - applyToStack: /* @__PURE__ */ __name((clientStack) => { - clientStack.add(retryMiddleware(options), retryMiddlewareOptions); - }, "applyToStack") -}), "getRetryPlugin"); -var getRetryAfterHint = /* @__PURE__ */ __name((response) => { - if (!import_protocol_http.HttpResponse.isInstance(response)) return; - const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); - if (!retryAfterHeaderName) return; - const retryAfter = response.headers[retryAfterHeaderName]; - const retryAfterSeconds = Number(retryAfter); - if (!Number.isNaN(retryAfterSeconds)) return new Date(retryAfterSeconds * 1e3); - const retryAfterDate = new Date(retryAfter); - return retryAfterDate; -}, "getRetryAfterHint"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 9831: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isStreamingPayload = void 0; -const stream_1 = __nccwpck_require__(2203); -const isStreamingPayload = (request) => (request === null || request === void 0 ? void 0 : request.body) instanceof stream_1.Readable || - (typeof ReadableStream !== "undefined" && (request === null || request === void 0 ? void 0 : request.body) instanceof ReadableStream); -exports.isStreamingPayload = isStreamingPayload; - - -/***/ }), - -/***/ 3255: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - deserializerMiddleware: () => deserializerMiddleware, - deserializerMiddlewareOption: () => deserializerMiddlewareOption, - getSerdePlugin: () => getSerdePlugin, - serializerMiddleware: () => serializerMiddleware, - serializerMiddlewareOption: () => serializerMiddlewareOption -}); -module.exports = __toCommonJS(index_exports); - -// src/deserializerMiddleware.ts -var import_protocol_http = __nccwpck_require__(2356); -var deserializerMiddleware = /* @__PURE__ */ __name((options, deserializer) => (next, context) => async (args) => { - const { response } = await next(args); - try { - const parsed = await deserializer(response, options); - return { - response, - output: parsed - }; - } catch (error) { - Object.defineProperty(error, "$response", { - value: response - }); - if (!("$metadata" in error)) { - const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; - try { - error.message += "\n " + hint; - } catch (e) { - if (!context.logger || context.logger?.constructor?.name === "NoOpLogger") { - console.warn(hint); - } else { - context.logger?.warn?.(hint); - } - } - if (typeof error.$responseBodyText !== "undefined") { - if (error.$response) { - error.$response.body = error.$responseBodyText; - } - } - try { - if (import_protocol_http.HttpResponse.isInstance(response)) { - const { headers = {} } = response; - const headerEntries = Object.entries(headers); - error.$metadata = { - httpStatusCode: response.statusCode, - requestId: findHeader(/^x-[\w-]+-request-?id$/, headerEntries), - extendedRequestId: findHeader(/^x-[\w-]+-id-2$/, headerEntries), - cfId: findHeader(/^x-[\w-]+-cf-id$/, headerEntries) - }; - } - } catch (e) { - } - } - throw error; - } -}, "deserializerMiddleware"); -var findHeader = /* @__PURE__ */ __name((pattern, headers) => { - return (headers.find(([k]) => { - return k.match(pattern); - }) || [void 0, void 0])[1]; -}, "findHeader"); - -// src/serializerMiddleware.ts -var serializerMiddleware = /* @__PURE__ */ __name((options, serializer) => (next, context) => async (args) => { - const endpointConfig = options; - const endpoint = context.endpointV2?.url && endpointConfig.urlParser ? async () => endpointConfig.urlParser(context.endpointV2.url) : endpointConfig.endpoint; - if (!endpoint) { - throw new Error("No valid endpoint provider available."); - } - const request = await serializer(args.input, { ...options, endpoint }); - return next({ - ...args, - request - }); -}, "serializerMiddleware"); - -// src/serdePlugin.ts -var deserializerMiddlewareOption = { - name: "deserializerMiddleware", - step: "deserialize", - tags: ["DESERIALIZER"], - override: true -}; -var serializerMiddlewareOption = { - name: "serializerMiddleware", - step: "serialize", - tags: ["SERIALIZER"], - override: true -}; -function getSerdePlugin(config, serializer, deserializer) { - return { - applyToStack: /* @__PURE__ */ __name((commandStack) => { - commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption); - commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption); - }, "applyToStack") - }; -} -__name(getSerdePlugin, "getSerdePlugin"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 5704: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - loadConfig: () => loadConfig -}); -module.exports = __toCommonJS(index_exports); - -// src/configLoader.ts - - -// src/fromEnv.ts -var import_property_provider = __nccwpck_require__(1238); - -// src/getSelectorName.ts -function getSelectorName(functionString) { - try { - const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); - constants.delete("CONFIG"); - constants.delete("CONFIG_PREFIX_SEPARATOR"); - constants.delete("ENV"); - return [...constants].join(", "); - } catch (e) { - return functionString; - } -} -__name(getSelectorName, "getSelectorName"); - -// src/fromEnv.ts -var fromEnv = /* @__PURE__ */ __name((envVarSelector, options) => async () => { - try { - const config = envVarSelector(process.env, options); - if (config === void 0) { - throw new Error(); - } - return config; - } catch (e) { - throw new import_property_provider.CredentialsProviderError( - e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, - { logger: options?.logger } - ); - } -}, "fromEnv"); - -// src/fromSharedConfigFiles.ts - -var import_shared_ini_file_loader = __nccwpck_require__(4964); -var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { - const profile = (0, import_shared_ini_file_loader.getProfileName)(init); - const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); - const profileFromCredentials = credentialsFile[profile] || {}; - const profileFromConfig = configFile[profile] || {}; - const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; - try { - const cfgFile = preferredFile === "config" ? configFile : credentialsFile; - const configValue = configSelector(mergedProfile, cfgFile); - if (configValue === void 0) { - throw new Error(); - } - return configValue; - } catch (e) { - throw new import_property_provider.CredentialsProviderError( - e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, - { logger: init.logger } - ); - } -}, "fromSharedConfigFiles"); - -// src/fromStatic.ts - -var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); -var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider.fromStatic)(defaultValue), "fromStatic"); - -// src/configLoader.ts -var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => { - const { signingName, logger } = configuration; - const envOptions = { signingName, logger }; - return (0, import_property_provider.memoize)( - (0, import_property_provider.chain)( - fromEnv(environmentVariableSelector, envOptions), - fromSharedConfigFiles(configFileSelector, configuration), - fromStatic(defaultValue) - ) - ); -}, "loadConfig"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); - - - -/***/ }), - -/***/ 1279: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __create = Object.create; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - DEFAULT_REQUEST_TIMEOUT: () => DEFAULT_REQUEST_TIMEOUT, - NodeHttp2Handler: () => NodeHttp2Handler, - NodeHttpHandler: () => NodeHttpHandler, - streamCollector: () => streamCollector -}); -module.exports = __toCommonJS(index_exports); - -// src/node-http-handler.ts -var import_protocol_http = __nccwpck_require__(2356); -var import_querystring_builder = __nccwpck_require__(8256); -var import_http = __nccwpck_require__(8611); -var import_https = __nccwpck_require__(5692); - -// src/constants.ts -var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; - -// src/get-transformed-headers.ts -var getTransformedHeaders = /* @__PURE__ */ __name((headers) => { - const transformedHeaders = {}; - for (const name of Object.keys(headers)) { - const headerValues = headers[name]; - transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; - } - return transformedHeaders; -}, "getTransformedHeaders"); - -// src/timing.ts -var timing = { - setTimeout: /* @__PURE__ */ __name((cb, ms) => setTimeout(cb, ms), "setTimeout"), - clearTimeout: /* @__PURE__ */ __name((timeoutId) => clearTimeout(timeoutId), "clearTimeout") -}; - -// src/set-connection-timeout.ts -var DEFER_EVENT_LISTENER_TIME = 1e3; -var setConnectionTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = 0) => { - if (!timeoutInMs) { - return -1; - } - const registerTimeout = /* @__PURE__ */ __name((offset) => { - const timeoutId = timing.setTimeout(() => { - request.destroy(); - reject( - Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { - name: "TimeoutError" - }) - ); - }, timeoutInMs - offset); - const doWithSocket = /* @__PURE__ */ __name((socket) => { - if (socket?.connecting) { - socket.on("connect", () => { - timing.clearTimeout(timeoutId); - }); - } else { - timing.clearTimeout(timeoutId); - } - }, "doWithSocket"); - if (request.socket) { - doWithSocket(request.socket); - } else { - request.on("socket", doWithSocket); - } - }, "registerTimeout"); - if (timeoutInMs < 2e3) { - registerTimeout(0); - return 0; - } - return timing.setTimeout(registerTimeout.bind(null, DEFER_EVENT_LISTENER_TIME), DEFER_EVENT_LISTENER_TIME); -}, "setConnectionTimeout"); - -// src/set-socket-keep-alive.ts -var DEFER_EVENT_LISTENER_TIME2 = 3e3; -var setSocketKeepAlive = /* @__PURE__ */ __name((request, { keepAlive, keepAliveMsecs }, deferTimeMs = DEFER_EVENT_LISTENER_TIME2) => { - if (keepAlive !== true) { - return -1; - } - const registerListener = /* @__PURE__ */ __name(() => { - if (request.socket) { - request.socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); - } else { - request.on("socket", (socket) => { - socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); - }); - } - }, "registerListener"); - if (deferTimeMs === 0) { - registerListener(); - return 0; - } - return timing.setTimeout(registerListener, deferTimeMs); -}, "setSocketKeepAlive"); - -// src/set-socket-timeout.ts -var DEFER_EVENT_LISTENER_TIME3 = 3e3; -var setSocketTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = DEFAULT_REQUEST_TIMEOUT) => { - const registerTimeout = /* @__PURE__ */ __name((offset) => { - const timeout = timeoutInMs - offset; - const onTimeout = /* @__PURE__ */ __name(() => { - request.destroy(); - reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); - }, "onTimeout"); - if (request.socket) { - request.socket.setTimeout(timeout, onTimeout); - request.on("close", () => request.socket?.removeListener("timeout", onTimeout)); - } else { - request.setTimeout(timeout, onTimeout); - } - }, "registerTimeout"); - if (0 < timeoutInMs && timeoutInMs < 6e3) { - registerTimeout(0); - return 0; - } - return timing.setTimeout( - registerTimeout.bind(null, timeoutInMs === 0 ? 0 : DEFER_EVENT_LISTENER_TIME3), - DEFER_EVENT_LISTENER_TIME3 - ); -}, "setSocketTimeout"); - -// src/write-request-body.ts -var import_stream = __nccwpck_require__(2203); -var MIN_WAIT_TIME = 6e3; -async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { - const headers = request.headers ?? {}; - const expect = headers["Expect"] || headers["expect"]; - let timeoutId = -1; - let sendBody = true; - if (expect === "100-continue") { - sendBody = await Promise.race([ - new Promise((resolve) => { - timeoutId = Number(timing.setTimeout(() => resolve(true), Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); - }), - new Promise((resolve) => { - httpRequest.on("continue", () => { - timing.clearTimeout(timeoutId); - resolve(true); - }); - httpRequest.on("response", () => { - timing.clearTimeout(timeoutId); - resolve(false); - }); - httpRequest.on("error", () => { - timing.clearTimeout(timeoutId); - resolve(false); - }); - }) - ]); - } - if (sendBody) { - writeBody(httpRequest, request.body); - } -} -__name(writeRequestBody, "writeRequestBody"); -function writeBody(httpRequest, body) { - if (body instanceof import_stream.Readable) { - body.pipe(httpRequest); - return; - } - if (body) { - if (Buffer.isBuffer(body) || typeof body === "string") { - httpRequest.end(body); - return; - } - const uint8 = body; - if (typeof uint8 === "object" && uint8.buffer && typeof uint8.byteOffset === "number" && typeof uint8.byteLength === "number") { - httpRequest.end(Buffer.from(uint8.buffer, uint8.byteOffset, uint8.byteLength)); - return; - } - httpRequest.end(Buffer.from(body)); - return; - } - httpRequest.end(); -} -__name(writeBody, "writeBody"); - -// src/node-http-handler.ts -var DEFAULT_REQUEST_TIMEOUT = 0; -var NodeHttpHandler = class _NodeHttpHandler { - constructor(options) { - this.socketWarningTimestamp = 0; - // Node http handler is hard-coded to http/1.1: https://github.com/nodejs/node/blob/ff5664b83b89c55e4ab5d5f60068fb457f1f5872/lib/_http_server.js#L286 - this.metadata = { handlerProtocol: "http/1.1" }; - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options().then((_options) => { - resolve(this.resolveDefaultConfig(_options)); - }).catch(reject); - } else { - resolve(this.resolveDefaultConfig(options)); - } - }); - } - static { - __name(this, "NodeHttpHandler"); - } - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof instanceOrOptions?.handle === "function") { - return instanceOrOptions; - } - return new _NodeHttpHandler(instanceOrOptions); - } - /** - * @internal - * - * @param agent - http(s) agent in use by the NodeHttpHandler instance. - * @param socketWarningTimestamp - last socket usage check timestamp. - * @param logger - channel for the warning. - * @returns timestamp of last emitted warning. - */ - static checkSocketUsage(agent, socketWarningTimestamp, logger = console) { - const { sockets, requests, maxSockets } = agent; - if (typeof maxSockets !== "number" || maxSockets === Infinity) { - return socketWarningTimestamp; - } - const interval = 15e3; - if (Date.now() - interval < socketWarningTimestamp) { - return socketWarningTimestamp; - } - if (sockets && requests) { - for (const origin in sockets) { - const socketsInUse = sockets[origin]?.length ?? 0; - const requestsEnqueued = requests[origin]?.length ?? 0; - if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) { - logger?.warn?.( - `@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued. -See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html -or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.` - ); - return Date.now(); - } - } - } - return socketWarningTimestamp; - } - resolveDefaultConfig(options) { - const { requestTimeout, connectionTimeout, socketTimeout, socketAcquisitionWarningTimeout, httpAgent, httpsAgent } = options || {}; - const keepAlive = true; - const maxSockets = 50; - return { - connectionTimeout, - requestTimeout: requestTimeout ?? socketTimeout, - socketAcquisitionWarningTimeout, - httpAgent: (() => { - if (httpAgent instanceof import_http.Agent || typeof httpAgent?.destroy === "function") { - return httpAgent; - } - return new import_http.Agent({ keepAlive, maxSockets, ...httpAgent }); - })(), - httpsAgent: (() => { - if (httpsAgent instanceof import_https.Agent || typeof httpsAgent?.destroy === "function") { - return httpsAgent; - } - return new import_https.Agent({ keepAlive, maxSockets, ...httpsAgent }); - })(), - logger: console - }; - } - destroy() { - this.config?.httpAgent?.destroy(); - this.config?.httpsAgent?.destroy(); - } - async handle(request, { abortSignal, requestTimeout } = {}) { - if (!this.config) { - this.config = await this.configProvider; - } - return new Promise((_resolve, _reject) => { - let writeRequestBodyPromise = void 0; - const timeouts = []; - const resolve = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - timeouts.forEach(timing.clearTimeout); - _resolve(arg); - }, "resolve"); - const reject = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - timeouts.forEach(timing.clearTimeout); - _reject(arg); - }, "reject"); - if (!this.config) { - throw new Error("Node HTTP request handler config is not resolved"); - } - if (abortSignal?.aborted) { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const isSSL = request.protocol === "https:"; - const agent = isSSL ? this.config.httpsAgent : this.config.httpAgent; - timeouts.push( - timing.setTimeout( - () => { - this.socketWarningTimestamp = _NodeHttpHandler.checkSocketUsage( - agent, - this.socketWarningTimestamp, - this.config.logger - ); - }, - this.config.socketAcquisitionWarningTimeout ?? (this.config.requestTimeout ?? 2e3) + (this.config.connectionTimeout ?? 1e3) - ) - ); - const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); - let auth = void 0; - if (request.username != null || request.password != null) { - const username = request.username ?? ""; - const password = request.password ?? ""; - auth = `${username}:${password}`; - } - let path = request.path; - if (queryString) { - path += `?${queryString}`; - } - if (request.fragment) { - path += `#${request.fragment}`; - } - let hostname = request.hostname ?? ""; - if (hostname[0] === "[" && hostname.endsWith("]")) { - hostname = request.hostname.slice(1, -1); - } else { - hostname = request.hostname; - } - const nodeHttpsOptions = { - headers: request.headers, - host: hostname, - method: request.method, - path, - port: request.port, - agent, - auth - }; - const requestFunc = isSSL ? import_https.request : import_http.request; - const req = requestFunc(nodeHttpsOptions, (res) => { - const httpResponse = new import_protocol_http.HttpResponse({ - statusCode: res.statusCode || -1, - reason: res.statusMessage, - headers: getTransformedHeaders(res.headers), - body: res - }); - resolve({ response: httpResponse }); - }); - req.on("error", (err) => { - if (NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { - reject(Object.assign(err, { name: "TimeoutError" })); - } else { - reject(err); - } - }); - if (abortSignal) { - const onAbort = /* @__PURE__ */ __name(() => { - req.destroy(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - req.once("close", () => signal.removeEventListener("abort", onAbort)); - } else { - abortSignal.onabort = onAbort; - } - } - const effectiveRequestTimeout = requestTimeout ?? this.config.requestTimeout; - timeouts.push(setConnectionTimeout(req, reject, this.config.connectionTimeout)); - timeouts.push(setSocketTimeout(req, reject, effectiveRequestTimeout)); - const httpAgent = nodeHttpsOptions.agent; - if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { - timeouts.push( - setSocketKeepAlive(req, { - // @ts-expect-error keepAlive is not public on httpAgent. - keepAlive: httpAgent.keepAlive, - // @ts-expect-error keepAliveMsecs is not public on httpAgent. - keepAliveMsecs: httpAgent.keepAliveMsecs - }) - ); - } - writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout).catch((e) => { - timeouts.forEach(timing.clearTimeout); - return _reject(e); - }); - }); - } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - return { - ...config, - [key]: value - }; - }); - } - httpHandlerConfigs() { - return this.config ?? {}; - } -}; - -// src/node-http2-handler.ts - - -var import_http22 = __nccwpck_require__(5675); -// src/node-http2-connection-manager.ts -var import_http2 = __toESM(__nccwpck_require__(5675)); +var protocolHttp = __nccwpck_require__(2356); -// src/node-http2-connection-pool.ts -var NodeHttp2ConnectionPool = class { - constructor(sessions) { - this.sessions = []; - this.sessions = sessions ?? []; - } - static { - __name(this, "NodeHttp2ConnectionPool"); - } - poll() { - if (this.sessions.length > 0) { - return this.sessions.shift(); +const deserializerMiddleware = (options, deserializer) => (next, context) => async (args) => { + const { response } = await next(args); + try { + const parsed = await deserializer(response, options); + return { + response, + output: parsed, + }; } - } - offerLast(session) { - this.sessions.push(session); - } - contains(session) { - return this.sessions.includes(session); - } - remove(session) { - this.sessions = this.sessions.filter((s) => s !== session); - } - [Symbol.iterator]() { - return this.sessions[Symbol.iterator](); - } - destroy(connection) { - for (const session of this.sessions) { - if (session === connection) { - if (!session.destroyed) { - session.destroy(); + catch (error) { + Object.defineProperty(error, "$response", { + value: response, + }); + if (!("$metadata" in error)) { + const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; + try { + error.message += "\n " + hint; + } + catch (e) { + if (!context.logger || context.logger?.constructor?.name === "NoOpLogger") { + console.warn(hint); + } + else { + context.logger?.warn?.(hint); + } + } + if (typeof error.$responseBodyText !== "undefined") { + if (error.$response) { + error.$response.body = error.$responseBodyText; + } + } + try { + if (protocolHttp.HttpResponse.isInstance(response)) { + const { headers = {} } = response; + const headerEntries = Object.entries(headers); + error.$metadata = { + httpStatusCode: response.statusCode, + requestId: findHeader(/^x-[\w-]+-request-?id$/, headerEntries), + extendedRequestId: findHeader(/^x-[\w-]+-id-2$/, headerEntries), + cfId: findHeader(/^x-[\w-]+-cf-id$/, headerEntries), + }; + } + } + catch (e) { + } } - } + throw error; } - } }; - -// src/node-http2-connection-manager.ts -var NodeHttp2ConnectionManager = class { - constructor(config) { - this.sessionCache = /* @__PURE__ */ new Map(); - this.config = config; - if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { - throw new RangeError("maxConcurrency must be greater than zero."); - } - } - static { - __name(this, "NodeHttp2ConnectionManager"); - } - lease(requestContext, connectionConfiguration) { - const url = this.getUrlString(requestContext); - const existingPool = this.sessionCache.get(url); - if (existingPool) { - const existingSession = existingPool.poll(); - if (existingSession && !this.config.disableConcurrency) { - return existingSession; - } - } - const session = import_http2.default.connect(url); - if (this.config.maxConcurrency) { - session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { - if (err) { - throw new Error( - "Fail to set maxConcurrentStreams to " + this.config.maxConcurrency + "when creating new session for " + requestContext.destination.toString() - ); - } - }); - } - session.unref(); - const destroySessionCb = /* @__PURE__ */ __name(() => { - session.destroy(); - this.deleteSession(url, session); - }, "destroySessionCb"); - session.on("goaway", destroySessionCb); - session.on("error", destroySessionCb); - session.on("frameError", destroySessionCb); - session.on("close", () => this.deleteSession(url, session)); - if (connectionConfiguration.requestTimeout) { - session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); - } - const connectionPool = this.sessionCache.get(url) || new NodeHttp2ConnectionPool(); - connectionPool.offerLast(session); - this.sessionCache.set(url, connectionPool); - return session; - } - /** - * Delete a session from the connection pool. - * @param authority The authority of the session to delete. - * @param session The session to delete. - */ - deleteSession(authority, session) { - const existingConnectionPool = this.sessionCache.get(authority); - if (!existingConnectionPool) { - return; - } - if (!existingConnectionPool.contains(session)) { - return; - } - existingConnectionPool.remove(session); - this.sessionCache.set(authority, existingConnectionPool); - } - release(requestContext, session) { - const cacheKey = this.getUrlString(requestContext); - this.sessionCache.get(cacheKey)?.offerLast(session); - } - destroy() { - for (const [key, connectionPool] of this.sessionCache) { - for (const session of connectionPool) { - if (!session.destroyed) { - session.destroy(); - } - connectionPool.remove(session); - } - this.sessionCache.delete(key); - } - } - setMaxConcurrentStreams(maxConcurrentStreams) { - if (maxConcurrentStreams && maxConcurrentStreams <= 0) { - throw new RangeError("maxConcurrentStreams must be greater than zero."); - } - this.config.maxConcurrency = maxConcurrentStreams; - } - setDisableConcurrentStreams(disableConcurrentStreams) { - this.config.disableConcurrency = disableConcurrentStreams; - } - getUrlString(request) { - return request.destination.toString(); - } +const findHeader = (pattern, headers) => { + return (headers.find(([k]) => { + return k.match(pattern); + }) || [void 0, void 0])[1]; }; -// src/node-http2-handler.ts -var NodeHttp2Handler = class _NodeHttp2Handler { - constructor(options) { - this.metadata = { handlerProtocol: "h2" }; - this.connectionManager = new NodeHttp2ConnectionManager({}); - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options().then((opts) => { - resolve(opts || {}); - }).catch(reject); - } else { - resolve(options || {}); - } - }); - } - static { - __name(this, "NodeHttp2Handler"); - } - /** - * @returns the input if it is an HttpHandler of any class, - * or instantiates a new instance of this handler. - */ - static create(instanceOrOptions) { - if (typeof instanceOrOptions?.handle === "function") { - return instanceOrOptions; - } - return new _NodeHttp2Handler(instanceOrOptions); - } - destroy() { - this.connectionManager.destroy(); - } - async handle(request, { abortSignal, requestTimeout } = {}) { - if (!this.config) { - this.config = await this.configProvider; - this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); - if (this.config.maxConcurrentStreams) { - this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); - } +const serializerMiddleware = (options, serializer) => (next, context) => async (args) => { + const endpointConfig = options; + const endpoint = context.endpointV2?.url && endpointConfig.urlParser + ? async () => endpointConfig.urlParser(context.endpointV2.url) + : endpointConfig.endpoint; + if (!endpoint) { + throw new Error("No valid endpoint provider available."); } - const { requestTimeout: configRequestTimeout, disableConcurrentStreams } = this.config; - const effectiveRequestTimeout = requestTimeout ?? configRequestTimeout; - return new Promise((_resolve, _reject) => { - let fulfilled = false; - let writeRequestBodyPromise = void 0; - const resolve = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - _resolve(arg); - }, "resolve"); - const reject = /* @__PURE__ */ __name(async (arg) => { - await writeRequestBodyPromise; - _reject(arg); - }, "reject"); - if (abortSignal?.aborted) { - fulfilled = true; - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const { hostname, method, port, protocol, query } = request; - let auth = ""; - if (request.username != null || request.password != null) { - const username = request.username ?? ""; - const password = request.password ?? ""; - auth = `${username}:${password}@`; - } - const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; - const requestContext = { destination: new URL(authority) }; - const session = this.connectionManager.lease(requestContext, { - requestTimeout: this.config?.sessionTimeout, - disableConcurrentStreams: disableConcurrentStreams || false - }); - const rejectWithDestroy = /* @__PURE__ */ __name((err) => { - if (disableConcurrentStreams) { - this.destroySession(session); - } - fulfilled = true; - reject(err); - }, "rejectWithDestroy"); - const queryString = (0, import_querystring_builder.buildQueryString)(query || {}); - let path = request.path; - if (queryString) { - path += `?${queryString}`; - } - if (request.fragment) { - path += `#${request.fragment}`; - } - const req = session.request({ - ...request.headers, - [import_http22.constants.HTTP2_HEADER_PATH]: path, - [import_http22.constants.HTTP2_HEADER_METHOD]: method - }); - session.ref(); - req.on("response", (headers) => { - const httpResponse = new import_protocol_http.HttpResponse({ - statusCode: headers[":status"] || -1, - headers: getTransformedHeaders(headers), - body: req - }); - fulfilled = true; - resolve({ response: httpResponse }); - if (disableConcurrentStreams) { - session.close(); - this.connectionManager.deleteSession(authority, session); - } - }); - if (effectiveRequestTimeout) { - req.setTimeout(effectiveRequestTimeout, () => { - req.close(); - const timeoutError = new Error(`Stream timed out because of no activity for ${effectiveRequestTimeout} ms`); - timeoutError.name = "TimeoutError"; - rejectWithDestroy(timeoutError); - }); - } - if (abortSignal) { - const onAbort = /* @__PURE__ */ __name(() => { - req.close(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - rejectWithDestroy(abortError); - }, "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - const signal = abortSignal; - signal.addEventListener("abort", onAbort, { once: true }); - req.once("close", () => signal.removeEventListener("abort", onAbort)); - } else { - abortSignal.onabort = onAbort; - } - } - req.on("frameError", (type, code, id) => { - rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); - }); - req.on("error", rejectWithDestroy); - req.on("aborted", () => { - rejectWithDestroy( - new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`) - ); - }); - req.on("close", () => { - session.unref(); - if (disableConcurrentStreams) { - session.destroy(); - } - if (!fulfilled) { - rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); - } - }); - writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout); - }); - } - updateHttpClientConfig(key, value) { - this.config = void 0; - this.configProvider = this.configProvider.then((config) => { - return { - ...config, - [key]: value - }; + const request = await serializer(args.input, { ...options, endpoint }); + return next({ + ...args, + request, }); - } - httpHandlerConfigs() { - return this.config ?? {}; - } - /** - * Destroys a session. - * @param session - the session to destroy. - */ - destroySession(session) { - if (!session.destroyed) { - session.destroy(); - } - } }; -// src/stream-collector/collector.ts - -var Collector = class extends import_stream.Writable { - constructor() { - super(...arguments); - this.bufferedBytes = []; - } - static { - __name(this, "Collector"); - } - _write(chunk, encoding, callback) { - this.bufferedBytes.push(chunk); - callback(); - } +const deserializerMiddlewareOption = { + name: "deserializerMiddleware", + step: "deserialize", + tags: ["DESERIALIZER"], + override: true, }; - -// src/stream-collector/index.ts -var streamCollector = /* @__PURE__ */ __name((stream) => { - if (isReadableStreamInstance(stream)) { - return collectReadableStream(stream); - } - return new Promise((resolve, reject) => { - const collector = new Collector(); - stream.pipe(collector); - stream.on("error", (err) => { - collector.end(); - reject(err); - }); - collector.on("error", reject); - collector.on("finish", function() { - const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); - resolve(bytes); - }); - }); -}, "streamCollector"); -var isReadableStreamInstance = /* @__PURE__ */ __name((stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream, "isReadableStreamInstance"); -async function collectReadableStream(stream) { - const chunks = []; - const reader = stream.getReader(); - let isDone = false; - let length = 0; - while (!isDone) { - const { done, value } = await reader.read(); - if (value) { - chunks.push(value); - length += value.length; +const serializerMiddlewareOption = { + name: "serializerMiddleware", + step: "serialize", + tags: ["SERIALIZER"], + override: true, +}; +function getSerdePlugin(config, serializer, deserializer) { + return { + applyToStack: (commandStack) => { + commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption); + commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption); + }, + }; +} + +exports.deserializerMiddleware = deserializerMiddleware; +exports.deserializerMiddlewareOption = deserializerMiddlewareOption; +exports.getSerdePlugin = getSerdePlugin; +exports.serializerMiddleware = serializerMiddleware; +exports.serializerMiddlewareOption = serializerMiddlewareOption; + + +/***/ }), + +/***/ 5704: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +var propertyProvider = __nccwpck_require__(1238); +var sharedIniFileLoader = __nccwpck_require__(4964); + +function getSelectorName(functionString) { + try { + const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); + constants.delete("CONFIG"); + constants.delete("CONFIG_PREFIX_SEPARATOR"); + constants.delete("ENV"); + return [...constants].join(", "); + } + catch (e) { + return functionString; } - isDone = done; - } - const collected = new Uint8Array(length); - let offset = 0; - for (const chunk of chunks) { - collected.set(chunk, offset); - offset += chunk.length; - } - return collected; } -__name(collectReadableStream, "collectReadableStream"); -// Annotate the CommonJS export names for ESM import in node: -0 && (0); +const fromEnv = (envVarSelector, options) => async () => { + try { + const config = envVarSelector(process.env, options); + if (config === undefined) { + throw new Error(); + } + return config; + } + catch (e) { + throw new propertyProvider.CredentialsProviderError(e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, { logger: options?.logger }); + } +}; +const fromSharedConfigFiles = (configSelector, { preferredFile = "config", ...init } = {}) => async () => { + const profile = sharedIniFileLoader.getProfileName(init); + const { configFile, credentialsFile } = await sharedIniFileLoader.loadSharedConfigFiles(init); + const profileFromCredentials = credentialsFile[profile] || {}; + const profileFromConfig = configFile[profile] || {}; + const mergedProfile = preferredFile === "config" + ? { ...profileFromCredentials, ...profileFromConfig } + : { ...profileFromConfig, ...profileFromCredentials }; + try { + const cfgFile = preferredFile === "config" ? configFile : credentialsFile; + const configValue = configSelector(mergedProfile, cfgFile); + if (configValue === undefined) { + throw new Error(); + } + return configValue; + } + catch (e) { + throw new propertyProvider.CredentialsProviderError(e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, { logger: init.logger }); + } +}; + +const isFunction = (func) => typeof func === "function"; +const fromStatic = (defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : propertyProvider.fromStatic(defaultValue); + +const loadConfig = ({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => { + const { signingName, logger } = configuration; + const envOptions = { signingName, logger }; + return propertyProvider.memoize(propertyProvider.chain(fromEnv(environmentVariableSelector, envOptions), fromSharedConfigFiles(configFileSelector, configuration), fromStatic(defaultValue))); +}; + +exports.loadConfig = loadConfig; /***/ }), -/***/ 1238: -/***/ ((module) => { +/***/ 1279: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); +"use strict"; + + +var protocolHttp = __nccwpck_require__(2356); +var querystringBuilder = __nccwpck_require__(8256); +var http = __nccwpck_require__(8611); +var https = __nccwpck_require__(5692); +var stream = __nccwpck_require__(2203); +var http2 = __nccwpck_require__(5675); + +const NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; + +const getTransformedHeaders = (headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; + } + return transformedHeaders; }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; + +const timing = { + setTimeout: (cb, ms) => setTimeout(cb, ms), + clearTimeout: (timeoutId) => clearTimeout(timeoutId), }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - CredentialsProviderError: () => CredentialsProviderError, - ProviderError: () => ProviderError, - TokenProviderError: () => TokenProviderError, - chain: () => chain, - fromStatic: () => fromStatic, - memoize: () => memoize -}); -module.exports = __toCommonJS(index_exports); - -// src/ProviderError.ts -var ProviderError = class _ProviderError extends Error { - constructor(message, options = true) { - let logger; - let tryNextLink = true; - if (typeof options === "boolean") { - logger = void 0; - tryNextLink = options; - } else if (options != null && typeof options === "object") { - logger = options.logger; - tryNextLink = options.tryNextLink ?? true; - } - super(message); - this.name = "ProviderError"; - this.tryNextLink = tryNextLink; - Object.setPrototypeOf(this, _ProviderError.prototype); - logger?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); - } - static { - __name(this, "ProviderError"); - } - /** - * @deprecated use new operator. - */ - static from(error, options = true) { - return Object.assign(new this(error.message, options), error); - } +const DEFER_EVENT_LISTENER_TIME$2 = 1000; +const setConnectionTimeout = (request, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return -1; + } + const registerTimeout = (offset) => { + const timeoutId = timing.setTimeout(() => { + request.destroy(); + reject(Object.assign(new Error(`@smithy/node-http-handler - the request socket did not establish a connection with the server within the configured timeout of ${timeoutInMs} ms.`), { + name: "TimeoutError", + })); + }, timeoutInMs - offset); + const doWithSocket = (socket) => { + if (socket?.connecting) { + socket.on("connect", () => { + timing.clearTimeout(timeoutId); + }); + } + else { + timing.clearTimeout(timeoutId); + } + }; + if (request.socket) { + doWithSocket(request.socket); + } + else { + request.on("socket", doWithSocket); + } + }; + if (timeoutInMs < 2000) { + registerTimeout(0); + return 0; + } + return timing.setTimeout(registerTimeout.bind(null, DEFER_EVENT_LISTENER_TIME$2), DEFER_EVENT_LISTENER_TIME$2); }; -// src/CredentialsProviderError.ts -var CredentialsProviderError = class _CredentialsProviderError extends ProviderError { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "CredentialsProviderError"; - Object.setPrototypeOf(this, _CredentialsProviderError.prototype); - } - static { - __name(this, "CredentialsProviderError"); - } +const setRequestTimeout = (req, reject, timeoutInMs = 0, throwOnRequestTimeout, logger) => { + if (timeoutInMs) { + return timing.setTimeout(() => { + let msg = `@smithy/node-http-handler - [${throwOnRequestTimeout ? "ERROR" : "WARN"}] a request has exceeded the configured ${timeoutInMs} ms requestTimeout.`; + if (throwOnRequestTimeout) { + const error = Object.assign(new Error(msg), { + name: "TimeoutError", + code: "ETIMEDOUT", + }); + req.destroy(error); + reject(error); + } + else { + msg += ` Init client requestHandler with throwOnRequestTimeout=true to turn this into an error.`; + logger?.warn?.(msg); + } + }, timeoutInMs); + } + return -1; }; -// src/TokenProviderError.ts -var TokenProviderError = class _TokenProviderError extends ProviderError { - /** - * @override - */ - constructor(message, options = true) { - super(message, options); - this.name = "TokenProviderError"; - Object.setPrototypeOf(this, _TokenProviderError.prototype); - } - static { - __name(this, "TokenProviderError"); - } +const DEFER_EVENT_LISTENER_TIME$1 = 3000; +const setSocketKeepAlive = (request, { keepAlive, keepAliveMsecs }, deferTimeMs = DEFER_EVENT_LISTENER_TIME$1) => { + if (keepAlive !== true) { + return -1; + } + const registerListener = () => { + if (request.socket) { + request.socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + } + else { + request.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + }); + } + }; + if (deferTimeMs === 0) { + registerListener(); + return 0; + } + return timing.setTimeout(registerListener, deferTimeMs); }; -// src/chain.ts -var chain = /* @__PURE__ */ __name((...providers) => async () => { - if (providers.length === 0) { - throw new ProviderError("No providers in chain"); - } - let lastProviderError; - for (const provider of providers) { - try { - const credentials = await provider(); - return credentials; - } catch (err) { - lastProviderError = err; - if (err?.tryNextLink) { - continue; - } - throw err; +const DEFER_EVENT_LISTENER_TIME = 3000; +const setSocketTimeout = (request, reject, timeoutInMs = 0) => { + const registerTimeout = (offset) => { + const timeout = timeoutInMs - offset; + const onTimeout = () => { + request.destroy(); + reject(Object.assign(new Error(`@smithy/node-http-handler - the request socket timed out after ${timeoutInMs} ms of inactivity (configured by client requestHandler).`), { name: "TimeoutError" })); + }; + if (request.socket) { + request.socket.setTimeout(timeout, onTimeout); + request.on("close", () => request.socket?.removeListener("timeout", onTimeout)); + } + else { + request.setTimeout(timeout, onTimeout); + } + }; + if (0 < timeoutInMs && timeoutInMs < 6000) { + registerTimeout(0); + return 0; } - } - throw lastProviderError; -}, "chain"); + return timing.setTimeout(registerTimeout.bind(null, timeoutInMs === 0 ? 0 : DEFER_EVENT_LISTENER_TIME), DEFER_EVENT_LISTENER_TIME); +}; + +const MIN_WAIT_TIME = 6_000; +async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME, externalAgent = false) { + const headers = request.headers ?? {}; + const expect = headers.Expect || headers.expect; + let timeoutId = -1; + let sendBody = true; + if (!externalAgent && expect === "100-continue") { + sendBody = await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(timing.setTimeout(() => resolve(true), Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + timing.clearTimeout(timeoutId); + resolve(true); + }); + httpRequest.on("response", () => { + timing.clearTimeout(timeoutId); + resolve(false); + }); + httpRequest.on("error", () => { + timing.clearTimeout(timeoutId); + resolve(false); + }); + }), + ]); + } + if (sendBody) { + writeBody(httpRequest, request.body); + } +} +function writeBody(httpRequest, body) { + if (body instanceof stream.Readable) { + body.pipe(httpRequest); + return; + } + if (body) { + if (Buffer.isBuffer(body) || typeof body === "string") { + httpRequest.end(body); + return; + } + const uint8 = body; + if (typeof uint8 === "object" && + uint8.buffer && + typeof uint8.byteOffset === "number" && + typeof uint8.byteLength === "number") { + httpRequest.end(Buffer.from(uint8.buffer, uint8.byteOffset, uint8.byteLength)); + return; + } + httpRequest.end(Buffer.from(body)); + return; + } + httpRequest.end(); +} + +const DEFAULT_REQUEST_TIMEOUT = 0; +class NodeHttpHandler { + config; + configProvider; + socketWarningTimestamp = 0; + externalAgent = false; + metadata = { handlerProtocol: "http/1.1" }; + static create(instanceOrOptions) { + if (typeof instanceOrOptions?.handle === "function") { + return instanceOrOptions; + } + return new NodeHttpHandler(instanceOrOptions); + } + static checkSocketUsage(agent, socketWarningTimestamp, logger = console) { + const { sockets, requests, maxSockets } = agent; + if (typeof maxSockets !== "number" || maxSockets === Infinity) { + return socketWarningTimestamp; + } + const interval = 15_000; + if (Date.now() - interval < socketWarningTimestamp) { + return socketWarningTimestamp; + } + if (sockets && requests) { + for (const origin in sockets) { + const socketsInUse = sockets[origin]?.length ?? 0; + const requestsEnqueued = requests[origin]?.length ?? 0; + if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) { + logger?.warn?.(`@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued. +See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html +or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.`); + return Date.now(); + } + } + } + return socketWarningTimestamp; + } + constructor(options) { + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }) + .catch(reject); + } + else { + resolve(this.resolveDefaultConfig(options)); + } + }); + } + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, socketAcquisitionWarningTimeout, httpAgent, httpsAgent, throwOnRequestTimeout, } = options || {}; + const keepAlive = true; + const maxSockets = 50; + return { + connectionTimeout, + requestTimeout, + socketTimeout, + socketAcquisitionWarningTimeout, + throwOnRequestTimeout, + httpAgent: (() => { + if (httpAgent instanceof http.Agent || typeof httpAgent?.destroy === "function") { + this.externalAgent = true; + return httpAgent; + } + return new http.Agent({ keepAlive, maxSockets, ...httpAgent }); + })(), + httpsAgent: (() => { + if (httpsAgent instanceof https.Agent || typeof httpsAgent?.destroy === "function") { + this.externalAgent = true; + return httpsAgent; + } + return new https.Agent({ keepAlive, maxSockets, ...httpsAgent }); + })(), + logger: console, + }; + } + destroy() { + this.config?.httpAgent?.destroy(); + this.config?.httpsAgent?.destroy(); + } + async handle(request, { abortSignal, requestTimeout } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + return new Promise((_resolve, _reject) => { + const config = this.config; + let writeRequestBodyPromise = undefined; + const timeouts = []; + const resolve = async (arg) => { + await writeRequestBodyPromise; + timeouts.forEach(timing.clearTimeout); + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + timeouts.forEach(timing.clearTimeout); + _reject(arg); + }; + if (abortSignal?.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request.protocol === "https:"; + const headers = request.headers ?? {}; + const expectContinue = (headers.Expect ?? headers.expect) === "100-continue"; + let agent = isSSL ? config.httpsAgent : config.httpAgent; + if (expectContinue && !this.externalAgent) { + agent = new (isSSL ? https.Agent : http.Agent)({ + keepAlive: false, + maxSockets: Infinity, + }); + } + timeouts.push(timing.setTimeout(() => { + this.socketWarningTimestamp = NodeHttpHandler.checkSocketUsage(agent, this.socketWarningTimestamp, config.logger); + }, config.socketAcquisitionWarningTimeout ?? (config.requestTimeout ?? 2000) + (config.connectionTimeout ?? 1000))); + const queryString = querystringBuilder.buildQueryString(request.query || {}); + let auth = undefined; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}`; + } + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + let hostname = request.hostname ?? ""; + if (hostname[0] === "[" && hostname.endsWith("]")) { + hostname = request.hostname.slice(1, -1); + } + else { + hostname = request.hostname; + } + const nodeHttpsOptions = { + headers: request.headers, + host: hostname, + method: request.method, + path, + port: request.port, + agent, + auth, + }; + const requestFunc = isSSL ? https.request : http.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new protocolHttp.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: getTransformedHeaders(res.headers), + body: res, + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); + } + else { + reject(err); + } + }); + if (abortSignal) { + const onAbort = () => { + req.destroy(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }; + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + req.once("close", () => signal.removeEventListener("abort", onAbort)); + } + else { + abortSignal.onabort = onAbort; + } + } + const effectiveRequestTimeout = requestTimeout ?? config.requestTimeout; + timeouts.push(setConnectionTimeout(req, reject, config.connectionTimeout)); + timeouts.push(setRequestTimeout(req, reject, effectiveRequestTimeout, config.throwOnRequestTimeout, config.logger ?? console)); + timeouts.push(setSocketTimeout(req, reject, config.socketTimeout)); + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + timeouts.push(setSocketKeepAlive(req, { + keepAlive: httpAgent.keepAlive, + keepAliveMsecs: httpAgent.keepAliveMsecs, + })); + } + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout, this.externalAgent).catch((e) => { + timeouts.forEach(timing.clearTimeout); + return _reject(e); + }); + }); + } + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); + } + httpHandlerConfigs() { + return this.config ?? {}; + } +} -// src/fromStatic.ts -var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); +class NodeHttp2ConnectionPool { + sessions = []; + constructor(sessions) { + this.sessions = sessions ?? []; + } + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); + } + } + offerLast(session) { + this.sessions.push(session); + } + contains(session) { + return this.sessions.includes(session); + } + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); + } + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); + } + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); + } + } + } + } +} -// src/memoize.ts -var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = /* @__PURE__ */ __name(async () => { - if (!pending) { - pending = provider(); +class NodeHttp2ConnectionManager { + constructor(config) { + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); + } } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } finally { - pending = void 0; + config; + sessionCache = new Map(); + lease(requestContext, connectionConfiguration) { + const url = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; + } + } + const session = http2.connect(url); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error("Fail to set maxConcurrentStreams to " + + this.config.maxConcurrency + + "when creating new session for " + + requestContext.destination.toString()); + } + }); + } + session.unref(); + const destroySessionCb = () => { + session.destroy(); + this.deleteSession(url, session); + }; + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url) || new NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url, connectionPool); + return session; + } + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; + } + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); } - return resolved; - }, "coalesceProvider"); - if (isExpired === void 0) { - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(); - } - return resolved; - }; - } - return async (options) => { - if (!hasResult || options?.forceRefresh) { - resolved = await coalesceProvider(); + release(requestContext, session) { + const cacheKey = this.getUrlString(requestContext); + this.sessionCache.get(cacheKey)?.offerLast(session); } - if (isConstant) { - return resolved; + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); + } + connectionPool.remove(session); + } + this.sessionCache.delete(key); + } } - if (requiresRefresh && !requiresRefresh(resolved)) { - isConstant = true; - return resolved; + setMaxConcurrentStreams(maxConcurrentStreams) { + if (maxConcurrentStreams && maxConcurrentStreams <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); + } + this.config.maxConcurrency = maxConcurrentStreams; } - if (isExpired(resolved)) { - await coalesceProvider(); - return resolved; + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; } - return resolved; - }; -}, "memoize"); -// Annotate the CommonJS export names for ESM import in node: + getUrlString(request) { + return request.destination.toString(); + } +} -0 && (0); +class NodeHttp2Handler { + config; + configProvider; + metadata = { handlerProtocol: "h2" }; + connectionManager = new NodeHttp2ConnectionManager({}); + static create(instanceOrOptions) { + if (typeof instanceOrOptions?.handle === "function") { + return instanceOrOptions; + } + return new NodeHttp2Handler(instanceOrOptions); + } + constructor(options) { + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((opts) => { + resolve(opts || {}); + }) + .catch(reject); + } + else { + resolve(options || {}); + } + }); + } + destroy() { + this.connectionManager.destroy(); + } + async handle(request, { abortSignal, requestTimeout } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); + } + } + const { requestTimeout: configRequestTimeout, disableConcurrentStreams } = this.config; + const effectiveRequestTimeout = requestTimeout ?? configRequestTimeout; + return new Promise((_resolve, _reject) => { + let fulfilled = false; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (abortSignal?.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request; + let auth = ""; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: this.config?.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false, + }); + const rejectWithDestroy = (err) => { + if (disableConcurrentStreams) { + this.destroySession(session); + } + fulfilled = true; + reject(err); + }; + const queryString = querystringBuilder.buildQueryString(query || {}); + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const req = session.request({ + ...request.headers, + [http2.constants.HTTP2_HEADER_PATH]: path, + [http2.constants.HTTP2_HEADER_METHOD]: method, + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new protocolHttp.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: getTransformedHeaders(headers), + body: req, + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); + } + }); + if (effectiveRequestTimeout) { + req.setTimeout(effectiveRequestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${effectiveRequestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + const onAbort = () => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }; + if (typeof abortSignal.addEventListener === "function") { + const signal = abortSignal; + signal.addEventListener("abort", onAbort, { once: true }); + req.once("close", () => signal.removeEventListener("abort", onAbort)); + } + else { + abortSignal.onabort = onAbort; + } + } + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy(new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`)); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = writeRequestBody(req, request, effectiveRequestTimeout); + }); + } + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); + } + httpHandlerConfigs() { + return this.config ?? {}; + } + destroySession(session) { + if (!session.destroyed) { + session.destroy(); + } + } +} + +class Collector extends stream.Writable { + bufferedBytes = []; + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); + } +} + +const streamCollector = (stream) => { + if (isReadableStreamInstance(stream)) { + return collectReadableStream(stream); + } + return new Promise((resolve, reject) => { + const collector = new Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function () { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); + }); +}; +const isReadableStreamInstance = (stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream; +async function collectReadableStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; + } + isDone = done; + } + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; + } + return collected; +} +exports.DEFAULT_REQUEST_TIMEOUT = DEFAULT_REQUEST_TIMEOUT; +exports.NodeHttp2Handler = NodeHttp2Handler; +exports.NodeHttpHandler = NodeHttpHandler; +exports.streamCollector = streamCollector; /***/ }), -/***/ 2356: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 1238: +/***/ ((__unused_webpack_module, exports) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +"use strict"; -// src/index.ts -var index_exports = {}; -__export(index_exports, { - Field: () => Field, - Fields: () => Fields, - HttpRequest: () => HttpRequest, - HttpResponse: () => HttpResponse, - IHttpRequest: () => import_types.HttpRequest, - getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, - isValidHostname: () => isValidHostname, - resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig -}); -module.exports = __toCommonJS(index_exports); -// src/extensions/httpExtensionConfiguration.ts -var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return { - setHttpHandler(handler) { - runtimeConfig.httpHandler = handler; - }, - httpHandler() { - return runtimeConfig.httpHandler; - }, - updateHttpClientConfig(key, value) { - runtimeConfig.httpHandler?.updateHttpClientConfig(key, value); - }, - httpHandlerConfigs() { - return runtimeConfig.httpHandler.httpHandlerConfigs(); +class ProviderError extends Error { + name = "ProviderError"; + tryNextLink; + constructor(message, options = true) { + let logger; + let tryNextLink = true; + if (typeof options === "boolean") { + logger = undefined; + tryNextLink = options; + } + else if (options != null && typeof options === "object") { + logger = options.logger; + tryNextLink = options.tryNextLink ?? true; + } + super(message); + this.tryNextLink = tryNextLink; + Object.setPrototypeOf(this, ProviderError.prototype); + logger?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); } - }; -}, "getHttpHandlerExtensionConfiguration"); -var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { - return { - httpHandler: httpHandlerExtensionConfiguration.httpHandler() - }; -}, "resolveHttpHandlerRuntimeConfig"); + static from(error, options = true) { + return Object.assign(new this(error.message, options), error); + } +} -// src/Field.ts -var import_types = __nccwpck_require__(690); -var Field = class { - static { - __name(this, "Field"); - } - constructor({ name, kind = import_types.FieldPosition.HEADER, values = [] }) { - this.name = name; - this.kind = kind; - this.values = values; - } - /** - * Appends a value to the field. - * - * @param value The value to append. - */ - add(value) { - this.values.push(value); - } - /** - * Overwrite existing field values. - * - * @param values The new field values. - */ - set(values) { - this.values = values; - } - /** - * Remove all matching entries from list. - * - * @param value Value to remove. - */ - remove(value) { - this.values = this.values.filter((v) => v !== value); - } - /** - * Get comma-delimited string. - * - * @returns String representation of {@link Field}. - */ - toString() { - return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); - } - /** - * Get string values as a list - * - * @returns Values in {@link Field} as a list. - */ - get() { - return this.values; - } +class CredentialsProviderError extends ProviderError { + name = "CredentialsProviderError"; + constructor(message, options = true) { + super(message, options); + Object.setPrototypeOf(this, CredentialsProviderError.prototype); + } +} + +class TokenProviderError extends ProviderError { + name = "TokenProviderError"; + constructor(message, options = true) { + super(message, options); + Object.setPrototypeOf(this, TokenProviderError.prototype); + } +} + +const chain = (...providers) => async () => { + if (providers.length === 0) { + throw new ProviderError("No providers in chain"); + } + let lastProviderError; + for (const provider of providers) { + try { + const credentials = await provider(); + return credentials; + } + catch (err) { + lastProviderError = err; + if (err?.tryNextLink) { + continue; + } + throw err; + } + } + throw lastProviderError; }; -// src/Fields.ts -var Fields = class { - constructor({ fields = [], encoding = "utf-8" }) { - this.entries = {}; - fields.forEach(this.setField.bind(this)); - this.encoding = encoding; - } - static { - __name(this, "Fields"); - } - /** - * Set entry for a {@link Field} name. The `name` - * attribute will be used to key the collection. - * - * @param field The {@link Field} to set. - */ - setField(field) { - this.entries[field.name.toLowerCase()] = field; - } - /** - * Retrieve {@link Field} entry by name. - * - * @param name The name of the {@link Field} entry - * to retrieve - * @returns The {@link Field} if it exists. - */ - getField(name) { - return this.entries[name.toLowerCase()]; - } - /** - * Delete entry from collection. - * - * @param name Name of the entry to delete. - */ - removeField(name) { - delete this.entries[name.toLowerCase()]; - } - /** - * Helper function for retrieving specific types of fields. - * Used to grab all headers or all trailers. - * - * @param kind {@link FieldPosition} of entries to retrieve. - * @returns The {@link Field} entries with the specified - * {@link FieldPosition}. - */ - getByType(kind) { - return Object.values(this.entries).filter((field) => field.kind === kind); - } +const fromStatic = (staticValue) => () => Promise.resolve(staticValue); + +const memoize = (provider, isExpired, requiresRefresh) => { + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = async () => { + if (!pending) { + pending = provider(); + } + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } + finally { + pending = undefined; + } + return resolved; + }; + if (isExpired === undefined) { + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(); + } + return resolved; + }; + } + return async (options) => { + if (!hasResult || options?.forceRefresh) { + resolved = await coalesceProvider(); + } + if (isConstant) { + return resolved; + } + if (requiresRefresh && !requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(); + return resolved; + } + return resolved; + }; }; -// src/httpRequest.ts +exports.CredentialsProviderError = CredentialsProviderError; +exports.ProviderError = ProviderError; +exports.TokenProviderError = TokenProviderError; +exports.chain = chain; +exports.fromStatic = fromStatic; +exports.memoize = memoize; + + +/***/ }), + +/***/ 2356: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + -var HttpRequest = class _HttpRequest { - static { - __name(this, "HttpRequest"); - } - constructor(options) { - this.method = options.method || "GET"; - this.hostname = options.hostname || "localhost"; - this.port = options.port; - this.query = options.query || {}; - this.headers = options.headers || {}; - this.body = options.body; - this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; - this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; - this.username = options.username; - this.password = options.password; - this.fragment = options.fragment; - } - /** - * Note: this does not deep-clone the body. - */ - static clone(request) { - const cloned = new _HttpRequest({ - ...request, - headers: { ...request.headers } - }); - if (cloned.query) { - cloned.query = cloneQuery(cloned.query); - } - return cloned; - } - /** - * This method only actually asserts that request is the interface {@link IHttpRequest}, - * and not necessarily this concrete class. Left in place for API stability. - * - * Do not call instance methods on the input of this function, and - * do not assume it has the HttpRequest prototype. - */ - static isInstance(request) { - if (!request) { - return false; - } - const req = request; - return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; - } - /** - * @deprecated use static HttpRequest.clone(request) instead. It's not safe to call - * this method because {@link HttpRequest.isInstance} incorrectly - * asserts that IHttpRequest (interface) objects are of type HttpRequest (class). - */ - clone() { - return _HttpRequest.clone(this); - } +var types = __nccwpck_require__(690); + +const getHttpHandlerExtensionConfiguration = (runtimeConfig) => { + return { + setHttpHandler(handler) { + runtimeConfig.httpHandler = handler; + }, + httpHandler() { + return runtimeConfig.httpHandler; + }, + updateHttpClientConfig(key, value) { + runtimeConfig.httpHandler?.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return runtimeConfig.httpHandler.httpHandlerConfigs(); + }, + }; }; -function cloneQuery(query) { - return Object.keys(query).reduce((carry, paramName) => { - const param = query[paramName]; +const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => { return { - ...carry, - [paramName]: Array.isArray(param) ? [...param] : param + httpHandler: httpHandlerExtensionConfiguration.httpHandler(), }; - }, {}); +}; + +class Field { + name; + kind; + values; + constructor({ name, kind = types.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; + } + add(value) { + this.values.push(value); + } + set(values) { + this.values = values; + } + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); + } + get() { + return this.values; + } +} + +class Fields { + entries = {}; + encoding; + constructor({ fields = [], encoding = "utf-8" }) { + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } + setField(field) { + this.entries[field.name.toLowerCase()] = field; + } + getField(name) { + return this.entries[name.toLowerCase()]; + } + removeField(name) { + delete this.entries[name.toLowerCase()]; + } + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } +} + +class HttpRequest { + method; + protocol; + hostname; + port; + path; + query; + headers; + username; + password; + fragment; + body; + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; + } + static clone(request) { + const cloned = new HttpRequest({ + ...request, + headers: { ...request.headers }, + }); + if (cloned.query) { + cloned.query = cloneQuery(cloned.query); + } + return cloned; + } + static isInstance(request) { + if (!request) { + return false; + } + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); + } + clone() { + return HttpRequest.clone(this); + } +} +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); } -__name(cloneQuery, "cloneQuery"); -// src/httpResponse.ts -var HttpResponse = class { - static { - __name(this, "HttpResponse"); - } - constructor(options) { - this.statusCode = options.statusCode; - this.reason = options.reason; - this.headers = options.headers || {}; - this.body = options.body; - } - static isInstance(response) { - if (!response) return false; - const resp = response; - return typeof resp.statusCode === "number" && typeof resp.headers === "object"; - } -}; +class HttpResponse { + statusCode; + reason; + headers; + body; + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +} -// src/isValidHostname.ts function isValidHostname(hostname) { - const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; - return hostPattern.test(hostname); + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); } -__name(isValidHostname, "isValidHostname"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); +exports.Field = Field; +exports.Fields = Fields; +exports.HttpRequest = HttpRequest; +exports.HttpResponse = HttpResponse; +exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration; +exports.isValidHostname = isValidHostname; +exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig; /***/ }), /***/ 8256: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +"use strict"; + + +var utilUriEscape = __nccwpck_require__(146); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - buildQueryString: () => buildQueryString -}); -module.exports = __toCommonJS(index_exports); -var import_util_uri_escape = __nccwpck_require__(146); function buildQueryString(query) { - const parts = []; - for (let key of Object.keys(query).sort()) { - const value = query[key]; - key = (0, import_util_uri_escape.escapeUri)(key); - if (Array.isArray(value)) { - for (let i = 0, iLen = value.length; i < iLen; i++) { - parts.push(`${key}=${(0, import_util_uri_escape.escapeUri)(value[i])}`); - } - } else { - let qsEntry = key; - if (value || typeof value === "string") { - qsEntry += `=${(0, import_util_uri_escape.escapeUri)(value)}`; - } - parts.push(qsEntry); + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = utilUriEscape.escapeUri(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${utilUriEscape.escapeUri(value[i])}`); + } + } + else { + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${utilUriEscape.escapeUri(value)}`; + } + parts.push(qsEntry); + } } - } - return parts.join("&"); + return parts.join("&"); } -__name(buildQueryString, "buildQueryString"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); +exports.buildQueryString = buildQueryString; /***/ }), /***/ 8822: -/***/ ((module) => { +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - parseQueryString: () => parseQueryString -}); -module.exports = __toCommonJS(index_exports); function parseQueryString(querystring) { - const query = {}; - querystring = querystring.replace(/^\?/, ""); - if (querystring) { - for (const pair of querystring.split("&")) { - let [key, value = null] = pair.split("="); - key = decodeURIComponent(key); - if (value) { - value = decodeURIComponent(value); - } - if (!(key in query)) { - query[key] = value; - } else if (Array.isArray(query[key])) { - query[key].push(value); - } else { - query[key] = [query[key], value]; - } + const query = {}; + querystring = querystring.replace(/^\?/, ""); + if (querystring) { + for (const pair of querystring.split("&")) { + let [key, value = null] = pair.split("="); + key = decodeURIComponent(key); + if (value) { + value = decodeURIComponent(value); + } + if (!(key in query)) { + query[key] = value; + } + else if (Array.isArray(query[key])) { + query[key].push(value); + } + else { + query[key] = [query[key], value]; + } + } } - } - return query; + return query; } -__name(parseQueryString, "parseQueryString"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); +exports.parseQueryString = parseQueryString; /***/ }), /***/ 2058: -/***/ ((module) => { +/***/ ((__unused_webpack_module, exports) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +"use strict"; -// src/index.ts -var index_exports = {}; -__export(index_exports, { - isBrowserNetworkError: () => isBrowserNetworkError, - isClockSkewCorrectedError: () => isClockSkewCorrectedError, - isClockSkewError: () => isClockSkewError, - isRetryableByTrait: () => isRetryableByTrait, - isServerError: () => isServerError, - isThrottlingError: () => isThrottlingError, - isTransientError: () => isTransientError -}); -module.exports = __toCommonJS(index_exports); -// src/constants.ts -var CLOCK_SKEW_ERROR_CODES = [ - "AuthFailure", - "InvalidSignatureException", - "RequestExpired", - "RequestInTheFuture", - "RequestTimeTooSkewed", - "SignatureDoesNotMatch" +const CLOCK_SKEW_ERROR_CODES = [ + "AuthFailure", + "InvalidSignatureException", + "RequestExpired", + "RequestInTheFuture", + "RequestTimeTooSkewed", + "SignatureDoesNotMatch", ]; -var THROTTLING_ERROR_CODES = [ - "BandwidthLimitExceeded", - "EC2ThrottledException", - "LimitExceededException", - "PriorRequestNotComplete", - "ProvisionedThroughputExceededException", - "RequestLimitExceeded", - "RequestThrottled", - "RequestThrottledException", - "SlowDown", - "ThrottledException", - "Throttling", - "ThrottlingException", - "TooManyRequestsException", - "TransactionInProgressException" - // DynamoDB +const THROTTLING_ERROR_CODES = [ + "BandwidthLimitExceeded", + "EC2ThrottledException", + "LimitExceededException", + "PriorRequestNotComplete", + "ProvisionedThroughputExceededException", + "RequestLimitExceeded", + "RequestThrottled", + "RequestThrottledException", + "SlowDown", + "ThrottledException", + "Throttling", + "ThrottlingException", + "TooManyRequestsException", + "TransactionInProgressException", ]; -var TRANSIENT_ERROR_CODES = ["TimeoutError", "RequestTimeout", "RequestTimeoutException"]; -var TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504]; -var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "ECONNREFUSED", "EPIPE", "ETIMEDOUT"]; -var NODEJS_NETWORK_ERROR_CODES = ["EHOSTUNREACH", "ENETUNREACH", "ENOTFOUND"]; - -// src/index.ts -var isRetryableByTrait = /* @__PURE__ */ __name((error) => error.$retryable !== void 0, "isRetryableByTrait"); -var isClockSkewError = /* @__PURE__ */ __name((error) => CLOCK_SKEW_ERROR_CODES.includes(error.name), "isClockSkewError"); -var isClockSkewCorrectedError = /* @__PURE__ */ __name((error) => error.$metadata?.clockSkewCorrected, "isClockSkewCorrectedError"); -var isBrowserNetworkError = /* @__PURE__ */ __name((error) => { - const errorMessages = /* @__PURE__ */ new Set([ - "Failed to fetch", - // Chrome - "NetworkError when attempting to fetch resource", - // Firefox - "The Internet connection appears to be offline", - // Safari 16 - "Load failed", - // Safari 17+ - "Network request failed" - // `cross-fetch` - ]); - const isValid = error && error instanceof TypeError; - if (!isValid) { - return false; - } - return errorMessages.has(error.message); -}, "isBrowserNetworkError"); -var isThrottlingError = /* @__PURE__ */ __name((error) => error.$metadata?.httpStatusCode === 429 || THROTTLING_ERROR_CODES.includes(error.name) || error.$retryable?.throttling == true, "isThrottlingError"); -var isTransientError = /* @__PURE__ */ __name((error, depth = 0) => isClockSkewCorrectedError(error) || TRANSIENT_ERROR_CODES.includes(error.name) || NODEJS_TIMEOUT_ERROR_CODES.includes(error?.code || "") || NODEJS_NETWORK_ERROR_CODES.includes(error?.code || "") || TRANSIENT_ERROR_STATUS_CODES.includes(error.$metadata?.httpStatusCode || 0) || isBrowserNetworkError(error) || error.cause !== void 0 && depth <= 10 && isTransientError(error.cause, depth + 1), "isTransientError"); -var isServerError = /* @__PURE__ */ __name((error) => { - if (error.$metadata?.httpStatusCode !== void 0) { - const statusCode = error.$metadata.httpStatusCode; - if (500 <= statusCode && statusCode <= 599 && !isTransientError(error)) { - return true; +const TRANSIENT_ERROR_CODES = ["TimeoutError", "RequestTimeout", "RequestTimeoutException"]; +const TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504]; +const NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "ECONNREFUSED", "EPIPE", "ETIMEDOUT"]; +const NODEJS_NETWORK_ERROR_CODES = ["EHOSTUNREACH", "ENETUNREACH", "ENOTFOUND"]; + +const isRetryableByTrait = (error) => error?.$retryable !== undefined; +const isClockSkewError = (error) => CLOCK_SKEW_ERROR_CODES.includes(error.name); +const isClockSkewCorrectedError = (error) => error.$metadata?.clockSkewCorrected; +const isBrowserNetworkError = (error) => { + const errorMessages = new Set([ + "Failed to fetch", + "NetworkError when attempting to fetch resource", + "The Internet connection appears to be offline", + "Load failed", + "Network request failed", + ]); + const isValid = error && error instanceof TypeError; + if (!isValid) { + return false; + } + return errorMessages.has(error.message); +}; +const isThrottlingError = (error) => error.$metadata?.httpStatusCode === 429 || + THROTTLING_ERROR_CODES.includes(error.name) || + error.$retryable?.throttling == true; +const isTransientError = (error, depth = 0) => isRetryableByTrait(error) || + isClockSkewCorrectedError(error) || + TRANSIENT_ERROR_CODES.includes(error.name) || + NODEJS_TIMEOUT_ERROR_CODES.includes(error?.code || "") || + NODEJS_NETWORK_ERROR_CODES.includes(error?.code || "") || + TRANSIENT_ERROR_STATUS_CODES.includes(error.$metadata?.httpStatusCode || 0) || + isBrowserNetworkError(error) || + (error.cause !== undefined && depth <= 10 && isTransientError(error.cause, depth + 1)); +const isServerError = (error) => { + if (error.$metadata?.httpStatusCode !== undefined) { + const statusCode = error.$metadata.httpStatusCode; + if (500 <= statusCode && statusCode <= 599 && !isTransientError(error)) { + return true; + } + return false; } return false; - } - return false; -}, "isServerError"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); +}; +exports.isBrowserNetworkError = isBrowserNetworkError; +exports.isClockSkewCorrectedError = isClockSkewCorrectedError; +exports.isClockSkewError = isClockSkewError; +exports.isRetryableByTrait = isRetryableByTrait; +exports.isServerError = isServerError; +exports.isThrottlingError = isThrottlingError; +exports.isTransientError = isTransientError; /***/ }), @@ -24938,224 +18422,199 @@ exports.getSSOTokenFromFile = getSSOTokenFromFile; /***/ }), /***/ 4964: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -// src/index.ts -var index_exports = {}; -__export(index_exports, { - CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, - DEFAULT_PROFILE: () => DEFAULT_PROFILE, - ENV_PROFILE: () => ENV_PROFILE, - SSOToken: () => import_getSSOTokenFromFile2.SSOToken, - externalDataInterceptor: () => externalDataInterceptor, - getProfileName: () => getProfileName, - getSSOTokenFromFile: () => import_getSSOTokenFromFile2.getSSOTokenFromFile, - loadSharedConfigFiles: () => loadSharedConfigFiles, - loadSsoSessionData: () => loadSsoSessionData, - parseKnownFiles: () => parseKnownFiles -}); -module.exports = __toCommonJS(index_exports); -__reExport(index_exports, __nccwpck_require__(4172), module.exports); +"use strict"; -// src/getProfileName.ts -var ENV_PROFILE = "AWS_PROFILE"; -var DEFAULT_PROFILE = "default"; -var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); -// src/index.ts -__reExport(index_exports, __nccwpck_require__(269), module.exports); -var import_getSSOTokenFromFile2 = __nccwpck_require__(1326); +var getHomeDir = __nccwpck_require__(4172); +var getSSOTokenFilepath = __nccwpck_require__(269); +var getSSOTokenFromFile = __nccwpck_require__(1326); +var path = __nccwpck_require__(6928); +var types = __nccwpck_require__(690); +var slurpFile = __nccwpck_require__(4246); -// src/loadSharedConfigFiles.ts +const ENV_PROFILE = "AWS_PROFILE"; +const DEFAULT_PROFILE = "default"; +const getProfileName = (init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE; +const CONFIG_PREFIX_SEPARATOR = "."; -// src/getConfigData.ts -var import_types = __nccwpck_require__(690); -var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { - const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - if (indexOfSeparator === -1) { - return false; - } - return Object.values(import_types.IniSectionType).includes(key.substring(0, indexOfSeparator)); -}).reduce( - (acc, [key, value]) => { +const getConfigData = (data) => Object.entries(data) + .filter(([key]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + if (indexOfSeparator === -1) { + return false; + } + return Object.values(types.IniSectionType).includes(key.substring(0, indexOfSeparator)); +}) + .reduce((acc, [key, value]) => { const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); - const updatedKey = key.substring(0, indexOfSeparator) === import_types.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; + const updatedKey = key.substring(0, indexOfSeparator) === types.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; acc[updatedKey] = value; return acc; - }, - { - // Populate default profile, if present. - ...data.default && { default: data.default } - } -), "getConfigData"); - -// src/getConfigFilepath.ts -var import_path = __nccwpck_require__(6928); -var import_getHomeDir = __nccwpck_require__(4172); -var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; -var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); - -// src/getCredentialsFilepath.ts - -var import_getHomeDir2 = __nccwpck_require__(4172); -var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; -var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); - -// src/loadSharedConfigFiles.ts -var import_getHomeDir3 = __nccwpck_require__(4172); - -// src/parseIni.ts - -var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; -var profileNameBlockList = ["__proto__", "profile __proto__"]; -var parseIni = /* @__PURE__ */ __name((iniData) => { - const map = {}; - let currentSection; - let currentSubSection; - for (const iniLine of iniData.split(/\r?\n/)) { - const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); - const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; - if (isSection) { - currentSection = void 0; - currentSubSection = void 0; - const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); - const matches = prefixKeyRegex.exec(sectionName); - if (matches) { - const [, prefix, , name] = matches; - if (Object.values(import_types.IniSectionType).includes(prefix)) { - currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); +}, { + ...(data.default && { default: data.default }), +}); + +const ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; +const getConfigFilepath = () => process.env[ENV_CONFIG_PATH] || path.join(getHomeDir.getHomeDir(), ".aws", "config"); + +const ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; +const getCredentialsFilepath = () => process.env[ENV_CREDENTIALS_PATH] || path.join(getHomeDir.getHomeDir(), ".aws", "credentials"); + +const prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; +const profileNameBlockList = ["__proto__", "profile __proto__"]; +const parseIni = (iniData) => { + const map = {}; + let currentSection; + let currentSubSection; + for (const iniLine of iniData.split(/\r?\n/)) { + const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); + const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; + if (isSection) { + currentSection = undefined; + currentSubSection = undefined; + const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); + const matches = prefixKeyRegex.exec(sectionName); + if (matches) { + const [, prefix, , name] = matches; + if (Object.values(types.IniSectionType).includes(prefix)) { + currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); + } + } + else { + currentSection = sectionName; + } + if (profileNameBlockList.includes(sectionName)) { + throw new Error(`Found invalid profile name "${sectionName}"`); + } } - } else { - currentSection = sectionName; - } - if (profileNameBlockList.includes(sectionName)) { - throw new Error(`Found invalid profile name "${sectionName}"`); - } - } else if (currentSection) { - const indexOfEqualsSign = trimmedLine.indexOf("="); - if (![0, -1].includes(indexOfEqualsSign)) { - const [name, value] = [ - trimmedLine.substring(0, indexOfEqualsSign).trim(), - trimmedLine.substring(indexOfEqualsSign + 1).trim() - ]; - if (value === "") { - currentSubSection = name; - } else { - if (currentSubSection && iniLine.trimStart() === iniLine) { - currentSubSection = void 0; - } - map[currentSection] = map[currentSection] || {}; - const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; - map[currentSection][key] = value; - } - } - } - } - return map; -}, "parseIni"); - -// src/loadSharedConfigFiles.ts -var import_slurpFile = __nccwpck_require__(4246); -var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); -var CONFIG_PREFIX_SEPARATOR = "."; -var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { - const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; - const homeDir = (0, import_getHomeDir3.getHomeDir)(); - const relativeHomeDirPrefix = "~/"; - let resolvedFilepath = filepath; - if (filepath.startsWith(relativeHomeDirPrefix)) { - resolvedFilepath = (0, import_path.join)(homeDir, filepath.slice(2)); - } - let resolvedConfigFilepath = configFilepath; - if (configFilepath.startsWith(relativeHomeDirPrefix)) { - resolvedConfigFilepath = (0, import_path.join)(homeDir, configFilepath.slice(2)); - } - const parsedFiles = await Promise.all([ - (0, import_slurpFile.slurpFile)(resolvedConfigFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).then(getConfigData).catch(swallowError), - (0, import_slurpFile.slurpFile)(resolvedFilepath, { - ignoreCache: init.ignoreCache - }).then(parseIni).catch(swallowError) - ]); - return { - configFile: parsedFiles[0], - credentialsFile: parsedFiles[1] - }; -}, "loadSharedConfigFiles"); + else if (currentSection) { + const indexOfEqualsSign = trimmedLine.indexOf("="); + if (![0, -1].includes(indexOfEqualsSign)) { + const [name, value] = [ + trimmedLine.substring(0, indexOfEqualsSign).trim(), + trimmedLine.substring(indexOfEqualsSign + 1).trim(), + ]; + if (value === "") { + currentSubSection = name; + } + else { + if (currentSubSection && iniLine.trimStart() === iniLine) { + currentSubSection = undefined; + } + map[currentSection] = map[currentSection] || {}; + const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; + map[currentSection][key] = value; + } + } + } + } + return map; +}; -// src/getSsoSessionData.ts +const swallowError$1 = () => ({}); +const loadSharedConfigFiles = async (init = {}) => { + const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; + const homeDir = getHomeDir.getHomeDir(); + const relativeHomeDirPrefix = "~/"; + let resolvedFilepath = filepath; + if (filepath.startsWith(relativeHomeDirPrefix)) { + resolvedFilepath = path.join(homeDir, filepath.slice(2)); + } + let resolvedConfigFilepath = configFilepath; + if (configFilepath.startsWith(relativeHomeDirPrefix)) { + resolvedConfigFilepath = path.join(homeDir, configFilepath.slice(2)); + } + const parsedFiles = await Promise.all([ + slurpFile.slurpFile(resolvedConfigFilepath, { + ignoreCache: init.ignoreCache, + }) + .then(parseIni) + .then(getConfigData) + .catch(swallowError$1), + slurpFile.slurpFile(resolvedFilepath, { + ignoreCache: init.ignoreCache, + }) + .then(parseIni) + .catch(swallowError$1), + ]); + return { + configFile: parsedFiles[0], + credentialsFile: parsedFiles[1], + }; +}; -var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); +const getSsoSessionData = (data) => Object.entries(data) + .filter(([key]) => key.startsWith(types.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)) + .reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}); -// src/loadSsoSessionData.ts -var import_slurpFile2 = __nccwpck_require__(4246); -var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); -var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); +const swallowError = () => ({}); +const loadSsoSessionData = async (init = {}) => slurpFile.slurpFile(init.configFilepath ?? getConfigFilepath()) + .then(parseIni) + .then(getSsoSessionData) + .catch(swallowError); -// src/mergeConfigFiles.ts -var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { - const merged = {}; - for (const file of files) { - for (const [key, values] of Object.entries(file)) { - if (merged[key] !== void 0) { - Object.assign(merged[key], values); - } else { - merged[key] = values; - } +const mergeConfigFiles = (...files) => { + const merged = {}; + for (const file of files) { + for (const [key, values] of Object.entries(file)) { + if (merged[key] !== undefined) { + Object.assign(merged[key], values); + } + else { + merged[key] = values; + } + } } - } - return merged; -}, "mergeConfigFiles"); - -// src/parseKnownFiles.ts -var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { - const parsedFiles = await loadSharedConfigFiles(init); - return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); -}, "parseKnownFiles"); + return merged; +}; -// src/externalDataInterceptor.ts -var import_getSSOTokenFromFile = __nccwpck_require__(1326); -var import_slurpFile3 = __nccwpck_require__(4246); -var externalDataInterceptor = { - getFileRecord() { - return import_slurpFile3.fileIntercept; - }, - interceptFile(path, contents) { - import_slurpFile3.fileIntercept[path] = Promise.resolve(contents); - }, - getTokenRecord() { - return import_getSSOTokenFromFile.tokenIntercept; - }, - interceptToken(id, contents) { - import_getSSOTokenFromFile.tokenIntercept[id] = contents; - } +const parseKnownFiles = async (init) => { + const parsedFiles = await loadSharedConfigFiles(init); + return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); }; -// Annotate the CommonJS export names for ESM import in node: -0 && (0); +const externalDataInterceptor = { + getFileRecord() { + return slurpFile.fileIntercept; + }, + interceptFile(path, contents) { + slurpFile.fileIntercept[path] = Promise.resolve(contents); + }, + getTokenRecord() { + return getSSOTokenFromFile.tokenIntercept; + }, + interceptToken(id, contents) { + getSSOTokenFromFile.tokenIntercept[id] = contents; + }, +}; +Object.defineProperty(exports, "getSSOTokenFromFile", ({ + enumerable: true, + get: function () { return getSSOTokenFromFile.getSSOTokenFromFile; } +})); +exports.CONFIG_PREFIX_SEPARATOR = CONFIG_PREFIX_SEPARATOR; +exports.DEFAULT_PROFILE = DEFAULT_PROFILE; +exports.ENV_PROFILE = ENV_PROFILE; +exports.externalDataInterceptor = externalDataInterceptor; +exports.getProfileName = getProfileName; +exports.loadSharedConfigFiles = loadSharedConfigFiles; +exports.loadSsoSessionData = loadSsoSessionData; +exports.parseKnownFiles = parseKnownFiles; +Object.keys(getHomeDir).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return getHomeDir[k]; } + }); +}); +Object.keys(getSSOTokenFilepath).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return getSSOTokenFilepath[k]; } + }); +}); /***/ }), @@ -25175,7 +18634,7 @@ const slurpFile = (path, options) => { if (exports.fileIntercept[path] !== undefined) { return exports.fileIntercept[path]; } - if (!exports.filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { + if (!exports.filePromisesHash[path] || options?.ignoreCache) { exports.filePromisesHash[path] = readFile(path, "utf8"); } return exports.filePromisesHash[path]; @@ -25186,647 +18645,565 @@ exports.slurpFile = slurpFile; /***/ }), /***/ 5118: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - ALGORITHM_IDENTIFIER: () => ALGORITHM_IDENTIFIER, - ALGORITHM_IDENTIFIER_V4A: () => ALGORITHM_IDENTIFIER_V4A, - ALGORITHM_QUERY_PARAM: () => ALGORITHM_QUERY_PARAM, - ALWAYS_UNSIGNABLE_HEADERS: () => ALWAYS_UNSIGNABLE_HEADERS, - AMZ_DATE_HEADER: () => AMZ_DATE_HEADER, - AMZ_DATE_QUERY_PARAM: () => AMZ_DATE_QUERY_PARAM, - AUTH_HEADER: () => AUTH_HEADER, - CREDENTIAL_QUERY_PARAM: () => CREDENTIAL_QUERY_PARAM, - DATE_HEADER: () => DATE_HEADER, - EVENT_ALGORITHM_IDENTIFIER: () => EVENT_ALGORITHM_IDENTIFIER, - EXPIRES_QUERY_PARAM: () => EXPIRES_QUERY_PARAM, - GENERATED_HEADERS: () => GENERATED_HEADERS, - HOST_HEADER: () => HOST_HEADER, - KEY_TYPE_IDENTIFIER: () => KEY_TYPE_IDENTIFIER, - MAX_CACHE_SIZE: () => MAX_CACHE_SIZE, - MAX_PRESIGNED_TTL: () => MAX_PRESIGNED_TTL, - PROXY_HEADER_PATTERN: () => PROXY_HEADER_PATTERN, - REGION_SET_PARAM: () => REGION_SET_PARAM, - SEC_HEADER_PATTERN: () => SEC_HEADER_PATTERN, - SHA256_HEADER: () => SHA256_HEADER, - SIGNATURE_HEADER: () => SIGNATURE_HEADER, - SIGNATURE_QUERY_PARAM: () => SIGNATURE_QUERY_PARAM, - SIGNED_HEADERS_QUERY_PARAM: () => SIGNED_HEADERS_QUERY_PARAM, - SignatureV4: () => SignatureV4, - SignatureV4Base: () => SignatureV4Base, - TOKEN_HEADER: () => TOKEN_HEADER, - TOKEN_QUERY_PARAM: () => TOKEN_QUERY_PARAM, - UNSIGNABLE_PATTERNS: () => UNSIGNABLE_PATTERNS, - UNSIGNED_PAYLOAD: () => UNSIGNED_PAYLOAD, - clearCredentialCache: () => clearCredentialCache, - createScope: () => createScope, - getCanonicalHeaders: () => getCanonicalHeaders, - getCanonicalQuery: () => getCanonicalQuery, - getPayloadHash: () => getPayloadHash, - getSigningKey: () => getSigningKey, - hasHeader: () => hasHeader, - moveHeadersToQuery: () => moveHeadersToQuery, - prepareRequest: () => prepareRequest, - signatureV4aContainer: () => signatureV4aContainer -}); -module.exports = __toCommonJS(index_exports); - -// src/SignatureV4.ts +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -var import_util_utf85 = __nccwpck_require__(1577); +"use strict"; -// src/constants.ts -var ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm"; -var CREDENTIAL_QUERY_PARAM = "X-Amz-Credential"; -var AMZ_DATE_QUERY_PARAM = "X-Amz-Date"; -var SIGNED_HEADERS_QUERY_PARAM = "X-Amz-SignedHeaders"; -var EXPIRES_QUERY_PARAM = "X-Amz-Expires"; -var SIGNATURE_QUERY_PARAM = "X-Amz-Signature"; -var TOKEN_QUERY_PARAM = "X-Amz-Security-Token"; -var REGION_SET_PARAM = "X-Amz-Region-Set"; -var AUTH_HEADER = "authorization"; -var AMZ_DATE_HEADER = AMZ_DATE_QUERY_PARAM.toLowerCase(); -var DATE_HEADER = "date"; -var GENERATED_HEADERS = [AUTH_HEADER, AMZ_DATE_HEADER, DATE_HEADER]; -var SIGNATURE_HEADER = SIGNATURE_QUERY_PARAM.toLowerCase(); -var SHA256_HEADER = "x-amz-content-sha256"; -var TOKEN_HEADER = TOKEN_QUERY_PARAM.toLowerCase(); -var HOST_HEADER = "host"; -var ALWAYS_UNSIGNABLE_HEADERS = { - authorization: true, - "cache-control": true, - connection: true, - expect: true, - from: true, - "keep-alive": true, - "max-forwards": true, - pragma: true, - referer: true, - te: true, - trailer: true, - "transfer-encoding": true, - upgrade: true, - "user-agent": true, - "x-amzn-trace-id": true -}; -var PROXY_HEADER_PATTERN = /^proxy-/; -var SEC_HEADER_PATTERN = /^sec-/; -var UNSIGNABLE_PATTERNS = [/^proxy-/i, /^sec-/i]; -var ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256"; -var ALGORITHM_IDENTIFIER_V4A = "AWS4-ECDSA-P256-SHA256"; -var EVENT_ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256-PAYLOAD"; -var UNSIGNED_PAYLOAD = "UNSIGNED-PAYLOAD"; -var MAX_CACHE_SIZE = 50; -var KEY_TYPE_IDENTIFIER = "aws4_request"; -var MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7; - -// src/credentialDerivation.ts -var import_util_hex_encoding = __nccwpck_require__(6435); -var import_util_utf8 = __nccwpck_require__(1577); -var signingKeyCache = {}; -var cacheQueue = []; -var createScope = /* @__PURE__ */ __name((shortDate, region, service) => `${shortDate}/${region}/${service}/${KEY_TYPE_IDENTIFIER}`, "createScope"); -var getSigningKey = /* @__PURE__ */ __name(async (sha256Constructor, credentials, shortDate, region, service) => { - const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId); - const cacheKey = `${shortDate}:${region}:${service}:${(0, import_util_hex_encoding.toHex)(credsHash)}:${credentials.sessionToken}`; - if (cacheKey in signingKeyCache) { - return signingKeyCache[cacheKey]; - } - cacheQueue.push(cacheKey); - while (cacheQueue.length > MAX_CACHE_SIZE) { - delete signingKeyCache[cacheQueue.shift()]; - } - let key = `AWS4${credentials.secretAccessKey}`; - for (const signable of [shortDate, region, service, KEY_TYPE_IDENTIFIER]) { - key = await hmac(sha256Constructor, key, signable); - } - return signingKeyCache[cacheKey] = key; -}, "getSigningKey"); -var clearCredentialCache = /* @__PURE__ */ __name(() => { - cacheQueue.length = 0; - Object.keys(signingKeyCache).forEach((cacheKey) => { - delete signingKeyCache[cacheKey]; - }); -}, "clearCredentialCache"); -var hmac = /* @__PURE__ */ __name((ctor, secret, data) => { - const hash = new ctor(secret); - hash.update((0, import_util_utf8.toUint8Array)(data)); - return hash.digest(); -}, "hmac"); - -// src/getCanonicalHeaders.ts -var getCanonicalHeaders = /* @__PURE__ */ __name(({ headers }, unsignableHeaders, signableHeaders) => { - const canonical = {}; - for (const headerName of Object.keys(headers).sort()) { - if (headers[headerName] == void 0) { - continue; - } - const canonicalHeaderName = headerName.toLowerCase(); - if (canonicalHeaderName in ALWAYS_UNSIGNABLE_HEADERS || unsignableHeaders?.has(canonicalHeaderName) || PROXY_HEADER_PATTERN.test(canonicalHeaderName) || SEC_HEADER_PATTERN.test(canonicalHeaderName)) { - if (!signableHeaders || signableHeaders && !signableHeaders.has(canonicalHeaderName)) { - continue; - } - } - canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\s+/g, " "); - } - return canonical; -}, "getCanonicalHeaders"); -// src/getPayloadHash.ts -var import_is_array_buffer = __nccwpck_require__(6130); +var utilHexEncoding = __nccwpck_require__(6435); +var utilUtf8 = __nccwpck_require__(1577); +var isArrayBuffer = __nccwpck_require__(6130); +var protocolHttp = __nccwpck_require__(2356); +var utilMiddleware = __nccwpck_require__(6324); +var utilUriEscape = __nccwpck_require__(146); + +const ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm"; +const CREDENTIAL_QUERY_PARAM = "X-Amz-Credential"; +const AMZ_DATE_QUERY_PARAM = "X-Amz-Date"; +const SIGNED_HEADERS_QUERY_PARAM = "X-Amz-SignedHeaders"; +const EXPIRES_QUERY_PARAM = "X-Amz-Expires"; +const SIGNATURE_QUERY_PARAM = "X-Amz-Signature"; +const TOKEN_QUERY_PARAM = "X-Amz-Security-Token"; +const REGION_SET_PARAM = "X-Amz-Region-Set"; +const AUTH_HEADER = "authorization"; +const AMZ_DATE_HEADER = AMZ_DATE_QUERY_PARAM.toLowerCase(); +const DATE_HEADER = "date"; +const GENERATED_HEADERS = [AUTH_HEADER, AMZ_DATE_HEADER, DATE_HEADER]; +const SIGNATURE_HEADER = SIGNATURE_QUERY_PARAM.toLowerCase(); +const SHA256_HEADER = "x-amz-content-sha256"; +const TOKEN_HEADER = TOKEN_QUERY_PARAM.toLowerCase(); +const HOST_HEADER = "host"; +const ALWAYS_UNSIGNABLE_HEADERS = { + authorization: true, + "cache-control": true, + connection: true, + expect: true, + from: true, + "keep-alive": true, + "max-forwards": true, + pragma: true, + referer: true, + te: true, + trailer: true, + "transfer-encoding": true, + upgrade: true, + "user-agent": true, + "x-amzn-trace-id": true, +}; +const PROXY_HEADER_PATTERN = /^proxy-/; +const SEC_HEADER_PATTERN = /^sec-/; +const UNSIGNABLE_PATTERNS = [/^proxy-/i, /^sec-/i]; +const ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256"; +const ALGORITHM_IDENTIFIER_V4A = "AWS4-ECDSA-P256-SHA256"; +const EVENT_ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256-PAYLOAD"; +const UNSIGNED_PAYLOAD = "UNSIGNED-PAYLOAD"; +const MAX_CACHE_SIZE = 50; +const KEY_TYPE_IDENTIFIER = "aws4_request"; +const MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7; + +const signingKeyCache = {}; +const cacheQueue = []; +const createScope = (shortDate, region, service) => `${shortDate}/${region}/${service}/${KEY_TYPE_IDENTIFIER}`; +const getSigningKey = async (sha256Constructor, credentials, shortDate, region, service) => { + const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId); + const cacheKey = `${shortDate}:${region}:${service}:${utilHexEncoding.toHex(credsHash)}:${credentials.sessionToken}`; + if (cacheKey in signingKeyCache) { + return signingKeyCache[cacheKey]; + } + cacheQueue.push(cacheKey); + while (cacheQueue.length > MAX_CACHE_SIZE) { + delete signingKeyCache[cacheQueue.shift()]; + } + let key = `AWS4${credentials.secretAccessKey}`; + for (const signable of [shortDate, region, service, KEY_TYPE_IDENTIFIER]) { + key = await hmac(sha256Constructor, key, signable); + } + return (signingKeyCache[cacheKey] = key); +}; +const clearCredentialCache = () => { + cacheQueue.length = 0; + Object.keys(signingKeyCache).forEach((cacheKey) => { + delete signingKeyCache[cacheKey]; + }); +}; +const hmac = (ctor, secret, data) => { + const hash = new ctor(secret); + hash.update(utilUtf8.toUint8Array(data)); + return hash.digest(); +}; -var import_util_utf82 = __nccwpck_require__(1577); -var getPayloadHash = /* @__PURE__ */ __name(async ({ headers, body }, hashConstructor) => { - for (const headerName of Object.keys(headers)) { - if (headerName.toLowerCase() === SHA256_HEADER) { - return headers[headerName]; +const getCanonicalHeaders = ({ headers }, unsignableHeaders, signableHeaders) => { + const canonical = {}; + for (const headerName of Object.keys(headers).sort()) { + if (headers[headerName] == undefined) { + continue; + } + const canonicalHeaderName = headerName.toLowerCase(); + if (canonicalHeaderName in ALWAYS_UNSIGNABLE_HEADERS || + unsignableHeaders?.has(canonicalHeaderName) || + PROXY_HEADER_PATTERN.test(canonicalHeaderName) || + SEC_HEADER_PATTERN.test(canonicalHeaderName)) { + if (!signableHeaders || (signableHeaders && !signableHeaders.has(canonicalHeaderName))) { + continue; + } + } + canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\s+/g, " "); } - } - if (body == void 0) { - return "e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855"; - } else if (typeof body === "string" || ArrayBuffer.isView(body) || (0, import_is_array_buffer.isArrayBuffer)(body)) { - const hashCtor = new hashConstructor(); - hashCtor.update((0, import_util_utf82.toUint8Array)(body)); - return (0, import_util_hex_encoding.toHex)(await hashCtor.digest()); - } - return UNSIGNED_PAYLOAD; -}, "getPayloadHash"); - -// src/HeaderFormatter.ts + return canonical; +}; -var import_util_utf83 = __nccwpck_require__(1577); -var HeaderFormatter = class { - static { - __name(this, "HeaderFormatter"); - } - format(headers) { - const chunks = []; +const getPayloadHash = async ({ headers, body }, hashConstructor) => { for (const headerName of Object.keys(headers)) { - const bytes = (0, import_util_utf83.fromUtf8)(headerName); - chunks.push(Uint8Array.from([bytes.byteLength]), bytes, this.formatHeaderValue(headers[headerName])); + if (headerName.toLowerCase() === SHA256_HEADER) { + return headers[headerName]; + } } - const out = new Uint8Array(chunks.reduce((carry, bytes) => carry + bytes.byteLength, 0)); - let position = 0; - for (const chunk of chunks) { - out.set(chunk, position); - position += chunk.byteLength; + if (body == undefined) { + return "e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855"; } - return out; - } - formatHeaderValue(header) { - switch (header.type) { - case "boolean": - return Uint8Array.from([header.value ? 0 /* boolTrue */ : 1 /* boolFalse */]); - case "byte": - return Uint8Array.from([2 /* byte */, header.value]); - case "short": - const shortView = new DataView(new ArrayBuffer(3)); - shortView.setUint8(0, 3 /* short */); - shortView.setInt16(1, header.value, false); - return new Uint8Array(shortView.buffer); - case "integer": - const intView = new DataView(new ArrayBuffer(5)); - intView.setUint8(0, 4 /* integer */); - intView.setInt32(1, header.value, false); - return new Uint8Array(intView.buffer); - case "long": - const longBytes = new Uint8Array(9); - longBytes[0] = 5 /* long */; - longBytes.set(header.value.bytes, 1); - return longBytes; - case "binary": - const binView = new DataView(new ArrayBuffer(3 + header.value.byteLength)); - binView.setUint8(0, 6 /* byteArray */); - binView.setUint16(1, header.value.byteLength, false); - const binBytes = new Uint8Array(binView.buffer); - binBytes.set(header.value, 3); - return binBytes; - case "string": - const utf8Bytes = (0, import_util_utf83.fromUtf8)(header.value); - const strView = new DataView(new ArrayBuffer(3 + utf8Bytes.byteLength)); - strView.setUint8(0, 7 /* string */); - strView.setUint16(1, utf8Bytes.byteLength, false); - const strBytes = new Uint8Array(strView.buffer); - strBytes.set(utf8Bytes, 3); - return strBytes; - case "timestamp": - const tsBytes = new Uint8Array(9); - tsBytes[0] = 8 /* timestamp */; - tsBytes.set(Int64.fromNumber(header.value.valueOf()).bytes, 1); - return tsBytes; - case "uuid": - if (!UUID_PATTERN.test(header.value)) { - throw new Error(`Invalid UUID received: ${header.value}`); - } - const uuidBytes = new Uint8Array(17); - uuidBytes[0] = 9 /* uuid */; - uuidBytes.set((0, import_util_hex_encoding.fromHex)(header.value.replace(/\-/g, "")), 1); - return uuidBytes; + else if (typeof body === "string" || ArrayBuffer.isView(body) || isArrayBuffer.isArrayBuffer(body)) { + const hashCtor = new hashConstructor(); + hashCtor.update(utilUtf8.toUint8Array(body)); + return utilHexEncoding.toHex(await hashCtor.digest()); } - } + return UNSIGNED_PAYLOAD; }; -var UUID_PATTERN = /^[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}$/; -var Int64 = class _Int64 { - constructor(bytes) { - this.bytes = bytes; - if (bytes.byteLength !== 8) { - throw new Error("Int64 buffers must be exactly 8 bytes"); + +class HeaderFormatter { + format(headers) { + const chunks = []; + for (const headerName of Object.keys(headers)) { + const bytes = utilUtf8.fromUtf8(headerName); + chunks.push(Uint8Array.from([bytes.byteLength]), bytes, this.formatHeaderValue(headers[headerName])); + } + const out = new Uint8Array(chunks.reduce((carry, bytes) => carry + bytes.byteLength, 0)); + let position = 0; + for (const chunk of chunks) { + out.set(chunk, position); + position += chunk.byteLength; + } + return out; } - } - static { - __name(this, "Int64"); - } - static fromNumber(number) { - if (number > 9223372036854776e3 || number < -9223372036854776e3) { - throw new Error(`${number} is too large (or, if negative, too small) to represent as an Int64`); + formatHeaderValue(header) { + switch (header.type) { + case "boolean": + return Uint8Array.from([header.value ? 0 : 1]); + case "byte": + return Uint8Array.from([2, header.value]); + case "short": + const shortView = new DataView(new ArrayBuffer(3)); + shortView.setUint8(0, 3); + shortView.setInt16(1, header.value, false); + return new Uint8Array(shortView.buffer); + case "integer": + const intView = new DataView(new ArrayBuffer(5)); + intView.setUint8(0, 4); + intView.setInt32(1, header.value, false); + return new Uint8Array(intView.buffer); + case "long": + const longBytes = new Uint8Array(9); + longBytes[0] = 5; + longBytes.set(header.value.bytes, 1); + return longBytes; + case "binary": + const binView = new DataView(new ArrayBuffer(3 + header.value.byteLength)); + binView.setUint8(0, 6); + binView.setUint16(1, header.value.byteLength, false); + const binBytes = new Uint8Array(binView.buffer); + binBytes.set(header.value, 3); + return binBytes; + case "string": + const utf8Bytes = utilUtf8.fromUtf8(header.value); + const strView = new DataView(new ArrayBuffer(3 + utf8Bytes.byteLength)); + strView.setUint8(0, 7); + strView.setUint16(1, utf8Bytes.byteLength, false); + const strBytes = new Uint8Array(strView.buffer); + strBytes.set(utf8Bytes, 3); + return strBytes; + case "timestamp": + const tsBytes = new Uint8Array(9); + tsBytes[0] = 8; + tsBytes.set(Int64.fromNumber(header.value.valueOf()).bytes, 1); + return tsBytes; + case "uuid": + if (!UUID_PATTERN.test(header.value)) { + throw new Error(`Invalid UUID received: ${header.value}`); + } + const uuidBytes = new Uint8Array(17); + uuidBytes[0] = 9; + uuidBytes.set(utilHexEncoding.fromHex(header.value.replace(/\-/g, "")), 1); + return uuidBytes; + } } - const bytes = new Uint8Array(8); - for (let i = 7, remaining = Math.abs(Math.round(number)); i > -1 && remaining > 0; i--, remaining /= 256) { - bytes[i] = remaining; +} +const UUID_PATTERN = /^[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}$/; +class Int64 { + bytes; + constructor(bytes) { + this.bytes = bytes; + if (bytes.byteLength !== 8) { + throw new Error("Int64 buffers must be exactly 8 bytes"); + } } - if (number < 0) { - negate(bytes); + static fromNumber(number) { + if (number > 9_223_372_036_854_775_807 || number < -9223372036854776e3) { + throw new Error(`${number} is too large (or, if negative, too small) to represent as an Int64`); + } + const bytes = new Uint8Array(8); + for (let i = 7, remaining = Math.abs(Math.round(number)); i > -1 && remaining > 0; i--, remaining /= 256) { + bytes[i] = remaining; + } + if (number < 0) { + negate(bytes); + } + return new Int64(bytes); } - return new _Int64(bytes); - } - /** - * Called implicitly by infix arithmetic operators. - */ - valueOf() { - const bytes = this.bytes.slice(0); - const negative = bytes[0] & 128; - if (negative) { - negate(bytes); + valueOf() { + const bytes = this.bytes.slice(0); + const negative = bytes[0] & 0b10000000; + if (negative) { + negate(bytes); + } + return parseInt(utilHexEncoding.toHex(bytes), 16) * (negative ? -1 : 1); + } + toString() { + return String(this.valueOf()); } - return parseInt((0, import_util_hex_encoding.toHex)(bytes), 16) * (negative ? -1 : 1); - } - toString() { - return String(this.valueOf()); - } -}; -function negate(bytes) { - for (let i = 0; i < 8; i++) { - bytes[i] ^= 255; - } - for (let i = 7; i > -1; i--) { - bytes[i]++; - if (bytes[i] !== 0) break; - } } -__name(negate, "negate"); - -// src/headerUtil.ts -var hasHeader = /* @__PURE__ */ __name((soughtHeader, headers) => { - soughtHeader = soughtHeader.toLowerCase(); - for (const headerName of Object.keys(headers)) { - if (soughtHeader === headerName.toLowerCase()) { - return true; +function negate(bytes) { + for (let i = 0; i < 8; i++) { + bytes[i] ^= 0xff; } - } - return false; -}, "hasHeader"); - -// src/moveHeadersToQuery.ts -var import_protocol_http = __nccwpck_require__(2356); -var moveHeadersToQuery = /* @__PURE__ */ __name((request, options = {}) => { - const { headers, query = {} } = import_protocol_http.HttpRequest.clone(request); - for (const name of Object.keys(headers)) { - const lname = name.toLowerCase(); - if (lname.slice(0, 6) === "x-amz-" && !options.unhoistableHeaders?.has(lname) || options.hoistableHeaders?.has(lname)) { - query[name] = headers[name]; - delete headers[name]; + for (let i = 7; i > -1; i--) { + bytes[i]++; + if (bytes[i] !== 0) + break; } - } - return { - ...request, - headers, - query - }; -}, "moveHeadersToQuery"); - -// src/prepareRequest.ts +} -var prepareRequest = /* @__PURE__ */ __name((request) => { - request = import_protocol_http.HttpRequest.clone(request); - for (const headerName of Object.keys(request.headers)) { - if (GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) { - delete request.headers[headerName]; +const hasHeader = (soughtHeader, headers) => { + soughtHeader = soughtHeader.toLowerCase(); + for (const headerName of Object.keys(headers)) { + if (soughtHeader === headerName.toLowerCase()) { + return true; + } } - } - return request; -}, "prepareRequest"); - -// src/SignatureV4Base.ts - -var import_util_middleware = __nccwpck_require__(6324); - -var import_util_utf84 = __nccwpck_require__(1577); + return false; +}; -// src/getCanonicalQuery.ts -var import_util_uri_escape = __nccwpck_require__(146); -var getCanonicalQuery = /* @__PURE__ */ __name(({ query = {} }) => { - const keys = []; - const serialized = {}; - for (const key of Object.keys(query)) { - if (key.toLowerCase() === SIGNATURE_HEADER) { - continue; - } - const encodedKey = (0, import_util_uri_escape.escapeUri)(key); - keys.push(encodedKey); - const value = query[key]; - if (typeof value === "string") { - serialized[encodedKey] = `${encodedKey}=${(0, import_util_uri_escape.escapeUri)(value)}`; - } else if (Array.isArray(value)) { - serialized[encodedKey] = value.slice(0).reduce((encoded, value2) => encoded.concat([`${encodedKey}=${(0, import_util_uri_escape.escapeUri)(value2)}`]), []).sort().join("&"); +const moveHeadersToQuery = (request, options = {}) => { + const { headers, query = {} } = protocolHttp.HttpRequest.clone(request); + for (const name of Object.keys(headers)) { + const lname = name.toLowerCase(); + if ((lname.slice(0, 6) === "x-amz-" && !options.unhoistableHeaders?.has(lname)) || + options.hoistableHeaders?.has(lname)) { + query[name] = headers[name]; + delete headers[name]; + } } - } - return keys.sort().map((key) => serialized[key]).filter((serialized2) => serialized2).join("&"); -}, "getCanonicalQuery"); + return { + ...request, + headers, + query, + }; +}; -// src/utilDate.ts -var iso8601 = /* @__PURE__ */ __name((time) => toDate(time).toISOString().replace(/\.\d{3}Z$/, "Z"), "iso8601"); -var toDate = /* @__PURE__ */ __name((time) => { - if (typeof time === "number") { - return new Date(time * 1e3); - } - if (typeof time === "string") { - if (Number(time)) { - return new Date(Number(time) * 1e3); +const prepareRequest = (request) => { + request = protocolHttp.HttpRequest.clone(request); + for (const headerName of Object.keys(request.headers)) { + if (GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) { + delete request.headers[headerName]; + } } - return new Date(time); - } - return time; -}, "toDate"); + return request; +}; -// src/SignatureV4Base.ts -var SignatureV4Base = class { - static { - __name(this, "SignatureV4Base"); - } - constructor({ - applyChecksum, - credentials, - region, - service, - sha256, - uriEscapePath = true - }) { - this.service = service; - this.sha256 = sha256; - this.uriEscapePath = uriEscapePath; - this.applyChecksum = typeof applyChecksum === "boolean" ? applyChecksum : true; - this.regionProvider = (0, import_util_middleware.normalizeProvider)(region); - this.credentialProvider = (0, import_util_middleware.normalizeProvider)(credentials); - } - createCanonicalRequest(request, canonicalHeaders, payloadHash) { - const sortedHeaders = Object.keys(canonicalHeaders).sort(); - return `${request.method} +const getCanonicalQuery = ({ query = {} }) => { + const keys = []; + const serialized = {}; + for (const key of Object.keys(query)) { + if (key.toLowerCase() === SIGNATURE_HEADER) { + continue; + } + const encodedKey = utilUriEscape.escapeUri(key); + keys.push(encodedKey); + const value = query[key]; + if (typeof value === "string") { + serialized[encodedKey] = `${encodedKey}=${utilUriEscape.escapeUri(value)}`; + } + else if (Array.isArray(value)) { + serialized[encodedKey] = value + .slice(0) + .reduce((encoded, value) => encoded.concat([`${encodedKey}=${utilUriEscape.escapeUri(value)}`]), []) + .sort() + .join("&"); + } + } + return keys + .sort() + .map((key) => serialized[key]) + .filter((serialized) => serialized) + .join("&"); +}; + +const iso8601 = (time) => toDate(time) + .toISOString() + .replace(/\.\d{3}Z$/, "Z"); +const toDate = (time) => { + if (typeof time === "number") { + return new Date(time * 1000); + } + if (typeof time === "string") { + if (Number(time)) { + return new Date(Number(time) * 1000); + } + return new Date(time); + } + return time; +}; + +class SignatureV4Base { + service; + regionProvider; + credentialProvider; + sha256; + uriEscapePath; + applyChecksum; + constructor({ applyChecksum, credentials, region, service, sha256, uriEscapePath = true, }) { + this.service = service; + this.sha256 = sha256; + this.uriEscapePath = uriEscapePath; + this.applyChecksum = typeof applyChecksum === "boolean" ? applyChecksum : true; + this.regionProvider = utilMiddleware.normalizeProvider(region); + this.credentialProvider = utilMiddleware.normalizeProvider(credentials); + } + createCanonicalRequest(request, canonicalHeaders, payloadHash) { + const sortedHeaders = Object.keys(canonicalHeaders).sort(); + return `${request.method} ${this.getCanonicalPath(request)} ${getCanonicalQuery(request)} ${sortedHeaders.map((name) => `${name}:${canonicalHeaders[name]}`).join("\n")} ${sortedHeaders.join(";")} ${payloadHash}`; - } - async createStringToSign(longDate, credentialScope, canonicalRequest, algorithmIdentifier) { - const hash = new this.sha256(); - hash.update((0, import_util_utf84.toUint8Array)(canonicalRequest)); - const hashedRequest = await hash.digest(); - return `${algorithmIdentifier} + } + async createStringToSign(longDate, credentialScope, canonicalRequest, algorithmIdentifier) { + const hash = new this.sha256(); + hash.update(utilUtf8.toUint8Array(canonicalRequest)); + const hashedRequest = await hash.digest(); + return `${algorithmIdentifier} ${longDate} ${credentialScope} -${(0, import_util_hex_encoding.toHex)(hashedRequest)}`; - } - getCanonicalPath({ path }) { - if (this.uriEscapePath) { - const normalizedPathSegments = []; - for (const pathSegment of path.split("/")) { - if (pathSegment?.length === 0) continue; - if (pathSegment === ".") continue; - if (pathSegment === "..") { - normalizedPathSegments.pop(); - } else { - normalizedPathSegments.push(pathSegment); +${utilHexEncoding.toHex(hashedRequest)}`; + } + getCanonicalPath({ path }) { + if (this.uriEscapePath) { + const normalizedPathSegments = []; + for (const pathSegment of path.split("/")) { + if (pathSegment?.length === 0) + continue; + if (pathSegment === ".") + continue; + if (pathSegment === "..") { + normalizedPathSegments.pop(); + } + else { + normalizedPathSegments.push(pathSegment); + } + } + const normalizedPath = `${path?.startsWith("/") ? "/" : ""}${normalizedPathSegments.join("/")}${normalizedPathSegments.length > 0 && path?.endsWith("/") ? "/" : ""}`; + const doubleEncoded = utilUriEscape.escapeUri(normalizedPath); + return doubleEncoded.replace(/%2F/g, "/"); } - } - const normalizedPath = `${path?.startsWith("/") ? "/" : ""}${normalizedPathSegments.join("/")}${normalizedPathSegments.length > 0 && path?.endsWith("/") ? "/" : ""}`; - const doubleEncoded = (0, import_util_uri_escape.escapeUri)(normalizedPath); - return doubleEncoded.replace(/%2F/g, "/"); + return path; } - return path; - } - validateResolvedCredentials(credentials) { - if (typeof credentials !== "object" || // @ts-expect-error: Property 'accessKeyId' does not exist on type 'object'.ts(2339) - typeof credentials.accessKeyId !== "string" || // @ts-expect-error: Property 'secretAccessKey' does not exist on type 'object'.ts(2339) - typeof credentials.secretAccessKey !== "string") { - throw new Error("Resolved credential object is not valid"); + validateResolvedCredentials(credentials) { + if (typeof credentials !== "object" || + typeof credentials.accessKeyId !== "string" || + typeof credentials.secretAccessKey !== "string") { + throw new Error("Resolved credential object is not valid"); + } } - } - formatDate(now) { - const longDate = iso8601(now).replace(/[\-:]/g, ""); - return { - longDate, - shortDate: longDate.slice(0, 8) - }; - } - getCanonicalHeaderList(headers) { - return Object.keys(headers).sort().join(";"); - } -}; - -// src/SignatureV4.ts -var SignatureV4 = class extends SignatureV4Base { - constructor({ - applyChecksum, - credentials, - region, - service, - sha256, - uriEscapePath = true - }) { - super({ - applyChecksum, - credentials, - region, - service, - sha256, - uriEscapePath - }); - this.headerFormatter = new HeaderFormatter(); - } - static { - __name(this, "SignatureV4"); - } - async presign(originalRequest, options = {}) { - const { - signingDate = /* @__PURE__ */ new Date(), - expiresIn = 3600, - unsignableHeaders, - unhoistableHeaders, - signableHeaders, - hoistableHeaders, - signingRegion, - signingService - } = options; - const credentials = await this.credentialProvider(); - this.validateResolvedCredentials(credentials); - const region = signingRegion ?? await this.regionProvider(); - const { longDate, shortDate } = this.formatDate(signingDate); - if (expiresIn > MAX_PRESIGNED_TTL) { - return Promise.reject( - "Signature version 4 presigned URLs must have an expiration date less than one week in the future" - ); + formatDate(now) { + const longDate = iso8601(now).replace(/[\-:]/g, ""); + return { + longDate, + shortDate: longDate.slice(0, 8), + }; } - const scope = createScope(shortDate, region, signingService ?? this.service); - const request = moveHeadersToQuery(prepareRequest(originalRequest), { unhoistableHeaders, hoistableHeaders }); - if (credentials.sessionToken) { - request.query[TOKEN_QUERY_PARAM] = credentials.sessionToken; - } - request.query[ALGORITHM_QUERY_PARAM] = ALGORITHM_IDENTIFIER; - request.query[CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`; - request.query[AMZ_DATE_QUERY_PARAM] = longDate; - request.query[EXPIRES_QUERY_PARAM] = expiresIn.toString(10); - const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders); - request.query[SIGNED_HEADERS_QUERY_PARAM] = this.getCanonicalHeaderList(canonicalHeaders); - request.query[SIGNATURE_QUERY_PARAM] = await this.getSignature( - longDate, - scope, - this.getSigningKey(credentials, region, shortDate, signingService), - this.createCanonicalRequest(request, canonicalHeaders, await getPayloadHash(originalRequest, this.sha256)) - ); - return request; - } - async sign(toSign, options) { - if (typeof toSign === "string") { - return this.signString(toSign, options); - } else if (toSign.headers && toSign.payload) { - return this.signEvent(toSign, options); - } else if (toSign.message) { - return this.signMessage(toSign, options); - } else { - return this.signRequest(toSign, options); - } - } - async signEvent({ headers, payload }, { signingDate = /* @__PURE__ */ new Date(), priorSignature, signingRegion, signingService }) { - const region = signingRegion ?? await this.regionProvider(); - const { shortDate, longDate } = this.formatDate(signingDate); - const scope = createScope(shortDate, region, signingService ?? this.service); - const hashedPayload = await getPayloadHash({ headers: {}, body: payload }, this.sha256); - const hash = new this.sha256(); - hash.update(headers); - const hashedHeaders = (0, import_util_hex_encoding.toHex)(await hash.digest()); - const stringToSign = [ - EVENT_ALGORITHM_IDENTIFIER, - longDate, - scope, - priorSignature, - hashedHeaders, - hashedPayload - ].join("\n"); - return this.signString(stringToSign, { signingDate, signingRegion: region, signingService }); - } - async signMessage(signableMessage, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService }) { - const promise = this.signEvent( - { - headers: this.headerFormatter.format(signableMessage.message.headers), - payload: signableMessage.message.body - }, - { - signingDate, - signingRegion, - signingService, - priorSignature: signableMessage.priorSignature - } - ); - return promise.then((signature) => { - return { message: signableMessage.message, signature }; - }); - } - async signString(stringToSign, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService } = {}) { - const credentials = await this.credentialProvider(); - this.validateResolvedCredentials(credentials); - const region = signingRegion ?? await this.regionProvider(); - const { shortDate } = this.formatDate(signingDate); - const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService)); - hash.update((0, import_util_utf85.toUint8Array)(stringToSign)); - return (0, import_util_hex_encoding.toHex)(await hash.digest()); - } - async signRequest(requestToSign, { - signingDate = /* @__PURE__ */ new Date(), - signableHeaders, - unsignableHeaders, - signingRegion, - signingService - } = {}) { - const credentials = await this.credentialProvider(); - this.validateResolvedCredentials(credentials); - const region = signingRegion ?? await this.regionProvider(); - const request = prepareRequest(requestToSign); - const { longDate, shortDate } = this.formatDate(signingDate); - const scope = createScope(shortDate, region, signingService ?? this.service); - request.headers[AMZ_DATE_HEADER] = longDate; - if (credentials.sessionToken) { - request.headers[TOKEN_HEADER] = credentials.sessionToken; - } - const payloadHash = await getPayloadHash(request, this.sha256); - if (!hasHeader(SHA256_HEADER, request.headers) && this.applyChecksum) { - request.headers[SHA256_HEADER] = payloadHash; - } - const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders); - const signature = await this.getSignature( - longDate, - scope, - this.getSigningKey(credentials, region, shortDate, signingService), - this.createCanonicalRequest(request, canonicalHeaders, payloadHash) - ); - request.headers[AUTH_HEADER] = `${ALGORITHM_IDENTIFIER} Credential=${credentials.accessKeyId}/${scope}, SignedHeaders=${this.getCanonicalHeaderList(canonicalHeaders)}, Signature=${signature}`; - return request; - } - async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) { - const stringToSign = await this.createStringToSign( - longDate, - credentialScope, - canonicalRequest, - ALGORITHM_IDENTIFIER - ); - const hash = new this.sha256(await keyPromise); - hash.update((0, import_util_utf85.toUint8Array)(stringToSign)); - return (0, import_util_hex_encoding.toHex)(await hash.digest()); - } - getSigningKey(credentials, region, shortDate, service) { - return getSigningKey(this.sha256, credentials, shortDate, region, service || this.service); - } -}; - -// src/signature-v4a-container.ts -var signatureV4aContainer = { - SignatureV4a: null -}; -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); + getCanonicalHeaderList(headers) { + return Object.keys(headers).sort().join(";"); + } +} +class SignatureV4 extends SignatureV4Base { + headerFormatter = new HeaderFormatter(); + constructor({ applyChecksum, credentials, region, service, sha256, uriEscapePath = true, }) { + super({ + applyChecksum, + credentials, + region, + service, + sha256, + uriEscapePath, + }); + } + async presign(originalRequest, options = {}) { + const { signingDate = new Date(), expiresIn = 3600, unsignableHeaders, unhoistableHeaders, signableHeaders, hoistableHeaders, signingRegion, signingService, } = options; + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? (await this.regionProvider()); + const { longDate, shortDate } = this.formatDate(signingDate); + if (expiresIn > MAX_PRESIGNED_TTL) { + return Promise.reject("Signature version 4 presigned URLs" + " must have an expiration date less than one week in" + " the future"); + } + const scope = createScope(shortDate, region, signingService ?? this.service); + const request = moveHeadersToQuery(prepareRequest(originalRequest), { unhoistableHeaders, hoistableHeaders }); + if (credentials.sessionToken) { + request.query[TOKEN_QUERY_PARAM] = credentials.sessionToken; + } + request.query[ALGORITHM_QUERY_PARAM] = ALGORITHM_IDENTIFIER; + request.query[CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`; + request.query[AMZ_DATE_QUERY_PARAM] = longDate; + request.query[EXPIRES_QUERY_PARAM] = expiresIn.toString(10); + const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders); + request.query[SIGNED_HEADERS_QUERY_PARAM] = this.getCanonicalHeaderList(canonicalHeaders); + request.query[SIGNATURE_QUERY_PARAM] = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, await getPayloadHash(originalRequest, this.sha256))); + return request; + } + async sign(toSign, options) { + if (typeof toSign === "string") { + return this.signString(toSign, options); + } + else if (toSign.headers && toSign.payload) { + return this.signEvent(toSign, options); + } + else if (toSign.message) { + return this.signMessage(toSign, options); + } + else { + return this.signRequest(toSign, options); + } + } + async signEvent({ headers, payload }, { signingDate = new Date(), priorSignature, signingRegion, signingService }) { + const region = signingRegion ?? (await this.regionProvider()); + const { shortDate, longDate } = this.formatDate(signingDate); + const scope = createScope(shortDate, region, signingService ?? this.service); + const hashedPayload = await getPayloadHash({ headers: {}, body: payload }, this.sha256); + const hash = new this.sha256(); + hash.update(headers); + const hashedHeaders = utilHexEncoding.toHex(await hash.digest()); + const stringToSign = [ + EVENT_ALGORITHM_IDENTIFIER, + longDate, + scope, + priorSignature, + hashedHeaders, + hashedPayload, + ].join("\n"); + return this.signString(stringToSign, { signingDate, signingRegion: region, signingService }); + } + async signMessage(signableMessage, { signingDate = new Date(), signingRegion, signingService }) { + const promise = this.signEvent({ + headers: this.headerFormatter.format(signableMessage.message.headers), + payload: signableMessage.message.body, + }, { + signingDate, + signingRegion, + signingService, + priorSignature: signableMessage.priorSignature, + }); + return promise.then((signature) => { + return { message: signableMessage.message, signature }; + }); + } + async signString(stringToSign, { signingDate = new Date(), signingRegion, signingService } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? (await this.regionProvider()); + const { shortDate } = this.formatDate(signingDate); + const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService)); + hash.update(utilUtf8.toUint8Array(stringToSign)); + return utilHexEncoding.toHex(await hash.digest()); + } + async signRequest(requestToSign, { signingDate = new Date(), signableHeaders, unsignableHeaders, signingRegion, signingService, } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? (await this.regionProvider()); + const request = prepareRequest(requestToSign); + const { longDate, shortDate } = this.formatDate(signingDate); + const scope = createScope(shortDate, region, signingService ?? this.service); + request.headers[AMZ_DATE_HEADER] = longDate; + if (credentials.sessionToken) { + request.headers[TOKEN_HEADER] = credentials.sessionToken; + } + const payloadHash = await getPayloadHash(request, this.sha256); + if (!hasHeader(SHA256_HEADER, request.headers) && this.applyChecksum) { + request.headers[SHA256_HEADER] = payloadHash; + } + const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders); + const signature = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, payloadHash)); + request.headers[AUTH_HEADER] = + `${ALGORITHM_IDENTIFIER} ` + + `Credential=${credentials.accessKeyId}/${scope}, ` + + `SignedHeaders=${this.getCanonicalHeaderList(canonicalHeaders)}, ` + + `Signature=${signature}`; + return request; + } + async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) { + const stringToSign = await this.createStringToSign(longDate, credentialScope, canonicalRequest, ALGORITHM_IDENTIFIER); + const hash = new this.sha256(await keyPromise); + hash.update(utilUtf8.toUint8Array(stringToSign)); + return utilHexEncoding.toHex(await hash.digest()); + } + getSigningKey(credentials, region, shortDate, service) { + return getSigningKey(this.sha256, credentials, shortDate, region, service || this.service); + } +} + +const signatureV4aContainer = { + SignatureV4a: null, +}; + +exports.ALGORITHM_IDENTIFIER = ALGORITHM_IDENTIFIER; +exports.ALGORITHM_IDENTIFIER_V4A = ALGORITHM_IDENTIFIER_V4A; +exports.ALGORITHM_QUERY_PARAM = ALGORITHM_QUERY_PARAM; +exports.ALWAYS_UNSIGNABLE_HEADERS = ALWAYS_UNSIGNABLE_HEADERS; +exports.AMZ_DATE_HEADER = AMZ_DATE_HEADER; +exports.AMZ_DATE_QUERY_PARAM = AMZ_DATE_QUERY_PARAM; +exports.AUTH_HEADER = AUTH_HEADER; +exports.CREDENTIAL_QUERY_PARAM = CREDENTIAL_QUERY_PARAM; +exports.DATE_HEADER = DATE_HEADER; +exports.EVENT_ALGORITHM_IDENTIFIER = EVENT_ALGORITHM_IDENTIFIER; +exports.EXPIRES_QUERY_PARAM = EXPIRES_QUERY_PARAM; +exports.GENERATED_HEADERS = GENERATED_HEADERS; +exports.HOST_HEADER = HOST_HEADER; +exports.KEY_TYPE_IDENTIFIER = KEY_TYPE_IDENTIFIER; +exports.MAX_CACHE_SIZE = MAX_CACHE_SIZE; +exports.MAX_PRESIGNED_TTL = MAX_PRESIGNED_TTL; +exports.PROXY_HEADER_PATTERN = PROXY_HEADER_PATTERN; +exports.REGION_SET_PARAM = REGION_SET_PARAM; +exports.SEC_HEADER_PATTERN = SEC_HEADER_PATTERN; +exports.SHA256_HEADER = SHA256_HEADER; +exports.SIGNATURE_HEADER = SIGNATURE_HEADER; +exports.SIGNATURE_QUERY_PARAM = SIGNATURE_QUERY_PARAM; +exports.SIGNED_HEADERS_QUERY_PARAM = SIGNED_HEADERS_QUERY_PARAM; +exports.SignatureV4 = SignatureV4; +exports.SignatureV4Base = SignatureV4Base; +exports.TOKEN_HEADER = TOKEN_HEADER; +exports.TOKEN_QUERY_PARAM = TOKEN_QUERY_PARAM; +exports.UNSIGNABLE_PATTERNS = UNSIGNABLE_PATTERNS; +exports.UNSIGNED_PAYLOAD = UNSIGNED_PAYLOAD; +exports.clearCredentialCache = clearCredentialCache; +exports.createScope = createScope; +exports.getCanonicalHeaders = getCanonicalHeaders; +exports.getCanonicalQuery = getCanonicalQuery; +exports.getPayloadHash = getPayloadHash; +exports.getSigningKey = getSigningKey; +exports.hasHeader = hasHeader; +exports.moveHeadersToQuery = moveHeadersToQuery; +exports.prepareRequest = prepareRequest; +exports.signatureV4aContainer = signatureV4aContainer; /***/ }), @@ -29524,7 +22901,7 @@ var Uint8ArrayBlobAdapter = _Uint8ArrayBlobAdapter; // src/index.ts __reExport(src_exports, __nccwpck_require__(6253), module.exports); -__reExport(src_exports, __nccwpck_require__(2295), module.exports); +__reExport(src_exports, __nccwpck_require__(4676), module.exports); __reExport(src_exports, __nccwpck_require__(3107), module.exports); __reExport(src_exports, __nccwpck_require__(190), module.exports); __reExport(src_exports, __nccwpck_require__(4005), module.exports); @@ -29615,7 +22992,7 @@ const isBlobInstance = (stream) => typeof Blob === "function" && stream instance /***/ }), -/***/ 2295: +/***/ 4676: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; @@ -29860,195 +23237,131 @@ var toUtf8 = /* @__PURE__ */ __name((input) => { /***/ }), /***/ 690: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); - -// src/index.ts -var index_exports = {}; -__export(index_exports, { - AlgorithmId: () => AlgorithmId, - EndpointURLScheme: () => EndpointURLScheme, - FieldPosition: () => FieldPosition, - HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, - HttpAuthLocation: () => HttpAuthLocation, - IniSectionType: () => IniSectionType, - RequestHandlerProtocol: () => RequestHandlerProtocol, - SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, - getDefaultClientConfiguration: () => getDefaultClientConfiguration, - resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig -}); -module.exports = __toCommonJS(index_exports); - -// src/auth/auth.ts -var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { - HttpAuthLocation2["HEADER"] = "header"; - HttpAuthLocation2["QUERY"] = "query"; - return HttpAuthLocation2; -})(HttpAuthLocation || {}); +/***/ ((__unused_webpack_module, exports) => { -// src/auth/HttpApiKeyAuth.ts -var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { - HttpApiKeyAuthLocation2["HEADER"] = "header"; - HttpApiKeyAuthLocation2["QUERY"] = "query"; - return HttpApiKeyAuthLocation2; -})(HttpApiKeyAuthLocation || {}); +"use strict"; -// src/endpoint.ts -var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { - EndpointURLScheme2["HTTP"] = "http"; - EndpointURLScheme2["HTTPS"] = "https"; - return EndpointURLScheme2; -})(EndpointURLScheme || {}); -// src/extensions/checksum.ts -var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { - AlgorithmId2["MD5"] = "md5"; - AlgorithmId2["CRC32"] = "crc32"; - AlgorithmId2["CRC32C"] = "crc32c"; - AlgorithmId2["SHA1"] = "sha1"; - AlgorithmId2["SHA256"] = "sha256"; - return AlgorithmId2; -})(AlgorithmId || {}); -var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - const checksumAlgorithms = []; - if (runtimeConfig.sha256 !== void 0) { - checksumAlgorithms.push({ - algorithmId: /* @__PURE__ */ __name(() => "sha256" /* SHA256 */, "algorithmId"), - checksumConstructor: /* @__PURE__ */ __name(() => runtimeConfig.sha256, "checksumConstructor") - }); - } - if (runtimeConfig.md5 != void 0) { - checksumAlgorithms.push({ - algorithmId: /* @__PURE__ */ __name(() => "md5" /* MD5 */, "algorithmId"), - checksumConstructor: /* @__PURE__ */ __name(() => runtimeConfig.md5, "checksumConstructor") - }); - } - return { - addChecksumAlgorithm(algo) { - checksumAlgorithms.push(algo); - }, - checksumAlgorithms() { - return checksumAlgorithms; +exports.HttpAuthLocation = void 0; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); + +exports.HttpApiKeyAuthLocation = void 0; +(function (HttpApiKeyAuthLocation) { + HttpApiKeyAuthLocation["HEADER"] = "header"; + HttpApiKeyAuthLocation["QUERY"] = "query"; +})(exports.HttpApiKeyAuthLocation || (exports.HttpApiKeyAuthLocation = {})); + +exports.EndpointURLScheme = void 0; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + +exports.AlgorithmId = void 0; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => exports.AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); } - }; -}, "getChecksumConfiguration"); -var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { - const runtimeConfig = {}; - clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { - runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); - }); - return runtimeConfig; -}, "resolveChecksumRuntimeConfig"); - -// src/extensions/defaultClientConfiguration.ts -var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { - return getChecksumConfiguration(runtimeConfig); -}, "getDefaultClientConfiguration"); -var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { - return resolveChecksumRuntimeConfig(config); -}, "resolveDefaultRuntimeConfig"); + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => exports.AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); + } + return { + addChecksumAlgorithm(algo) { + checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return checksumAlgorithms; + }, + }; +}; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}; -// src/http.ts -var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { - FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; - FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; - return FieldPosition2; -})(FieldPosition || {}); +const getDefaultClientConfiguration = (runtimeConfig) => { + return getChecksumConfiguration(runtimeConfig); +}; +const resolveDefaultRuntimeConfig = (config) => { + return resolveChecksumRuntimeConfig(config); +}; -// src/middleware.ts -var SMITHY_CONTEXT_KEY = "__smithy_context"; +exports.FieldPosition = void 0; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(exports.FieldPosition || (exports.FieldPosition = {})); -// src/profile.ts -var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { - IniSectionType2["PROFILE"] = "profile"; - IniSectionType2["SSO_SESSION"] = "sso-session"; - IniSectionType2["SERVICES"] = "services"; - return IniSectionType2; -})(IniSectionType || {}); +const SMITHY_CONTEXT_KEY = "__smithy_context"; -// src/transfer.ts -var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { - RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; - RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; - RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; - return RequestHandlerProtocol2; -})(RequestHandlerProtocol || {}); -// Annotate the CommonJS export names for ESM import in node: +exports.IniSectionType = void 0; +(function (IniSectionType) { + IniSectionType["PROFILE"] = "profile"; + IniSectionType["SSO_SESSION"] = "sso-session"; + IniSectionType["SERVICES"] = "services"; +})(exports.IniSectionType || (exports.IniSectionType = {})); -0 && (0); +exports.RequestHandlerProtocol = void 0; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); +exports.SMITHY_CONTEXT_KEY = SMITHY_CONTEXT_KEY; +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; /***/ }), /***/ 4494: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +"use strict"; -// src/index.ts -var index_exports = {}; -__export(index_exports, { - parseUrl: () => parseUrl -}); -module.exports = __toCommonJS(index_exports); -var import_querystring_parser = __nccwpck_require__(8822); -var parseUrl = /* @__PURE__ */ __name((url) => { - if (typeof url === "string") { - return parseUrl(new URL(url)); - } - const { hostname, pathname, port, protocol, search } = url; - let query; - if (search) { - query = (0, import_querystring_parser.parseQueryString)(search); - } - return { - hostname, - port: port ? parseInt(port) : void 0, - protocol, - path: pathname, - query - }; -}, "parseUrl"); -// Annotate the CommonJS export names for ESM import in node: -0 && (0); +var querystringParser = __nccwpck_require__(8822); + +const parseUrl = (url) => { + if (typeof url === "string") { + return parseUrl(new URL(url)); + } + const { hostname, pathname, port, protocol, search } = url; + let query; + if (search) { + query = querystringParser.parseQueryString(search); + } + return { + hostname, + port: port ? parseInt(port) : undefined, + protocol, + path: pathname, + query, + }; +}; +exports.parseUrl = parseUrl; /***/ }), @@ -30078,33 +23391,29 @@ exports.fromBase64 = fromBase64; /***/ }), /***/ 8385: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +"use strict"; -// src/index.ts -var index_exports = {}; -module.exports = __toCommonJS(index_exports); -__reExport(index_exports, __nccwpck_require__(2674), module.exports); -__reExport(index_exports, __nccwpck_require__(4871), module.exports); -// Annotate the CommonJS export names for ESM import in node: -0 && (0); +var fromBase64 = __nccwpck_require__(2674); +var toBase64 = __nccwpck_require__(4871); + +Object.keys(fromBase64).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return fromBase64[k]; } + }); +}); +Object.keys(toBase64).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return toBase64[k]; } + }); +}); + /***/ }), @@ -30136,1367 +23445,1062 @@ exports.toBase64 = toBase64; /***/ }), /***/ 2098: -/***/ ((module) => { +/***/ ((__unused_webpack_module, exports) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +"use strict"; -// src/index.ts -var index_exports = {}; -__export(index_exports, { - calculateBodyLength: () => calculateBodyLength -}); -module.exports = __toCommonJS(index_exports); - -// src/calculateBodyLength.ts -var TEXT_ENCODER = typeof TextEncoder == "function" ? new TextEncoder() : null; -var calculateBodyLength = /* @__PURE__ */ __name((body) => { - if (typeof body === "string") { - if (TEXT_ENCODER) { - return TEXT_ENCODER.encode(body).byteLength; - } - let len = body.length; - for (let i = len - 1; i >= 0; i--) { - const code = body.charCodeAt(i); - if (code > 127 && code <= 2047) len++; - else if (code > 2047 && code <= 65535) len += 2; - if (code >= 56320 && code <= 57343) i--; - } - return len; - } else if (typeof body.byteLength === "number") { - return body.byteLength; - } else if (typeof body.size === "number") { - return body.size; - } - throw new Error(`Body Length computation failed for ${body}`); -}, "calculateBodyLength"); -// Annotate the CommonJS export names for ESM import in node: -0 && (0); +const TEXT_ENCODER = typeof TextEncoder == "function" ? new TextEncoder() : null; +const calculateBodyLength = (body) => { + if (typeof body === "string") { + if (TEXT_ENCODER) { + return TEXT_ENCODER.encode(body).byteLength; + } + let len = body.length; + for (let i = len - 1; i >= 0; i--) { + const code = body.charCodeAt(i); + if (code > 0x7f && code <= 0x7ff) + len++; + else if (code > 0x7ff && code <= 0xffff) + len += 2; + if (code >= 0xdc00 && code <= 0xdfff) + i--; + } + return len; + } + else if (typeof body.byteLength === "number") { + return body.byteLength; + } + else if (typeof body.size === "number") { + return body.size; + } + throw new Error(`Body Length computation failed for ${body}`); +}; +exports.calculateBodyLength = calculateBodyLength; /***/ }), /***/ 3638: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +"use strict"; -// src/index.ts -var index_exports = {}; -__export(index_exports, { - calculateBodyLength: () => calculateBodyLength -}); -module.exports = __toCommonJS(index_exports); -// src/calculateBodyLength.ts -var import_fs = __nccwpck_require__(9896); -var calculateBodyLength = /* @__PURE__ */ __name((body) => { - if (!body) { - return 0; - } - if (typeof body === "string") { - return Buffer.byteLength(body); - } else if (typeof body.byteLength === "number") { - return body.byteLength; - } else if (typeof body.size === "number") { - return body.size; - } else if (typeof body.start === "number" && typeof body.end === "number") { - return body.end + 1 - body.start; - } else if (typeof body.path === "string" || Buffer.isBuffer(body.path)) { - return (0, import_fs.lstatSync)(body.path).size; - } else if (typeof body.fd === "number") { - return (0, import_fs.fstatSync)(body.fd).size; - } - throw new Error(`Body Length computation failed for ${body}`); -}, "calculateBodyLength"); -// Annotate the CommonJS export names for ESM import in node: +var node_fs = __nccwpck_require__(3024); -0 && (0); +const calculateBodyLength = (body) => { + if (!body) { + return 0; + } + if (typeof body === "string") { + return Buffer.byteLength(body); + } + else if (typeof body.byteLength === "number") { + return body.byteLength; + } + else if (typeof body.size === "number") { + return body.size; + } + else if (typeof body.start === "number" && typeof body.end === "number") { + return body.end + 1 - body.start; + } + else if (body instanceof node_fs.ReadStream) { + if (body.path != null) { + return node_fs.lstatSync(body.path).size; + } + else if (typeof body.fd === "number") { + return node_fs.fstatSync(body.fd).size; + } + } + throw new Error(`Body Length computation failed for ${body}`); +}; +exports.calculateBodyLength = calculateBodyLength; /***/ }), /***/ 4151: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +"use strict"; -// src/index.ts -var index_exports = {}; -__export(index_exports, { - fromArrayBuffer: () => fromArrayBuffer, - fromString: () => fromString -}); -module.exports = __toCommonJS(index_exports); -var import_is_array_buffer = __nccwpck_require__(6130); -var import_buffer = __nccwpck_require__(181); -var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { - if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { - throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); - } - return import_buffer.Buffer.from(input, offset, length); -}, "fromArrayBuffer"); -var fromString = /* @__PURE__ */ __name((input, encoding) => { - if (typeof input !== "string") { - throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); - } - return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); -}, "fromString"); -// Annotate the CommonJS export names for ESM import in node: -0 && (0); +var isArrayBuffer = __nccwpck_require__(6130); +var buffer = __nccwpck_require__(181); + +const fromArrayBuffer = (input, offset = 0, length = input.byteLength - offset) => { + if (!isArrayBuffer.isArrayBuffer(input)) { + throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); + } + return buffer.Buffer.from(input, offset, length); +}; +const fromString = (input, encoding) => { + if (typeof input !== "string") { + throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); + } + return encoding ? buffer.Buffer.from(input, encoding) : buffer.Buffer.from(input); +}; +exports.fromArrayBuffer = fromArrayBuffer; +exports.fromString = fromString; /***/ }), /***/ 6716: -/***/ ((module) => { +/***/ ((__unused_webpack_module, exports) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; +"use strict"; + + +const booleanSelector = (obj, key, type) => { + if (!(key in obj)) + return undefined; + if (obj[key] === "true") + return true; + if (obj[key] === "false") + return false; + throw new Error(`Cannot load ${type} "${key}". Expected "true" or "false", got ${obj[key]}.`); }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - SelectorType: () => SelectorType, - booleanSelector: () => booleanSelector, - numberSelector: () => numberSelector -}); -module.exports = __toCommonJS(index_exports); - -// src/booleanSelector.ts -var booleanSelector = /* @__PURE__ */ __name((obj, key, type) => { - if (!(key in obj)) return void 0; - if (obj[key] === "true") return true; - if (obj[key] === "false") return false; - throw new Error(`Cannot load ${type} "${key}". Expected "true" or "false", got ${obj[key]}.`); -}, "booleanSelector"); - -// src/numberSelector.ts -var numberSelector = /* @__PURE__ */ __name((obj, key, type) => { - if (!(key in obj)) return void 0; - const numberValue = parseInt(obj[key], 10); - if (Number.isNaN(numberValue)) { - throw new TypeError(`Cannot load ${type} '${key}'. Expected number, got '${obj[key]}'.`); - } - return numberValue; -}, "numberSelector"); - -// src/types.ts -var SelectorType = /* @__PURE__ */ ((SelectorType2) => { - SelectorType2["ENV"] = "env"; - SelectorType2["CONFIG"] = "shared config entry"; - return SelectorType2; -})(SelectorType || {}); -// Annotate the CommonJS export names for ESM import in node: +const numberSelector = (obj, key, type) => { + if (!(key in obj)) + return undefined; + const numberValue = parseInt(obj[key], 10); + if (Number.isNaN(numberValue)) { + throw new TypeError(`Cannot load ${type} '${key}'. Expected number, got '${obj[key]}'.`); + } + return numberValue; +}; -0 && (0); +exports.SelectorType = void 0; +(function (SelectorType) { + SelectorType["ENV"] = "env"; + SelectorType["CONFIG"] = "shared config entry"; +})(exports.SelectorType || (exports.SelectorType = {})); +exports.booleanSelector = booleanSelector; +exports.numberSelector = numberSelector; /***/ }), /***/ 5435: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -var __create = Object.create; -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __getProtoOf = Object.getPrototypeOf; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( - // If the importer is in node compatibility mode or this is not an ESM - // file that has been converted to a CommonJS file using a Babel- - // compatible transform (i.e. "__esModule" has not been set), then set - // "default" to the CommonJS "module.exports" for node compatibility. - isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, - mod -)); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +"use strict"; -// src/index.ts -var index_exports = {}; -__export(index_exports, { - resolveDefaultsModeConfig: () => resolveDefaultsModeConfig -}); -module.exports = __toCommonJS(index_exports); -// src/resolveDefaultsModeConfig.ts -var import_config_resolver = __nccwpck_require__(9316); -var import_node_config_provider = __nccwpck_require__(5704); -var import_property_provider = __nccwpck_require__(1238); +var configResolver = __nccwpck_require__(9316); +var nodeConfigProvider = __nccwpck_require__(5704); +var propertyProvider = __nccwpck_require__(1238); -// src/constants.ts -var AWS_EXECUTION_ENV = "AWS_EXECUTION_ENV"; -var AWS_REGION_ENV = "AWS_REGION"; -var AWS_DEFAULT_REGION_ENV = "AWS_DEFAULT_REGION"; -var ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; -var DEFAULTS_MODE_OPTIONS = ["in-region", "cross-region", "mobile", "standard", "legacy"]; -var IMDS_REGION_PATH = "/latest/meta-data/placement/region"; - -// src/defaultsModeConfig.ts -var AWS_DEFAULTS_MODE_ENV = "AWS_DEFAULTS_MODE"; -var AWS_DEFAULTS_MODE_CONFIG = "defaults_mode"; -var NODE_DEFAULTS_MODE_CONFIG_OPTIONS = { - environmentVariableSelector: /* @__PURE__ */ __name((env) => { - return env[AWS_DEFAULTS_MODE_ENV]; - }, "environmentVariableSelector"), - configFileSelector: /* @__PURE__ */ __name((profile) => { - return profile[AWS_DEFAULTS_MODE_CONFIG]; - }, "configFileSelector"), - default: "legacy" -}; - -// src/resolveDefaultsModeConfig.ts -var resolveDefaultsModeConfig = /* @__PURE__ */ __name(({ - region = (0, import_node_config_provider.loadConfig)(import_config_resolver.NODE_REGION_CONFIG_OPTIONS), - defaultsMode = (0, import_node_config_provider.loadConfig)(NODE_DEFAULTS_MODE_CONFIG_OPTIONS) -} = {}) => (0, import_property_provider.memoize)(async () => { - const mode = typeof defaultsMode === "function" ? await defaultsMode() : defaultsMode; - switch (mode?.toLowerCase()) { - case "auto": - return resolveNodeDefaultsModeAuto(region); - case "in-region": - case "cross-region": - case "mobile": - case "standard": - case "legacy": - return Promise.resolve(mode?.toLocaleLowerCase()); - case void 0: - return Promise.resolve("legacy"); - default: - throw new Error( - `Invalid parameter for "defaultsMode", expect ${DEFAULTS_MODE_OPTIONS.join(", ")}, got ${mode}` - ); - } -}), "resolveDefaultsModeConfig"); -var resolveNodeDefaultsModeAuto = /* @__PURE__ */ __name(async (clientRegion) => { - if (clientRegion) { - const resolvedRegion = typeof clientRegion === "function" ? await clientRegion() : clientRegion; - const inferredRegion = await inferPhysicalRegion(); - if (!inferredRegion) { - return "standard"; +const AWS_EXECUTION_ENV = "AWS_EXECUTION_ENV"; +const AWS_REGION_ENV = "AWS_REGION"; +const AWS_DEFAULT_REGION_ENV = "AWS_DEFAULT_REGION"; +const ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; +const DEFAULTS_MODE_OPTIONS = ["in-region", "cross-region", "mobile", "standard", "legacy"]; +const IMDS_REGION_PATH = "/latest/meta-data/placement/region"; + +const AWS_DEFAULTS_MODE_ENV = "AWS_DEFAULTS_MODE"; +const AWS_DEFAULTS_MODE_CONFIG = "defaults_mode"; +const NODE_DEFAULTS_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => { + return env[AWS_DEFAULTS_MODE_ENV]; + }, + configFileSelector: (profile) => { + return profile[AWS_DEFAULTS_MODE_CONFIG]; + }, + default: "legacy", +}; + +const resolveDefaultsModeConfig = ({ region = nodeConfigProvider.loadConfig(configResolver.NODE_REGION_CONFIG_OPTIONS), defaultsMode = nodeConfigProvider.loadConfig(NODE_DEFAULTS_MODE_CONFIG_OPTIONS), } = {}) => propertyProvider.memoize(async () => { + const mode = typeof defaultsMode === "function" ? await defaultsMode() : defaultsMode; + switch (mode?.toLowerCase()) { + case "auto": + return resolveNodeDefaultsModeAuto(region); + case "in-region": + case "cross-region": + case "mobile": + case "standard": + case "legacy": + return Promise.resolve(mode?.toLocaleLowerCase()); + case undefined: + return Promise.resolve("legacy"); + default: + throw new Error(`Invalid parameter for "defaultsMode", expect ${DEFAULTS_MODE_OPTIONS.join(", ")}, got ${mode}`); } - if (resolvedRegion === inferredRegion) { - return "in-region"; - } else { - return "cross-region"; +}); +const resolveNodeDefaultsModeAuto = async (clientRegion) => { + if (clientRegion) { + const resolvedRegion = typeof clientRegion === "function" ? await clientRegion() : clientRegion; + const inferredRegion = await inferPhysicalRegion(); + if (!inferredRegion) { + return "standard"; + } + if (resolvedRegion === inferredRegion) { + return "in-region"; + } + else { + return "cross-region"; + } } - } - return "standard"; -}, "resolveNodeDefaultsModeAuto"); -var inferPhysicalRegion = /* @__PURE__ */ __name(async () => { - if (process.env[AWS_EXECUTION_ENV] && (process.env[AWS_REGION_ENV] || process.env[AWS_DEFAULT_REGION_ENV])) { - return process.env[AWS_REGION_ENV] ?? process.env[AWS_DEFAULT_REGION_ENV]; - } - if (!process.env[ENV_IMDS_DISABLED]) { - try { - const { getInstanceMetadataEndpoint, httpRequest } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(566))); - const endpoint = await getInstanceMetadataEndpoint(); - return (await httpRequest({ ...endpoint, path: IMDS_REGION_PATH })).toString(); - } catch (e) { + return "standard"; +}; +const inferPhysicalRegion = async () => { + if (process.env[AWS_EXECUTION_ENV] && (process.env[AWS_REGION_ENV] || process.env[AWS_DEFAULT_REGION_ENV])) { + return process.env[AWS_REGION_ENV] ?? process.env[AWS_DEFAULT_REGION_ENV]; } - } -}, "inferPhysicalRegion"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); + if (!process.env[ENV_IMDS_DISABLED]) { + try { + const { getInstanceMetadataEndpoint, httpRequest } = await __nccwpck_require__.e(/* import() */ 566).then(__nccwpck_require__.t.bind(__nccwpck_require__, 566, 19)); + const endpoint = await getInstanceMetadataEndpoint(); + return (await httpRequest({ ...endpoint, path: IMDS_REGION_PATH })).toString(); + } + catch (e) { + } + } +}; +exports.resolveDefaultsModeConfig = resolveDefaultsModeConfig; /***/ }), /***/ 9674: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +"use strict"; -// src/index.ts -var index_exports = {}; -__export(index_exports, { - EndpointCache: () => EndpointCache, - EndpointError: () => EndpointError, - customEndpointFunctions: () => customEndpointFunctions, - isIpAddress: () => isIpAddress, - isValidHostLabel: () => isValidHostLabel, - resolveEndpoint: () => resolveEndpoint -}); -module.exports = __toCommonJS(index_exports); -// src/cache/EndpointCache.ts -var EndpointCache = class { - /** - * @param [size] - desired average maximum capacity. A buffer of 10 additional keys will be allowed - * before keys are dropped. - * @param [params] - list of params to consider as part of the cache key. - * - * If the params list is not populated, no caching will happen. - * This may be out of order depending on how the object is created and arrives to this class. - */ - constructor({ size, params }) { - this.data = /* @__PURE__ */ new Map(); - this.parameters = []; - this.capacity = size ?? 50; - if (params) { - this.parameters = params; +var types = __nccwpck_require__(690); + +class EndpointCache { + capacity; + data = new Map(); + parameters = []; + constructor({ size, params }) { + this.capacity = size ?? 50; + if (params) { + this.parameters = params; + } } - } - static { - __name(this, "EndpointCache"); - } - /** - * @param endpointParams - query for endpoint. - * @param resolver - provider of the value if not present. - * @returns endpoint corresponding to the query. - */ - get(endpointParams, resolver) { - const key = this.hash(endpointParams); - if (key === false) { - return resolver(); - } - if (!this.data.has(key)) { - if (this.data.size > this.capacity + 10) { - const keys = this.data.keys(); - let i = 0; - while (true) { - const { value, done } = keys.next(); - this.data.delete(value); - if (done || ++i > 10) { - break; - } + get(endpointParams, resolver) { + const key = this.hash(endpointParams); + if (key === false) { + return resolver(); } - } - this.data.set(key, resolver()); + if (!this.data.has(key)) { + if (this.data.size > this.capacity + 10) { + const keys = this.data.keys(); + let i = 0; + while (true) { + const { value, done } = keys.next(); + this.data.delete(value); + if (done || ++i > 10) { + break; + } + } + } + this.data.set(key, resolver()); + } + return this.data.get(key); } - return this.data.get(key); - } - size() { - return this.data.size; - } - /** - * @returns cache key or false if not cachable. - */ - hash(endpointParams) { - let buffer = ""; - const { parameters } = this; - if (parameters.length === 0) { - return false; + size() { + return this.data.size; } - for (const param of parameters) { - const val = String(endpointParams[param] ?? ""); - if (val.includes("|;")) { - return false; - } - buffer += val + "|;"; + hash(endpointParams) { + let buffer = ""; + const { parameters } = this; + if (parameters.length === 0) { + return false; + } + for (const param of parameters) { + const val = String(endpointParams[param] ?? ""); + if (val.includes("|;")) { + return false; + } + buffer += val + "|;"; + } + return buffer; } - return buffer; - } -}; +} -// src/lib/isIpAddress.ts -var IP_V4_REGEX = new RegExp( - `^(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)(?:\\.(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)){3}$` -); -var isIpAddress = /* @__PURE__ */ __name((value) => IP_V4_REGEX.test(value) || value.startsWith("[") && value.endsWith("]"), "isIpAddress"); +const IP_V4_REGEX = new RegExp(`^(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)(?:\\.(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)){3}$`); +const isIpAddress = (value) => IP_V4_REGEX.test(value) || (value.startsWith("[") && value.endsWith("]")); -// src/lib/isValidHostLabel.ts -var VALID_HOST_LABEL_REGEX = new RegExp(`^(?!.*-$)(?!-)[a-zA-Z0-9-]{1,63}$`); -var isValidHostLabel = /* @__PURE__ */ __name((value, allowSubDomains = false) => { - if (!allowSubDomains) { - return VALID_HOST_LABEL_REGEX.test(value); - } - const labels = value.split("."); - for (const label of labels) { - if (!isValidHostLabel(label)) { - return false; +const VALID_HOST_LABEL_REGEX = new RegExp(`^(?!.*-$)(?!-)[a-zA-Z0-9-]{1,63}$`); +const isValidHostLabel = (value, allowSubDomains = false) => { + if (!allowSubDomains) { + return VALID_HOST_LABEL_REGEX.test(value); } - } - return true; -}, "isValidHostLabel"); + const labels = value.split("."); + for (const label of labels) { + if (!isValidHostLabel(label)) { + return false; + } + } + return true; +}; -// src/utils/customEndpointFunctions.ts -var customEndpointFunctions = {}; +const customEndpointFunctions = {}; -// src/debug/debugId.ts -var debugId = "endpoints"; +const debugId = "endpoints"; -// src/debug/toDebugString.ts function toDebugString(input) { - if (typeof input !== "object" || input == null) { - return input; - } - if ("ref" in input) { - return `$${toDebugString(input.ref)}`; - } - if ("fn" in input) { - return `${input.fn}(${(input.argv || []).map(toDebugString).join(", ")})`; - } - return JSON.stringify(input, null, 2); + if (typeof input !== "object" || input == null) { + return input; + } + if ("ref" in input) { + return `$${toDebugString(input.ref)}`; + } + if ("fn" in input) { + return `${input.fn}(${(input.argv || []).map(toDebugString).join(", ")})`; + } + return JSON.stringify(input, null, 2); } -__name(toDebugString, "toDebugString"); -// src/types/EndpointError.ts -var EndpointError = class extends Error { - static { - __name(this, "EndpointError"); - } - constructor(message) { - super(message); - this.name = "EndpointError"; - } -}; +class EndpointError extends Error { + constructor(message) { + super(message); + this.name = "EndpointError"; + } +} -// src/lib/booleanEquals.ts -var booleanEquals = /* @__PURE__ */ __name((value1, value2) => value1 === value2, "booleanEquals"); +const booleanEquals = (value1, value2) => value1 === value2; -// src/lib/getAttrPathList.ts -var getAttrPathList = /* @__PURE__ */ __name((path) => { - const parts = path.split("."); - const pathList = []; - for (const part of parts) { - const squareBracketIndex = part.indexOf("["); - if (squareBracketIndex !== -1) { - if (part.indexOf("]") !== part.length - 1) { - throw new EndpointError(`Path: '${path}' does not end with ']'`); - } - const arrayIndex = part.slice(squareBracketIndex + 1, -1); - if (Number.isNaN(parseInt(arrayIndex))) { - throw new EndpointError(`Invalid array index: '${arrayIndex}' in path: '${path}'`); - } - if (squareBracketIndex !== 0) { - pathList.push(part.slice(0, squareBracketIndex)); - } - pathList.push(arrayIndex); - } else { - pathList.push(part); +const getAttrPathList = (path) => { + const parts = path.split("."); + const pathList = []; + for (const part of parts) { + const squareBracketIndex = part.indexOf("["); + if (squareBracketIndex !== -1) { + if (part.indexOf("]") !== part.length - 1) { + throw new EndpointError(`Path: '${path}' does not end with ']'`); + } + const arrayIndex = part.slice(squareBracketIndex + 1, -1); + if (Number.isNaN(parseInt(arrayIndex))) { + throw new EndpointError(`Invalid array index: '${arrayIndex}' in path: '${path}'`); + } + if (squareBracketIndex !== 0) { + pathList.push(part.slice(0, squareBracketIndex)); + } + pathList.push(arrayIndex); + } + else { + pathList.push(part); + } } - } - return pathList; -}, "getAttrPathList"); + return pathList; +}; -// src/lib/getAttr.ts -var getAttr = /* @__PURE__ */ __name((value, path) => getAttrPathList(path).reduce((acc, index) => { - if (typeof acc !== "object") { - throw new EndpointError(`Index '${index}' in '${path}' not found in '${JSON.stringify(value)}'`); - } else if (Array.isArray(acc)) { - return acc[parseInt(index)]; - } - return acc[index]; -}, value), "getAttr"); +const getAttr = (value, path) => getAttrPathList(path).reduce((acc, index) => { + if (typeof acc !== "object") { + throw new EndpointError(`Index '${index}' in '${path}' not found in '${JSON.stringify(value)}'`); + } + else if (Array.isArray(acc)) { + return acc[parseInt(index)]; + } + return acc[index]; +}, value); -// src/lib/isSet.ts -var isSet = /* @__PURE__ */ __name((value) => value != null, "isSet"); +const isSet = (value) => value != null; -// src/lib/not.ts -var not = /* @__PURE__ */ __name((value) => !value, "not"); +const not = (value) => !value; -// src/lib/parseURL.ts -var import_types3 = __nccwpck_require__(690); -var DEFAULT_PORTS = { - [import_types3.EndpointURLScheme.HTTP]: 80, - [import_types3.EndpointURLScheme.HTTPS]: 443 +const DEFAULT_PORTS = { + [types.EndpointURLScheme.HTTP]: 80, + [types.EndpointURLScheme.HTTPS]: 443, }; -var parseURL = /* @__PURE__ */ __name((value) => { - const whatwgURL = (() => { - try { - if (value instanceof URL) { - return value; - } - if (typeof value === "object" && "hostname" in value) { - const { hostname: hostname2, port, protocol: protocol2 = "", path = "", query = {} } = value; - const url = new URL(`${protocol2}//${hostname2}${port ? `:${port}` : ""}${path}`); - url.search = Object.entries(query).map(([k, v]) => `${k}=${v}`).join("&"); - return url; - } - return new URL(value); - } catch (error) { - return null; +const parseURL = (value) => { + const whatwgURL = (() => { + try { + if (value instanceof URL) { + return value; + } + if (typeof value === "object" && "hostname" in value) { + const { hostname, port, protocol = "", path = "", query = {} } = value; + const url = new URL(`${protocol}//${hostname}${port ? `:${port}` : ""}${path}`); + url.search = Object.entries(query) + .map(([k, v]) => `${k}=${v}`) + .join("&"); + return url; + } + return new URL(value); + } + catch (error) { + return null; + } + })(); + if (!whatwgURL) { + console.error(`Unable to parse ${JSON.stringify(value)} as a whatwg URL.`); + return null; } - })(); - if (!whatwgURL) { - console.error(`Unable to parse ${JSON.stringify(value)} as a whatwg URL.`); - return null; - } - const urlString = whatwgURL.href; - const { host, hostname, pathname, protocol, search } = whatwgURL; - if (search) { - return null; - } - const scheme = protocol.slice(0, -1); - if (!Object.values(import_types3.EndpointURLScheme).includes(scheme)) { - return null; - } - const isIp = isIpAddress(hostname); - const inputContainsDefaultPort = urlString.includes(`${host}:${DEFAULT_PORTS[scheme]}`) || typeof value === "string" && value.includes(`${host}:${DEFAULT_PORTS[scheme]}`); - const authority = `${host}${inputContainsDefaultPort ? `:${DEFAULT_PORTS[scheme]}` : ``}`; - return { - scheme, - authority, - path: pathname, - normalizedPath: pathname.endsWith("/") ? pathname : `${pathname}/`, - isIp - }; -}, "parseURL"); + const urlString = whatwgURL.href; + const { host, hostname, pathname, protocol, search } = whatwgURL; + if (search) { + return null; + } + const scheme = protocol.slice(0, -1); + if (!Object.values(types.EndpointURLScheme).includes(scheme)) { + return null; + } + const isIp = isIpAddress(hostname); + const inputContainsDefaultPort = urlString.includes(`${host}:${DEFAULT_PORTS[scheme]}`) || + (typeof value === "string" && value.includes(`${host}:${DEFAULT_PORTS[scheme]}`)); + const authority = `${host}${inputContainsDefaultPort ? `:${DEFAULT_PORTS[scheme]}` : ``}`; + return { + scheme, + authority, + path: pathname, + normalizedPath: pathname.endsWith("/") ? pathname : `${pathname}/`, + isIp, + }; +}; -// src/lib/stringEquals.ts -var stringEquals = /* @__PURE__ */ __name((value1, value2) => value1 === value2, "stringEquals"); +const stringEquals = (value1, value2) => value1 === value2; -// src/lib/substring.ts -var substring = /* @__PURE__ */ __name((input, start, stop, reverse) => { - if (start >= stop || input.length < stop) { - return null; - } - if (!reverse) { - return input.substring(start, stop); - } - return input.substring(input.length - stop, input.length - start); -}, "substring"); +const substring = (input, start, stop, reverse) => { + if (start >= stop || input.length < stop) { + return null; + } + if (!reverse) { + return input.substring(start, stop); + } + return input.substring(input.length - stop, input.length - start); +}; -// src/lib/uriEncode.ts -var uriEncode = /* @__PURE__ */ __name((value) => encodeURIComponent(value).replace(/[!*'()]/g, (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`), "uriEncode"); +const uriEncode = (value) => encodeURIComponent(value).replace(/[!*'()]/g, (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`); -// src/utils/endpointFunctions.ts -var endpointFunctions = { - booleanEquals, - getAttr, - isSet, - isValidHostLabel, - not, - parseURL, - stringEquals, - substring, - uriEncode +const endpointFunctions = { + booleanEquals, + getAttr, + isSet, + isValidHostLabel, + not, + parseURL, + stringEquals, + substring, + uriEncode, }; -// src/utils/evaluateTemplate.ts -var evaluateTemplate = /* @__PURE__ */ __name((template, options) => { - const evaluatedTemplateArr = []; - const templateContext = { - ...options.endpointParams, - ...options.referenceRecord - }; - let currentIndex = 0; - while (currentIndex < template.length) { - const openingBraceIndex = template.indexOf("{", currentIndex); - if (openingBraceIndex === -1) { - evaluatedTemplateArr.push(template.slice(currentIndex)); - break; - } - evaluatedTemplateArr.push(template.slice(currentIndex, openingBraceIndex)); - const closingBraceIndex = template.indexOf("}", openingBraceIndex); - if (closingBraceIndex === -1) { - evaluatedTemplateArr.push(template.slice(openingBraceIndex)); - break; - } - if (template[openingBraceIndex + 1] === "{" && template[closingBraceIndex + 1] === "}") { - evaluatedTemplateArr.push(template.slice(openingBraceIndex + 1, closingBraceIndex)); - currentIndex = closingBraceIndex + 2; - } - const parameterName = template.substring(openingBraceIndex + 1, closingBraceIndex); - if (parameterName.includes("#")) { - const [refName, attrName] = parameterName.split("#"); - evaluatedTemplateArr.push(getAttr(templateContext[refName], attrName)); - } else { - evaluatedTemplateArr.push(templateContext[parameterName]); +const evaluateTemplate = (template, options) => { + const evaluatedTemplateArr = []; + const templateContext = { + ...options.endpointParams, + ...options.referenceRecord, + }; + let currentIndex = 0; + while (currentIndex < template.length) { + const openingBraceIndex = template.indexOf("{", currentIndex); + if (openingBraceIndex === -1) { + evaluatedTemplateArr.push(template.slice(currentIndex)); + break; + } + evaluatedTemplateArr.push(template.slice(currentIndex, openingBraceIndex)); + const closingBraceIndex = template.indexOf("}", openingBraceIndex); + if (closingBraceIndex === -1) { + evaluatedTemplateArr.push(template.slice(openingBraceIndex)); + break; + } + if (template[openingBraceIndex + 1] === "{" && template[closingBraceIndex + 1] === "}") { + evaluatedTemplateArr.push(template.slice(openingBraceIndex + 1, closingBraceIndex)); + currentIndex = closingBraceIndex + 2; + } + const parameterName = template.substring(openingBraceIndex + 1, closingBraceIndex); + if (parameterName.includes("#")) { + const [refName, attrName] = parameterName.split("#"); + evaluatedTemplateArr.push(getAttr(templateContext[refName], attrName)); + } + else { + evaluatedTemplateArr.push(templateContext[parameterName]); + } + currentIndex = closingBraceIndex + 1; } - currentIndex = closingBraceIndex + 1; - } - return evaluatedTemplateArr.join(""); -}, "evaluateTemplate"); - -// src/utils/getReferenceValue.ts -var getReferenceValue = /* @__PURE__ */ __name(({ ref }, options) => { - const referenceRecord = { - ...options.endpointParams, - ...options.referenceRecord - }; - return referenceRecord[ref]; -}, "getReferenceValue"); - -// src/utils/evaluateExpression.ts -var evaluateExpression = /* @__PURE__ */ __name((obj, keyName, options) => { - if (typeof obj === "string") { - return evaluateTemplate(obj, options); - } else if (obj["fn"]) { - return callFunction(obj, options); - } else if (obj["ref"]) { - return getReferenceValue(obj, options); - } - throw new EndpointError(`'${keyName}': ${String(obj)} is not a string, function or reference.`); -}, "evaluateExpression"); - -// src/utils/callFunction.ts -var callFunction = /* @__PURE__ */ __name(({ fn, argv }, options) => { - const evaluatedArgs = argv.map( - (arg) => ["boolean", "number"].includes(typeof arg) ? arg : evaluateExpression(arg, "arg", options) - ); - const fnSegments = fn.split("."); - if (fnSegments[0] in customEndpointFunctions && fnSegments[1] != null) { - return customEndpointFunctions[fnSegments[0]][fnSegments[1]](...evaluatedArgs); - } - return endpointFunctions[fn](...evaluatedArgs); -}, "callFunction"); + return evaluatedTemplateArr.join(""); +}; -// src/utils/evaluateCondition.ts -var evaluateCondition = /* @__PURE__ */ __name(({ assign, ...fnArgs }, options) => { - if (assign && assign in options.referenceRecord) { - throw new EndpointError(`'${assign}' is already defined in Reference Record.`); - } - const value = callFunction(fnArgs, options); - options.logger?.debug?.(`${debugId} evaluateCondition: ${toDebugString(fnArgs)} = ${toDebugString(value)}`); - return { - result: value === "" ? true : !!value, - ...assign != null && { toAssign: { name: assign, value } } - }; -}, "evaluateCondition"); - -// src/utils/evaluateConditions.ts -var evaluateConditions = /* @__PURE__ */ __name((conditions = [], options) => { - const conditionsReferenceRecord = {}; - for (const condition of conditions) { - const { result, toAssign } = evaluateCondition(condition, { - ...options, - referenceRecord: { +const getReferenceValue = ({ ref }, options) => { + const referenceRecord = { + ...options.endpointParams, ...options.referenceRecord, - ...conditionsReferenceRecord - } - }); - if (!result) { - return { result }; + }; + return referenceRecord[ref]; +}; + +const evaluateExpression = (obj, keyName, options) => { + if (typeof obj === "string") { + return evaluateTemplate(obj, options); } - if (toAssign) { - conditionsReferenceRecord[toAssign.name] = toAssign.value; - options.logger?.debug?.(`${debugId} assign: ${toAssign.name} := ${toDebugString(toAssign.value)}`); + else if (obj["fn"]) { + return group$2.callFunction(obj, options); } - } - return { result: true, referenceRecord: conditionsReferenceRecord }; -}, "evaluateConditions"); + else if (obj["ref"]) { + return getReferenceValue(obj, options); + } + throw new EndpointError(`'${keyName}': ${String(obj)} is not a string, function or reference.`); +}; +const callFunction = ({ fn, argv }, options) => { + const evaluatedArgs = argv.map((arg) => ["boolean", "number"].includes(typeof arg) ? arg : group$2.evaluateExpression(arg, "arg", options)); + const fnSegments = fn.split("."); + if (fnSegments[0] in customEndpointFunctions && fnSegments[1] != null) { + return customEndpointFunctions[fnSegments[0]][fnSegments[1]](...evaluatedArgs); + } + return endpointFunctions[fn](...evaluatedArgs); +}; +const group$2 = { + evaluateExpression, + callFunction, +}; + +const evaluateCondition = ({ assign, ...fnArgs }, options) => { + if (assign && assign in options.referenceRecord) { + throw new EndpointError(`'${assign}' is already defined in Reference Record.`); + } + const value = callFunction(fnArgs, options); + options.logger?.debug?.(`${debugId} evaluateCondition: ${toDebugString(fnArgs)} = ${toDebugString(value)}`); + return { + result: value === "" ? true : !!value, + ...(assign != null && { toAssign: { name: assign, value } }), + }; +}; + +const evaluateConditions = (conditions = [], options) => { + const conditionsReferenceRecord = {}; + for (const condition of conditions) { + const { result, toAssign } = evaluateCondition(condition, { + ...options, + referenceRecord: { + ...options.referenceRecord, + ...conditionsReferenceRecord, + }, + }); + if (!result) { + return { result }; + } + if (toAssign) { + conditionsReferenceRecord[toAssign.name] = toAssign.value; + options.logger?.debug?.(`${debugId} assign: ${toAssign.name} := ${toDebugString(toAssign.value)}`); + } + } + return { result: true, referenceRecord: conditionsReferenceRecord }; +}; -// src/utils/getEndpointHeaders.ts -var getEndpointHeaders = /* @__PURE__ */ __name((headers, options) => Object.entries(headers).reduce( - (acc, [headerKey, headerVal]) => ({ +const getEndpointHeaders = (headers, options) => Object.entries(headers).reduce((acc, [headerKey, headerVal]) => ({ ...acc, [headerKey]: headerVal.map((headerValEntry) => { - const processedExpr = evaluateExpression(headerValEntry, "Header value entry", options); - if (typeof processedExpr !== "string") { - throw new EndpointError(`Header '${headerKey}' value '${processedExpr}' is not a string`); - } - return processedExpr; - }) - }), - {} -), "getEndpointHeaders"); - -// src/utils/getEndpointProperty.ts -var getEndpointProperty = /* @__PURE__ */ __name((property, options) => { - if (Array.isArray(property)) { - return property.map((propertyEntry) => getEndpointProperty(propertyEntry, options)); - } - switch (typeof property) { - case "string": - return evaluateTemplate(property, options); - case "object": - if (property === null) { - throw new EndpointError(`Unexpected endpoint property: ${property}`); - } - return getEndpointProperties(property, options); - case "boolean": - return property; - default: - throw new EndpointError(`Unexpected endpoint property type: ${typeof property}`); - } -}, "getEndpointProperty"); + const processedExpr = evaluateExpression(headerValEntry, "Header value entry", options); + if (typeof processedExpr !== "string") { + throw new EndpointError(`Header '${headerKey}' value '${processedExpr}' is not a string`); + } + return processedExpr; + }), +}), {}); -// src/utils/getEndpointProperties.ts -var getEndpointProperties = /* @__PURE__ */ __name((properties, options) => Object.entries(properties).reduce( - (acc, [propertyKey, propertyVal]) => ({ +const getEndpointProperties = (properties, options) => Object.entries(properties).reduce((acc, [propertyKey, propertyVal]) => ({ ...acc, - [propertyKey]: getEndpointProperty(propertyVal, options) - }), - {} -), "getEndpointProperties"); - -// src/utils/getEndpointUrl.ts -var getEndpointUrl = /* @__PURE__ */ __name((endpointUrl, options) => { - const expression = evaluateExpression(endpointUrl, "Endpoint URL", options); - if (typeof expression === "string") { - try { - return new URL(expression); - } catch (error) { - console.error(`Failed to construct URL with ${expression}`, error); - throw error; + [propertyKey]: group$1.getEndpointProperty(propertyVal, options), +}), {}); +const getEndpointProperty = (property, options) => { + if (Array.isArray(property)) { + return property.map((propertyEntry) => getEndpointProperty(propertyEntry, options)); + } + switch (typeof property) { + case "string": + return evaluateTemplate(property, options); + case "object": + if (property === null) { + throw new EndpointError(`Unexpected endpoint property: ${property}`); + } + return group$1.getEndpointProperties(property, options); + case "boolean": + return property; + default: + throw new EndpointError(`Unexpected endpoint property type: ${typeof property}`); } - } - throw new EndpointError(`Endpoint URL must be a string, got ${typeof expression}`); -}, "getEndpointUrl"); +}; +const group$1 = { + getEndpointProperty, + getEndpointProperties, +}; -// src/utils/evaluateEndpointRule.ts -var evaluateEndpointRule = /* @__PURE__ */ __name((endpointRule, options) => { - const { conditions, endpoint } = endpointRule; - const { result, referenceRecord } = evaluateConditions(conditions, options); - if (!result) { - return; - } - const endpointRuleOptions = { - ...options, - referenceRecord: { ...options.referenceRecord, ...referenceRecord } - }; - const { url, properties, headers } = endpoint; - options.logger?.debug?.(`${debugId} Resolving endpoint from template: ${toDebugString(endpoint)}`); - return { - ...headers != void 0 && { - headers: getEndpointHeaders(headers, endpointRuleOptions) - }, - ...properties != void 0 && { - properties: getEndpointProperties(properties, endpointRuleOptions) - }, - url: getEndpointUrl(url, endpointRuleOptions) - }; -}, "evaluateEndpointRule"); +const getEndpointUrl = (endpointUrl, options) => { + const expression = evaluateExpression(endpointUrl, "Endpoint URL", options); + if (typeof expression === "string") { + try { + return new URL(expression); + } + catch (error) { + console.error(`Failed to construct URL with ${expression}`, error); + throw error; + } + } + throw new EndpointError(`Endpoint URL must be a string, got ${typeof expression}`); +}; -// src/utils/evaluateErrorRule.ts -var evaluateErrorRule = /* @__PURE__ */ __name((errorRule, options) => { - const { conditions, error } = errorRule; - const { result, referenceRecord } = evaluateConditions(conditions, options); - if (!result) { - return; - } - throw new EndpointError( - evaluateExpression(error, "Error", { - ...options, - referenceRecord: { ...options.referenceRecord, ...referenceRecord } - }) - ); -}, "evaluateErrorRule"); +const evaluateEndpointRule = (endpointRule, options) => { + const { conditions, endpoint } = endpointRule; + const { result, referenceRecord } = evaluateConditions(conditions, options); + if (!result) { + return; + } + const endpointRuleOptions = { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord }, + }; + const { url, properties, headers } = endpoint; + options.logger?.debug?.(`${debugId} Resolving endpoint from template: ${toDebugString(endpoint)}`); + return { + ...(headers != undefined && { + headers: getEndpointHeaders(headers, endpointRuleOptions), + }), + ...(properties != undefined && { + properties: getEndpointProperties(properties, endpointRuleOptions), + }), + url: getEndpointUrl(url, endpointRuleOptions), + }; +}; -// src/utils/evaluateTreeRule.ts -var evaluateTreeRule = /* @__PURE__ */ __name((treeRule, options) => { - const { conditions, rules } = treeRule; - const { result, referenceRecord } = evaluateConditions(conditions, options); - if (!result) { - return; - } - return evaluateRules(rules, { - ...options, - referenceRecord: { ...options.referenceRecord, ...referenceRecord } - }); -}, "evaluateTreeRule"); - -// src/utils/evaluateRules.ts -var evaluateRules = /* @__PURE__ */ __name((rules, options) => { - for (const rule of rules) { - if (rule.type === "endpoint") { - const endpointOrUndefined = evaluateEndpointRule(rule, options); - if (endpointOrUndefined) { - return endpointOrUndefined; - } - } else if (rule.type === "error") { - evaluateErrorRule(rule, options); - } else if (rule.type === "tree") { - const endpointOrUndefined = evaluateTreeRule(rule, options); - if (endpointOrUndefined) { - return endpointOrUndefined; - } - } else { - throw new EndpointError(`Unknown endpoint rule: ${rule}`); +const evaluateErrorRule = (errorRule, options) => { + const { conditions, error } = errorRule; + const { result, referenceRecord } = evaluateConditions(conditions, options); + if (!result) { + return; } - } - throw new EndpointError(`Rules evaluation failed`); -}, "evaluateRules"); + throw new EndpointError(evaluateExpression(error, "Error", { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord }, + })); +}; -// src/resolveEndpoint.ts -var resolveEndpoint = /* @__PURE__ */ __name((ruleSetObject, options) => { - const { endpointParams, logger } = options; - const { parameters, rules } = ruleSetObject; - options.logger?.debug?.(`${debugId} Initial EndpointParams: ${toDebugString(endpointParams)}`); - const paramsWithDefault = Object.entries(parameters).filter(([, v]) => v.default != null).map(([k, v]) => [k, v.default]); - if (paramsWithDefault.length > 0) { - for (const [paramKey, paramDefaultValue] of paramsWithDefault) { - endpointParams[paramKey] = endpointParams[paramKey] ?? paramDefaultValue; +const evaluateRules = (rules, options) => { + for (const rule of rules) { + if (rule.type === "endpoint") { + const endpointOrUndefined = evaluateEndpointRule(rule, options); + if (endpointOrUndefined) { + return endpointOrUndefined; + } + } + else if (rule.type === "error") { + evaluateErrorRule(rule, options); + } + else if (rule.type === "tree") { + const endpointOrUndefined = group.evaluateTreeRule(rule, options); + if (endpointOrUndefined) { + return endpointOrUndefined; + } + } + else { + throw new EndpointError(`Unknown endpoint rule: ${rule}`); + } } - } - const requiredParams = Object.entries(parameters).filter(([, v]) => v.required).map(([k]) => k); - for (const requiredParam of requiredParams) { - if (endpointParams[requiredParam] == null) { - throw new EndpointError(`Missing required parameter: '${requiredParam}'`); + throw new EndpointError(`Rules evaluation failed`); +}; +const evaluateTreeRule = (treeRule, options) => { + const { conditions, rules } = treeRule; + const { result, referenceRecord } = evaluateConditions(conditions, options); + if (!result) { + return; } - } - const endpoint = evaluateRules(rules, { endpointParams, logger, referenceRecord: {} }); - options.logger?.debug?.(`${debugId} Resolved endpoint: ${toDebugString(endpoint)}`); - return endpoint; -}, "resolveEndpoint"); -// Annotate the CommonJS export names for ESM import in node: + return group.evaluateRules(rules, { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord }, + }); +}; +const group = { + evaluateRules, + evaluateTreeRule, +}; -0 && (0); +const resolveEndpoint = (ruleSetObject, options) => { + const { endpointParams, logger } = options; + const { parameters, rules } = ruleSetObject; + options.logger?.debug?.(`${debugId} Initial EndpointParams: ${toDebugString(endpointParams)}`); + const paramsWithDefault = Object.entries(parameters) + .filter(([, v]) => v.default != null) + .map(([k, v]) => [k, v.default]); + if (paramsWithDefault.length > 0) { + for (const [paramKey, paramDefaultValue] of paramsWithDefault) { + endpointParams[paramKey] = endpointParams[paramKey] ?? paramDefaultValue; + } + } + const requiredParams = Object.entries(parameters) + .filter(([, v]) => v.required) + .map(([k]) => k); + for (const requiredParam of requiredParams) { + if (endpointParams[requiredParam] == null) { + throw new EndpointError(`Missing required parameter: '${requiredParam}'`); + } + } + const endpoint = evaluateRules(rules, { endpointParams, logger, referenceRecord: {} }); + options.logger?.debug?.(`${debugId} Resolved endpoint: ${toDebugString(endpoint)}`); + return endpoint; +}; +exports.EndpointCache = EndpointCache; +exports.EndpointError = EndpointError; +exports.customEndpointFunctions = customEndpointFunctions; +exports.isIpAddress = isIpAddress; +exports.isValidHostLabel = isValidHostLabel; +exports.resolveEndpoint = resolveEndpoint; /***/ }), /***/ 6435: -/***/ ((module) => { +/***/ ((__unused_webpack_module, exports) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +"use strict"; -// src/index.ts -var index_exports = {}; -__export(index_exports, { - fromHex: () => fromHex, - toHex: () => toHex -}); -module.exports = __toCommonJS(index_exports); -var SHORT_TO_HEX = {}; -var HEX_TO_SHORT = {}; + +const SHORT_TO_HEX = {}; +const HEX_TO_SHORT = {}; for (let i = 0; i < 256; i++) { - let encodedByte = i.toString(16).toLowerCase(); - if (encodedByte.length === 1) { - encodedByte = `0${encodedByte}`; - } - SHORT_TO_HEX[i] = encodedByte; - HEX_TO_SHORT[encodedByte] = i; + let encodedByte = i.toString(16).toLowerCase(); + if (encodedByte.length === 1) { + encodedByte = `0${encodedByte}`; + } + SHORT_TO_HEX[i] = encodedByte; + HEX_TO_SHORT[encodedByte] = i; } function fromHex(encoded) { - if (encoded.length % 2 !== 0) { - throw new Error("Hex encoded strings must have an even number length"); - } - const out = new Uint8Array(encoded.length / 2); - for (let i = 0; i < encoded.length; i += 2) { - const encodedByte = encoded.slice(i, i + 2).toLowerCase(); - if (encodedByte in HEX_TO_SHORT) { - out[i / 2] = HEX_TO_SHORT[encodedByte]; - } else { - throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); + if (encoded.length % 2 !== 0) { + throw new Error("Hex encoded strings must have an even number length"); } - } - return out; + const out = new Uint8Array(encoded.length / 2); + for (let i = 0; i < encoded.length; i += 2) { + const encodedByte = encoded.slice(i, i + 2).toLowerCase(); + if (encodedByte in HEX_TO_SHORT) { + out[i / 2] = HEX_TO_SHORT[encodedByte]; + } + else { + throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); + } + } + return out; } -__name(fromHex, "fromHex"); function toHex(bytes) { - let out = ""; - for (let i = 0; i < bytes.byteLength; i++) { - out += SHORT_TO_HEX[bytes[i]]; - } - return out; + let out = ""; + for (let i = 0; i < bytes.byteLength; i++) { + out += SHORT_TO_HEX[bytes[i]]; + } + return out; } -__name(toHex, "toHex"); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); +exports.fromHex = fromHex; +exports.toHex = toHex; /***/ }), /***/ 6324: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +"use strict"; -// src/index.ts -var index_exports = {}; -__export(index_exports, { - getSmithyContext: () => getSmithyContext, - normalizeProvider: () => normalizeProvider -}); -module.exports = __toCommonJS(index_exports); - -// src/getSmithyContext.ts -var import_types = __nccwpck_require__(690); -var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); - -// src/normalizeProvider.ts -var normalizeProvider = /* @__PURE__ */ __name((input) => { - if (typeof input === "function") return input; - const promisified = Promise.resolve(input); - return () => promisified; -}, "normalizeProvider"); -// Annotate the CommonJS export names for ESM import in node: -0 && (0); +var types = __nccwpck_require__(690); + +const getSmithyContext = (context) => context[types.SMITHY_CONTEXT_KEY] || (context[types.SMITHY_CONTEXT_KEY] = {}); + +const normalizeProvider = (input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; +}; +exports.getSmithyContext = getSmithyContext; +exports.normalizeProvider = normalizeProvider; /***/ }), /***/ 5518: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +"use strict"; -// src/index.ts -var index_exports = {}; -__export(index_exports, { - AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, - ConfiguredRetryStrategy: () => ConfiguredRetryStrategy, - DEFAULT_MAX_ATTEMPTS: () => DEFAULT_MAX_ATTEMPTS, - DEFAULT_RETRY_DELAY_BASE: () => DEFAULT_RETRY_DELAY_BASE, - DEFAULT_RETRY_MODE: () => DEFAULT_RETRY_MODE, - DefaultRateLimiter: () => DefaultRateLimiter, - INITIAL_RETRY_TOKENS: () => INITIAL_RETRY_TOKENS, - INVOCATION_ID_HEADER: () => INVOCATION_ID_HEADER, - MAXIMUM_RETRY_DELAY: () => MAXIMUM_RETRY_DELAY, - NO_RETRY_INCREMENT: () => NO_RETRY_INCREMENT, - REQUEST_HEADER: () => REQUEST_HEADER, - RETRY_COST: () => RETRY_COST, - RETRY_MODES: () => RETRY_MODES, - StandardRetryStrategy: () => StandardRetryStrategy, - THROTTLING_RETRY_DELAY_BASE: () => THROTTLING_RETRY_DELAY_BASE, - TIMEOUT_RETRY_COST: () => TIMEOUT_RETRY_COST -}); -module.exports = __toCommonJS(index_exports); - -// src/config.ts -var RETRY_MODES = /* @__PURE__ */ ((RETRY_MODES2) => { - RETRY_MODES2["STANDARD"] = "standard"; - RETRY_MODES2["ADAPTIVE"] = "adaptive"; - return RETRY_MODES2; -})(RETRY_MODES || {}); -var DEFAULT_MAX_ATTEMPTS = 3; -var DEFAULT_RETRY_MODE = "standard" /* STANDARD */; - -// src/DefaultRateLimiter.ts -var import_service_error_classification = __nccwpck_require__(2058); -var DefaultRateLimiter = class _DefaultRateLimiter { - constructor(options) { - // Pre-set state variables - this.currentCapacity = 0; - this.enabled = false; - this.lastMaxRate = 0; - this.measuredTxRate = 0; - this.requestCount = 0; - this.lastTimestamp = 0; - this.timeWindow = 0; - this.beta = options?.beta ?? 0.7; - this.minCapacity = options?.minCapacity ?? 1; - this.minFillRate = options?.minFillRate ?? 0.5; - this.scaleConstant = options?.scaleConstant ?? 0.4; - this.smooth = options?.smooth ?? 0.8; - const currentTimeInSeconds = this.getCurrentTimeInSeconds(); - this.lastThrottleTime = currentTimeInSeconds; - this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds()); - this.fillRate = this.minFillRate; - this.maxCapacity = this.minCapacity; - } - static { - __name(this, "DefaultRateLimiter"); - } - static { - /** - * Only used in testing. - */ - this.setTimeoutFn = setTimeout; - } - getCurrentTimeInSeconds() { - return Date.now() / 1e3; - } - async getSendToken() { - return this.acquireTokenBucket(1); - } - async acquireTokenBucket(amount) { - if (!this.enabled) { - return; + +var serviceErrorClassification = __nccwpck_require__(2058); + +exports.RETRY_MODES = void 0; +(function (RETRY_MODES) { + RETRY_MODES["STANDARD"] = "standard"; + RETRY_MODES["ADAPTIVE"] = "adaptive"; +})(exports.RETRY_MODES || (exports.RETRY_MODES = {})); +const DEFAULT_MAX_ATTEMPTS = 3; +const DEFAULT_RETRY_MODE = exports.RETRY_MODES.STANDARD; + +class DefaultRateLimiter { + static setTimeoutFn = setTimeout; + beta; + minCapacity; + minFillRate; + scaleConstant; + smooth; + currentCapacity = 0; + enabled = false; + lastMaxRate = 0; + measuredTxRate = 0; + requestCount = 0; + fillRate; + lastThrottleTime; + lastTimestamp = 0; + lastTxRateBucket; + maxCapacity; + timeWindow = 0; + constructor(options) { + this.beta = options?.beta ?? 0.7; + this.minCapacity = options?.minCapacity ?? 1; + this.minFillRate = options?.minFillRate ?? 0.5; + this.scaleConstant = options?.scaleConstant ?? 0.4; + this.smooth = options?.smooth ?? 0.8; + const currentTimeInSeconds = this.getCurrentTimeInSeconds(); + this.lastThrottleTime = currentTimeInSeconds; + this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds()); + this.fillRate = this.minFillRate; + this.maxCapacity = this.minCapacity; + } + getCurrentTimeInSeconds() { + return Date.now() / 1000; + } + async getSendToken() { + return this.acquireTokenBucket(1); + } + async acquireTokenBucket(amount) { + if (!this.enabled) { + return; + } + this.refillTokenBucket(); + if (amount > this.currentCapacity) { + const delay = ((amount - this.currentCapacity) / this.fillRate) * 1000; + await new Promise((resolve) => DefaultRateLimiter.setTimeoutFn(resolve, delay)); + } + this.currentCapacity = this.currentCapacity - amount; } - this.refillTokenBucket(); - if (amount > this.currentCapacity) { - const delay = (amount - this.currentCapacity) / this.fillRate * 1e3; - await new Promise((resolve) => _DefaultRateLimiter.setTimeoutFn(resolve, delay)); + refillTokenBucket() { + const timestamp = this.getCurrentTimeInSeconds(); + if (!this.lastTimestamp) { + this.lastTimestamp = timestamp; + return; + } + const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate; + this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount); + this.lastTimestamp = timestamp; + } + updateClientSendingRate(response) { + let calculatedRate; + this.updateMeasuredRate(); + if (serviceErrorClassification.isThrottlingError(response)) { + const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate); + this.lastMaxRate = rateToUse; + this.calculateTimeWindow(); + this.lastThrottleTime = this.getCurrentTimeInSeconds(); + calculatedRate = this.cubicThrottle(rateToUse); + this.enableTokenBucket(); + } + else { + this.calculateTimeWindow(); + calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds()); + } + const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate); + this.updateTokenBucketRate(newRate); } - this.currentCapacity = this.currentCapacity - amount; - } - refillTokenBucket() { - const timestamp = this.getCurrentTimeInSeconds(); - if (!this.lastTimestamp) { - this.lastTimestamp = timestamp; - return; + calculateTimeWindow() { + this.timeWindow = this.getPrecise(Math.pow((this.lastMaxRate * (1 - this.beta)) / this.scaleConstant, 1 / 3)); } - const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate; - this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount); - this.lastTimestamp = timestamp; - } - updateClientSendingRate(response) { - let calculatedRate; - this.updateMeasuredRate(); - if ((0, import_service_error_classification.isThrottlingError)(response)) { - const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate); - this.lastMaxRate = rateToUse; - this.calculateTimeWindow(); - this.lastThrottleTime = this.getCurrentTimeInSeconds(); - calculatedRate = this.cubicThrottle(rateToUse); - this.enableTokenBucket(); - } else { - this.calculateTimeWindow(); - calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds()); + cubicThrottle(rateToUse) { + return this.getPrecise(rateToUse * this.beta); } - const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate); - this.updateTokenBucketRate(newRate); - } - calculateTimeWindow() { - this.timeWindow = this.getPrecise(Math.pow(this.lastMaxRate * (1 - this.beta) / this.scaleConstant, 1 / 3)); - } - cubicThrottle(rateToUse) { - return this.getPrecise(rateToUse * this.beta); - } - cubicSuccess(timestamp) { - return this.getPrecise( - this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate - ); - } - enableTokenBucket() { - this.enabled = true; - } - updateTokenBucketRate(newRate) { - this.refillTokenBucket(); - this.fillRate = Math.max(newRate, this.minFillRate); - this.maxCapacity = Math.max(newRate, this.minCapacity); - this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity); - } - updateMeasuredRate() { - const t = this.getCurrentTimeInSeconds(); - const timeBucket = Math.floor(t * 2) / 2; - this.requestCount++; - if (timeBucket > this.lastTxRateBucket) { - const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket); - this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth)); - this.requestCount = 0; - this.lastTxRateBucket = timeBucket; + cubicSuccess(timestamp) { + return this.getPrecise(this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate); } - } - getPrecise(num) { - return parseFloat(num.toFixed(8)); - } -}; - -// src/constants.ts -var DEFAULT_RETRY_DELAY_BASE = 100; -var MAXIMUM_RETRY_DELAY = 20 * 1e3; -var THROTTLING_RETRY_DELAY_BASE = 500; -var INITIAL_RETRY_TOKENS = 500; -var RETRY_COST = 5; -var TIMEOUT_RETRY_COST = 10; -var NO_RETRY_INCREMENT = 1; -var INVOCATION_ID_HEADER = "amz-sdk-invocation-id"; -var REQUEST_HEADER = "amz-sdk-request"; - -// src/defaultRetryBackoffStrategy.ts -var getDefaultRetryBackoffStrategy = /* @__PURE__ */ __name(() => { - let delayBase = DEFAULT_RETRY_DELAY_BASE; - const computeNextBackoffDelay = /* @__PURE__ */ __name((attempts) => { - return Math.floor(Math.min(MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); - }, "computeNextBackoffDelay"); - const setDelayBase = /* @__PURE__ */ __name((delay) => { - delayBase = delay; - }, "setDelayBase"); - return { - computeNextBackoffDelay, - setDelayBase - }; -}, "getDefaultRetryBackoffStrategy"); - -// src/defaultRetryToken.ts -var createDefaultRetryToken = /* @__PURE__ */ __name(({ - retryDelay, - retryCount, - retryCost -}) => { - const getRetryCount = /* @__PURE__ */ __name(() => retryCount, "getRetryCount"); - const getRetryDelay = /* @__PURE__ */ __name(() => Math.min(MAXIMUM_RETRY_DELAY, retryDelay), "getRetryDelay"); - const getRetryCost = /* @__PURE__ */ __name(() => retryCost, "getRetryCost"); - return { - getRetryCount, - getRetryDelay, - getRetryCost - }; -}, "createDefaultRetryToken"); - -// src/StandardRetryStrategy.ts -var StandardRetryStrategy = class { - constructor(maxAttempts) { - this.maxAttempts = maxAttempts; - this.mode = "standard" /* STANDARD */; - this.capacity = INITIAL_RETRY_TOKENS; - this.retryBackoffStrategy = getDefaultRetryBackoffStrategy(); - this.maxAttemptsProvider = typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts; - } - static { - __name(this, "StandardRetryStrategy"); - } - // eslint-disable-next-line @typescript-eslint/no-unused-vars - async acquireInitialRetryToken(retryTokenScope) { - return createDefaultRetryToken({ - retryDelay: DEFAULT_RETRY_DELAY_BASE, - retryCount: 0 - }); - } - async refreshRetryTokenForRetry(token, errorInfo) { - const maxAttempts = await this.getMaxAttempts(); - if (this.shouldRetry(token, errorInfo, maxAttempts)) { - const errorType = errorInfo.errorType; - this.retryBackoffStrategy.setDelayBase( - errorType === "THROTTLING" ? THROTTLING_RETRY_DELAY_BASE : DEFAULT_RETRY_DELAY_BASE - ); - const delayFromErrorType = this.retryBackoffStrategy.computeNextBackoffDelay(token.getRetryCount()); - const retryDelay = errorInfo.retryAfterHint ? Math.max(errorInfo.retryAfterHint.getTime() - Date.now() || 0, delayFromErrorType) : delayFromErrorType; - const capacityCost = this.getCapacityCost(errorType); - this.capacity -= capacityCost; - return createDefaultRetryToken({ - retryDelay, - retryCount: token.getRetryCount() + 1, - retryCost: capacityCost - }); + enableTokenBucket() { + this.enabled = true; } - throw new Error("No retry token available"); - } - recordSuccess(token) { - this.capacity = Math.max(INITIAL_RETRY_TOKENS, this.capacity + (token.getRetryCost() ?? NO_RETRY_INCREMENT)); - } - /** - * @returns the current available retry capacity. - * - * This number decreases when retries are executed and refills when requests or retries succeed. - */ - getCapacity() { - return this.capacity; - } - async getMaxAttempts() { - try { - return await this.maxAttemptsProvider(); - } catch (error) { - console.warn(`Max attempts provider could not resolve. Using default of ${DEFAULT_MAX_ATTEMPTS}`); - return DEFAULT_MAX_ATTEMPTS; + updateTokenBucketRate(newRate) { + this.refillTokenBucket(); + this.fillRate = Math.max(newRate, this.minFillRate); + this.maxCapacity = Math.max(newRate, this.minCapacity); + this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity); } - } - shouldRetry(tokenToRenew, errorInfo, maxAttempts) { - const attempts = tokenToRenew.getRetryCount() + 1; - return attempts < maxAttempts && this.capacity >= this.getCapacityCost(errorInfo.errorType) && this.isRetryableError(errorInfo.errorType); - } - getCapacityCost(errorType) { - return errorType === "TRANSIENT" ? TIMEOUT_RETRY_COST : RETRY_COST; - } - isRetryableError(errorType) { - return errorType === "THROTTLING" || errorType === "TRANSIENT"; - } + updateMeasuredRate() { + const t = this.getCurrentTimeInSeconds(); + const timeBucket = Math.floor(t * 2) / 2; + this.requestCount++; + if (timeBucket > this.lastTxRateBucket) { + const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket); + this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth)); + this.requestCount = 0; + this.lastTxRateBucket = timeBucket; + } + } + getPrecise(num) { + return parseFloat(num.toFixed(8)); + } +} + +const DEFAULT_RETRY_DELAY_BASE = 100; +const MAXIMUM_RETRY_DELAY = 20 * 1000; +const THROTTLING_RETRY_DELAY_BASE = 500; +const INITIAL_RETRY_TOKENS = 500; +const RETRY_COST = 5; +const TIMEOUT_RETRY_COST = 10; +const NO_RETRY_INCREMENT = 1; +const INVOCATION_ID_HEADER = "amz-sdk-invocation-id"; +const REQUEST_HEADER = "amz-sdk-request"; + +const getDefaultRetryBackoffStrategy = () => { + let delayBase = DEFAULT_RETRY_DELAY_BASE; + const computeNextBackoffDelay = (attempts) => { + return Math.floor(Math.min(MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); + }; + const setDelayBase = (delay) => { + delayBase = delay; + }; + return { + computeNextBackoffDelay, + setDelayBase, + }; }; -// src/AdaptiveRetryStrategy.ts -var AdaptiveRetryStrategy = class { - constructor(maxAttemptsProvider, options) { - this.maxAttemptsProvider = maxAttemptsProvider; - this.mode = "adaptive" /* ADAPTIVE */; - const { rateLimiter } = options ?? {}; - this.rateLimiter = rateLimiter ?? new DefaultRateLimiter(); - this.standardRetryStrategy = new StandardRetryStrategy(maxAttemptsProvider); - } - static { - __name(this, "AdaptiveRetryStrategy"); - } - async acquireInitialRetryToken(retryTokenScope) { - await this.rateLimiter.getSendToken(); - return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope); - } - async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { - this.rateLimiter.updateClientSendingRate(errorInfo); - return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo); - } - recordSuccess(token) { - this.rateLimiter.updateClientSendingRate({}); - this.standardRetryStrategy.recordSuccess(token); - } +const createDefaultRetryToken = ({ retryDelay, retryCount, retryCost, }) => { + const getRetryCount = () => retryCount; + const getRetryDelay = () => Math.min(MAXIMUM_RETRY_DELAY, retryDelay); + const getRetryCost = () => retryCost; + return { + getRetryCount, + getRetryDelay, + getRetryCost, + }; }; -// src/ConfiguredRetryStrategy.ts -var ConfiguredRetryStrategy = class extends StandardRetryStrategy { - static { - __name(this, "ConfiguredRetryStrategy"); - } - /** - * @param maxAttempts - the maximum number of retry attempts allowed. - * e.g., if set to 3, then 4 total requests are possible. - * @param computeNextBackoffDelay - a millisecond delay for each retry or a function that takes the retry attempt - * and returns the delay. - * - * @example exponential backoff. - * ```js - * new Client({ - * retryStrategy: new ConfiguredRetryStrategy(3, (attempt) => attempt ** 2) - * }); - * ``` - * @example constant delay. - * ```js - * new Client({ - * retryStrategy: new ConfiguredRetryStrategy(3, 2000) - * }); - * ``` - */ - constructor(maxAttempts, computeNextBackoffDelay = DEFAULT_RETRY_DELAY_BASE) { - super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts); - if (typeof computeNextBackoffDelay === "number") { - this.computeNextBackoffDelay = () => computeNextBackoffDelay; - } else { - this.computeNextBackoffDelay = computeNextBackoffDelay; +class StandardRetryStrategy { + maxAttempts; + mode = exports.RETRY_MODES.STANDARD; + capacity = INITIAL_RETRY_TOKENS; + retryBackoffStrategy = getDefaultRetryBackoffStrategy(); + maxAttemptsProvider; + constructor(maxAttempts) { + this.maxAttempts = maxAttempts; + this.maxAttemptsProvider = typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts; + } + async acquireInitialRetryToken(retryTokenScope) { + return createDefaultRetryToken({ + retryDelay: DEFAULT_RETRY_DELAY_BASE, + retryCount: 0, + }); } - } - async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { - const token = await super.refreshRetryTokenForRetry(tokenToRenew, errorInfo); - token.getRetryDelay = () => this.computeNextBackoffDelay(token.getRetryCount()); - return token; - } -}; -// Annotate the CommonJS export names for ESM import in node: + async refreshRetryTokenForRetry(token, errorInfo) { + const maxAttempts = await this.getMaxAttempts(); + if (this.shouldRetry(token, errorInfo, maxAttempts)) { + const errorType = errorInfo.errorType; + this.retryBackoffStrategy.setDelayBase(errorType === "THROTTLING" ? THROTTLING_RETRY_DELAY_BASE : DEFAULT_RETRY_DELAY_BASE); + const delayFromErrorType = this.retryBackoffStrategy.computeNextBackoffDelay(token.getRetryCount()); + const retryDelay = errorInfo.retryAfterHint + ? Math.max(errorInfo.retryAfterHint.getTime() - Date.now() || 0, delayFromErrorType) + : delayFromErrorType; + const capacityCost = this.getCapacityCost(errorType); + this.capacity -= capacityCost; + return createDefaultRetryToken({ + retryDelay, + retryCount: token.getRetryCount() + 1, + retryCost: capacityCost, + }); + } + throw new Error("No retry token available"); + } + recordSuccess(token) { + this.capacity = Math.max(INITIAL_RETRY_TOKENS, this.capacity + (token.getRetryCost() ?? NO_RETRY_INCREMENT)); + } + getCapacity() { + return this.capacity; + } + async getMaxAttempts() { + try { + return await this.maxAttemptsProvider(); + } + catch (error) { + console.warn(`Max attempts provider could not resolve. Using default of ${DEFAULT_MAX_ATTEMPTS}`); + return DEFAULT_MAX_ATTEMPTS; + } + } + shouldRetry(tokenToRenew, errorInfo, maxAttempts) { + const attempts = tokenToRenew.getRetryCount() + 1; + return (attempts < maxAttempts && + this.capacity >= this.getCapacityCost(errorInfo.errorType) && + this.isRetryableError(errorInfo.errorType)); + } + getCapacityCost(errorType) { + return errorType === "TRANSIENT" ? TIMEOUT_RETRY_COST : RETRY_COST; + } + isRetryableError(errorType) { + return errorType === "THROTTLING" || errorType === "TRANSIENT"; + } +} -0 && (0); +class AdaptiveRetryStrategy { + maxAttemptsProvider; + rateLimiter; + standardRetryStrategy; + mode = exports.RETRY_MODES.ADAPTIVE; + constructor(maxAttemptsProvider, options) { + this.maxAttemptsProvider = maxAttemptsProvider; + const { rateLimiter } = options ?? {}; + this.rateLimiter = rateLimiter ?? new DefaultRateLimiter(); + this.standardRetryStrategy = new StandardRetryStrategy(maxAttemptsProvider); + } + async acquireInitialRetryToken(retryTokenScope) { + await this.rateLimiter.getSendToken(); + return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope); + } + async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { + this.rateLimiter.updateClientSendingRate(errorInfo); + return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo); + } + recordSuccess(token) { + this.rateLimiter.updateClientSendingRate({}); + this.standardRetryStrategy.recordSuccess(token); + } +} +class ConfiguredRetryStrategy extends StandardRetryStrategy { + computeNextBackoffDelay; + constructor(maxAttempts, computeNextBackoffDelay = DEFAULT_RETRY_DELAY_BASE) { + super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts); + if (typeof computeNextBackoffDelay === "number") { + this.computeNextBackoffDelay = () => computeNextBackoffDelay; + } + else { + this.computeNextBackoffDelay = computeNextBackoffDelay; + } + } + async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { + const token = await super.refreshRetryTokenForRetry(tokenToRenew, errorInfo); + token.getRetryDelay = () => this.computeNextBackoffDelay(token.getRetryCount()); + return token; + } +} + +exports.AdaptiveRetryStrategy = AdaptiveRetryStrategy; +exports.ConfiguredRetryStrategy = ConfiguredRetryStrategy; +exports.DEFAULT_MAX_ATTEMPTS = DEFAULT_MAX_ATTEMPTS; +exports.DEFAULT_RETRY_DELAY_BASE = DEFAULT_RETRY_DELAY_BASE; +exports.DEFAULT_RETRY_MODE = DEFAULT_RETRY_MODE; +exports.DefaultRateLimiter = DefaultRateLimiter; +exports.INITIAL_RETRY_TOKENS = INITIAL_RETRY_TOKENS; +exports.INVOCATION_ID_HEADER = INVOCATION_ID_HEADER; +exports.MAXIMUM_RETRY_DELAY = MAXIMUM_RETRY_DELAY; +exports.NO_RETRY_INCREMENT = NO_RETRY_INCREMENT; +exports.REQUEST_HEADER = REQUEST_HEADER; +exports.RETRY_COST = RETRY_COST; +exports.StandardRetryStrategy = StandardRetryStrategy; +exports.THROTTLING_RETRY_DELAY_BASE = THROTTLING_RETRY_DELAY_BASE; +exports.TIMEOUT_RETRY_COST = TIMEOUT_RETRY_COST; /***/ }), @@ -31509,10 +24513,11 @@ var ConfiguredRetryStrategy = class extends StandardRetryStrategy { Object.defineProperty(exports, "__esModule", ({ value: true })); exports.ByteArrayCollector = void 0; class ByteArrayCollector { + allocByteArray; + byteLength = 0; + byteArrays = []; constructor(allocByteArray) { this.allocByteArray = allocByteArray; - this.byteLength = 0; - this.byteArrays = []; } push(byteArray) { this.byteArrays.push(byteArray); @@ -31569,16 +24574,20 @@ exports.ChecksumStream = void 0; const util_base64_1 = __nccwpck_require__(8385); const stream_1 = __nccwpck_require__(2203); class ChecksumStream extends stream_1.Duplex { + expectedChecksum; + checksumSourceLocation; + checksum; + source; + base64Encoder; constructor({ expectedChecksum, checksum, source, checksumSourceLocation, base64Encoder, }) { - var _a, _b; super(); if (typeof source.pipe === "function") { this.source = source; } else { - throw new Error(`@smithy/util-stream: unsupported source type ${(_b = (_a = source === null || source === void 0 ? void 0 : source.constructor) === null || _a === void 0 ? void 0 : _a.name) !== null && _b !== void 0 ? _b : source} in ChecksumStream.`); + throw new Error(`@smithy/util-stream: unsupported source type ${source?.constructor?.name ?? source} in ChecksumStream.`); } - this.base64Encoder = base64Encoder !== null && base64Encoder !== void 0 ? base64Encoder : util_base64_1.toBase64; + this.base64Encoder = base64Encoder ?? util_base64_1.toBase64; this.expectedChecksum = expectedChecksum; this.checksum = checksum; this.checksumSourceLocation = checksumSourceLocation; @@ -31627,11 +24636,10 @@ const util_base64_1 = __nccwpck_require__(8385); const stream_type_check_1 = __nccwpck_require__(4414); const ChecksumStream_browser_1 = __nccwpck_require__(7753); const createChecksumStream = ({ expectedChecksum, checksum, source, checksumSourceLocation, base64Encoder, }) => { - var _a, _b; if (!(0, stream_type_check_1.isReadableStream)(source)) { - throw new Error(`@smithy/util-stream: unsupported source type ${(_b = (_a = source === null || source === void 0 ? void 0 : source.constructor) === null || _a === void 0 ? void 0 : _a.name) !== null && _b !== void 0 ? _b : source} in ChecksumStream.`); + throw new Error(`@smithy/util-stream: unsupported source type ${source?.constructor?.name ?? source} in ChecksumStream.`); } - const encoder = base64Encoder !== null && base64Encoder !== void 0 ? base64Encoder : util_base64_1.toBase64; + const encoder = base64Encoder ?? util_base64_1.toBase64; if (typeof TransformStream !== "function") { throw new Error("@smithy/util-stream: unable to instantiate ChecksumStream because API unavailable: ReadableStream/TransformStream."); } @@ -31730,7 +24738,7 @@ function createBufferedReadable(upstream, size, logger) { const newSize = (0, createBufferedReadableStream_1.merge)(buffers, mode, chunk); if (!streamBufferingLoggedWarning && bytesSeen > size * 2) { streamBufferingLoggedWarning = true; - logger === null || logger === void 0 ? void 0 : logger.warn(`@smithy/util-stream - stream chunk size ${chunkSize} is below threshold of ${size}, automatically buffering.`); + logger?.warn(`@smithy/util-stream - stream chunk size ${chunkSize} is below threshold of ${size}, automatically buffering.`); } if (newSize >= size) { downstream.push((0, createBufferedReadableStream_1.flush)(buffers, mode)); @@ -31805,7 +24813,7 @@ function createBufferedReadableStream(upstream, size, logger) { const newSize = merge(buffers, mode, chunk); if (!streamBufferingLoggedWarning && bytesSeen > size * 2) { streamBufferingLoggedWarning = true; - logger === null || logger === void 0 ? void 0 : logger.warn(`@smithy/util-stream - stream chunk size ${chunkSize} is below threshold of ${size}, automatically buffering.`); + logger?.warn(`@smithy/util-stream - stream chunk size ${chunkSize} is below threshold of ${size}, automatically buffering.`); } if (newSize >= size) { controller.enqueue(flush(buffers, mode)); @@ -31845,8 +24853,7 @@ function flush(buffers, mode) { throw new Error(`@smithy/util-stream - invalid index ${mode} given to flush()`); } function sizeOf(chunk) { - var _a, _b; - return (_b = (_a = chunk === null || chunk === void 0 ? void 0 : chunk.byteLength) !== null && _a !== void 0 ? _a : chunk === null || chunk === void 0 ? void 0 : chunk.length) !== null && _b !== void 0 ? _b : 0; + return chunk?.byteLength ?? chunk?.length ?? 0; } function modeOf(chunk, allowBuffer = true) { if (allowBuffer && typeof Buffer !== "undefined" && chunk instanceof Buffer) { @@ -31910,7 +24917,6 @@ exports.getAwsChunkedEncodingStream = getAwsChunkedEncodingStream; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.headStream = headStream; async function headStream(stream, bytes) { - var _a; let byteLengthCounter = 0; const chunks = []; const reader = stream.getReader(); @@ -31919,7 +24925,7 @@ async function headStream(stream, bytes) { const { done, value } = await reader.read(); if (value) { chunks.push(value); - byteLengthCounter += (_a = value === null || value === void 0 ? void 0 : value.byteLength) !== null && _a !== void 0 ? _a : 0; + byteLengthCounter += value?.byteLength ?? 0; } if (byteLengthCounter >= bytes) { break; @@ -31976,16 +24982,12 @@ const headStream = (stream, bytes) => { }; exports.headStream = headStream; class Collector extends stream_1.Writable { - constructor() { - super(...arguments); - this.buffers = []; - this.limit = Infinity; - this.bytesBuffered = 0; - } + buffers = []; + limit = Infinity; + bytesBuffered = 0; _write(chunk, encoding, callback) { - var _a; this.buffers.push(chunk); - this.bytesBuffered += (_a = chunk.byteLength) !== null && _a !== void 0 ? _a : 0; + this.bytesBuffered += chunk.byteLength ?? 0; if (this.bytesBuffered >= this.limit) { const excess = this.bytesBuffered - this.limit; const tailBuffer = this.buffers[this.buffers.length - 1]; @@ -32000,100 +25002,93 @@ class Collector extends stream_1.Writable { /***/ }), /***/ 4252: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -// src/index.ts -var index_exports = {}; -__export(index_exports, { - Uint8ArrayBlobAdapter: () => Uint8ArrayBlobAdapter -}); -module.exports = __toCommonJS(index_exports); +"use strict"; -// src/blob/transforms.ts -var import_util_base64 = __nccwpck_require__(8385); -var import_util_utf8 = __nccwpck_require__(1577); -function transformToString(payload, encoding = "utf-8") { - if (encoding === "base64") { - return (0, import_util_base64.toBase64)(payload); - } - return (0, import_util_utf8.toUtf8)(payload); -} -__name(transformToString, "transformToString"); -function transformFromString(str, encoding) { - if (encoding === "base64") { - return Uint8ArrayBlobAdapter.mutate((0, import_util_base64.fromBase64)(str)); - } - return Uint8ArrayBlobAdapter.mutate((0, import_util_utf8.fromUtf8)(str)); -} -__name(transformFromString, "transformFromString"); -// src/blob/Uint8ArrayBlobAdapter.ts -var Uint8ArrayBlobAdapter = class _Uint8ArrayBlobAdapter extends Uint8Array { - static { - __name(this, "Uint8ArrayBlobAdapter"); - } - /** - * @param source - such as a string or Stream. - * @returns a new Uint8ArrayBlobAdapter extending Uint8Array. - */ - static fromString(source, encoding = "utf-8") { - switch (typeof source) { - case "string": - return transformFromString(source, encoding); - default: +var utilBase64 = __nccwpck_require__(8385); +var utilUtf8 = __nccwpck_require__(1577); +var ChecksumStream = __nccwpck_require__(1775); +var createChecksumStream = __nccwpck_require__(5639); +var createBufferedReadable = __nccwpck_require__(2005); +var getAwsChunkedEncodingStream = __nccwpck_require__(6522); +var headStream = __nccwpck_require__(8412); +var sdkStreamMixin = __nccwpck_require__(7201); +var splitStream = __nccwpck_require__(2108); +var streamTypeCheck = __nccwpck_require__(4414); + +class Uint8ArrayBlobAdapter extends Uint8Array { + static fromString(source, encoding = "utf-8") { + if (typeof source === "string") { + if (encoding === "base64") { + return Uint8ArrayBlobAdapter.mutate(utilBase64.fromBase64(source)); + } + return Uint8ArrayBlobAdapter.mutate(utilUtf8.fromUtf8(source)); + } throw new Error(`Unsupported conversion from ${typeof source} to Uint8ArrayBlobAdapter.`); } - } - /** - * @param source - Uint8Array to be mutated. - * @returns the same Uint8Array but with prototype switched to Uint8ArrayBlobAdapter. - */ - static mutate(source) { - Object.setPrototypeOf(source, _Uint8ArrayBlobAdapter.prototype); - return source; - } - /** - * @param encoding - default 'utf-8'. - * @returns the blob as string. - */ - transformToString(encoding = "utf-8") { - return transformToString(this, encoding); - } -}; - -// src/index.ts -__reExport(index_exports, __nccwpck_require__(1775), module.exports); -__reExport(index_exports, __nccwpck_require__(5639), module.exports); -__reExport(index_exports, __nccwpck_require__(2005), module.exports); -__reExport(index_exports, __nccwpck_require__(6522), module.exports); -__reExport(index_exports, __nccwpck_require__(8412), module.exports); -__reExport(index_exports, __nccwpck_require__(7201), module.exports); -__reExport(index_exports, __nccwpck_require__(2108), module.exports); -__reExport(index_exports, __nccwpck_require__(4414), module.exports); -// Annotate the CommonJS export names for ESM import in node: - -0 && (0); + static mutate(source) { + Object.setPrototypeOf(source, Uint8ArrayBlobAdapter.prototype); + return source; + } + transformToString(encoding = "utf-8") { + if (encoding === "base64") { + return utilBase64.toBase64(this); + } + return utilUtf8.toUtf8(this); + } +} +exports.Uint8ArrayBlobAdapter = Uint8ArrayBlobAdapter; +Object.keys(ChecksumStream).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return ChecksumStream[k]; } + }); +}); +Object.keys(createChecksumStream).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return createChecksumStream[k]; } + }); +}); +Object.keys(createBufferedReadable).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return createBufferedReadable[k]; } + }); +}); +Object.keys(getAwsChunkedEncodingStream).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return getAwsChunkedEncodingStream[k]; } + }); +}); +Object.keys(headStream).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return headStream[k]; } + }); +}); +Object.keys(sdkStreamMixin).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return sdkStreamMixin[k]; } + }); +}); +Object.keys(splitStream).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return splitStream[k]; } + }); +}); +Object.keys(streamTypeCheck).forEach(function (k) { + if (k !== 'default' && !Object.prototype.hasOwnProperty.call(exports, k)) Object.defineProperty(exports, k, { + enumerable: true, + get: function () { return streamTypeCheck[k]; } + }); +}); /***/ }), @@ -32112,9 +25107,8 @@ const util_utf8_1 = __nccwpck_require__(1577); const stream_type_check_1 = __nccwpck_require__(4414); const ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; const sdkStreamMixin = (stream) => { - var _a, _b; if (!isBlobInstance(stream) && !(0, stream_type_check_1.isReadableStream)(stream)) { - const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; + const name = stream?.__proto__?.constructor?.name || stream; throw new Error(`Unexpected stream implementation, expect Blob or ReadableStream, got ${name}`); } let transformed = false; @@ -32188,13 +25182,12 @@ const stream_1 = __nccwpck_require__(2203); const sdk_stream_mixin_browser_1 = __nccwpck_require__(2207); const ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; const sdkStreamMixin = (stream) => { - var _a, _b; if (!(stream instanceof stream_1.Readable)) { try { return (0, sdk_stream_mixin_browser_1.sdkStreamMixin)(stream); } catch (e) { - const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; + const name = stream?.__proto__?.constructor?.name || stream; throw new Error(`Unexpected stream implementation, expect Stream.Readable instance, got ${name}`); } } @@ -32287,15 +25280,11 @@ async function splitStream(stream) { Object.defineProperty(exports, "__esModule", ({ value: true })); exports.isBlob = exports.isReadableStream = void 0; -const isReadableStream = (stream) => { - var _a; - return typeof ReadableStream === "function" && - (((_a = stream === null || stream === void 0 ? void 0 : stream.constructor) === null || _a === void 0 ? void 0 : _a.name) === ReadableStream.name || stream instanceof ReadableStream); -}; +const isReadableStream = (stream) => typeof ReadableStream === "function" && + (stream?.constructor?.name === ReadableStream.name || stream instanceof ReadableStream); exports.isReadableStream = isReadableStream; const isBlob = (blob) => { - var _a; - return typeof Blob === "function" && (((_a = blob === null || blob === void 0 ? void 0 : blob.constructor) === null || _a === void 0 ? void 0 : _a.name) === Blob.name || blob instanceof Blob); + return typeof Blob === "function" && (blob?.constructor?.name === Blob.name || blob instanceof Blob); }; exports.isBlob = isBlob; @@ -32303,322 +25292,304 @@ exports.isBlob = isBlob; /***/ }), /***/ 146: -/***/ ((module) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +/***/ ((__unused_webpack_module, exports) => { -// src/index.ts -var index_exports = {}; -__export(index_exports, { - escapeUri: () => escapeUri, - escapeUriPath: () => escapeUriPath -}); -module.exports = __toCommonJS(index_exports); +"use strict"; -// src/escape-uri.ts -var escapeUri = /* @__PURE__ */ __name((uri) => ( - // AWS percent-encodes some extra non-standard characters in a URI - encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode) -), "escapeUri"); -var hexEncode = /* @__PURE__ */ __name((c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`, "hexEncode"); -// src/escape-uri-path.ts -var escapeUriPath = /* @__PURE__ */ __name((uri) => uri.split("/").map(escapeUri).join("/"), "escapeUriPath"); -// Annotate the CommonJS export names for ESM import in node: +const escapeUri = (uri) => encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode); +const hexEncode = (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`; -0 && (0); +const escapeUriPath = (uri) => uri.split("/").map(escapeUri).join("/"); +exports.escapeUri = escapeUri; +exports.escapeUriPath = escapeUriPath; /***/ }), /***/ 1577: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); -}; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; -}; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -// src/index.ts -var index_exports = {}; -__export(index_exports, { - fromUtf8: () => fromUtf8, - toUint8Array: () => toUint8Array, - toUtf8: () => toUtf8 -}); -module.exports = __toCommonJS(index_exports); +"use strict"; -// src/fromUtf8.ts -var import_util_buffer_from = __nccwpck_require__(4151); -var fromUtf8 = /* @__PURE__ */ __name((input) => { - const buf = (0, import_util_buffer_from.fromString)(input, "utf8"); - return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); -}, "fromUtf8"); -// src/toUint8Array.ts -var toUint8Array = /* @__PURE__ */ __name((data) => { - if (typeof data === "string") { - return fromUtf8(data); - } - if (ArrayBuffer.isView(data)) { - return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT); - } - return new Uint8Array(data); -}, "toUint8Array"); +var utilBufferFrom = __nccwpck_require__(4151); -// src/toUtf8.ts +const fromUtf8 = (input) => { + const buf = utilBufferFrom.fromString(input, "utf8"); + return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); +}; -var toUtf8 = /* @__PURE__ */ __name((input) => { - if (typeof input === "string") { - return input; - } - if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { - throw new Error("@smithy/util-utf8: toUtf8 encoder function only accepts string | Uint8Array."); - } - return (0, import_util_buffer_from.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); -}, "toUtf8"); -// Annotate the CommonJS export names for ESM import in node: +const toUint8Array = (data) => { + if (typeof data === "string") { + return fromUtf8(data); + } + if (ArrayBuffer.isView(data)) { + return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT); + } + return new Uint8Array(data); +}; -0 && (0); +const toUtf8 = (input) => { + if (typeof input === "string") { + return input; + } + if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { + throw new Error("@smithy/util-utf8: toUtf8 encoder function only accepts string | Uint8Array."); + } + return utilBufferFrom.fromArrayBuffer(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); +}; +exports.fromUtf8 = fromUtf8; +exports.toUint8Array = toUint8Array; +exports.toUtf8 = toUtf8; /***/ }), /***/ 5290: -/***/ ((module) => { +/***/ ((__unused_webpack_module, exports) => { -var __defProp = Object.defineProperty; -var __getOwnPropDesc = Object.getOwnPropertyDescriptor; -var __getOwnPropNames = Object.getOwnPropertyNames; -var __hasOwnProp = Object.prototype.hasOwnProperty; -var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); -var __export = (target, all) => { - for (var name in all) - __defProp(target, name, { get: all[name], enumerable: true }); +"use strict"; + + +const getCircularReplacer = () => { + const seen = new WeakSet(); + return (key, value) => { + if (typeof value === "object" && value !== null) { + if (seen.has(value)) { + return "[Circular]"; + } + seen.add(value); + } + return value; + }; }; -var __copyProps = (to, from, except, desc) => { - if (from && typeof from === "object" || typeof from === "function") { - for (let key of __getOwnPropNames(from)) - if (!__hasOwnProp.call(to, key) && key !== except) - __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); - } - return to; + +const sleep = (seconds) => { + return new Promise((resolve) => setTimeout(resolve, seconds * 1000)); +}; + +const waiterServiceDefaults = { + minDelay: 2, + maxDelay: 120, +}; +exports.WaiterState = void 0; +(function (WaiterState) { + WaiterState["ABORTED"] = "ABORTED"; + WaiterState["FAILURE"] = "FAILURE"; + WaiterState["SUCCESS"] = "SUCCESS"; + WaiterState["RETRY"] = "RETRY"; + WaiterState["TIMEOUT"] = "TIMEOUT"; +})(exports.WaiterState || (exports.WaiterState = {})); +const checkExceptions = (result) => { + if (result.state === exports.WaiterState.ABORTED) { + const abortError = new Error(`${JSON.stringify({ + ...result, + reason: "Request was aborted", + }, getCircularReplacer())}`); + abortError.name = "AbortError"; + throw abortError; + } + else if (result.state === exports.WaiterState.TIMEOUT) { + const timeoutError = new Error(`${JSON.stringify({ + ...result, + reason: "Waiter has timed out", + }, getCircularReplacer())}`); + timeoutError.name = "TimeoutError"; + throw timeoutError; + } + else if (result.state !== exports.WaiterState.SUCCESS) { + throw new Error(`${JSON.stringify(result, getCircularReplacer())}`); + } + return result; }; -var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); -// src/index.ts -var index_exports = {}; -__export(index_exports, { - WaiterState: () => WaiterState, - checkExceptions: () => checkExceptions, - createWaiter: () => createWaiter, - waiterServiceDefaults: () => waiterServiceDefaults -}); -module.exports = __toCommonJS(index_exports); - -// src/utils/sleep.ts -var sleep = /* @__PURE__ */ __name((seconds) => { - return new Promise((resolve) => setTimeout(resolve, seconds * 1e3)); -}, "sleep"); - -// src/waiter.ts -var waiterServiceDefaults = { - minDelay: 2, - maxDelay: 120 -}; -var WaiterState = /* @__PURE__ */ ((WaiterState2) => { - WaiterState2["ABORTED"] = "ABORTED"; - WaiterState2["FAILURE"] = "FAILURE"; - WaiterState2["SUCCESS"] = "SUCCESS"; - WaiterState2["RETRY"] = "RETRY"; - WaiterState2["TIMEOUT"] = "TIMEOUT"; - return WaiterState2; -})(WaiterState || {}); -var checkExceptions = /* @__PURE__ */ __name((result) => { - if (result.state === "ABORTED" /* ABORTED */) { - const abortError = new Error( - `${JSON.stringify({ - ...result, - reason: "Request was aborted" - })}` - ); - abortError.name = "AbortError"; - throw abortError; - } else if (result.state === "TIMEOUT" /* TIMEOUT */) { - const timeoutError = new Error( - `${JSON.stringify({ - ...result, - reason: "Waiter has timed out" - })}` - ); - timeoutError.name = "TimeoutError"; - throw timeoutError; - } else if (result.state !== "SUCCESS" /* SUCCESS */) { - throw new Error(`${JSON.stringify(result)}`); - } - return result; -}, "checkExceptions"); - -// src/poller.ts -var exponentialBackoffWithJitter = /* @__PURE__ */ __name((minDelay, maxDelay, attemptCeiling, attempt) => { - if (attempt > attemptCeiling) return maxDelay; - const delay = minDelay * 2 ** (attempt - 1); - return randomInRange(minDelay, delay); -}, "exponentialBackoffWithJitter"); -var randomInRange = /* @__PURE__ */ __name((min, max) => min + Math.random() * (max - min), "randomInRange"); -var runPolling = /* @__PURE__ */ __name(async ({ minDelay, maxDelay, maxWaitTime, abortController, client, abortSignal }, input, acceptorChecks) => { - const observedResponses = {}; - const { state, reason } = await acceptorChecks(client, input); - if (reason) { - const message = createMessageFromResponse(reason); - observedResponses[message] |= 0; - observedResponses[message] += 1; - } - if (state !== "RETRY" /* RETRY */) { - return { state, reason, observedResponses }; - } - let currentAttempt = 1; - const waitUntil = Date.now() + maxWaitTime * 1e3; - const attemptCeiling = Math.log(maxDelay / minDelay) / Math.log(2) + 1; - while (true) { - if (abortController?.signal?.aborted || abortSignal?.aborted) { - const message = "AbortController signal aborted."; - observedResponses[message] |= 0; - observedResponses[message] += 1; - return { state: "ABORTED" /* ABORTED */, observedResponses }; - } - const delay = exponentialBackoffWithJitter(minDelay, maxDelay, attemptCeiling, currentAttempt); - if (Date.now() + delay * 1e3 > waitUntil) { - return { state: "TIMEOUT" /* TIMEOUT */, observedResponses }; - } - await sleep(delay); - const { state: state2, reason: reason2 } = await acceptorChecks(client, input); - if (reason2) { - const message = createMessageFromResponse(reason2); - observedResponses[message] |= 0; - observedResponses[message] += 1; - } - if (state2 !== "RETRY" /* RETRY */) { - return { state: state2, reason: reason2, observedResponses }; - } - currentAttempt += 1; - } -}, "runPolling"); -var createMessageFromResponse = /* @__PURE__ */ __name((reason) => { - if (reason?.$responseBodyText) { - return `Deserialization error for body: ${reason.$responseBodyText}`; - } - if (reason?.$metadata?.httpStatusCode) { - if (reason.$response || reason.message) { - return `${reason.$response.statusCode ?? reason.$metadata.httpStatusCode ?? "Unknown"}: ${reason.message}`; - } - return `${reason.$metadata.httpStatusCode}: OK`; - } - return String(reason?.message ?? JSON.stringify(reason) ?? "Unknown"); -}, "createMessageFromResponse"); - -// src/utils/validate.ts -var validateWaiterOptions = /* @__PURE__ */ __name((options) => { - if (options.maxWaitTime <= 0) { - throw new Error(`WaiterConfiguration.maxWaitTime must be greater than 0`); - } else if (options.minDelay <= 0) { - throw new Error(`WaiterConfiguration.minDelay must be greater than 0`); - } else if (options.maxDelay <= 0) { - throw new Error(`WaiterConfiguration.maxDelay must be greater than 0`); - } else if (options.maxWaitTime <= options.minDelay) { - throw new Error( - `WaiterConfiguration.maxWaitTime [${options.maxWaitTime}] must be greater than WaiterConfiguration.minDelay [${options.minDelay}] for this waiter` - ); - } else if (options.maxDelay < options.minDelay) { - throw new Error( - `WaiterConfiguration.maxDelay [${options.maxDelay}] must be greater than WaiterConfiguration.minDelay [${options.minDelay}] for this waiter` - ); - } -}, "validateWaiterOptions"); +const exponentialBackoffWithJitter = (minDelay, maxDelay, attemptCeiling, attempt) => { + if (attempt > attemptCeiling) + return maxDelay; + const delay = minDelay * 2 ** (attempt - 1); + return randomInRange(minDelay, delay); +}; +const randomInRange = (min, max) => min + Math.random() * (max - min); +const runPolling = async ({ minDelay, maxDelay, maxWaitTime, abortController, client, abortSignal }, input, acceptorChecks) => { + const observedResponses = {}; + const { state, reason } = await acceptorChecks(client, input); + if (reason) { + const message = createMessageFromResponse(reason); + observedResponses[message] |= 0; + observedResponses[message] += 1; + } + if (state !== exports.WaiterState.RETRY) { + return { state, reason, observedResponses }; + } + let currentAttempt = 1; + const waitUntil = Date.now() + maxWaitTime * 1000; + const attemptCeiling = Math.log(maxDelay / minDelay) / Math.log(2) + 1; + while (true) { + if (abortController?.signal?.aborted || abortSignal?.aborted) { + const message = "AbortController signal aborted."; + observedResponses[message] |= 0; + observedResponses[message] += 1; + return { state: exports.WaiterState.ABORTED, observedResponses }; + } + const delay = exponentialBackoffWithJitter(minDelay, maxDelay, attemptCeiling, currentAttempt); + if (Date.now() + delay * 1000 > waitUntil) { + return { state: exports.WaiterState.TIMEOUT, observedResponses }; + } + await sleep(delay); + const { state, reason } = await acceptorChecks(client, input); + if (reason) { + const message = createMessageFromResponse(reason); + observedResponses[message] |= 0; + observedResponses[message] += 1; + } + if (state !== exports.WaiterState.RETRY) { + return { state, reason, observedResponses }; + } + currentAttempt += 1; + } +}; +const createMessageFromResponse = (reason) => { + if (reason?.$responseBodyText) { + return `Deserialization error for body: ${reason.$responseBodyText}`; + } + if (reason?.$metadata?.httpStatusCode) { + if (reason.$response || reason.message) { + return `${reason.$response.statusCode ?? reason.$metadata.httpStatusCode ?? "Unknown"}: ${reason.message}`; + } + return `${reason.$metadata.httpStatusCode}: OK`; + } + return String(reason?.message ?? JSON.stringify(reason, getCircularReplacer()) ?? "Unknown"); +}; -// src/createWaiter.ts -var abortTimeout = /* @__PURE__ */ __name((abortSignal) => { - let onAbort; - const promise = new Promise((resolve) => { - onAbort = /* @__PURE__ */ __name(() => resolve({ state: "ABORTED" /* ABORTED */ }), "onAbort"); - if (typeof abortSignal.addEventListener === "function") { - abortSignal.addEventListener("abort", onAbort); - } else { - abortSignal.onabort = onAbort; +const validateWaiterOptions = (options) => { + if (options.maxWaitTime <= 0) { + throw new Error(`WaiterConfiguration.maxWaitTime must be greater than 0`); } - }); - return { - clearListener() { - if (typeof abortSignal.removeEventListener === "function") { - abortSignal.removeEventListener("abort", onAbort); - } - }, - aborted: promise - }; -}, "abortTimeout"); -var createWaiter = /* @__PURE__ */ __name(async (options, input, acceptorChecks) => { - const params = { - ...waiterServiceDefaults, - ...options - }; - validateWaiterOptions(params); - const exitConditions = [runPolling(params, input, acceptorChecks)]; - const finalize = []; - if (options.abortSignal) { - const { aborted, clearListener } = abortTimeout(options.abortSignal); - finalize.push(clearListener); - exitConditions.push(aborted); - } - if (options.abortController?.signal) { - const { aborted, clearListener } = abortTimeout(options.abortController.signal); - finalize.push(clearListener); - exitConditions.push(aborted); - } - return Promise.race(exitConditions).then((result) => { - for (const fn of finalize) { - fn(); + else if (options.minDelay <= 0) { + throw new Error(`WaiterConfiguration.minDelay must be greater than 0`); } - return result; - }); -}, "createWaiter"); -// Annotate the CommonJS export names for ESM import in node: + else if (options.maxDelay <= 0) { + throw new Error(`WaiterConfiguration.maxDelay must be greater than 0`); + } + else if (options.maxWaitTime <= options.minDelay) { + throw new Error(`WaiterConfiguration.maxWaitTime [${options.maxWaitTime}] must be greater than WaiterConfiguration.minDelay [${options.minDelay}] for this waiter`); + } + else if (options.maxDelay < options.minDelay) { + throw new Error(`WaiterConfiguration.maxDelay [${options.maxDelay}] must be greater than WaiterConfiguration.minDelay [${options.minDelay}] for this waiter`); + } +}; -0 && (0); +const abortTimeout = (abortSignal) => { + let onAbort; + const promise = new Promise((resolve) => { + onAbort = () => resolve({ state: exports.WaiterState.ABORTED }); + if (typeof abortSignal.addEventListener === "function") { + abortSignal.addEventListener("abort", onAbort); + } + else { + abortSignal.onabort = onAbort; + } + }); + return { + clearListener() { + if (typeof abortSignal.removeEventListener === "function") { + abortSignal.removeEventListener("abort", onAbort); + } + }, + aborted: promise, + }; +}; +const createWaiter = async (options, input, acceptorChecks) => { + const params = { + ...waiterServiceDefaults, + ...options, + }; + validateWaiterOptions(params); + const exitConditions = [runPolling(params, input, acceptorChecks)]; + const finalize = []; + if (options.abortSignal) { + const { aborted, clearListener } = abortTimeout(options.abortSignal); + finalize.push(clearListener); + exitConditions.push(aborted); + } + if (options.abortController?.signal) { + const { aborted, clearListener } = abortTimeout(options.abortController.signal); + finalize.push(clearListener); + exitConditions.push(aborted); + } + return Promise.race(exitConditions).then((result) => { + for (const fn of finalize) { + fn(); + } + return result; + }); +}; + +exports.checkExceptions = checkExceptions; +exports.createWaiter = createWaiter; +exports.waiterServiceDefaults = waiterServiceDefaults; +/***/ }), + +/***/ 266: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +var randomUUID = __nccwpck_require__(8492); + +const decimalToHex = Array.from({ length: 256 }, (_, i) => i.toString(16).padStart(2, "0")); +const v4 = () => { + if (randomUUID.randomUUID) { + return randomUUID.randomUUID(); + } + const rnds = new Uint8Array(16); + crypto.getRandomValues(rnds); + rnds[6] = (rnds[6] & 0x0f) | 0x40; + rnds[8] = (rnds[8] & 0x3f) | 0x80; + return (decimalToHex[rnds[0]] + + decimalToHex[rnds[1]] + + decimalToHex[rnds[2]] + + decimalToHex[rnds[3]] + + "-" + + decimalToHex[rnds[4]] + + decimalToHex[rnds[5]] + + "-" + + decimalToHex[rnds[6]] + + decimalToHex[rnds[7]] + + "-" + + decimalToHex[rnds[8]] + + decimalToHex[rnds[9]] + + "-" + + decimalToHex[rnds[10]] + + decimalToHex[rnds[11]] + + decimalToHex[rnds[12]] + + decimalToHex[rnds[13]] + + decimalToHex[rnds[14]] + + decimalToHex[rnds[15]]); +}; + +exports.v4 = v4; + + +/***/ }), + +/***/ 8492: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.randomUUID = void 0; +const tslib_1 = __nccwpck_require__(1860); +const crypto_1 = tslib_1.__importDefault(__nccwpck_require__(6982)); +exports.randomUUID = crypto_1.default.randomUUID.bind(crypto_1.default); + /***/ }), @@ -56375,687 +49346,6 @@ module.exports = { } -/***/ }), - -/***/ 2048: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -Object.defineProperty(exports, "NIL", ({ - enumerable: true, - get: function () { - return _nil.default; - } -})); -Object.defineProperty(exports, "parse", ({ - enumerable: true, - get: function () { - return _parse.default; - } -})); -Object.defineProperty(exports, "stringify", ({ - enumerable: true, - get: function () { - return _stringify.default; - } -})); -Object.defineProperty(exports, "v1", ({ - enumerable: true, - get: function () { - return _v.default; - } -})); -Object.defineProperty(exports, "v3", ({ - enumerable: true, - get: function () { - return _v2.default; - } -})); -Object.defineProperty(exports, "v4", ({ - enumerable: true, - get: function () { - return _v3.default; - } -})); -Object.defineProperty(exports, "v5", ({ - enumerable: true, - get: function () { - return _v4.default; - } -})); -Object.defineProperty(exports, "validate", ({ - enumerable: true, - get: function () { - return _validate.default; - } -})); -Object.defineProperty(exports, "version", ({ - enumerable: true, - get: function () { - return _version.default; - } -})); - -var _v = _interopRequireDefault(__nccwpck_require__(6415)); - -var _v2 = _interopRequireDefault(__nccwpck_require__(1697)); - -var _v3 = _interopRequireDefault(__nccwpck_require__(4676)); - -var _v4 = _interopRequireDefault(__nccwpck_require__(9771)); - -var _nil = _interopRequireDefault(__nccwpck_require__(7723)); - -var _version = _interopRequireDefault(__nccwpck_require__(5868)); - -var _validate = _interopRequireDefault(__nccwpck_require__(6200)); - -var _stringify = _interopRequireDefault(__nccwpck_require__(7597)); - -var _parse = _interopRequireDefault(__nccwpck_require__(7267)); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -/***/ }), - -/***/ 216: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; - -var _crypto = _interopRequireDefault(__nccwpck_require__(6982)); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -function md5(bytes) { - if (Array.isArray(bytes)) { - bytes = Buffer.from(bytes); - } else if (typeof bytes === 'string') { - bytes = Buffer.from(bytes, 'utf8'); - } - - return _crypto.default.createHash('md5').update(bytes).digest(); -} - -var _default = md5; -exports["default"] = _default; - -/***/ }), - -/***/ 4221: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; - -var _crypto = _interopRequireDefault(__nccwpck_require__(6982)); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -var _default = { - randomUUID: _crypto.default.randomUUID -}; -exports["default"] = _default; - -/***/ }), - -/***/ 7723: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; -var _default = '00000000-0000-0000-0000-000000000000'; -exports["default"] = _default; - -/***/ }), - -/***/ 7267: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; - -var _validate = _interopRequireDefault(__nccwpck_require__(6200)); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -function parse(uuid) { - if (!(0, _validate.default)(uuid)) { - throw TypeError('Invalid UUID'); - } - - let v; - const arr = new Uint8Array(16); // Parse ########-....-....-....-............ - - arr[0] = (v = parseInt(uuid.slice(0, 8), 16)) >>> 24; - arr[1] = v >>> 16 & 0xff; - arr[2] = v >>> 8 & 0xff; - arr[3] = v & 0xff; // Parse ........-####-....-....-............ - - arr[4] = (v = parseInt(uuid.slice(9, 13), 16)) >>> 8; - arr[5] = v & 0xff; // Parse ........-....-####-....-............ - - arr[6] = (v = parseInt(uuid.slice(14, 18), 16)) >>> 8; - arr[7] = v & 0xff; // Parse ........-....-....-####-............ - - arr[8] = (v = parseInt(uuid.slice(19, 23), 16)) >>> 8; - arr[9] = v & 0xff; // Parse ........-....-....-....-############ - // (Use "/" to avoid 32-bit truncation when bit-shifting high-order bytes) - - arr[10] = (v = parseInt(uuid.slice(24, 36), 16)) / 0x10000000000 & 0xff; - arr[11] = v / 0x100000000 & 0xff; - arr[12] = v >>> 24 & 0xff; - arr[13] = v >>> 16 & 0xff; - arr[14] = v >>> 8 & 0xff; - arr[15] = v & 0xff; - return arr; -} - -var _default = parse; -exports["default"] = _default; - -/***/ }), - -/***/ 7879: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; -var _default = /^(?:[0-9a-f]{8}-[0-9a-f]{4}-[1-5][0-9a-f]{3}-[89ab][0-9a-f]{3}-[0-9a-f]{12}|00000000-0000-0000-0000-000000000000)$/i; -exports["default"] = _default; - -/***/ }), - -/***/ 2973: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = rng; - -var _crypto = _interopRequireDefault(__nccwpck_require__(6982)); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -const rnds8Pool = new Uint8Array(256); // # of random values to pre-allocate - -let poolPtr = rnds8Pool.length; - -function rng() { - if (poolPtr > rnds8Pool.length - 16) { - _crypto.default.randomFillSync(rnds8Pool); - - poolPtr = 0; - } - - return rnds8Pool.slice(poolPtr, poolPtr += 16); -} - -/***/ }), - -/***/ 507: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; - -var _crypto = _interopRequireDefault(__nccwpck_require__(6982)); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -function sha1(bytes) { - if (Array.isArray(bytes)) { - bytes = Buffer.from(bytes); - } else if (typeof bytes === 'string') { - bytes = Buffer.from(bytes, 'utf8'); - } - - return _crypto.default.createHash('sha1').update(bytes).digest(); -} - -var _default = sha1; -exports["default"] = _default; - -/***/ }), - -/***/ 7597: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; -exports.unsafeStringify = unsafeStringify; - -var _validate = _interopRequireDefault(__nccwpck_require__(6200)); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -/** - * Convert array of 16 byte values to UUID string format of the form: - * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX - */ -const byteToHex = []; - -for (let i = 0; i < 256; ++i) { - byteToHex.push((i + 0x100).toString(16).slice(1)); -} - -function unsafeStringify(arr, offset = 0) { - // Note: Be careful editing this code! It's been tuned for performance - // and works in ways you may not expect. See https://github.com/uuidjs/uuid/pull/434 - return byteToHex[arr[offset + 0]] + byteToHex[arr[offset + 1]] + byteToHex[arr[offset + 2]] + byteToHex[arr[offset + 3]] + '-' + byteToHex[arr[offset + 4]] + byteToHex[arr[offset + 5]] + '-' + byteToHex[arr[offset + 6]] + byteToHex[arr[offset + 7]] + '-' + byteToHex[arr[offset + 8]] + byteToHex[arr[offset + 9]] + '-' + byteToHex[arr[offset + 10]] + byteToHex[arr[offset + 11]] + byteToHex[arr[offset + 12]] + byteToHex[arr[offset + 13]] + byteToHex[arr[offset + 14]] + byteToHex[arr[offset + 15]]; -} - -function stringify(arr, offset = 0) { - const uuid = unsafeStringify(arr, offset); // Consistency check for valid UUID. If this throws, it's likely due to one - // of the following: - // - One or more input array values don't map to a hex octet (leading to - // "undefined" in the uuid) - // - Invalid input values for the RFC `version` or `variant` fields - - if (!(0, _validate.default)(uuid)) { - throw TypeError('Stringified UUID is invalid'); - } - - return uuid; -} - -var _default = stringify; -exports["default"] = _default; - -/***/ }), - -/***/ 6415: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; - -var _rng = _interopRequireDefault(__nccwpck_require__(2973)); - -var _stringify = __nccwpck_require__(7597); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -// **`v1()` - Generate time-based UUID** -// -// Inspired by https://github.com/LiosK/UUID.js -// and http://docs.python.org/library/uuid.html -let _nodeId; - -let _clockseq; // Previous uuid creation time - - -let _lastMSecs = 0; -let _lastNSecs = 0; // See https://github.com/uuidjs/uuid for API details - -function v1(options, buf, offset) { - let i = buf && offset || 0; - const b = buf || new Array(16); - options = options || {}; - let node = options.node || _nodeId; - let clockseq = options.clockseq !== undefined ? options.clockseq : _clockseq; // node and clockseq need to be initialized to random values if they're not - // specified. We do this lazily to minimize issues related to insufficient - // system entropy. See #189 - - if (node == null || clockseq == null) { - const seedBytes = options.random || (options.rng || _rng.default)(); - - if (node == null) { - // Per 4.5, create and 48-bit node id, (47 random bits + multicast bit = 1) - node = _nodeId = [seedBytes[0] | 0x01, seedBytes[1], seedBytes[2], seedBytes[3], seedBytes[4], seedBytes[5]]; - } - - if (clockseq == null) { - // Per 4.2.2, randomize (14 bit) clockseq - clockseq = _clockseq = (seedBytes[6] << 8 | seedBytes[7]) & 0x3fff; - } - } // UUID timestamps are 100 nano-second units since the Gregorian epoch, - // (1582-10-15 00:00). JSNumbers aren't precise enough for this, so - // time is handled internally as 'msecs' (integer milliseconds) and 'nsecs' - // (100-nanoseconds offset from msecs) since unix epoch, 1970-01-01 00:00. - - - let msecs = options.msecs !== undefined ? options.msecs : Date.now(); // Per 4.2.1.2, use count of uuid's generated during the current clock - // cycle to simulate higher resolution clock - - let nsecs = options.nsecs !== undefined ? options.nsecs : _lastNSecs + 1; // Time since last uuid creation (in msecs) - - const dt = msecs - _lastMSecs + (nsecs - _lastNSecs) / 10000; // Per 4.2.1.2, Bump clockseq on clock regression - - if (dt < 0 && options.clockseq === undefined) { - clockseq = clockseq + 1 & 0x3fff; - } // Reset nsecs if clock regresses (new clockseq) or we've moved onto a new - // time interval - - - if ((dt < 0 || msecs > _lastMSecs) && options.nsecs === undefined) { - nsecs = 0; - } // Per 4.2.1.2 Throw error if too many uuids are requested - - - if (nsecs >= 10000) { - throw new Error("uuid.v1(): Can't create more than 10M uuids/sec"); - } - - _lastMSecs = msecs; - _lastNSecs = nsecs; - _clockseq = clockseq; // Per 4.1.4 - Convert from unix epoch to Gregorian epoch - - msecs += 12219292800000; // `time_low` - - const tl = ((msecs & 0xfffffff) * 10000 + nsecs) % 0x100000000; - b[i++] = tl >>> 24 & 0xff; - b[i++] = tl >>> 16 & 0xff; - b[i++] = tl >>> 8 & 0xff; - b[i++] = tl & 0xff; // `time_mid` - - const tmh = msecs / 0x100000000 * 10000 & 0xfffffff; - b[i++] = tmh >>> 8 & 0xff; - b[i++] = tmh & 0xff; // `time_high_and_version` - - b[i++] = tmh >>> 24 & 0xf | 0x10; // include version - - b[i++] = tmh >>> 16 & 0xff; // `clock_seq_hi_and_reserved` (Per 4.2.2 - include variant) - - b[i++] = clockseq >>> 8 | 0x80; // `clock_seq_low` - - b[i++] = clockseq & 0xff; // `node` - - for (let n = 0; n < 6; ++n) { - b[i + n] = node[n]; - } - - return buf || (0, _stringify.unsafeStringify)(b); -} - -var _default = v1; -exports["default"] = _default; - -/***/ }), - -/***/ 1697: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; - -var _v = _interopRequireDefault(__nccwpck_require__(2930)); - -var _md = _interopRequireDefault(__nccwpck_require__(216)); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -const v3 = (0, _v.default)('v3', 0x30, _md.default); -var _default = v3; -exports["default"] = _default; - -/***/ }), - -/***/ 2930: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports.URL = exports.DNS = void 0; -exports["default"] = v35; - -var _stringify = __nccwpck_require__(7597); - -var _parse = _interopRequireDefault(__nccwpck_require__(7267)); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -function stringToBytes(str) { - str = unescape(encodeURIComponent(str)); // UTF8 escape - - const bytes = []; - - for (let i = 0; i < str.length; ++i) { - bytes.push(str.charCodeAt(i)); - } - - return bytes; -} - -const DNS = '6ba7b810-9dad-11d1-80b4-00c04fd430c8'; -exports.DNS = DNS; -const URL = '6ba7b811-9dad-11d1-80b4-00c04fd430c8'; -exports.URL = URL; - -function v35(name, version, hashfunc) { - function generateUUID(value, namespace, buf, offset) { - var _namespace; - - if (typeof value === 'string') { - value = stringToBytes(value); - } - - if (typeof namespace === 'string') { - namespace = (0, _parse.default)(namespace); - } - - if (((_namespace = namespace) === null || _namespace === void 0 ? void 0 : _namespace.length) !== 16) { - throw TypeError('Namespace must be array-like (16 iterable integer values, 0-255)'); - } // Compute hash of namespace and value, Per 4.3 - // Future: Use spread syntax when supported on all platforms, e.g. `bytes = - // hashfunc([...namespace, ... value])` - - - let bytes = new Uint8Array(16 + value.length); - bytes.set(namespace); - bytes.set(value, namespace.length); - bytes = hashfunc(bytes); - bytes[6] = bytes[6] & 0x0f | version; - bytes[8] = bytes[8] & 0x3f | 0x80; - - if (buf) { - offset = offset || 0; - - for (let i = 0; i < 16; ++i) { - buf[offset + i] = bytes[i]; - } - - return buf; - } - - return (0, _stringify.unsafeStringify)(bytes); - } // Function#name is not settable on some platforms (#270) - - - try { - generateUUID.name = name; // eslint-disable-next-line no-empty - } catch (err) {} // For CommonJS default export support - - - generateUUID.DNS = DNS; - generateUUID.URL = URL; - return generateUUID; -} - -/***/ }), - -/***/ 4676: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; - -var _native = _interopRequireDefault(__nccwpck_require__(4221)); - -var _rng = _interopRequireDefault(__nccwpck_require__(2973)); - -var _stringify = __nccwpck_require__(7597); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -function v4(options, buf, offset) { - if (_native.default.randomUUID && !buf && !options) { - return _native.default.randomUUID(); - } - - options = options || {}; - - const rnds = options.random || (options.rng || _rng.default)(); // Per 4.4, set bits for version and `clock_seq_hi_and_reserved` - - - rnds[6] = rnds[6] & 0x0f | 0x40; - rnds[8] = rnds[8] & 0x3f | 0x80; // Copy bytes to buffer, if provided - - if (buf) { - offset = offset || 0; - - for (let i = 0; i < 16; ++i) { - buf[offset + i] = rnds[i]; - } - - return buf; - } - - return (0, _stringify.unsafeStringify)(rnds); -} - -var _default = v4; -exports["default"] = _default; - -/***/ }), - -/***/ 9771: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; - -var _v = _interopRequireDefault(__nccwpck_require__(2930)); - -var _sha = _interopRequireDefault(__nccwpck_require__(507)); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -const v5 = (0, _v.default)('v5', 0x50, _sha.default); -var _default = v5; -exports["default"] = _default; - -/***/ }), - -/***/ 6200: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; - -var _regex = _interopRequireDefault(__nccwpck_require__(7879)); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -function validate(uuid) { - return typeof uuid === 'string' && _regex.default.test(uuid); -} - -var _default = validate; -exports["default"] = _default; - -/***/ }), - -/***/ 5868: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; - -var _validate = _interopRequireDefault(__nccwpck_require__(6200)); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -function version(uuid) { - if (!(0, _validate.default)(uuid)) { - throw TypeError('Invalid UUID'); - } - - return parseInt(uuid.slice(14, 15), 16); -} - -var _default = version; -exports["default"] = _default; - /***/ }), /***/ 2613: @@ -57186,6 +49476,14 @@ module.exports = require("node:events"); /***/ }), +/***/ 3024: +/***/ ((module) => { + +"use strict"; +module.exports = require("node:fs"); + +/***/ }), + /***/ 7075: /***/ ((module) => { @@ -58958,23 +51256,7 @@ module.exports = parseParams /***/ ((module) => { "use strict"; -module.exports = /*#__PURE__*/JSON.parse('{"name":"@aws-sdk/client-ecs","description":"AWS SDK for JavaScript Ecs Client for Node.js, Browser and React Native","version":"3.890.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"node ../../scripts/compilation/inline client-ecs","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo ecs"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"5.2.0","@aws-crypto/sha256-js":"5.2.0","@aws-sdk/core":"3.890.0","@aws-sdk/credential-provider-node":"3.890.0","@aws-sdk/middleware-host-header":"3.887.0","@aws-sdk/middleware-logger":"3.887.0","@aws-sdk/middleware-recursion-detection":"3.887.0","@aws-sdk/middleware-user-agent":"3.890.0","@aws-sdk/region-config-resolver":"3.890.0","@aws-sdk/types":"3.887.0","@aws-sdk/util-endpoints":"3.890.0","@aws-sdk/util-user-agent-browser":"3.887.0","@aws-sdk/util-user-agent-node":"3.890.0","@smithy/config-resolver":"^4.2.2","@smithy/core":"^3.11.0","@smithy/fetch-http-handler":"^5.2.1","@smithy/hash-node":"^4.1.1","@smithy/invalid-dependency":"^4.1.1","@smithy/middleware-content-length":"^4.1.1","@smithy/middleware-endpoint":"^4.2.2","@smithy/middleware-retry":"^4.2.2","@smithy/middleware-serde":"^4.1.1","@smithy/middleware-stack":"^4.1.1","@smithy/node-config-provider":"^4.2.2","@smithy/node-http-handler":"^4.2.1","@smithy/protocol-http":"^5.2.1","@smithy/smithy-client":"^4.6.2","@smithy/types":"^4.5.0","@smithy/url-parser":"^4.1.1","@smithy/util-base64":"^4.1.0","@smithy/util-body-length-browser":"^4.1.0","@smithy/util-body-length-node":"^4.1.0","@smithy/util-defaults-mode-browser":"^4.1.2","@smithy/util-defaults-mode-node":"^4.1.2","@smithy/util-endpoints":"^3.1.2","@smithy/util-middleware":"^4.1.1","@smithy/util-retry":"^4.1.1","@smithy/util-utf8":"^4.1.0","@smithy/util-waiter":"^4.1.1","@types/uuid":"^9.0.1","tslib":"^2.6.2","uuid":"^9.0.1"},"devDependencies":{"@tsconfig/node18":"18.2.4","@types/node":"^18.19.69","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typescript":"~5.8.3"},"engines":{"node":">=18.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-ecs","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-ecs"}}'); - -/***/ }), - -/***/ 5188: -/***/ ((module) => { - -"use strict"; -module.exports = /*#__PURE__*/JSON.parse('{"name":"@aws-sdk/client-sso","description":"AWS SDK for JavaScript Sso Client for Node.js, Browser and React Native","version":"3.890.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"node ../../scripts/compilation/inline client-sso","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo sso"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"5.2.0","@aws-crypto/sha256-js":"5.2.0","@aws-sdk/core":"3.890.0","@aws-sdk/middleware-host-header":"3.887.0","@aws-sdk/middleware-logger":"3.887.0","@aws-sdk/middleware-recursion-detection":"3.887.0","@aws-sdk/middleware-user-agent":"3.890.0","@aws-sdk/region-config-resolver":"3.890.0","@aws-sdk/types":"3.887.0","@aws-sdk/util-endpoints":"3.890.0","@aws-sdk/util-user-agent-browser":"3.887.0","@aws-sdk/util-user-agent-node":"3.890.0","@smithy/config-resolver":"^4.2.2","@smithy/core":"^3.11.0","@smithy/fetch-http-handler":"^5.2.1","@smithy/hash-node":"^4.1.1","@smithy/invalid-dependency":"^4.1.1","@smithy/middleware-content-length":"^4.1.1","@smithy/middleware-endpoint":"^4.2.2","@smithy/middleware-retry":"^4.2.2","@smithy/middleware-serde":"^4.1.1","@smithy/middleware-stack":"^4.1.1","@smithy/node-config-provider":"^4.2.2","@smithy/node-http-handler":"^4.2.1","@smithy/protocol-http":"^5.2.1","@smithy/smithy-client":"^4.6.2","@smithy/types":"^4.5.0","@smithy/url-parser":"^4.1.1","@smithy/util-base64":"^4.1.0","@smithy/util-body-length-browser":"^4.1.0","@smithy/util-body-length-node":"^4.1.0","@smithy/util-defaults-mode-browser":"^4.1.2","@smithy/util-defaults-mode-node":"^4.1.2","@smithy/util-endpoints":"^3.1.2","@smithy/util-middleware":"^4.1.1","@smithy/util-retry":"^4.1.1","@smithy/util-utf8":"^4.1.0","tslib":"^2.6.2"},"devDependencies":{"@tsconfig/node18":"18.2.4","@types/node":"^18.19.69","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typescript":"~5.8.3"},"engines":{"node":">=18.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sso","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sso"}}'); - -/***/ }), - -/***/ 9955: -/***/ ((module) => { - -"use strict"; -module.exports = /*#__PURE__*/JSON.parse('{"name":"@aws-sdk/nested-clients","version":"3.890.0","description":"Nested clients for AWS SDK packages.","main":"./dist-cjs/index.js","module":"./dist-es/index.js","types":"./dist-types/index.d.ts","scripts":{"build":"yarn lint && concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"node ../../scripts/compilation/inline nested-clients","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","lint":"node ../../scripts/validation/submodules-linter.js --pkg nested-clients","test":"yarn g:vitest run","test:watch":"yarn g:vitest watch"},"engines":{"node":">=18.0.0"},"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","dependencies":{"@aws-crypto/sha256-browser":"5.2.0","@aws-crypto/sha256-js":"5.2.0","@aws-sdk/core":"3.890.0","@aws-sdk/middleware-host-header":"3.887.0","@aws-sdk/middleware-logger":"3.887.0","@aws-sdk/middleware-recursion-detection":"3.887.0","@aws-sdk/middleware-user-agent":"3.890.0","@aws-sdk/region-config-resolver":"3.890.0","@aws-sdk/types":"3.887.0","@aws-sdk/util-endpoints":"3.890.0","@aws-sdk/util-user-agent-browser":"3.887.0","@aws-sdk/util-user-agent-node":"3.890.0","@smithy/config-resolver":"^4.2.2","@smithy/core":"^3.11.0","@smithy/fetch-http-handler":"^5.2.1","@smithy/hash-node":"^4.1.1","@smithy/invalid-dependency":"^4.1.1","@smithy/middleware-content-length":"^4.1.1","@smithy/middleware-endpoint":"^4.2.2","@smithy/middleware-retry":"^4.2.2","@smithy/middleware-serde":"^4.1.1","@smithy/middleware-stack":"^4.1.1","@smithy/node-config-provider":"^4.2.2","@smithy/node-http-handler":"^4.2.1","@smithy/protocol-http":"^5.2.1","@smithy/smithy-client":"^4.6.2","@smithy/types":"^4.5.0","@smithy/url-parser":"^4.1.1","@smithy/util-base64":"^4.1.0","@smithy/util-body-length-browser":"^4.1.0","@smithy/util-body-length-node":"^4.1.0","@smithy/util-defaults-mode-browser":"^4.1.2","@smithy/util-defaults-mode-node":"^4.1.2","@smithy/util-endpoints":"^3.1.2","@smithy/util-middleware":"^4.1.1","@smithy/util-retry":"^4.1.1","@smithy/util-utf8":"^4.1.0","tslib":"^2.6.2"},"devDependencies":{"concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typescript":"~5.8.3"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["./sso-oidc.d.ts","./sso-oidc.js","./sts.d.ts","./sts.js","dist-*/**"],"browser":{"./dist-es/submodules/sso-oidc/runtimeConfig":"./dist-es/submodules/sso-oidc/runtimeConfig.browser","./dist-es/submodules/sts/runtimeConfig":"./dist-es/submodules/sts/runtimeConfig.browser"},"react-native":{},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/packages/nested-clients","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"packages/nested-clients"},"exports":{"./sso-oidc":{"types":"./dist-types/submodules/sso-oidc/index.d.ts","module":"./dist-es/submodules/sso-oidc/index.js","node":"./dist-cjs/submodules/sso-oidc/index.js","import":"./dist-es/submodules/sso-oidc/index.js","require":"./dist-cjs/submodules/sso-oidc/index.js"},"./sts":{"types":"./dist-types/submodules/sts/index.d.ts","module":"./dist-es/submodules/sts/index.js","node":"./dist-cjs/submodules/sts/index.js","import":"./dist-es/submodules/sts/index.js","require":"./dist-cjs/submodules/sts/index.js"}}}'); +module.exports = /*#__PURE__*/JSON.parse('{"name":"@aws-sdk/client-ecs","description":"AWS SDK for JavaScript Ecs Client for Node.js, Browser and React Native","version":"3.923.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"node ../../scripts/compilation/inline client-ecs","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo ecs"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"5.2.0","@aws-crypto/sha256-js":"5.2.0","@aws-sdk/core":"3.922.0","@aws-sdk/credential-provider-node":"3.922.0","@aws-sdk/middleware-host-header":"3.922.0","@aws-sdk/middleware-logger":"3.922.0","@aws-sdk/middleware-recursion-detection":"3.922.0","@aws-sdk/middleware-user-agent":"3.922.0","@aws-sdk/region-config-resolver":"3.922.0","@aws-sdk/types":"3.922.0","@aws-sdk/util-endpoints":"3.922.0","@aws-sdk/util-user-agent-browser":"3.922.0","@aws-sdk/util-user-agent-node":"3.922.0","@smithy/config-resolver":"^4.4.1","@smithy/core":"^3.17.2","@smithy/fetch-http-handler":"^5.3.5","@smithy/hash-node":"^4.2.4","@smithy/invalid-dependency":"^4.2.4","@smithy/middleware-content-length":"^4.2.4","@smithy/middleware-endpoint":"^4.3.6","@smithy/middleware-retry":"^4.4.6","@smithy/middleware-serde":"^4.2.4","@smithy/middleware-stack":"^4.2.4","@smithy/node-config-provider":"^4.3.4","@smithy/node-http-handler":"^4.4.4","@smithy/protocol-http":"^5.3.4","@smithy/smithy-client":"^4.9.2","@smithy/types":"^4.8.1","@smithy/url-parser":"^4.2.4","@smithy/util-base64":"^4.3.0","@smithy/util-body-length-browser":"^4.2.0","@smithy/util-body-length-node":"^4.2.1","@smithy/util-defaults-mode-browser":"^4.3.5","@smithy/util-defaults-mode-node":"^4.2.7","@smithy/util-endpoints":"^3.2.4","@smithy/util-middleware":"^4.2.4","@smithy/util-retry":"^4.2.4","@smithy/util-utf8":"^4.2.0","@smithy/util-waiter":"^4.2.4","@smithy/uuid":"^1.1.0","tslib":"^2.6.2"},"devDependencies":{"@tsconfig/node18":"18.2.4","@types/node":"^18.19.69","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typescript":"~5.8.3"},"engines":{"node":">=18.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-ecs","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-ecs"}}'); /***/ }) @@ -59010,11 +51292,136 @@ module.exports = /*#__PURE__*/JSON.parse('{"name":"@aws-sdk/nested-clients","ver /******/ return module.exports; /******/ } /******/ +/******/ // expose the modules object (__webpack_modules__) +/******/ __nccwpck_require__.m = __webpack_modules__; +/******/ /************************************************************************/ +/******/ /* webpack/runtime/create fake namespace object */ +/******/ (() => { +/******/ var getProto = Object.getPrototypeOf ? (obj) => (Object.getPrototypeOf(obj)) : (obj) => (obj.__proto__); +/******/ var leafPrototypes; +/******/ // create a fake namespace object +/******/ // mode & 1: value is a module id, require it +/******/ // mode & 2: merge all properties of value into the ns +/******/ // mode & 4: return value when already ns object +/******/ // mode & 16: return value when it's Promise-like +/******/ // mode & 8|1: behave like require +/******/ __nccwpck_require__.t = function(value, mode) { +/******/ if(mode & 1) value = this(value); +/******/ if(mode & 8) return value; +/******/ if(typeof value === 'object' && value) { +/******/ if((mode & 4) && value.__esModule) return value; +/******/ if((mode & 16) && typeof value.then === 'function') return value; +/******/ } +/******/ var ns = Object.create(null); +/******/ __nccwpck_require__.r(ns); +/******/ var def = {}; +/******/ leafPrototypes = leafPrototypes || [null, getProto({}), getProto([]), getProto(getProto)]; +/******/ for(var current = mode & 2 && value; typeof current == 'object' && !~leafPrototypes.indexOf(current); current = getProto(current)) { +/******/ Object.getOwnPropertyNames(current).forEach((key) => (def[key] = () => (value[key]))); +/******/ } +/******/ def['default'] = () => (value); +/******/ __nccwpck_require__.d(ns, def); +/******/ return ns; +/******/ }; +/******/ })(); +/******/ +/******/ /* webpack/runtime/define property getters */ +/******/ (() => { +/******/ // define getter functions for harmony exports +/******/ __nccwpck_require__.d = (exports, definition) => { +/******/ for(var key in definition) { +/******/ if(__nccwpck_require__.o(definition, key) && !__nccwpck_require__.o(exports, key)) { +/******/ Object.defineProperty(exports, key, { enumerable: true, get: definition[key] }); +/******/ } +/******/ } +/******/ }; +/******/ })(); +/******/ +/******/ /* webpack/runtime/ensure chunk */ +/******/ (() => { +/******/ __nccwpck_require__.f = {}; +/******/ // This file contains only the entry chunk. +/******/ // The chunk loading function for additional chunks +/******/ __nccwpck_require__.e = (chunkId) => { +/******/ return Promise.all(Object.keys(__nccwpck_require__.f).reduce((promises, key) => { +/******/ __nccwpck_require__.f[key](chunkId, promises); +/******/ return promises; +/******/ }, [])); +/******/ }; +/******/ })(); +/******/ +/******/ /* webpack/runtime/get javascript chunk filename */ +/******/ (() => { +/******/ // This function allow to reference async chunks +/******/ __nccwpck_require__.u = (chunkId) => { +/******/ // return url for filenames based on template +/******/ return "" + chunkId + ".index.js"; +/******/ }; +/******/ })(); +/******/ +/******/ /* webpack/runtime/hasOwnProperty shorthand */ +/******/ (() => { +/******/ __nccwpck_require__.o = (obj, prop) => (Object.prototype.hasOwnProperty.call(obj, prop)) +/******/ })(); +/******/ +/******/ /* webpack/runtime/make namespace object */ +/******/ (() => { +/******/ // define __esModule on exports +/******/ __nccwpck_require__.r = (exports) => { +/******/ if(typeof Symbol !== 'undefined' && Symbol.toStringTag) { +/******/ Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' }); +/******/ } +/******/ Object.defineProperty(exports, '__esModule', { value: true }); +/******/ }; +/******/ })(); +/******/ /******/ /* webpack/runtime/compat */ /******/ /******/ if (typeof __nccwpck_require__ !== 'undefined') __nccwpck_require__.ab = __dirname + "/"; /******/ +/******/ /* webpack/runtime/require chunk loading */ +/******/ (() => { +/******/ // no baseURI +/******/ +/******/ // object to store loaded chunks +/******/ // "1" means "loaded", otherwise not loaded yet +/******/ var installedChunks = { +/******/ 792: 1 +/******/ }; +/******/ +/******/ // no on chunks loaded +/******/ +/******/ var installChunk = (chunk) => { +/******/ var moreModules = chunk.modules, chunkIds = chunk.ids, runtime = chunk.runtime; +/******/ for(var moduleId in moreModules) { +/******/ if(__nccwpck_require__.o(moreModules, moduleId)) { +/******/ __nccwpck_require__.m[moduleId] = moreModules[moduleId]; +/******/ } +/******/ } +/******/ if(runtime) runtime(__nccwpck_require__); +/******/ for(var i = 0; i < chunkIds.length; i++) +/******/ installedChunks[chunkIds[i]] = 1; +/******/ +/******/ }; +/******/ +/******/ // require() chunk loading for javascript +/******/ __nccwpck_require__.f.require = (chunkId, promises) => { +/******/ // "1" is the signal for "already loaded" +/******/ if(!installedChunks[chunkId]) { +/******/ if(true) { // all chunks have JS +/******/ installChunk(require("./" + __nccwpck_require__.u(chunkId))); +/******/ } else installedChunks[chunkId] = 1; +/******/ } +/******/ }; +/******/ +/******/ // no external install chunk +/******/ +/******/ // no HMR +/******/ +/******/ // no HMR manifest +/******/ })(); +/******/ /************************************************************************/ /******/ /******/ // startup diff --git a/package-lock.json b/package-lock.json index e4089657..8c2e4782 100644 --- a/package-lock.json +++ b/package-lock.json @@ -10,7 +10,7 @@ "license": "MIT", "dependencies": { "@actions/core": "^1.11.1", - "@aws-sdk/client-ecs": "^3.890.0", + "@aws-sdk/client-ecs": "^3.923.0", "tmp": "^0.2.5" }, "devDependencies": { @@ -189,101 +189,100 @@ } }, "node_modules/@aws-sdk/client-ecs": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/client-ecs/-/client-ecs-3.890.0.tgz", - "integrity": "sha512-Kkh6sCsfo8REo/gvv1FHw92pDHyAnt1Kc22LQPbyboVC8I57LIG9R9P/OL3pe6QuF4fBaE9P3wsSRUPNmVNuxw==", + "version": "3.923.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/client-ecs/-/client-ecs-3.923.0.tgz", + "integrity": "sha512-fvGy+1ZpLjgiFAIptmmGRRKF1GXxINq066ygEkGRFQxh8QPSHO4jgmlcur0ZjHQyxgKrbqyPe6GBeqtUIcRy3A==", "license": "Apache-2.0", "dependencies": { "@aws-crypto/sha256-browser": "5.2.0", "@aws-crypto/sha256-js": "5.2.0", - "@aws-sdk/core": "3.890.0", - "@aws-sdk/credential-provider-node": "3.890.0", - "@aws-sdk/middleware-host-header": "3.887.0", - "@aws-sdk/middleware-logger": "3.887.0", - "@aws-sdk/middleware-recursion-detection": "3.887.0", - "@aws-sdk/middleware-user-agent": "3.890.0", - "@aws-sdk/region-config-resolver": "3.890.0", - "@aws-sdk/types": "3.887.0", - "@aws-sdk/util-endpoints": "3.890.0", - "@aws-sdk/util-user-agent-browser": "3.887.0", - "@aws-sdk/util-user-agent-node": "3.890.0", - "@smithy/config-resolver": "^4.2.2", - "@smithy/core": "^3.11.0", - "@smithy/fetch-http-handler": "^5.2.1", - "@smithy/hash-node": "^4.1.1", - "@smithy/invalid-dependency": "^4.1.1", - "@smithy/middleware-content-length": "^4.1.1", - "@smithy/middleware-endpoint": "^4.2.2", - "@smithy/middleware-retry": "^4.2.2", - "@smithy/middleware-serde": "^4.1.1", - "@smithy/middleware-stack": "^4.1.1", - "@smithy/node-config-provider": "^4.2.2", - "@smithy/node-http-handler": "^4.2.1", - "@smithy/protocol-http": "^5.2.1", - "@smithy/smithy-client": "^4.6.2", - "@smithy/types": "^4.5.0", - "@smithy/url-parser": "^4.1.1", - "@smithy/util-base64": "^4.1.0", - "@smithy/util-body-length-browser": "^4.1.0", - "@smithy/util-body-length-node": "^4.1.0", - "@smithy/util-defaults-mode-browser": "^4.1.2", - "@smithy/util-defaults-mode-node": "^4.1.2", - "@smithy/util-endpoints": "^3.1.2", - "@smithy/util-middleware": "^4.1.1", - "@smithy/util-retry": "^4.1.1", - "@smithy/util-utf8": "^4.1.0", - "@smithy/util-waiter": "^4.1.1", - "@types/uuid": "^9.0.1", - "tslib": "^2.6.2", - "uuid": "^9.0.1" + "@aws-sdk/core": "3.922.0", + "@aws-sdk/credential-provider-node": "3.922.0", + "@aws-sdk/middleware-host-header": "3.922.0", + "@aws-sdk/middleware-logger": "3.922.0", + "@aws-sdk/middleware-recursion-detection": "3.922.0", + "@aws-sdk/middleware-user-agent": "3.922.0", + "@aws-sdk/region-config-resolver": "3.922.0", + "@aws-sdk/types": "3.922.0", + "@aws-sdk/util-endpoints": "3.922.0", + "@aws-sdk/util-user-agent-browser": "3.922.0", + "@aws-sdk/util-user-agent-node": "3.922.0", + "@smithy/config-resolver": "^4.4.1", + "@smithy/core": "^3.17.2", + "@smithy/fetch-http-handler": "^5.3.5", + "@smithy/hash-node": "^4.2.4", + "@smithy/invalid-dependency": "^4.2.4", + "@smithy/middleware-content-length": "^4.2.4", + "@smithy/middleware-endpoint": "^4.3.6", + "@smithy/middleware-retry": "^4.4.6", + "@smithy/middleware-serde": "^4.2.4", + "@smithy/middleware-stack": "^4.2.4", + "@smithy/node-config-provider": "^4.3.4", + "@smithy/node-http-handler": "^4.4.4", + "@smithy/protocol-http": "^5.3.4", + "@smithy/smithy-client": "^4.9.2", + "@smithy/types": "^4.8.1", + "@smithy/url-parser": "^4.2.4", + "@smithy/util-base64": "^4.3.0", + "@smithy/util-body-length-browser": "^4.2.0", + "@smithy/util-body-length-node": "^4.2.1", + "@smithy/util-defaults-mode-browser": "^4.3.5", + "@smithy/util-defaults-mode-node": "^4.2.7", + "@smithy/util-endpoints": "^3.2.4", + "@smithy/util-middleware": "^4.2.4", + "@smithy/util-retry": "^4.2.4", + "@smithy/util-utf8": "^4.2.0", + "@smithy/util-waiter": "^4.2.4", + "@smithy/uuid": "^1.1.0", + "tslib": "^2.6.2" }, "engines": { "node": ">=18.0.0" } }, "node_modules/@aws-sdk/client-sso": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/client-sso/-/client-sso-3.890.0.tgz", - "integrity": "sha512-vefYNwh/K5V5YiJpFJfoMPNqsoiRTqD7ZnkvR0cjJdwhOIwFnSKN1vz0OMjySTQmVMcG4JKGVul82ou7ErtOhQ==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/client-sso/-/client-sso-3.922.0.tgz", + "integrity": "sha512-jdHs7uy7cSpiMvrxhYmqHyJxgK7hyqw4plG8OQ4YTBpq0SbfAxdoOuOkwJ1IVUUQho4otR1xYYjiX/8e8J8qwQ==", "license": "Apache-2.0", "dependencies": { "@aws-crypto/sha256-browser": "5.2.0", "@aws-crypto/sha256-js": "5.2.0", - "@aws-sdk/core": "3.890.0", - "@aws-sdk/middleware-host-header": "3.887.0", - "@aws-sdk/middleware-logger": "3.887.0", - "@aws-sdk/middleware-recursion-detection": "3.887.0", - "@aws-sdk/middleware-user-agent": "3.890.0", - "@aws-sdk/region-config-resolver": "3.890.0", - "@aws-sdk/types": "3.887.0", - "@aws-sdk/util-endpoints": "3.890.0", - "@aws-sdk/util-user-agent-browser": "3.887.0", - "@aws-sdk/util-user-agent-node": "3.890.0", - "@smithy/config-resolver": "^4.2.2", - "@smithy/core": "^3.11.0", - "@smithy/fetch-http-handler": "^5.2.1", - "@smithy/hash-node": "^4.1.1", - "@smithy/invalid-dependency": "^4.1.1", - "@smithy/middleware-content-length": "^4.1.1", - "@smithy/middleware-endpoint": "^4.2.2", - "@smithy/middleware-retry": "^4.2.2", - "@smithy/middleware-serde": "^4.1.1", - "@smithy/middleware-stack": "^4.1.1", - "@smithy/node-config-provider": "^4.2.2", - "@smithy/node-http-handler": "^4.2.1", - "@smithy/protocol-http": "^5.2.1", - "@smithy/smithy-client": "^4.6.2", - "@smithy/types": "^4.5.0", - "@smithy/url-parser": "^4.1.1", - "@smithy/util-base64": "^4.1.0", - "@smithy/util-body-length-browser": "^4.1.0", - "@smithy/util-body-length-node": "^4.1.0", - "@smithy/util-defaults-mode-browser": "^4.1.2", - "@smithy/util-defaults-mode-node": "^4.1.2", - "@smithy/util-endpoints": "^3.1.2", - "@smithy/util-middleware": "^4.1.1", - "@smithy/util-retry": "^4.1.1", - "@smithy/util-utf8": "^4.1.0", + "@aws-sdk/core": "3.922.0", + "@aws-sdk/middleware-host-header": "3.922.0", + "@aws-sdk/middleware-logger": "3.922.0", + "@aws-sdk/middleware-recursion-detection": "3.922.0", + "@aws-sdk/middleware-user-agent": "3.922.0", + "@aws-sdk/region-config-resolver": "3.922.0", + "@aws-sdk/types": "3.922.0", + "@aws-sdk/util-endpoints": "3.922.0", + "@aws-sdk/util-user-agent-browser": "3.922.0", + "@aws-sdk/util-user-agent-node": "3.922.0", + "@smithy/config-resolver": "^4.4.1", + "@smithy/core": "^3.17.2", + "@smithy/fetch-http-handler": "^5.3.5", + "@smithy/hash-node": "^4.2.4", + "@smithy/invalid-dependency": "^4.2.4", + "@smithy/middleware-content-length": "^4.2.4", + "@smithy/middleware-endpoint": "^4.3.6", + "@smithy/middleware-retry": "^4.4.6", + "@smithy/middleware-serde": "^4.2.4", + "@smithy/middleware-stack": "^4.2.4", + "@smithy/node-config-provider": "^4.3.4", + "@smithy/node-http-handler": "^4.4.4", + "@smithy/protocol-http": "^5.3.4", + "@smithy/smithy-client": "^4.9.2", + "@smithy/types": "^4.8.1", + "@smithy/url-parser": "^4.2.4", + "@smithy/util-base64": "^4.3.0", + "@smithy/util-body-length-browser": "^4.2.0", + "@smithy/util-body-length-node": "^4.2.1", + "@smithy/util-defaults-mode-browser": "^4.3.5", + "@smithy/util-defaults-mode-node": "^4.2.7", + "@smithy/util-endpoints": "^3.2.4", + "@smithy/util-middleware": "^4.2.4", + "@smithy/util-retry": "^4.2.4", + "@smithy/util-utf8": "^4.2.0", "tslib": "^2.6.2" }, "engines": { @@ -291,25 +290,23 @@ } }, "node_modules/@aws-sdk/core": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/core/-/core-3.890.0.tgz", - "integrity": "sha512-CT+yjhytHdyKvV3Nh/fqBjnZ8+UiQZVz4NMm4LrPATgVSOdfygXHqrWxrPTVgiBtuJWkotg06DF7+pTd5ekLBw==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/core/-/core-3.922.0.tgz", + "integrity": "sha512-EvfP4cqJfpO3L2v5vkIlTkMesPtRwWlMfsaW6Tpfm7iYfBOuTi6jx60pMDMTyJNVfh6cGmXwh/kj1jQdR+w99Q==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/types": "3.887.0", - "@aws-sdk/xml-builder": "3.887.0", - "@smithy/core": "^3.11.0", - "@smithy/node-config-provider": "^4.2.2", - "@smithy/property-provider": "^4.1.1", - "@smithy/protocol-http": "^5.2.1", - "@smithy/signature-v4": "^5.2.1", - "@smithy/smithy-client": "^4.6.2", - "@smithy/types": "^4.5.0", - "@smithy/util-base64": "^4.1.0", - "@smithy/util-body-length-browser": "^4.1.0", - "@smithy/util-middleware": "^4.1.1", - "@smithy/util-utf8": "^4.1.0", - "fast-xml-parser": "5.2.5", + "@aws-sdk/types": "3.922.0", + "@aws-sdk/xml-builder": "3.921.0", + "@smithy/core": "^3.17.2", + "@smithy/node-config-provider": "^4.3.4", + "@smithy/property-provider": "^4.2.4", + "@smithy/protocol-http": "^5.3.4", + "@smithy/signature-v4": "^5.3.4", + "@smithy/smithy-client": "^4.9.2", + "@smithy/types": "^4.8.1", + "@smithy/util-base64": "^4.3.0", + "@smithy/util-middleware": "^4.2.4", + "@smithy/util-utf8": "^4.2.0", "tslib": "^2.6.2" }, "engines": { @@ -317,15 +314,15 @@ } }, "node_modules/@aws-sdk/credential-provider-env": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-env/-/credential-provider-env-3.890.0.tgz", - "integrity": "sha512-BtsUa2y0Rs8phmB2ScZ5RuPqZVmxJJXjGfeiXctmLFTxTwoayIK1DdNzOWx6SRMPVc3s2RBGN4vO7T1TwN+ajA==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-env/-/credential-provider-env-3.922.0.tgz", + "integrity": "sha512-WikGQpKkROJSK3D3E7odPjZ8tU7WJp5/TgGdRuZw3izsHUeH48xMv6IznafpRTmvHcjAbDQj4U3CJZNAzOK/OQ==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/core": "3.890.0", - "@aws-sdk/types": "3.887.0", - "@smithy/property-provider": "^4.1.1", - "@smithy/types": "^4.5.0", + "@aws-sdk/core": "3.922.0", + "@aws-sdk/types": "3.922.0", + "@smithy/property-provider": "^4.2.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -333,20 +330,20 @@ } }, "node_modules/@aws-sdk/credential-provider-http": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-http/-/credential-provider-http-3.890.0.tgz", - "integrity": "sha512-0sru3LVwsuGYyzbD90EC/d5HnCZ9PL4O9BA2LYT6b9XceC005Oj86uzE47LXb+mDhTAt3T6ZO0+ZcVQe0DDi8w==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-http/-/credential-provider-http-3.922.0.tgz", + "integrity": "sha512-i72DgHMK7ydAEqdzU0Duqh60Q8W59EZmRJ73y0Y5oFmNOqnYsAI+UXyOoCsubp+Dkr6+yOwAn1gPt1XGE9Aowg==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/core": "3.890.0", - "@aws-sdk/types": "3.887.0", - "@smithy/fetch-http-handler": "^5.2.1", - "@smithy/node-http-handler": "^4.2.1", - "@smithy/property-provider": "^4.1.1", - "@smithy/protocol-http": "^5.2.1", - "@smithy/smithy-client": "^4.6.2", - "@smithy/types": "^4.5.0", - "@smithy/util-stream": "^4.3.1", + "@aws-sdk/core": "3.922.0", + "@aws-sdk/types": "3.922.0", + "@smithy/fetch-http-handler": "^5.3.5", + "@smithy/node-http-handler": "^4.4.4", + "@smithy/property-provider": "^4.2.4", + "@smithy/protocol-http": "^5.3.4", + "@smithy/smithy-client": "^4.9.2", + "@smithy/types": "^4.8.1", + "@smithy/util-stream": "^4.5.5", "tslib": "^2.6.2" }, "engines": { @@ -354,23 +351,23 @@ } }, "node_modules/@aws-sdk/credential-provider-ini": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-ini/-/credential-provider-ini-3.890.0.tgz", - "integrity": "sha512-Mxv7ByftHKH7dE6YXu9gQ6ODXwO1iSO32t8tBrZLS3g8K1knWADIqDFv3yErQtJ8hp27IDxbAbVH/1RQdSkmhA==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-ini/-/credential-provider-ini-3.922.0.tgz", + "integrity": "sha512-bVF+pI5UCLNkvbiZr/t2fgTtv84s8FCdOGAPxQiQcw5qOZywNuuCCY3wIIchmQr6GJr8YFkEp5LgDCac5EC5aQ==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/core": "3.890.0", - "@aws-sdk/credential-provider-env": "3.890.0", - "@aws-sdk/credential-provider-http": "3.890.0", - "@aws-sdk/credential-provider-process": "3.890.0", - "@aws-sdk/credential-provider-sso": "3.890.0", - "@aws-sdk/credential-provider-web-identity": "3.890.0", - "@aws-sdk/nested-clients": "3.890.0", - "@aws-sdk/types": "3.887.0", - "@smithy/credential-provider-imds": "^4.1.2", - "@smithy/property-provider": "^4.1.1", - "@smithy/shared-ini-file-loader": "^4.2.0", - "@smithy/types": "^4.5.0", + "@aws-sdk/core": "3.922.0", + "@aws-sdk/credential-provider-env": "3.922.0", + "@aws-sdk/credential-provider-http": "3.922.0", + "@aws-sdk/credential-provider-process": "3.922.0", + "@aws-sdk/credential-provider-sso": "3.922.0", + "@aws-sdk/credential-provider-web-identity": "3.922.0", + "@aws-sdk/nested-clients": "3.922.0", + "@aws-sdk/types": "3.922.0", + "@smithy/credential-provider-imds": "^4.2.4", + "@smithy/property-provider": "^4.2.4", + "@smithy/shared-ini-file-loader": "^4.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -378,22 +375,22 @@ } }, "node_modules/@aws-sdk/credential-provider-node": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-node/-/credential-provider-node-3.890.0.tgz", - "integrity": "sha512-zbPz3mUtaBdch0KoH8/LouRDcYSzyT2ecyCOo5OAFVil7AxT1jvsn4vX78FlnSVpZ4mLuHY8pHTVGi235XiyBA==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-node/-/credential-provider-node-3.922.0.tgz", + "integrity": "sha512-agCwaD6mBihToHkjycL8ObIS2XOnWypWZZWhJSoWyHwFrhEKz1zGvgylK9Dc711oUfU+zU6J8e0JPKNJMNb3BQ==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/credential-provider-env": "3.890.0", - "@aws-sdk/credential-provider-http": "3.890.0", - "@aws-sdk/credential-provider-ini": "3.890.0", - "@aws-sdk/credential-provider-process": "3.890.0", - "@aws-sdk/credential-provider-sso": "3.890.0", - "@aws-sdk/credential-provider-web-identity": "3.890.0", - "@aws-sdk/types": "3.887.0", - "@smithy/credential-provider-imds": "^4.1.2", - "@smithy/property-provider": "^4.1.1", - "@smithy/shared-ini-file-loader": "^4.2.0", - "@smithy/types": "^4.5.0", + "@aws-sdk/credential-provider-env": "3.922.0", + "@aws-sdk/credential-provider-http": "3.922.0", + "@aws-sdk/credential-provider-ini": "3.922.0", + "@aws-sdk/credential-provider-process": "3.922.0", + "@aws-sdk/credential-provider-sso": "3.922.0", + "@aws-sdk/credential-provider-web-identity": "3.922.0", + "@aws-sdk/types": "3.922.0", + "@smithy/credential-provider-imds": "^4.2.4", + "@smithy/property-provider": "^4.2.4", + "@smithy/shared-ini-file-loader": "^4.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -401,16 +398,16 @@ } }, "node_modules/@aws-sdk/credential-provider-process": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-process/-/credential-provider-process-3.890.0.tgz", - "integrity": "sha512-dWZ54TI1Q+UerF5YOqGiCzY+x2YfHsSQvkyM3T4QDNTJpb/zjiVv327VbSOULOlI7gHKWY/G3tMz0D9nWI7YbA==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-process/-/credential-provider-process-3.922.0.tgz", + "integrity": "sha512-1DZOYezT6okslpvMW7oA2q+y17CJd4fxjNFH0jtThfswdh9CtG62+wxenqO+NExttq0UMaKisrkZiVrYQBTShw==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/core": "3.890.0", - "@aws-sdk/types": "3.887.0", - "@smithy/property-provider": "^4.1.1", - "@smithy/shared-ini-file-loader": "^4.2.0", - "@smithy/types": "^4.5.0", + "@aws-sdk/core": "3.922.0", + "@aws-sdk/types": "3.922.0", + "@smithy/property-provider": "^4.2.4", + "@smithy/shared-ini-file-loader": "^4.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -418,18 +415,18 @@ } }, "node_modules/@aws-sdk/credential-provider-sso": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-sso/-/credential-provider-sso-3.890.0.tgz", - "integrity": "sha512-ajYCZ6f2+98w8zG/IXcQ+NhWYoI5qPUDovw+gMqMWX/jL1cmZ9PFAwj2Vyq9cbjum5RNWwPLArWytTCgJex4AQ==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-sso/-/credential-provider-sso-3.922.0.tgz", + "integrity": "sha512-nbD3G3hShTYxLCkKMqLkLPtKwAAfxdY/k9jHtZmVBFXek2T6tQrqZHKxlAu+fd23Ga4/Aik7DLQQx1RA1a5ipg==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/client-sso": "3.890.0", - "@aws-sdk/core": "3.890.0", - "@aws-sdk/token-providers": "3.890.0", - "@aws-sdk/types": "3.887.0", - "@smithy/property-provider": "^4.1.1", - "@smithy/shared-ini-file-loader": "^4.2.0", - "@smithy/types": "^4.5.0", + "@aws-sdk/client-sso": "3.922.0", + "@aws-sdk/core": "3.922.0", + "@aws-sdk/token-providers": "3.922.0", + "@aws-sdk/types": "3.922.0", + "@smithy/property-provider": "^4.2.4", + "@smithy/shared-ini-file-loader": "^4.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -437,17 +434,17 @@ } }, "node_modules/@aws-sdk/credential-provider-web-identity": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-web-identity/-/credential-provider-web-identity-3.890.0.tgz", - "integrity": "sha512-qZ2Mx7BeYR1s0F/H6wePI0MAmkFswmBgrpgMCOt2S4b2IpQPnUa2JbxY3GwW2WqX3nV0KjPW08ctSLMmlq/tKA==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-web-identity/-/credential-provider-web-identity-3.922.0.tgz", + "integrity": "sha512-wjGIhgMHGGQfQTdFaJphNOKyAL8wZs6znJdHADPVURmgR+EWLyN/0fDO1u7wx8xaLMZpbHIFWBEvf9TritR/cQ==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/core": "3.890.0", - "@aws-sdk/nested-clients": "3.890.0", - "@aws-sdk/types": "3.887.0", - "@smithy/property-provider": "^4.1.1", - "@smithy/shared-ini-file-loader": "^4.2.0", - "@smithy/types": "^4.5.0", + "@aws-sdk/core": "3.922.0", + "@aws-sdk/nested-clients": "3.922.0", + "@aws-sdk/types": "3.922.0", + "@smithy/property-provider": "^4.2.4", + "@smithy/shared-ini-file-loader": "^4.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -455,14 +452,14 @@ } }, "node_modules/@aws-sdk/middleware-host-header": { - "version": "3.887.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/middleware-host-header/-/middleware-host-header-3.887.0.tgz", - "integrity": "sha512-ulzqXv6NNqdu/kr0sgBYupWmahISHY+azpJidtK6ZwQIC+vBUk9NdZeqQpy7KVhIk2xd4+5Oq9rxapPwPI21CA==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/middleware-host-header/-/middleware-host-header-3.922.0.tgz", + "integrity": "sha512-HPquFgBnq/KqKRVkiuCt97PmWbKtxQ5iUNLEc6FIviqOoZTmaYG3EDsIbuFBz9C4RHJU4FKLmHL2bL3FEId6AA==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/types": "3.887.0", - "@smithy/protocol-http": "^5.2.1", - "@smithy/types": "^4.5.0", + "@aws-sdk/types": "3.922.0", + "@smithy/protocol-http": "^5.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -470,13 +467,13 @@ } }, "node_modules/@aws-sdk/middleware-logger": { - "version": "3.887.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/middleware-logger/-/middleware-logger-3.887.0.tgz", - "integrity": "sha512-YbbgLI6jKp2qSoAcHnXrQ5jcuc5EYAmGLVFgMVdk8dfCfJLfGGSaOLxF4CXC7QYhO50s+mPPkhBYejCik02Kug==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/middleware-logger/-/middleware-logger-3.922.0.tgz", + "integrity": "sha512-AkvYO6b80FBm5/kk2E636zNNcNgjztNNUxpqVx+huyGn9ZqGTzS4kLqW2hO6CBe5APzVtPCtiQsXL24nzuOlAg==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/types": "3.887.0", - "@smithy/types": "^4.5.0", + "@aws-sdk/types": "3.922.0", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -484,15 +481,15 @@ } }, "node_modules/@aws-sdk/middleware-recursion-detection": { - "version": "3.887.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/middleware-recursion-detection/-/middleware-recursion-detection-3.887.0.tgz", - "integrity": "sha512-tjrUXFtQnFLo+qwMveq5faxP5MQakoLArXtqieHphSqZTXm21wDJM73hgT4/PQQGTwgYjDKqnqsE1hvk0hcfDw==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/middleware-recursion-detection/-/middleware-recursion-detection-3.922.0.tgz", + "integrity": "sha512-TtSCEDonV/9R0VhVlCpxZbp/9sxQvTTRKzIf8LxW3uXpby6Wl8IxEciBJlxmSkoqxh542WRcko7NYODlvL/gDA==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/types": "3.887.0", - "@aws/lambda-invoke-store": "^0.0.1", - "@smithy/protocol-http": "^5.2.1", - "@smithy/types": "^4.5.0", + "@aws-sdk/types": "3.922.0", + "@aws/lambda-invoke-store": "^0.1.1", + "@smithy/protocol-http": "^5.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -500,17 +497,17 @@ } }, "node_modules/@aws-sdk/middleware-user-agent": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/middleware-user-agent/-/middleware-user-agent-3.890.0.tgz", - "integrity": "sha512-x4+gLrOFGN7PnfxCaQbs3QEF8bMQE4CVxcOp066UEJqr2Pn4yB12Q3O+YntOtESK5NcTxIh7JlhGss95EHzNng==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/middleware-user-agent/-/middleware-user-agent-3.922.0.tgz", + "integrity": "sha512-N4Qx/9KP3oVQBJOrSghhz8iZFtUC2NNeSZt88hpPhbqAEAtuX8aD8OzVcpnAtrwWqy82Yd2YTxlkqMGkgqnBsQ==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/core": "3.890.0", - "@aws-sdk/types": "3.887.0", - "@aws-sdk/util-endpoints": "3.890.0", - "@smithy/core": "^3.11.0", - "@smithy/protocol-http": "^5.2.1", - "@smithy/types": "^4.5.0", + "@aws-sdk/core": "3.922.0", + "@aws-sdk/types": "3.922.0", + "@aws-sdk/util-endpoints": "3.922.0", + "@smithy/core": "^3.17.2", + "@smithy/protocol-http": "^5.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -518,48 +515,48 @@ } }, "node_modules/@aws-sdk/nested-clients": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/nested-clients/-/nested-clients-3.890.0.tgz", - "integrity": "sha512-D5qVNd+qlqdL8duJShzffAqPllGRA4tG7n/GEpL13eNfHChPvGkkUFBMrxSgCAETaTna13G6kq+dMO+SAdbm1A==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/nested-clients/-/nested-clients-3.922.0.tgz", + "integrity": "sha512-uYvKCF1TGh/MuJ4TMqmUM0Csuao02HawcseG4LUDyxdUsd/EFuxalWq1Cx4fKZQ2K8F504efZBjctMAMNY+l7A==", "license": "Apache-2.0", "dependencies": { "@aws-crypto/sha256-browser": "5.2.0", "@aws-crypto/sha256-js": "5.2.0", - "@aws-sdk/core": "3.890.0", - "@aws-sdk/middleware-host-header": "3.887.0", - "@aws-sdk/middleware-logger": "3.887.0", - "@aws-sdk/middleware-recursion-detection": "3.887.0", - "@aws-sdk/middleware-user-agent": "3.890.0", - "@aws-sdk/region-config-resolver": "3.890.0", - "@aws-sdk/types": "3.887.0", - "@aws-sdk/util-endpoints": "3.890.0", - "@aws-sdk/util-user-agent-browser": "3.887.0", - "@aws-sdk/util-user-agent-node": "3.890.0", - "@smithy/config-resolver": "^4.2.2", - "@smithy/core": "^3.11.0", - "@smithy/fetch-http-handler": "^5.2.1", - "@smithy/hash-node": "^4.1.1", - "@smithy/invalid-dependency": "^4.1.1", - "@smithy/middleware-content-length": "^4.1.1", - "@smithy/middleware-endpoint": "^4.2.2", - "@smithy/middleware-retry": "^4.2.2", - "@smithy/middleware-serde": "^4.1.1", - "@smithy/middleware-stack": "^4.1.1", - "@smithy/node-config-provider": "^4.2.2", - "@smithy/node-http-handler": "^4.2.1", - "@smithy/protocol-http": "^5.2.1", - "@smithy/smithy-client": "^4.6.2", - "@smithy/types": "^4.5.0", - "@smithy/url-parser": "^4.1.1", - "@smithy/util-base64": "^4.1.0", - "@smithy/util-body-length-browser": "^4.1.0", - "@smithy/util-body-length-node": "^4.1.0", - "@smithy/util-defaults-mode-browser": "^4.1.2", - "@smithy/util-defaults-mode-node": "^4.1.2", - "@smithy/util-endpoints": "^3.1.2", - "@smithy/util-middleware": "^4.1.1", - "@smithy/util-retry": "^4.1.1", - "@smithy/util-utf8": "^4.1.0", + "@aws-sdk/core": "3.922.0", + "@aws-sdk/middleware-host-header": "3.922.0", + "@aws-sdk/middleware-logger": "3.922.0", + "@aws-sdk/middleware-recursion-detection": "3.922.0", + "@aws-sdk/middleware-user-agent": "3.922.0", + "@aws-sdk/region-config-resolver": "3.922.0", + "@aws-sdk/types": "3.922.0", + "@aws-sdk/util-endpoints": "3.922.0", + "@aws-sdk/util-user-agent-browser": "3.922.0", + "@aws-sdk/util-user-agent-node": "3.922.0", + "@smithy/config-resolver": "^4.4.1", + "@smithy/core": "^3.17.2", + "@smithy/fetch-http-handler": "^5.3.5", + "@smithy/hash-node": "^4.2.4", + "@smithy/invalid-dependency": "^4.2.4", + "@smithy/middleware-content-length": "^4.2.4", + "@smithy/middleware-endpoint": "^4.3.6", + "@smithy/middleware-retry": "^4.4.6", + "@smithy/middleware-serde": "^4.2.4", + "@smithy/middleware-stack": "^4.2.4", + "@smithy/node-config-provider": "^4.3.4", + "@smithy/node-http-handler": "^4.4.4", + "@smithy/protocol-http": "^5.3.4", + "@smithy/smithy-client": "^4.9.2", + "@smithy/types": "^4.8.1", + "@smithy/url-parser": "^4.2.4", + "@smithy/util-base64": "^4.3.0", + "@smithy/util-body-length-browser": "^4.2.0", + "@smithy/util-body-length-node": "^4.2.1", + "@smithy/util-defaults-mode-browser": "^4.3.5", + "@smithy/util-defaults-mode-node": "^4.2.7", + "@smithy/util-endpoints": "^3.2.4", + "@smithy/util-middleware": "^4.2.4", + "@smithy/util-retry": "^4.2.4", + "@smithy/util-utf8": "^4.2.0", "tslib": "^2.6.2" }, "engines": { @@ -567,16 +564,15 @@ } }, "node_modules/@aws-sdk/region-config-resolver": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/region-config-resolver/-/region-config-resolver-3.890.0.tgz", - "integrity": "sha512-VfdT+tkF9groRYNzKvQCsCGDbOQdeBdzyB1d6hWiq22u13UafMIoskJ1ec0i0H1X29oT6mjTitfnvPq1UiKwzQ==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/region-config-resolver/-/region-config-resolver-3.922.0.tgz", + "integrity": "sha512-44Y/rNNwhngR2KHp6gkx//TOr56/hx6s4l+XLjOqH7EBCHL7XhnrT1y92L+DLiroVr1tCSmO8eHQwBv0Y2+mvw==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/types": "3.887.0", - "@smithy/node-config-provider": "^4.2.2", - "@smithy/types": "^4.5.0", - "@smithy/util-config-provider": "^4.1.0", - "@smithy/util-middleware": "^4.1.1", + "@aws-sdk/types": "3.922.0", + "@smithy/config-resolver": "^4.4.1", + "@smithy/node-config-provider": "^4.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -584,17 +580,17 @@ } }, "node_modules/@aws-sdk/token-providers": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/token-providers/-/token-providers-3.890.0.tgz", - "integrity": "sha512-+pK/0iQEpPmnztbAw0NNmb+B5pPy8VLu+Ab4SJLgVp41RE9NO13VQtrzUbh61TTAVMrzqWlLQ2qmAl2Fk4VNgw==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/token-providers/-/token-providers-3.922.0.tgz", + "integrity": "sha512-/inmPnjZE0ZBE16zaCowAvouSx05FJ7p6BQYuzlJ8vxEU0sS0Hf8fvhuiRnN9V9eDUPIBY+/5EjbMWygXL4wlQ==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/core": "3.890.0", - "@aws-sdk/nested-clients": "3.890.0", - "@aws-sdk/types": "3.887.0", - "@smithy/property-provider": "^4.1.1", - "@smithy/shared-ini-file-loader": "^4.2.0", - "@smithy/types": "^4.5.0", + "@aws-sdk/core": "3.922.0", + "@aws-sdk/nested-clients": "3.922.0", + "@aws-sdk/types": "3.922.0", + "@smithy/property-provider": "^4.2.4", + "@smithy/shared-ini-file-loader": "^4.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -602,12 +598,12 @@ } }, "node_modules/@aws-sdk/types": { - "version": "3.887.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/types/-/types-3.887.0.tgz", - "integrity": "sha512-fmTEJpUhsPsovQ12vZSpVTEP/IaRoJAMBGQXlQNjtCpkBp6Iq3KQDa/HDaPINE+3xxo6XvTdtibsNOd5zJLV9A==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/types/-/types-3.922.0.tgz", + "integrity": "sha512-eLA6XjVobAUAMivvM7DBL79mnHyrm+32TkXNWZua5mnxF+6kQCfblKKJvxMZLGosO53/Ex46ogim8IY5Nbqv2w==", "license": "Apache-2.0", "dependencies": { - "@smithy/types": "^4.5.0", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -615,15 +611,15 @@ } }, "node_modules/@aws-sdk/util-endpoints": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/util-endpoints/-/util-endpoints-3.890.0.tgz", - "integrity": "sha512-nJ8v1x9ZQKzMRK4dS4oefOMIHqb6cguctTcx1RB9iTaFOR5pP7bvq+D4mvNZ6vBxiHg1dQGBUUgl5XJmdR7atQ==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/util-endpoints/-/util-endpoints-3.922.0.tgz", + "integrity": "sha512-4ZdQCSuNMY8HMlR1YN4MRDdXuKd+uQTeKIr5/pIM+g3TjInZoj8imvXudjcrFGA63UF3t92YVTkBq88mg58RXQ==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/types": "3.887.0", - "@smithy/types": "^4.5.0", - "@smithy/url-parser": "^4.1.1", - "@smithy/util-endpoints": "^3.1.2", + "@aws-sdk/types": "3.922.0", + "@smithy/types": "^4.8.1", + "@smithy/url-parser": "^4.2.4", + "@smithy/util-endpoints": "^3.2.4", "tslib": "^2.6.2" }, "engines": { @@ -631,9 +627,9 @@ } }, "node_modules/@aws-sdk/util-locate-window": { - "version": "3.873.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/util-locate-window/-/util-locate-window-3.873.0.tgz", - "integrity": "sha512-xcVhZF6svjM5Rj89T1WzkjQmrTF6dpR2UvIHPMTnSZoNe6CixejPZ6f0JJ2kAhO8H+dUHwNBlsUgOTIKiK/Syg==", + "version": "3.893.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/util-locate-window/-/util-locate-window-3.893.0.tgz", + "integrity": "sha512-T89pFfgat6c8nMmpI8eKjBcDcgJq36+m9oiXbcUzeU55MP9ZuGgBomGjGnHaEyF36jenW9gmg3NfZDm0AO2XPg==", "license": "Apache-2.0", "dependencies": { "tslib": "^2.6.2" @@ -643,27 +639,27 @@ } }, "node_modules/@aws-sdk/util-user-agent-browser": { - "version": "3.887.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/util-user-agent-browser/-/util-user-agent-browser-3.887.0.tgz", - "integrity": "sha512-X71UmVsYc6ZTH4KU6hA5urOzYowSXc3qvroagJNLJYU1ilgZ529lP4J9XOYfEvTXkLR1hPFSRxa43SrwgelMjA==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/util-user-agent-browser/-/util-user-agent-browser-3.922.0.tgz", + "integrity": "sha512-qOJAERZ3Plj1st7M4Q5henl5FRpE30uLm6L9edZqZXGR6c7ry9jzexWamWVpQ4H4xVAVmiO9dIEBAfbq4mduOA==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/types": "3.887.0", - "@smithy/types": "^4.5.0", + "@aws-sdk/types": "3.922.0", + "@smithy/types": "^4.8.1", "bowser": "^2.11.0", "tslib": "^2.6.2" } }, "node_modules/@aws-sdk/util-user-agent-node": { - "version": "3.890.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/util-user-agent-node/-/util-user-agent-node-3.890.0.tgz", - "integrity": "sha512-s85NkCxKoAlUvx7UP7OelxLqwTi27Tps9/Q+4N+9rEUjThxEnDsqJSStJ1XiYhddz1xc/vxMvPjYN0qX6EKPtA==", + "version": "3.922.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/util-user-agent-node/-/util-user-agent-node-3.922.0.tgz", + "integrity": "sha512-NrPe/Rsr5kcGunkog0eBV+bY0inkRELsD2SacC4lQZvZiXf8VJ2Y7j+Yq1tB+h+FPLsdt3v9wItIvDf/laAm0Q==", "license": "Apache-2.0", "dependencies": { - "@aws-sdk/middleware-user-agent": "3.890.0", - "@aws-sdk/types": "3.887.0", - "@smithy/node-config-provider": "^4.2.2", - "@smithy/types": "^4.5.0", + "@aws-sdk/middleware-user-agent": "3.922.0", + "@aws-sdk/types": "3.922.0", + "@smithy/node-config-provider": "^4.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -679,12 +675,13 @@ } }, "node_modules/@aws-sdk/xml-builder": { - "version": "3.887.0", - "resolved": "https://registry.npmjs.org/@aws-sdk/xml-builder/-/xml-builder-3.887.0.tgz", - "integrity": "sha512-lMwgWK1kNgUhHGfBvO/5uLe7TKhycwOn3eRCqsKPT9aPCx/HWuTlpcQp8oW2pCRGLS7qzcxqpQulcD+bbUL7XQ==", + "version": "3.921.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/xml-builder/-/xml-builder-3.921.0.tgz", + "integrity": "sha512-LVHg0jgjyicKKvpNIEMXIMr1EBViESxcPkqfOlT+X1FkmUMTNZEEVF18tOJg4m4hV5vxtkWcqtr4IEeWa1C41Q==", "license": "Apache-2.0", "dependencies": { - "@smithy/types": "^4.5.0", + "@smithy/types": "^4.8.1", + "fast-xml-parser": "5.2.5", "tslib": "^2.6.2" }, "engines": { @@ -692,9 +689,9 @@ } }, "node_modules/@aws/lambda-invoke-store": { - "version": "0.0.1", - "resolved": "https://registry.npmjs.org/@aws/lambda-invoke-store/-/lambda-invoke-store-0.0.1.tgz", - "integrity": "sha512-ORHRQ2tmvnBXc8t/X9Z8IcSbBA4xTLKuN873FopzklHMeqBst7YG0d+AX97inkvDX+NChYtSr+qGfcqGFaI8Zw==", + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/@aws/lambda-invoke-store/-/lambda-invoke-store-0.1.1.tgz", + "integrity": "sha512-RcLam17LdlbSOSp9VxmUu1eI6Mwxp+OwhD2QhiSNmNCzoDb0EeUXTD2n/WbcnrAYMGlmf05th6QYq23VqvJqpA==", "license": "Apache-2.0", "engines": { "node": ">=18.0.0" @@ -1859,12 +1856,12 @@ } }, "node_modules/@smithy/abort-controller": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/abort-controller/-/abort-controller-4.1.1.tgz", - "integrity": "sha512-vkzula+IwRvPR6oKQhMYioM3A/oX/lFCZiwuxkQbRhqJS2S4YRY2k7k/SyR2jMf3607HLtbEwlRxi0ndXHMjRg==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/abort-controller/-/abort-controller-4.2.4.tgz", + "integrity": "sha512-Z4DUr/AkgyFf1bOThW2HwzREagee0sB5ycl+hDiSZOfRLW8ZgrOjDi6g8mHH19yyU5E2A/64W3z6SMIf5XiUSQ==", "license": "Apache-2.0", "dependencies": { - "@smithy/types": "^4.5.0", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -1872,15 +1869,16 @@ } }, "node_modules/@smithy/config-resolver": { - "version": "4.2.2", - "resolved": "https://registry.npmjs.org/@smithy/config-resolver/-/config-resolver-4.2.2.tgz", - "integrity": "sha512-IT6MatgBWagLybZl1xQcURXRICvqz1z3APSCAI9IqdvfCkrA7RaQIEfgC6G/KvfxnDfQUDqFV+ZlixcuFznGBQ==", + "version": "4.4.2", + "resolved": "https://registry.npmjs.org/@smithy/config-resolver/-/config-resolver-4.4.2.tgz", + "integrity": "sha512-4Jys0ni2tB2VZzgslbEgszZyMdTkPOFGA8g+So/NjR8oy6Qwaq4eSwsrRI+NMtb0Dq4kqCzGUu/nGUx7OM/xfw==", "license": "Apache-2.0", "dependencies": { - "@smithy/node-config-provider": "^4.2.2", - "@smithy/types": "^4.5.0", - "@smithy/util-config-provider": "^4.1.0", - "@smithy/util-middleware": "^4.1.1", + "@smithy/node-config-provider": "^4.3.4", + "@smithy/types": "^4.8.1", + "@smithy/util-config-provider": "^4.2.0", + "@smithy/util-endpoints": "^3.2.4", + "@smithy/util-middleware": "^4.2.4", "tslib": "^2.6.2" }, "engines": { @@ -1888,37 +1886,36 @@ } }, "node_modules/@smithy/core": { - "version": "3.11.0", - "resolved": "https://registry.npmjs.org/@smithy/core/-/core-3.11.0.tgz", - "integrity": "sha512-Abs5rdP1o8/OINtE49wwNeWuynCu0kme1r4RI3VXVrHr4odVDG7h7mTnw1WXXfN5Il+c25QOnrdL2y56USfxkA==", + "version": "3.17.2", + "resolved": "https://registry.npmjs.org/@smithy/core/-/core-3.17.2.tgz", + "integrity": "sha512-n3g4Nl1Te+qGPDbNFAYf+smkRVB+JhFsGy9uJXXZQEufoP4u0r+WLh6KvTDolCswaagysDc/afS1yvb2jnj1gQ==", "license": "Apache-2.0", "dependencies": { - "@smithy/middleware-serde": "^4.1.1", - "@smithy/protocol-http": "^5.2.1", - "@smithy/types": "^4.5.0", - "@smithy/util-base64": "^4.1.0", - "@smithy/util-body-length-browser": "^4.1.0", - "@smithy/util-middleware": "^4.1.1", - "@smithy/util-stream": "^4.3.1", - "@smithy/util-utf8": "^4.1.0", - "@types/uuid": "^9.0.1", - "tslib": "^2.6.2", - "uuid": "^9.0.1" + "@smithy/middleware-serde": "^4.2.4", + "@smithy/protocol-http": "^5.3.4", + "@smithy/types": "^4.8.1", + "@smithy/util-base64": "^4.3.0", + "@smithy/util-body-length-browser": "^4.2.0", + "@smithy/util-middleware": "^4.2.4", + "@smithy/util-stream": "^4.5.5", + "@smithy/util-utf8": "^4.2.0", + "@smithy/uuid": "^1.1.0", + "tslib": "^2.6.2" }, "engines": { "node": ">=18.0.0" } }, "node_modules/@smithy/credential-provider-imds": { - "version": "4.1.2", - "resolved": "https://registry.npmjs.org/@smithy/credential-provider-imds/-/credential-provider-imds-4.1.2.tgz", - "integrity": "sha512-JlYNq8TShnqCLg0h+afqe2wLAwZpuoSgOyzhYvTgbiKBWRov+uUve+vrZEQO6lkdLOWPh7gK5dtb9dS+KGendg==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/credential-provider-imds/-/credential-provider-imds-4.2.4.tgz", + "integrity": "sha512-YVNMjhdz2pVto5bRdux7GMs0x1m0Afz3OcQy/4Yf9DH4fWOtroGH7uLvs7ZmDyoBJzLdegtIPpXrpJOZWvUXdw==", "license": "Apache-2.0", "dependencies": { - "@smithy/node-config-provider": "^4.2.2", - "@smithy/property-provider": "^4.1.1", - "@smithy/types": "^4.5.0", - "@smithy/url-parser": "^4.1.1", + "@smithy/node-config-provider": "^4.3.4", + "@smithy/property-provider": "^4.2.4", + "@smithy/types": "^4.8.1", + "@smithy/url-parser": "^4.2.4", "tslib": "^2.6.2" }, "engines": { @@ -1926,15 +1923,15 @@ } }, "node_modules/@smithy/fetch-http-handler": { - "version": "5.2.1", - "resolved": "https://registry.npmjs.org/@smithy/fetch-http-handler/-/fetch-http-handler-5.2.1.tgz", - "integrity": "sha512-5/3wxKNtV3wO/hk1is+CZUhL8a1yy/U+9u9LKQ9kZTkMsHaQjJhc3stFfiujtMnkITjzWfndGA2f7g9Uh9vKng==", + "version": "5.3.5", + "resolved": "https://registry.npmjs.org/@smithy/fetch-http-handler/-/fetch-http-handler-5.3.5.tgz", + "integrity": "sha512-mg83SM3FLI8Sa2ooTJbsh5MFfyMTyNRwxqpKHmE0ICRIa66Aodv80DMsTQI02xBLVJ0hckwqTRr5IGAbbWuFLQ==", "license": "Apache-2.0", "dependencies": { - "@smithy/protocol-http": "^5.2.1", - "@smithy/querystring-builder": "^4.1.1", - "@smithy/types": "^4.5.0", - "@smithy/util-base64": "^4.1.0", + "@smithy/protocol-http": "^5.3.4", + "@smithy/querystring-builder": "^4.2.4", + "@smithy/types": "^4.8.1", + "@smithy/util-base64": "^4.3.0", "tslib": "^2.6.2" }, "engines": { @@ -1942,14 +1939,14 @@ } }, "node_modules/@smithy/hash-node": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/hash-node/-/hash-node-4.1.1.tgz", - "integrity": "sha512-H9DIU9WBLhYrvPs9v4sYvnZ1PiAI0oc8CgNQUJ1rpN3pP7QADbTOUjchI2FB764Ub0DstH5xbTqcMJu1pnVqxA==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/hash-node/-/hash-node-4.2.4.tgz", + "integrity": "sha512-kKU0gVhx/ppVMntvUOZE7WRMFW86HuaxLwvqileBEjL7PoILI8/djoILw3gPQloGVE6O0oOzqafxeNi2KbnUJw==", "license": "Apache-2.0", "dependencies": { - "@smithy/types": "^4.5.0", - "@smithy/util-buffer-from": "^4.1.0", - "@smithy/util-utf8": "^4.1.0", + "@smithy/types": "^4.8.1", + "@smithy/util-buffer-from": "^4.2.0", + "@smithy/util-utf8": "^4.2.0", "tslib": "^2.6.2" }, "engines": { @@ -1957,12 +1954,12 @@ } }, "node_modules/@smithy/invalid-dependency": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/invalid-dependency/-/invalid-dependency-4.1.1.tgz", - "integrity": "sha512-1AqLyFlfrrDkyES8uhINRlJXmHA2FkG+3DY8X+rmLSqmFwk3DJnvhyGzyByPyewh2jbmV+TYQBEfngQax8IFGg==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/invalid-dependency/-/invalid-dependency-4.2.4.tgz", + "integrity": "sha512-z6aDLGiHzsMhbS2MjetlIWopWz//K+mCoPXjW6aLr0mypF+Y7qdEh5TyJ20Onf9FbWHiWl4eC+rITdizpnXqOw==", "license": "Apache-2.0", "dependencies": { - "@smithy/types": "^4.5.0", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -1970,9 +1967,9 @@ } }, "node_modules/@smithy/is-array-buffer": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/@smithy/is-array-buffer/-/is-array-buffer-4.1.0.tgz", - "integrity": "sha512-ePTYUOV54wMogio+he4pBybe8fwg4sDvEVDBU8ZlHOZXbXK3/C0XfJgUCu6qAZcawv05ZhZzODGUerFBPsPUDQ==", + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/@smithy/is-array-buffer/-/is-array-buffer-4.2.0.tgz", + "integrity": "sha512-DZZZBvC7sjcYh4MazJSGiWMI2L7E0oCiRHREDzIxi/M2LY79/21iXt6aPLHge82wi5LsuRF5A06Ds3+0mlh6CQ==", "license": "Apache-2.0", "dependencies": { "tslib": "^2.6.2" @@ -1982,13 +1979,13 @@ } }, "node_modules/@smithy/middleware-content-length": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/middleware-content-length/-/middleware-content-length-4.1.1.tgz", - "integrity": "sha512-9wlfBBgTsRvC2JxLJxv4xDGNBrZuio3AgSl0lSFX7fneW2cGskXTYpFxCdRYD2+5yzmsiTuaAJD1Wp7gWt9y9w==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/middleware-content-length/-/middleware-content-length-4.2.4.tgz", + "integrity": "sha512-hJRZuFS9UsElX4DJSJfoX4M1qXRH+VFiLMUnhsWvtOOUWRNvvOfDaUSdlNbjwv1IkpVjj/Rd/O59Jl3nhAcxow==", "license": "Apache-2.0", "dependencies": { - "@smithy/protocol-http": "^5.2.1", - "@smithy/types": "^4.5.0", + "@smithy/protocol-http": "^5.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -1996,18 +1993,18 @@ } }, "node_modules/@smithy/middleware-endpoint": { - "version": "4.2.2", - "resolved": "https://registry.npmjs.org/@smithy/middleware-endpoint/-/middleware-endpoint-4.2.2.tgz", - "integrity": "sha512-M51KcwD+UeSOFtpALGf5OijWt915aQT5eJhqnMKJt7ZTfDfNcvg2UZgIgTZUoiORawb6o5lk4n3rv7vnzQXgsA==", + "version": "4.3.6", + "resolved": "https://registry.npmjs.org/@smithy/middleware-endpoint/-/middleware-endpoint-4.3.6.tgz", + "integrity": "sha512-PXehXofGMFpDqr933rxD8RGOcZ0QBAWtuzTgYRAHAL2BnKawHDEdf/TnGpcmfPJGwonhginaaeJIKluEojiF/w==", "license": "Apache-2.0", "dependencies": { - "@smithy/core": "^3.11.0", - "@smithy/middleware-serde": "^4.1.1", - "@smithy/node-config-provider": "^4.2.2", - "@smithy/shared-ini-file-loader": "^4.2.0", - "@smithy/types": "^4.5.0", - "@smithy/url-parser": "^4.1.1", - "@smithy/util-middleware": "^4.1.1", + "@smithy/core": "^3.17.2", + "@smithy/middleware-serde": "^4.2.4", + "@smithy/node-config-provider": "^4.3.4", + "@smithy/shared-ini-file-loader": "^4.3.4", + "@smithy/types": "^4.8.1", + "@smithy/url-parser": "^4.2.4", + "@smithy/util-middleware": "^4.2.4", "tslib": "^2.6.2" }, "engines": { @@ -2015,34 +2012,33 @@ } }, "node_modules/@smithy/middleware-retry": { - "version": "4.2.2", - "resolved": "https://registry.npmjs.org/@smithy/middleware-retry/-/middleware-retry-4.2.2.tgz", - "integrity": "sha512-KZJueEOO+PWqflv2oGx9jICpHdBYXwCI19j7e2V3IMwKgFcXc9D9q/dsTf4B+uCnYxjNoS1jpyv6pGNGRsKOXA==", + "version": "4.4.6", + "resolved": "https://registry.npmjs.org/@smithy/middleware-retry/-/middleware-retry-4.4.6.tgz", + "integrity": "sha512-OhLx131znrEDxZPAvH/OYufR9d1nB2CQADyYFN4C3V/NQS7Mg4V6uvxHC/Dr96ZQW8IlHJTJ+vAhKt6oxWRndA==", "license": "Apache-2.0", "dependencies": { - "@smithy/node-config-provider": "^4.2.2", - "@smithy/protocol-http": "^5.2.1", - "@smithy/service-error-classification": "^4.1.1", - "@smithy/smithy-client": "^4.6.2", - "@smithy/types": "^4.5.0", - "@smithy/util-middleware": "^4.1.1", - "@smithy/util-retry": "^4.1.1", - "@types/uuid": "^9.0.1", - "tslib": "^2.6.2", - "uuid": "^9.0.1" + "@smithy/node-config-provider": "^4.3.4", + "@smithy/protocol-http": "^5.3.4", + "@smithy/service-error-classification": "^4.2.4", + "@smithy/smithy-client": "^4.9.2", + "@smithy/types": "^4.8.1", + "@smithy/util-middleware": "^4.2.4", + "@smithy/util-retry": "^4.2.4", + "@smithy/uuid": "^1.1.0", + "tslib": "^2.6.2" }, "engines": { "node": ">=18.0.0" } }, "node_modules/@smithy/middleware-serde": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/middleware-serde/-/middleware-serde-4.1.1.tgz", - "integrity": "sha512-lh48uQdbCoj619kRouev5XbWhCwRKLmphAif16c4J6JgJ4uXjub1PI6RL38d3BLliUvSso6klyB/LTNpWSNIyg==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/middleware-serde/-/middleware-serde-4.2.4.tgz", + "integrity": "sha512-jUr3x2CDhV15TOX2/Uoz4gfgeqLrRoTQbYAuhLS7lcVKNev7FeYSJ1ebEfjk+l9kbb7k7LfzIR/irgxys5ZTOg==", "license": "Apache-2.0", "dependencies": { - "@smithy/protocol-http": "^5.2.1", - "@smithy/types": "^4.5.0", + "@smithy/protocol-http": "^5.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2050,12 +2046,12 @@ } }, "node_modules/@smithy/middleware-stack": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/middleware-stack/-/middleware-stack-4.1.1.tgz", - "integrity": "sha512-ygRnniqNcDhHzs6QAPIdia26M7e7z9gpkIMUe/pK0RsrQ7i5MblwxY8078/QCnGq6AmlUUWgljK2HlelsKIb/A==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/middleware-stack/-/middleware-stack-4.2.4.tgz", + "integrity": "sha512-Gy3TKCOnm9JwpFooldwAboazw+EFYlC+Bb+1QBsSi5xI0W5lX81j/P5+CXvD/9ZjtYKRgxq+kkqd/KOHflzvgA==", "license": "Apache-2.0", "dependencies": { - "@smithy/types": "^4.5.0", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2063,14 +2059,14 @@ } }, "node_modules/@smithy/node-config-provider": { - "version": "4.2.2", - "resolved": "https://registry.npmjs.org/@smithy/node-config-provider/-/node-config-provider-4.2.2.tgz", - "integrity": "sha512-SYGTKyPvyCfEzIN5rD8q/bYaOPZprYUPD2f5g9M7OjaYupWOoQFYJ5ho+0wvxIRf471i2SR4GoiZ2r94Jq9h6A==", + "version": "4.3.4", + "resolved": "https://registry.npmjs.org/@smithy/node-config-provider/-/node-config-provider-4.3.4.tgz", + "integrity": "sha512-3X3w7qzmo4XNNdPKNS4nbJcGSwiEMsNsRSunMA92S4DJLLIrH5g1AyuOA2XKM9PAPi8mIWfqC+fnfKNsI4KvHw==", "license": "Apache-2.0", "dependencies": { - "@smithy/property-provider": "^4.1.1", - "@smithy/shared-ini-file-loader": "^4.2.0", - "@smithy/types": "^4.5.0", + "@smithy/property-provider": "^4.2.4", + "@smithy/shared-ini-file-loader": "^4.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2078,15 +2074,15 @@ } }, "node_modules/@smithy/node-http-handler": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/@smithy/node-http-handler/-/node-http-handler-4.2.1.tgz", - "integrity": "sha512-REyybygHlxo3TJICPF89N2pMQSf+p+tBJqpVe1+77Cfi9HBPReNjTgtZ1Vg73exq24vkqJskKDpfF74reXjxfw==", + "version": "4.4.4", + "resolved": "https://registry.npmjs.org/@smithy/node-http-handler/-/node-http-handler-4.4.4.tgz", + "integrity": "sha512-VXHGfzCXLZeKnFp6QXjAdy+U8JF9etfpUXD1FAbzY1GzsFJiDQRQIt2CnMUvUdz3/YaHNqT3RphVWMUpXTIODA==", "license": "Apache-2.0", "dependencies": { - "@smithy/abort-controller": "^4.1.1", - "@smithy/protocol-http": "^5.2.1", - "@smithy/querystring-builder": "^4.1.1", - "@smithy/types": "^4.5.0", + "@smithy/abort-controller": "^4.2.4", + "@smithy/protocol-http": "^5.3.4", + "@smithy/querystring-builder": "^4.2.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2094,12 +2090,12 @@ } }, "node_modules/@smithy/property-provider": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/property-provider/-/property-provider-4.1.1.tgz", - "integrity": "sha512-gm3ZS7DHxUbzC2wr8MUCsAabyiXY0gaj3ROWnhSx/9sPMc6eYLMM4rX81w1zsMaObj2Lq3PZtNCC1J6lpEY7zg==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/property-provider/-/property-provider-4.2.4.tgz", + "integrity": "sha512-g2DHo08IhxV5GdY3Cpt/jr0mkTlAD39EJKN27Jb5N8Fb5qt8KG39wVKTXiTRCmHHou7lbXR8nKVU14/aRUf86w==", "license": "Apache-2.0", "dependencies": { - "@smithy/types": "^4.5.0", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2107,12 +2103,12 @@ } }, "node_modules/@smithy/protocol-http": { - "version": "5.2.1", - "resolved": "https://registry.npmjs.org/@smithy/protocol-http/-/protocol-http-5.2.1.tgz", - "integrity": "sha512-T8SlkLYCwfT/6m33SIU/JOVGNwoelkrvGjFKDSDtVvAXj/9gOT78JVJEas5a+ETjOu4SVvpCstKgd0PxSu/aHw==", + "version": "5.3.4", + "resolved": "https://registry.npmjs.org/@smithy/protocol-http/-/protocol-http-5.3.4.tgz", + "integrity": "sha512-3sfFd2MAzVt0Q/klOmjFi3oIkxczHs0avbwrfn1aBqtc23WqQSmjvk77MBw9WkEQcwbOYIX5/2z4ULj8DuxSsw==", "license": "Apache-2.0", "dependencies": { - "@smithy/types": "^4.5.0", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2120,13 +2116,13 @@ } }, "node_modules/@smithy/querystring-builder": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/querystring-builder/-/querystring-builder-4.1.1.tgz", - "integrity": "sha512-J9b55bfimP4z/Jg1gNo+AT84hr90p716/nvxDkPGCD4W70MPms0h8KF50RDRgBGZeL83/u59DWNqJv6tEP/DHA==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/querystring-builder/-/querystring-builder-4.2.4.tgz", + "integrity": "sha512-KQ1gFXXC+WsbPFnk7pzskzOpn4s+KheWgO3dzkIEmnb6NskAIGp/dGdbKisTPJdtov28qNDohQrgDUKzXZBLig==", "license": "Apache-2.0", "dependencies": { - "@smithy/types": "^4.5.0", - "@smithy/util-uri-escape": "^4.1.0", + "@smithy/types": "^4.8.1", + "@smithy/util-uri-escape": "^4.2.0", "tslib": "^2.6.2" }, "engines": { @@ -2134,12 +2130,12 @@ } }, "node_modules/@smithy/querystring-parser": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/querystring-parser/-/querystring-parser-4.1.1.tgz", - "integrity": "sha512-63TEp92YFz0oQ7Pj9IuI3IgnprP92LrZtRAkE3c6wLWJxfy/yOPRt39IOKerVr0JS770olzl0kGafXlAXZ1vng==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/querystring-parser/-/querystring-parser-4.2.4.tgz", + "integrity": "sha512-aHb5cqXZocdzEkZ/CvhVjdw5l4r1aU/9iMEyoKzH4eXMowT6M0YjBpp7W/+XjkBnY8Xh0kVd55GKjnPKlCwinQ==", "license": "Apache-2.0", "dependencies": { - "@smithy/types": "^4.5.0", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2147,24 +2143,24 @@ } }, "node_modules/@smithy/service-error-classification": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/service-error-classification/-/service-error-classification-4.1.1.tgz", - "integrity": "sha512-Iam75b/JNXyDE41UvrlM6n8DNOa/r1ylFyvgruTUx7h2Uk7vDNV9AAwP1vfL1fOL8ls0xArwEGVcGZVd7IO/Cw==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/service-error-classification/-/service-error-classification-4.2.4.tgz", + "integrity": "sha512-fdWuhEx4+jHLGeew9/IvqVU/fxT/ot70tpRGuOLxE3HzZOyKeTQfYeV1oaBXpzi93WOk668hjMuuagJ2/Qs7ng==", "license": "Apache-2.0", "dependencies": { - "@smithy/types": "^4.5.0" + "@smithy/types": "^4.8.1" }, "engines": { "node": ">=18.0.0" } }, "node_modules/@smithy/shared-ini-file-loader": { - "version": "4.2.0", - "resolved": "https://registry.npmjs.org/@smithy/shared-ini-file-loader/-/shared-ini-file-loader-4.2.0.tgz", - "integrity": "sha512-OQTfmIEp2LLuWdxa8nEEPhZmiOREO6bcB6pjs0AySf4yiZhl6kMOfqmcwcY8BaBPX+0Tb+tG7/Ia/6mwpoZ7Pw==", + "version": "4.3.4", + "resolved": "https://registry.npmjs.org/@smithy/shared-ini-file-loader/-/shared-ini-file-loader-4.3.4.tgz", + "integrity": "sha512-y5ozxeQ9omVjbnJo9dtTsdXj9BEvGx2X8xvRgKnV+/7wLBuYJQL6dOa/qMY6omyHi7yjt1OA97jZLoVRYi8lxA==", "license": "Apache-2.0", "dependencies": { - "@smithy/types": "^4.5.0", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2172,18 +2168,18 @@ } }, "node_modules/@smithy/signature-v4": { - "version": "5.2.1", - "resolved": "https://registry.npmjs.org/@smithy/signature-v4/-/signature-v4-5.2.1.tgz", - "integrity": "sha512-M9rZhWQLjlQVCCR37cSjHfhriGRN+FQ8UfgrYNufv66TJgk+acaggShl3KS5U/ssxivvZLlnj7QH2CUOKlxPyA==", + "version": "5.3.4", + "resolved": "https://registry.npmjs.org/@smithy/signature-v4/-/signature-v4-5.3.4.tgz", + "integrity": "sha512-ScDCpasxH7w1HXHYbtk3jcivjvdA1VICyAdgvVqKhKKwxi+MTwZEqFw0minE+oZ7F07oF25xh4FGJxgqgShz0A==", "license": "Apache-2.0", "dependencies": { - "@smithy/is-array-buffer": "^4.1.0", - "@smithy/protocol-http": "^5.2.1", - "@smithy/types": "^4.5.0", - "@smithy/util-hex-encoding": "^4.1.0", - "@smithy/util-middleware": "^4.1.1", - "@smithy/util-uri-escape": "^4.1.0", - "@smithy/util-utf8": "^4.1.0", + "@smithy/is-array-buffer": "^4.2.0", + "@smithy/protocol-http": "^5.3.4", + "@smithy/types": "^4.8.1", + "@smithy/util-hex-encoding": "^4.2.0", + "@smithy/util-middleware": "^4.2.4", + "@smithy/util-uri-escape": "^4.2.0", + "@smithy/util-utf8": "^4.2.0", "tslib": "^2.6.2" }, "engines": { @@ -2535,9 +2531,9 @@ } }, "node_modules/@smithy/types": { - "version": "4.5.0", - "resolved": "https://registry.npmjs.org/@smithy/types/-/types-4.5.0.tgz", - "integrity": "sha512-RkUpIOsVlAwUIZXO1dsz8Zm+N72LClFfsNqf173catVlvRZiwPy0x2u0JLEA4byreOPKDZPGjmPDylMoP8ZJRg==", + "version": "4.8.1", + "resolved": "https://registry.npmjs.org/@smithy/types/-/types-4.8.1.tgz", + "integrity": "sha512-N0Zn0OT1zc+NA+UVfkYqQzviRh5ucWwO7mBV3TmHHprMnfcJNfhlPicDkBHi0ewbh+y3evR6cNAW0Raxvb01NA==", "license": "Apache-2.0", "dependencies": { "tslib": "^2.6.2" @@ -2547,13 +2543,13 @@ } }, "node_modules/@smithy/url-parser": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/url-parser/-/url-parser-4.1.1.tgz", - "integrity": "sha512-bx32FUpkhcaKlEoOMbScvc93isaSiRM75pQ5IgIBaMkT7qMlIibpPRONyx/0CvrXHzJLpOn/u6YiDX2hcvs7Dg==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/url-parser/-/url-parser-4.2.4.tgz", + "integrity": "sha512-w/N/Iw0/PTwJ36PDqU9PzAwVElo4qXxCC0eCTlUtIz/Z5V/2j/cViMHi0hPukSBHp4DVwvUlUhLgCzqSJ6plrg==", "license": "Apache-2.0", "dependencies": { - "@smithy/querystring-parser": "^4.1.1", - "@smithy/types": "^4.5.0", + "@smithy/querystring-parser": "^4.2.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2561,13 +2557,13 @@ } }, "node_modules/@smithy/util-base64": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/@smithy/util-base64/-/util-base64-4.1.0.tgz", - "integrity": "sha512-RUGd4wNb8GeW7xk+AY5ghGnIwM96V0l2uzvs/uVHf+tIuVX2WSvynk5CxNoBCsM2rQRSZElAo9rt3G5mJ/gktQ==", + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/@smithy/util-base64/-/util-base64-4.3.0.tgz", + "integrity": "sha512-GkXZ59JfyxsIwNTWFnjmFEI8kZpRNIBfxKjv09+nkAWPt/4aGaEWMM04m4sxgNVWkbt2MdSvE3KF/PfX4nFedQ==", "license": "Apache-2.0", "dependencies": { - "@smithy/util-buffer-from": "^4.1.0", - "@smithy/util-utf8": "^4.1.0", + "@smithy/util-buffer-from": "^4.2.0", + "@smithy/util-utf8": "^4.2.0", "tslib": "^2.6.2" }, "engines": { @@ -2575,9 +2571,9 @@ } }, "node_modules/@smithy/util-body-length-browser": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/@smithy/util-body-length-browser/-/util-body-length-browser-4.1.0.tgz", - "integrity": "sha512-V2E2Iez+bo6bUMOTENPr6eEmepdY8Hbs+Uc1vkDKgKNA/brTJqOW/ai3JO1BGj9GbCeLqw90pbbH7HFQyFotGQ==", + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/@smithy/util-body-length-browser/-/util-body-length-browser-4.2.0.tgz", + "integrity": "sha512-Fkoh/I76szMKJnBXWPdFkQJl2r9SjPt3cMzLdOB6eJ4Pnpas8hVoWPYemX/peO0yrrvldgCUVJqOAjUrOLjbxg==", "license": "Apache-2.0", "dependencies": { "tslib": "^2.6.2" @@ -2587,9 +2583,9 @@ } }, "node_modules/@smithy/util-body-length-node": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/@smithy/util-body-length-node/-/util-body-length-node-4.1.0.tgz", - "integrity": "sha512-BOI5dYjheZdgR9XiEM3HJcEMCXSoqbzu7CzIgYrx0UtmvtC3tC2iDGpJLsSRFffUpy8ymsg2ARMP5fR8mtuUQQ==", + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/@smithy/util-body-length-node/-/util-body-length-node-4.2.1.tgz", + "integrity": "sha512-h53dz/pISVrVrfxV1iqXlx5pRg3V2YWFcSQyPyXZRrZoZj4R4DeWRDo1a7dd3CPTcFi3kE+98tuNyD2axyZReA==", "license": "Apache-2.0", "dependencies": { "tslib": "^2.6.2" @@ -2599,12 +2595,12 @@ } }, "node_modules/@smithy/util-buffer-from": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/@smithy/util-buffer-from/-/util-buffer-from-4.1.0.tgz", - "integrity": "sha512-N6yXcjfe/E+xKEccWEKzK6M+crMrlwaCepKja0pNnlSkm6SjAeLKKA++er5Ba0I17gvKfN/ThV+ZOx/CntKTVw==", + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/@smithy/util-buffer-from/-/util-buffer-from-4.2.0.tgz", + "integrity": "sha512-kAY9hTKulTNevM2nlRtxAG2FQ3B2OR6QIrPY3zE5LqJy1oxzmgBGsHLWTcNhWXKchgA0WHW+mZkQrng/pgcCew==", "license": "Apache-2.0", "dependencies": { - "@smithy/is-array-buffer": "^4.1.0", + "@smithy/is-array-buffer": "^4.2.0", "tslib": "^2.6.2" }, "engines": { @@ -2612,9 +2608,9 @@ } }, "node_modules/@smithy/util-config-provider": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/@smithy/util-config-provider/-/util-config-provider-4.1.0.tgz", - "integrity": "sha512-swXz2vMjrP1ZusZWVTB/ai5gK+J8U0BWvP10v9fpcFvg+Xi/87LHvHfst2IgCs1i0v4qFZfGwCmeD/KNCdJZbQ==", + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/@smithy/util-config-provider/-/util-config-provider-4.2.0.tgz", + "integrity": "sha512-YEjpl6XJ36FTKmD+kRJJWYvrHeUvm5ykaUS5xK+6oXffQPHeEM4/nXlZPe+Wu0lsgRUcNZiliYNh/y7q9c2y6Q==", "license": "Apache-2.0", "dependencies": { "tslib": "^2.6.2" @@ -2624,15 +2620,14 @@ } }, "node_modules/@smithy/util-defaults-mode-browser": { - "version": "4.1.2", - "resolved": "https://registry.npmjs.org/@smithy/util-defaults-mode-browser/-/util-defaults-mode-browser-4.1.2.tgz", - "integrity": "sha512-QKrOw01DvNHKgY+3p4r9Ut4u6EHLVZ01u6SkOMe6V6v5C+nRPXJeWh72qCT1HgwU3O7sxAIu23nNh+FOpYVZKA==", + "version": "4.3.5", + "resolved": "https://registry.npmjs.org/@smithy/util-defaults-mode-browser/-/util-defaults-mode-browser-4.3.5.tgz", + "integrity": "sha512-GwaGjv/QLuL/QHQaqhf/maM7+MnRFQQs7Bsl6FlaeK6lm6U7mV5AAnVabw68cIoMl5FQFyKK62u7RWRzWL25OQ==", "license": "Apache-2.0", "dependencies": { - "@smithy/property-provider": "^4.1.1", - "@smithy/smithy-client": "^4.6.2", - "@smithy/types": "^4.5.0", - "bowser": "^2.11.0", + "@smithy/property-provider": "^4.2.4", + "@smithy/smithy-client": "^4.9.2", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2640,17 +2635,17 @@ } }, "node_modules/@smithy/util-defaults-mode-node": { - "version": "4.1.2", - "resolved": "https://registry.npmjs.org/@smithy/util-defaults-mode-node/-/util-defaults-mode-node-4.1.2.tgz", - "integrity": "sha512-l2yRmSfx5haYHswPxMmCR6jGwgPs5LjHLuBwlj9U7nNBMS43YV/eevj+Xq1869UYdiynnMrCKtoOYQcwtb6lKg==", + "version": "4.2.8", + "resolved": "https://registry.npmjs.org/@smithy/util-defaults-mode-node/-/util-defaults-mode-node-4.2.8.tgz", + "integrity": "sha512-gIoTf9V/nFSIZ0TtgDNLd+Ws59AJvijmMDYrOozoMHPJaG9cMRdqNO50jZTlbM6ydzQYY8L/mQ4tKSw/TB+s6g==", "license": "Apache-2.0", "dependencies": { - "@smithy/config-resolver": "^4.2.2", - "@smithy/credential-provider-imds": "^4.1.2", - "@smithy/node-config-provider": "^4.2.2", - "@smithy/property-provider": "^4.1.1", - "@smithy/smithy-client": "^4.6.2", - "@smithy/types": "^4.5.0", + "@smithy/config-resolver": "^4.4.2", + "@smithy/credential-provider-imds": "^4.2.4", + "@smithy/node-config-provider": "^4.3.4", + "@smithy/property-provider": "^4.2.4", + "@smithy/smithy-client": "^4.9.2", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2658,13 +2653,13 @@ } }, "node_modules/@smithy/util-endpoints": { - "version": "3.1.2", - "resolved": "https://registry.npmjs.org/@smithy/util-endpoints/-/util-endpoints-3.1.2.tgz", - "integrity": "sha512-+AJsaaEGb5ySvf1SKMRrPZdYHRYSzMkCoK16jWnIMpREAnflVspMIDeCVSZJuj+5muZfgGpNpijE3mUNtjv01Q==", + "version": "3.2.4", + "resolved": "https://registry.npmjs.org/@smithy/util-endpoints/-/util-endpoints-3.2.4.tgz", + "integrity": "sha512-f+nBDhgYRCmUEDKEQb6q0aCcOTXRDqH5wWaFHJxt4anB4pKHlgGoYP3xtioKXH64e37ANUkzWf6p4Mnv1M5/Vg==", "license": "Apache-2.0", "dependencies": { - "@smithy/node-config-provider": "^4.2.2", - "@smithy/types": "^4.5.0", + "@smithy/node-config-provider": "^4.3.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2672,9 +2667,9 @@ } }, "node_modules/@smithy/util-hex-encoding": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/@smithy/util-hex-encoding/-/util-hex-encoding-4.1.0.tgz", - "integrity": "sha512-1LcueNN5GYC4tr8mo14yVYbh/Ur8jHhWOxniZXii+1+ePiIbsLZ5fEI0QQGtbRRP5mOhmooos+rLmVASGGoq5w==", + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/@smithy/util-hex-encoding/-/util-hex-encoding-4.2.0.tgz", + "integrity": "sha512-CCQBwJIvXMLKxVbO88IukazJD9a4kQ9ZN7/UMGBjBcJYvatpWk+9g870El4cB8/EJxfe+k+y0GmR9CAzkF+Nbw==", "license": "Apache-2.0", "dependencies": { "tslib": "^2.6.2" @@ -2684,12 +2679,12 @@ } }, "node_modules/@smithy/util-middleware": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/util-middleware/-/util-middleware-4.1.1.tgz", - "integrity": "sha512-CGmZ72mL29VMfESz7S6dekqzCh8ZISj3B+w0g1hZFXaOjGTVaSqfAEFAq8EGp8fUL+Q2l8aqNmt8U1tglTikeg==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/util-middleware/-/util-middleware-4.2.4.tgz", + "integrity": "sha512-fKGQAPAn8sgV0plRikRVo6g6aR0KyKvgzNrPuM74RZKy/wWVzx3BMk+ZWEueyN3L5v5EDg+P582mKU+sH5OAsg==", "license": "Apache-2.0", "dependencies": { - "@smithy/types": "^4.5.0", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2697,13 +2692,13 @@ } }, "node_modules/@smithy/util-retry": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/util-retry/-/util-retry-4.1.1.tgz", - "integrity": "sha512-jGeybqEZ/LIordPLMh5bnmnoIgsqnp4IEimmUp5c5voZ8yx+5kAlN5+juyr7p+f7AtZTgvhmInQk4Q0UVbrZ0Q==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/util-retry/-/util-retry-4.2.4.tgz", + "integrity": "sha512-yQncJmj4dtv/isTXxRb4AamZHy4QFr4ew8GxS6XLWt7sCIxkPxPzINWd7WLISEFPsIan14zrKgvyAF+/yzfwoA==", "license": "Apache-2.0", "dependencies": { - "@smithy/service-error-classification": "^4.1.1", - "@smithy/types": "^4.5.0", + "@smithy/service-error-classification": "^4.2.4", + "@smithy/types": "^4.8.1", "tslib": "^2.6.2" }, "engines": { @@ -2711,18 +2706,18 @@ } }, "node_modules/@smithy/util-stream": { - "version": "4.3.1", - "resolved": "https://registry.npmjs.org/@smithy/util-stream/-/util-stream-4.3.1.tgz", - "integrity": "sha512-khKkW/Jqkgh6caxMWbMuox9+YfGlsk9OnHOYCGVEdYQb/XVzcORXHLYUubHmmda0pubEDncofUrPNniS9d+uAA==", + "version": "4.5.5", + "resolved": "https://registry.npmjs.org/@smithy/util-stream/-/util-stream-4.5.5.tgz", + "integrity": "sha512-7M5aVFjT+HPilPOKbOmQfCIPchZe4DSBc1wf1+NvHvSoFTiFtauZzT+onZvCj70xhXd0AEmYnZYmdJIuwxOo4w==", "license": "Apache-2.0", "dependencies": { - "@smithy/fetch-http-handler": "^5.2.1", - "@smithy/node-http-handler": "^4.2.1", - "@smithy/types": "^4.5.0", - "@smithy/util-base64": "^4.1.0", - "@smithy/util-buffer-from": "^4.1.0", - "@smithy/util-hex-encoding": "^4.1.0", - "@smithy/util-utf8": "^4.1.0", + "@smithy/fetch-http-handler": "^5.3.5", + "@smithy/node-http-handler": "^4.4.4", + "@smithy/types": "^4.8.1", + "@smithy/util-base64": "^4.3.0", + "@smithy/util-buffer-from": "^4.2.0", + "@smithy/util-hex-encoding": "^4.2.0", + "@smithy/util-utf8": "^4.2.0", "tslib": "^2.6.2" }, "engines": { @@ -2730,9 +2725,9 @@ } }, "node_modules/@smithy/util-uri-escape": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/@smithy/util-uri-escape/-/util-uri-escape-4.1.0.tgz", - "integrity": "sha512-b0EFQkq35K5NHUYxU72JuoheM6+pytEVUGlTwiFxWFpmddA+Bpz3LgsPRIpBk8lnPE47yT7AF2Egc3jVnKLuPg==", + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/@smithy/util-uri-escape/-/util-uri-escape-4.2.0.tgz", + "integrity": "sha512-igZpCKV9+E/Mzrpq6YacdTQ0qTiLm85gD6N/IrmyDvQFA4UnU3d5g3m8tMT/6zG/vVkWSU+VxeUyGonL62DuxA==", "license": "Apache-2.0", "dependencies": { "tslib": "^2.6.2" @@ -2742,12 +2737,12 @@ } }, "node_modules/@smithy/util-utf8": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/@smithy/util-utf8/-/util-utf8-4.1.0.tgz", - "integrity": "sha512-mEu1/UIXAdNYuBcyEPbjScKi/+MQVXNIuY/7Cm5XLIWe319kDrT5SizBE95jqtmEXoDbGoZxKLCMttdZdqTZKQ==", + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/@smithy/util-utf8/-/util-utf8-4.2.0.tgz", + "integrity": "sha512-zBPfuzoI8xyBtR2P6WQj63Rz8i3AmfAaJLuNG8dWsfvPe8lO4aCPYLn879mEgHndZH1zQ2oXmG8O1GGzzaoZiw==", "license": "Apache-2.0", "dependencies": { - "@smithy/util-buffer-from": "^4.1.0", + "@smithy/util-buffer-from": "^4.2.0", "tslib": "^2.6.2" }, "engines": { @@ -2755,13 +2750,25 @@ } }, "node_modules/@smithy/util-waiter": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/@smithy/util-waiter/-/util-waiter-4.1.1.tgz", - "integrity": "sha512-PJBmyayrlfxM7nbqjomF4YcT1sApQwZio0NHSsT0EzhJqljRmvhzqZua43TyEs80nJk2Cn2FGPg/N8phH6KeCQ==", + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/@smithy/util-waiter/-/util-waiter-4.2.4.tgz", + "integrity": "sha512-roKXtXIC6fopFvVOju8VYHtguc/jAcMlK8IlDOHsrQn0ayMkHynjm/D2DCMRf7MJFXzjHhlzg2edr3QPEakchQ==", + "license": "Apache-2.0", + "dependencies": { + "@smithy/abort-controller": "^4.2.4", + "@smithy/types": "^4.8.1", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=18.0.0" + } + }, + "node_modules/@smithy/uuid": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/@smithy/uuid/-/uuid-1.1.0.tgz", + "integrity": "sha512-4aUIteuyxtBUhVdiQqcDhKFitwfd9hqoSDYY2KRXiWtgoWJ9Bmise+KfEPDiVHWeJepvF8xJO9/9+WDIciMFFw==", "license": "Apache-2.0", "dependencies": { - "@smithy/abort-controller": "^4.1.1", - "@smithy/types": "^4.5.0", "tslib": "^2.6.2" }, "engines": { @@ -2870,12 +2877,6 @@ "integrity": "sha512-9aEbYZ3TbYMznPdcdr3SmIrLXwC/AKZXQeCf9Pgao5CKb8CyHuEX5jzWPTkvregvhRJHcpRO6BFoGW9ycaOkYw==", "dev": true }, - "node_modules/@types/uuid": { - "version": "9.0.8", - "resolved": "https://registry.npmjs.org/@types/uuid/-/uuid-9.0.8.tgz", - "integrity": "sha512-jg+97EGIcY9AGHJJRaaPVgetKDsrTgbRjQ5Msgjh/DQKEFl0DtyRr/VCOyD1T2R1MNeWPK/u7JoGhlDZnKBAfA==", - "license": "MIT" - }, "node_modules/@types/yargs": { "version": "17.0.33", "resolved": "https://registry.npmjs.org/@types/yargs/-/yargs-17.0.33.tgz", @@ -5760,19 +5761,6 @@ "punycode": "^2.1.0" } }, - "node_modules/uuid": { - "version": "9.0.1", - "resolved": "https://registry.npmjs.org/uuid/-/uuid-9.0.1.tgz", - "integrity": "sha512-b+1eJOlsR9K8HJpow9Ok3fiWOWSIcIzXodvv0rQjVoOVNpWMpxf1wZNpt4y9h10odCNrqnYp1OBzRktckBe3sA==", - "funding": [ - "https://github.com/sponsors/broofa", - "https://github.com/sponsors/ctavan" - ], - "license": "MIT", - "bin": { - "uuid": "dist/bin/uuid" - } - }, "node_modules/v8-to-istanbul": { "version": "9.3.0", "resolved": "https://registry.npmjs.org/v8-to-istanbul/-/v8-to-istanbul-9.3.0.tgz", diff --git a/package.json b/package.json index f26ddf83..75b16296 100644 --- a/package.json +++ b/package.json @@ -26,7 +26,7 @@ "homepage": "https://github.com/aws-actions/amazon-ecs-render-task-definition#readme", "dependencies": { "@actions/core": "^1.11.1", - "@aws-sdk/client-ecs": "^3.890.0", + "@aws-sdk/client-ecs": "^3.923.0", "tmp": "^0.2.5" }, "devDependencies": {